Compare commits
109 Commits
cac0770467
...
release
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
e665dea82a | ||
|
|
b511ec5df0 | ||
|
|
c0e53cd3f6 | ||
|
|
4fc7abc5b4 | ||
|
|
e04bf6f405 | ||
|
|
bed761401f | ||
|
|
55463649b2 | ||
|
|
62d2aa17be | ||
|
|
acfb2259cc | ||
|
|
d1d2194861 | ||
|
|
b542f98a91 | ||
|
|
f983b869ba | ||
|
|
ead346bb1b | ||
|
|
8d27e771a7 | ||
|
|
31fe3a4260 | ||
|
|
a2c6cd1d4f | ||
|
|
5fe9f371b2 | ||
|
|
b27fb7ed4c | ||
|
|
919ef611bc | ||
|
|
3eeed888b5 | ||
|
|
322f611522 | ||
|
|
a7d2634c5f | ||
|
|
ae125f1144 | ||
|
|
d66907f636 | ||
|
|
508d69a4f4 | ||
|
|
ee00415d23 | ||
|
|
576b86fbbb | ||
|
|
918742293b | ||
|
|
19c06c71f8 | ||
|
|
3e5f3a7ece | ||
|
|
12fdd6da62 | ||
|
|
15a7319239 | ||
|
|
911fb86611 | ||
|
|
8b4c66ba0d | ||
|
|
1352dc49cc | ||
|
|
51ffe2031d | ||
|
|
c70ed9c504 | ||
|
|
67d798f590 | ||
|
|
d60cce83c9 | ||
|
|
c03d2b969c | ||
|
|
4af4450b94 | ||
|
|
6be4bed2e0 | ||
|
|
d13094c662 | ||
|
|
a9c3087f53 | ||
|
|
1b6d40627d | ||
|
|
67a7d1ad2a | ||
|
|
4ef550f48b | ||
|
|
993a5870c5 | ||
|
|
5a682bb6d7 | ||
|
|
bb5a89a06d | ||
|
|
3036eec3af | ||
|
|
63fc18ea74 | ||
|
|
ca3f62c709 | ||
|
|
b13f0b87a3 | ||
|
|
8ec8f35a31 | ||
|
|
230b7abf8b | ||
|
|
2abb080c09 | ||
|
|
a34c1e5a3d | ||
|
|
68605dea78 | ||
|
|
59b708a160 | ||
|
|
2849dfaade | ||
|
|
b08f9164e6 | ||
|
|
5fb9fbaf2b | ||
|
|
520c38782f | ||
|
|
5b21fb12e3 | ||
|
|
a49aa198f4 | ||
|
|
ef895ff892 | ||
|
|
06c8d2c589 | ||
|
|
20be1ab64c | ||
|
|
795f0e8853 | ||
|
|
d3f2cc6eb0 | ||
|
|
e34780c9a7 | ||
|
|
495b0dc98f | ||
|
|
7b03381f7c | ||
|
|
800a402046 | ||
|
|
50101d1196 | ||
|
|
ae25ea73a8 | ||
|
|
407425a2b9 | ||
|
|
088f4a2833 | ||
|
|
c63124b16b | ||
|
|
329708fe6c | ||
|
|
e5b2be5245 | ||
|
|
0fb1634a91 | ||
|
|
8634edc916 | ||
|
|
1211569078 | ||
|
|
26b970982c | ||
|
|
e77393dd13 | ||
|
|
020fa8823d | ||
|
|
959fc33fe4 | ||
|
|
a57fc811d8 | ||
|
|
a96084ba17 | ||
|
|
b96c988e80 | ||
|
|
14d2761832 | ||
|
|
bd3fd28d3c | ||
|
|
e8ef20d046 | ||
|
|
9fc8d5d1de | ||
|
|
73db84896a | ||
|
|
9734532491 | ||
|
|
7d38f54123 | ||
|
|
d02a627b86 | ||
|
|
6ce40dd2d6 | ||
|
|
00ffdcf10b | ||
|
|
e4d38692fe | ||
|
|
1f93a4e42d | ||
|
|
bf48971dc4 | ||
|
|
13933fc56c | ||
|
|
ca28e0a780 | ||
|
|
34b5efb1fc | ||
|
|
f96a51c7cf |
@@ -1,82 +0,0 @@
|
||||
# Details
|
||||
|
||||
Date : 2025-10-14 11:10:48
|
||||
|
||||
Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
|
||||
|
||||
Total : 67 files, 5159 codes, 328 comments, 739 blanks, all 6226 lines
|
||||
|
||||
[Summary](results.md) / Details / [Diff Summary](diff.md) / [Diff Details](diff-details.md)
|
||||
|
||||
## Files
|
||||
| filename | language | code | comment | blank | total |
|
||||
| :--- | :--- | ---: | ---: | ---: | ---: |
|
||||
| [README.md](/README.md) | Markdown | 45 | 0 | 16 | 61 |
|
||||
| [analysis\_options.yaml](/analysis_options.yaml) | YAML | 3 | 22 | 4 | 29 |
|
||||
| [android/app/google-services.json](/android/app/google-services.json) | JSON | 54 | 0 | 0 | 54 |
|
||||
| [android/app/src/debug/AndroidManifest.xml](/android/app/src/debug/AndroidManifest.xml) | XML | 3 | 4 | 1 | 8 |
|
||||
| [android/app/src/main/AndroidManifest.xml](/android/app/src/main/AndroidManifest.xml) | XML | 40 | 11 | 1 | 52 |
|
||||
| [android/app/src/main/res/drawable-v21/launch\_background.xml](/android/app/src/main/res/drawable-v21/launch_background.xml) | XML | 4 | 7 | 2 | 13 |
|
||||
| [android/app/src/main/res/drawable/launch\_background.xml](/android/app/src/main/res/drawable/launch_background.xml) | XML | 4 | 7 | 2 | 13 |
|
||||
| [android/app/src/main/res/values-night/styles.xml](/android/app/src/main/res/values-night/styles.xml) | XML | 9 | 9 | 1 | 19 |
|
||||
| [android/app/src/main/res/values/styles.xml](/android/app/src/main/res/values/styles.xml) | XML | 9 | 9 | 1 | 19 |
|
||||
| [android/app/src/profile/AndroidManifest.xml](/android/app/src/profile/AndroidManifest.xml) | XML | 3 | 4 | 1 | 8 |
|
||||
| [android/build/reports/problems/problems-report.html](/android/build/reports/problems/problems-report.html) | HTML | 548 | 2 | 114 | 664 |
|
||||
| [android/gradle.properties](/android/gradle.properties) | Properties | 3 | 0 | 1 | 4 |
|
||||
| [android/gradle/wrapper/gradle-wrapper.properties](/android/gradle/wrapper/gradle-wrapper.properties) | Properties | 5 | 0 | 1 | 6 |
|
||||
| [firebase.json](/firebase.json) | JSON | 1 | 0 | 0 | 1 |
|
||||
| [ios/Podfile](/ios/Podfile) | Ruby | 32 | 2 | 10 | 44 |
|
||||
| [ios/RunnerTests/RunnerTests.swift](/ios/RunnerTests/RunnerTests.swift) | Swift | 7 | 2 | 4 | 13 |
|
||||
| [ios/Runner/AppDelegate.swift](/ios/Runner/AppDelegate.swift) | Swift | 14 | 0 | 2 | 16 |
|
||||
| [ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json](/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json) | JSON | 122 | 0 | 1 | 123 |
|
||||
| [ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json](/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json) | JSON | 23 | 0 | 1 | 24 |
|
||||
| [ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md](/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md) | Markdown | 3 | 0 | 2 | 5 |
|
||||
| [ios/Runner/Base.lproj/LaunchScreen.storyboard](/ios/Runner/Base.lproj/LaunchScreen.storyboard) | XML | 36 | 1 | 1 | 38 |
|
||||
| [ios/Runner/Base.lproj/Main.storyboard](/ios/Runner/Base.lproj/Main.storyboard) | XML | 25 | 1 | 1 | 27 |
|
||||
| [ios/Runner/Runner-Bridging-Header.h](/ios/Runner/Runner-Bridging-Header.h) | C++ | 1 | 0 | 1 | 2 |
|
||||
| [lib/blocs/auth/auth\_bloc.dart](/lib/blocs/auth/auth_bloc.dart) | Dart | 129 | 1 | 20 | 150 |
|
||||
| [lib/blocs/auth/auth\_event.dart](/lib/blocs/auth/auth_event.dart) | Dart | 40 | 0 | 15 | 55 |
|
||||
| [lib/blocs/auth/auth\_state.dart](/lib/blocs/auth/auth_state.dart) | Dart | 28 | 0 | 14 | 42 |
|
||||
| [lib/blocs/theme/theme\_bloc.dart](/lib/blocs/theme/theme_bloc.dart) | Dart | 40 | 1 | 5 | 46 |
|
||||
| [lib/blocs/theme/theme\_event.dart](/lib/blocs/theme/theme_event.dart) | Dart | 14 | 0 | 6 | 20 |
|
||||
| [lib/blocs/theme/theme\_state.dart](/lib/blocs/theme/theme_state.dart) | Dart | 16 | 0 | 5 | 21 |
|
||||
| [lib/blocs/trip/trip\_bloc.dart](/lib/blocs/trip/trip_bloc.dart) | Dart | 103 | 1 | 14 | 118 |
|
||||
| [lib/blocs/trip/trip\_event.dart](/lib/blocs/trip/trip_event.dart) | Dart | 51 | 0 | 20 | 71 |
|
||||
| [lib/blocs/trip/trip\_state.dart](/lib/blocs/trip/trip_state.dart) | Dart | 27 | 0 | 13 | 40 |
|
||||
| [lib/blocs/user/user\_bloc.dart](/lib/blocs/user/user_bloc.dart) | Dart | 0 | 0 | 1 | 1 |
|
||||
| [lib/blocs/user/user\_event.dart](/lib/blocs/user/user_event.dart) | Dart | 0 | 0 | 1 | 1 |
|
||||
| [lib/blocs/user/user\_state.dart](/lib/blocs/user/user_state.dart) | Dart | 0 | 0 | 1 | 1 |
|
||||
| [lib/components/count/count\_content.dart](/lib/components/count/count_content.dart) | Dart | 25 | 0 | 3 | 28 |
|
||||
| [lib/components/group/group\_content.dart](/lib/components/group/group_content.dart) | Dart | 115 | 2 | 12 | 129 |
|
||||
| [lib/components/home/create\_trip\_content.dart](/lib/components/home/create_trip_content.dart) | Dart | 481 | 21 | 63 | 565 |
|
||||
| [lib/components/home/home\_content.dart](/lib/components/home/home_content.dart) | Dart | 366 | 12 | 30 | 408 |
|
||||
| [lib/components/home/show\_trip\_details\_content.dart](/lib/components/home/show_trip_details_content.dart) | Dart | 106 | 2 | 4 | 112 |
|
||||
| [lib/components/map/map\_content.dart](/lib/components/map/map_content.dart) | Dart | 100 | 4 | 11 | 115 |
|
||||
| [lib/components/profile/profile\_content.dart](/lib/components/profile/profile_content.dart) | Dart | 328 | 6 | 29 | 363 |
|
||||
| [lib/components/settings/settings\_content.dart](/lib/components/settings/settings_content.dart) | Dart | 60 | 2 | 10 | 72 |
|
||||
| [lib/components/settings/settings\_theme\_content.dart](/lib/components/settings/settings_theme_content.dart) | Dart | 123 | 4 | 10 | 137 |
|
||||
| [lib/data/data\_sources/firestore\_data\_source.dart](/lib/data/data_sources/firestore_data_source.dart) | Dart | 0 | 0 | 1 | 1 |
|
||||
| [lib/data/data\_sources/local\_data\_source.dart](/lib/data/data_sources/local_data_source.dart) | Dart | 0 | 0 | 1 | 1 |
|
||||
| [lib/data/models/group.dart](/lib/data/models/group.dart) | Dart | 23 | 0 | 3 | 26 |
|
||||
| [lib/data/models/message.dart](/lib/data/models/message.dart) | Dart | 14 | 0 | 1 | 15 |
|
||||
| [lib/data/models/trip.dart](/lib/data/models/trip.dart) | Dart | 176 | 16 | 24 | 216 |
|
||||
| [lib/data/models/user.dart](/lib/data/models/user.dart) | Dart | 61 | 6 | 13 | 80 |
|
||||
| [lib/firebase\_options.dart](/lib/firebase_options.dart) | Dart | 60 | 12 | 5 | 77 |
|
||||
| [lib/main.dart](/lib/main.dart) | Dart | 89 | 0 | 5 | 94 |
|
||||
| [lib/pages/home.dart](/lib/pages/home.dart) | Dart | 147 | 6 | 13 | 166 |
|
||||
| [lib/pages/login.dart](/lib/pages/login.dart) | Dart | 285 | 9 | 28 | 322 |
|
||||
| [lib/pages/resetpswd.dart](/lib/pages/resetpswd.dart) | Dart | 92 | 2 | 13 | 107 |
|
||||
| [lib/pages/signup.dart](/lib/pages/signup.dart) | Dart | 256 | 7 | 20 | 283 |
|
||||
| [lib/providers/theme\_provider.dart](/lib/providers/theme_provider.dart) | Dart | 41 | 1 | 9 | 51 |
|
||||
| [lib/providers/user\_provider.dart](/lib/providers/user_provider.dart) | Dart | 94 | 9 | 18 | 121 |
|
||||
| [lib/repositories/auth\_repository.dart](/lib/repositories/auth_repository.dart) | Dart | 115 | 11 | 22 | 148 |
|
||||
| [lib/repositories/trip\_repository.dart](/lib/repositories/trip_repository.dart) | Dart | 92 | 9 | 12 | 113 |
|
||||
| [lib/repositories/user\_repository.dart](/lib/repositories/user_repository.dart) | Dart | 77 | 7 | 11 | 95 |
|
||||
| [lib/services/auth\_service.dart](/lib/services/auth_service.dart) | Dart | 84 | 6 | 18 | 108 |
|
||||
| [lib/services/group\_service.dart](/lib/services/group_service.dart) | Dart | 53 | 1 | 6 | 60 |
|
||||
| [lib/services/message\_service.dart](/lib/services/message_service.dart) | Dart | 0 | 0 | 1 | 1 |
|
||||
| [lib/services/trip\_service.dart](/lib/services/trip_service.dart) | Dart | 209 | 21 | 39 | 269 |
|
||||
| [pubspec.yaml](/pubspec.yaml) | YAML | 31 | 58 | 14 | 103 |
|
||||
| [test/widget\_test.dart](/test/widget_test.dart) | Dart | 14 | 10 | 7 | 31 |
|
||||
|
||||
[Summary](results.md) / Details / [Diff Summary](diff.md) / [Diff Details](diff-details.md)
|
||||
@@ -1,15 +0,0 @@
|
||||
# Diff Details
|
||||
|
||||
Date : 2025-10-14 11:10:48
|
||||
|
||||
Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
|
||||
|
||||
Total : 0 files, 0 codes, 0 comments, 0 blanks, all 0 lines
|
||||
|
||||
[Summary](results.md) / [Details](details.md) / [Diff Summary](diff.md) / Diff Details
|
||||
|
||||
## Files
|
||||
| filename | language | code | comment | blank | total |
|
||||
| :--- | :--- | ---: | ---: | ---: | ---: |
|
||||
|
||||
[Summary](results.md) / [Details](details.md) / [Diff Summary](diff.md) / Diff Details
|
||||
@@ -1,2 +0,0 @@
|
||||
"filename", "language", "", "comment", "blank", "total"
|
||||
"Total", "-", , 0, 0, 0
|
||||
|
@@ -1,19 +0,0 @@
|
||||
# Diff Summary
|
||||
|
||||
Date : 2025-10-14 11:10:48
|
||||
|
||||
Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
|
||||
|
||||
Total : 0 files, 0 codes, 0 comments, 0 blanks, all 0 lines
|
||||
|
||||
[Summary](results.md) / [Details](details.md) / Diff Summary / [Diff Details](diff-details.md)
|
||||
|
||||
## Languages
|
||||
| language | files | code | comment | blank | total |
|
||||
| :--- | ---: | ---: | ---: | ---: | ---: |
|
||||
|
||||
## Directories
|
||||
| path | files | code | comment | blank | total |
|
||||
| :--- | ---: | ---: | ---: | ---: | ---: |
|
||||
|
||||
[Summary](results.md) / [Details](details.md) / Diff Summary / [Diff Details](diff-details.md)
|
||||
@@ -1,22 +0,0 @@
|
||||
Date : 2025-10-14 11:10:48
|
||||
Directory : c:\Users\dayro\Documents\coding\travel_mate
|
||||
Total : 0 files, 0 codes, 0 comments, 0 blanks, all 0 lines
|
||||
|
||||
Languages
|
||||
+----------+------------+------------+------------+------------+------------+
|
||||
| language | files | code | comment | blank | total |
|
||||
+----------+------------+------------+------------+------------+------------+
|
||||
+----------+------------+------------+------------+------------+------------+
|
||||
|
||||
Directories
|
||||
+------+------------+------------+------------+------------+------------+
|
||||
| path | files | code | comment | blank | total |
|
||||
+------+------------+------------+------------+------------+------------+
|
||||
+------+------------+------------+------------+------------+------------+
|
||||
|
||||
Files
|
||||
+----------+----------+------------+------------+------------+------------+
|
||||
| filename | language | code | comment | blank | total |
|
||||
+----------+----------+------------+------------+------------+------------+
|
||||
| Total | | 0 | 0 | 0 | 0 |
|
||||
+----------+----------+------------+------------+------------+------------+
|
||||
@@ -1,69 +0,0 @@
|
||||
"filename", "language", "YAML", "Markdown", "Dart", "JSON", "Swift", "C++", "XML", "Ruby", "Properties", "HTML", "comment", "blank", "total"
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\README.md", "Markdown", 0, 45, 0, 0, 0, 0, 0, 0, 0, 0, 0, 16, 61
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\analysis_options.yaml", "YAML", 3, 0, 0, 0, 0, 0, 0, 0, 0, 0, 22, 4, 29
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\google-services.json", "JSON", 0, 0, 0, 54, 0, 0, 0, 0, 0, 0, 0, 0, 54
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\debug\AndroidManifest.xml", "XML", 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 4, 1, 8
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\AndroidManifest.xml", "XML", 0, 0, 0, 0, 0, 0, 40, 0, 0, 0, 11, 1, 52
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable-v21\launch_background.xml", "XML", 0, 0, 0, 0, 0, 0, 4, 0, 0, 0, 7, 2, 13
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable\launch_background.xml", "XML", 0, 0, 0, 0, 0, 0, 4, 0, 0, 0, 7, 2, 13
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values-night\styles.xml", "XML", 0, 0, 0, 0, 0, 0, 9, 0, 0, 0, 9, 1, 19
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values\styles.xml", "XML", 0, 0, 0, 0, 0, 0, 9, 0, 0, 0, 9, 1, 19
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\profile\AndroidManifest.xml", "XML", 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 4, 1, 8
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\build\reports\problems\problems-report.html", "HTML", 0, 0, 0, 0, 0, 0, 0, 0, 0, 548, 2, 114, 664
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\gradle.properties", "Properties", 0, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 1, 4
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\android\gradle\wrapper\gradle-wrapper.properties", "Properties", 0, 0, 0, 0, 0, 0, 0, 0, 5, 0, 0, 1, 6
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\firebase.json", "JSON", 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Podfile", "Ruby", 0, 0, 0, 0, 0, 0, 0, 32, 0, 0, 2, 10, 44
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\RunnerTests\RunnerTests.swift", "Swift", 0, 0, 0, 0, 7, 0, 0, 0, 0, 0, 2, 4, 13
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\AppDelegate.swift", "Swift", 0, 0, 0, 0, 14, 0, 0, 0, 0, 0, 0, 2, 16
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\AppIcon.appiconset\Contents.json", "JSON", 0, 0, 0, 122, 0, 0, 0, 0, 0, 0, 0, 1, 123
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\Contents.json", "JSON", 0, 0, 0, 23, 0, 0, 0, 0, 0, 0, 0, 1, 24
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\README.md", "Markdown", 0, 3, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 5
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\LaunchScreen.storyboard", "XML", 0, 0, 0, 0, 0, 0, 36, 0, 0, 0, 1, 1, 38
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\Main.storyboard", "XML", 0, 0, 0, 0, 0, 0, 25, 0, 0, 0, 1, 1, 27
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Runner-Bridging-Header.h", "C++", 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 2
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_bloc.dart", "Dart", 0, 0, 129, 0, 0, 0, 0, 0, 0, 0, 1, 20, 150
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_event.dart", "Dart", 0, 0, 40, 0, 0, 0, 0, 0, 0, 0, 0, 15, 55
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_state.dart", "Dart", 0, 0, 28, 0, 0, 0, 0, 0, 0, 0, 0, 14, 42
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_bloc.dart", "Dart", 0, 0, 40, 0, 0, 0, 0, 0, 0, 0, 1, 5, 46
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_event.dart", "Dart", 0, 0, 14, 0, 0, 0, 0, 0, 0, 0, 0, 6, 20
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_state.dart", "Dart", 0, 0, 16, 0, 0, 0, 0, 0, 0, 0, 0, 5, 21
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_bloc.dart", "Dart", 0, 0, 103, 0, 0, 0, 0, 0, 0, 0, 1, 14, 118
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_event.dart", "Dart", 0, 0, 51, 0, 0, 0, 0, 0, 0, 0, 0, 20, 71
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_state.dart", "Dart", 0, 0, 27, 0, 0, 0, 0, 0, 0, 0, 0, 13, 40
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_bloc.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_event.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_state.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\count\count_content.dart", "Dart", 0, 0, 25, 0, 0, 0, 0, 0, 0, 0, 0, 3, 28
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\group\group_content.dart", "Dart", 0, 0, 115, 0, 0, 0, 0, 0, 0, 0, 2, 12, 129
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\create_trip_content.dart", "Dart", 0, 0, 481, 0, 0, 0, 0, 0, 0, 0, 21, 63, 565
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\home_content.dart", "Dart", 0, 0, 366, 0, 0, 0, 0, 0, 0, 0, 12, 30, 408
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\show_trip_details_content.dart", "Dart", 0, 0, 106, 0, 0, 0, 0, 0, 0, 0, 2, 4, 112
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\map\map_content.dart", "Dart", 0, 0, 100, 0, 0, 0, 0, 0, 0, 0, 4, 11, 115
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\profile\profile_content.dart", "Dart", 0, 0, 328, 0, 0, 0, 0, 0, 0, 0, 6, 29, 363
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_content.dart", "Dart", 0, 0, 60, 0, 0, 0, 0, 0, 0, 0, 2, 10, 72
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_theme_content.dart", "Dart", 0, 0, 123, 0, 0, 0, 0, 0, 0, 0, 4, 10, 137
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\firestore_data_source.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\local_data_source.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\group.dart", "Dart", 0, 0, 23, 0, 0, 0, 0, 0, 0, 0, 0, 3, 26
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\message.dart", "Dart", 0, 0, 14, 0, 0, 0, 0, 0, 0, 0, 0, 1, 15
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\trip.dart", "Dart", 0, 0, 176, 0, 0, 0, 0, 0, 0, 0, 16, 24, 216
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\user.dart", "Dart", 0, 0, 61, 0, 0, 0, 0, 0, 0, 0, 6, 13, 80
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\firebase_options.dart", "Dart", 0, 0, 60, 0, 0, 0, 0, 0, 0, 0, 12, 5, 77
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\main.dart", "Dart", 0, 0, 89, 0, 0, 0, 0, 0, 0, 0, 0, 5, 94
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\home.dart", "Dart", 0, 0, 147, 0, 0, 0, 0, 0, 0, 0, 6, 13, 166
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\login.dart", "Dart", 0, 0, 285, 0, 0, 0, 0, 0, 0, 0, 9, 28, 322
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\resetpswd.dart", "Dart", 0, 0, 92, 0, 0, 0, 0, 0, 0, 0, 2, 13, 107
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\signup.dart", "Dart", 0, 0, 256, 0, 0, 0, 0, 0, 0, 0, 7, 20, 283
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\providers\theme_provider.dart", "Dart", 0, 0, 41, 0, 0, 0, 0, 0, 0, 0, 1, 9, 51
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\providers\user_provider.dart", "Dart", 0, 0, 94, 0, 0, 0, 0, 0, 0, 0, 9, 18, 121
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\auth_repository.dart", "Dart", 0, 0, 115, 0, 0, 0, 0, 0, 0, 0, 11, 22, 148
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\trip_repository.dart", "Dart", 0, 0, 92, 0, 0, 0, 0, 0, 0, 0, 9, 12, 113
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\user_repository.dart", "Dart", 0, 0, 77, 0, 0, 0, 0, 0, 0, 0, 7, 11, 95
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\services\auth_service.dart", "Dart", 0, 0, 84, 0, 0, 0, 0, 0, 0, 0, 6, 18, 108
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\services\group_service.dart", "Dart", 0, 0, 53, 0, 0, 0, 0, 0, 0, 0, 1, 6, 60
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\services\message_service.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\lib\services\trip_service.dart", "Dart", 0, 0, 209, 0, 0, 0, 0, 0, 0, 0, 21, 39, 269
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\pubspec.yaml", "YAML", 31, 0, 0, 0, 0, 0, 0, 0, 0, 0, 58, 14, 103
|
||||
"c:\Users\dayro\Documents\coding\travel_mate\test\widget_test.dart", "Dart", 0, 0, 14, 0, 0, 0, 0, 0, 0, 0, 10, 7, 31
|
||||
"Total", "-", 34, 48, 4134, 200, 21, 1, 133, 32, 8, 548, 328, 739, 6226
|
||||
|
File diff suppressed because one or more lines are too long
@@ -1,81 +0,0 @@
|
||||
# Summary
|
||||
|
||||
Date : 2025-10-14 11:10:48
|
||||
|
||||
Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
|
||||
|
||||
Total : 67 files, 5159 codes, 328 comments, 739 blanks, all 6226 lines
|
||||
|
||||
Summary / [Details](details.md) / [Diff Summary](diff.md) / [Diff Details](diff-details.md)
|
||||
|
||||
## Languages
|
||||
| language | files | code | comment | blank | total |
|
||||
| :--- | ---: | ---: | ---: | ---: | ---: |
|
||||
| Dart | 43 | 4,134 | 189 | 557 | 4,880 |
|
||||
| HTML | 1 | 548 | 2 | 114 | 664 |
|
||||
| JSON | 4 | 200 | 0 | 2 | 202 |
|
||||
| XML | 9 | 133 | 53 | 11 | 197 |
|
||||
| Markdown | 2 | 48 | 0 | 18 | 66 |
|
||||
| YAML | 2 | 34 | 80 | 18 | 132 |
|
||||
| Ruby | 1 | 32 | 2 | 10 | 44 |
|
||||
| Swift | 2 | 21 | 2 | 6 | 29 |
|
||||
| Properties | 2 | 8 | 0 | 2 | 10 |
|
||||
| C++ | 1 | 1 | 0 | 1 | 2 |
|
||||
|
||||
## Directories
|
||||
| path | files | code | comment | blank | total |
|
||||
| :--- | ---: | ---: | ---: | ---: | ---: |
|
||||
| . | 67 | 5,159 | 328 | 739 | 6,226 |
|
||||
| . (Files) | 4 | 80 | 80 | 34 | 194 |
|
||||
| android | 11 | 682 | 53 | 125 | 860 |
|
||||
| android (Files) | 1 | 3 | 0 | 1 | 4 |
|
||||
| android\\app | 8 | 126 | 51 | 9 | 186 |
|
||||
| android\\app (Files) | 1 | 54 | 0 | 0 | 54 |
|
||||
| android\\app\\src | 7 | 72 | 51 | 9 | 132 |
|
||||
| android\\app\\src\\debug | 1 | 3 | 4 | 1 | 8 |
|
||||
| android\\app\\src\\main | 5 | 66 | 43 | 7 | 116 |
|
||||
| android\\app\\src\\main (Files) | 1 | 40 | 11 | 1 | 52 |
|
||||
| android\\app\\src\\main\\res | 4 | 26 | 32 | 6 | 64 |
|
||||
| android\\app\\src\\main\\res\\drawable | 1 | 4 | 7 | 2 | 13 |
|
||||
| android\\app\\src\\main\\res\\drawable-v21 | 1 | 4 | 7 | 2 | 13 |
|
||||
| android\\app\\src\\main\\res\\values | 1 | 9 | 9 | 1 | 19 |
|
||||
| android\\app\\src\\main\\res\\values-night | 1 | 9 | 9 | 1 | 19 |
|
||||
| android\\app\\src\\profile | 1 | 3 | 4 | 1 | 8 |
|
||||
| android\\build | 1 | 548 | 2 | 114 | 664 |
|
||||
| android\\build\\reports | 1 | 548 | 2 | 114 | 664 |
|
||||
| android\\build\\reports\\problems | 1 | 548 | 2 | 114 | 664 |
|
||||
| android\\gradle | 1 | 5 | 0 | 1 | 6 |
|
||||
| android\\gradle\\wrapper | 1 | 5 | 0 | 1 | 6 |
|
||||
| ios | 9 | 263 | 6 | 23 | 292 |
|
||||
| ios (Files) | 1 | 32 | 2 | 10 | 44 |
|
||||
| ios\\Runner | 7 | 224 | 2 | 9 | 235 |
|
||||
| ios\\Runner (Files) | 2 | 15 | 0 | 3 | 18 |
|
||||
| ios\\RunnerTests | 1 | 7 | 2 | 4 | 13 |
|
||||
| ios\\Runner\\Assets.xcassets | 3 | 148 | 0 | 4 | 152 |
|
||||
| ios\\Runner\\Assets.xcassets\\AppIcon.appiconset | 1 | 122 | 0 | 1 | 123 |
|
||||
| ios\\Runner\\Assets.xcassets\\LaunchImage.imageset | 2 | 26 | 0 | 3 | 29 |
|
||||
| ios\\Runner\\Base.lproj | 2 | 61 | 2 | 2 | 65 |
|
||||
| lib | 42 | 4,120 | 179 | 550 | 4,849 |
|
||||
| lib (Files) | 2 | 149 | 12 | 10 | 171 |
|
||||
| lib\\blocs | 12 | 448 | 3 | 115 | 566 |
|
||||
| lib\\blocs\\auth | 3 | 197 | 1 | 49 | 247 |
|
||||
| lib\\blocs\\theme | 3 | 70 | 1 | 16 | 87 |
|
||||
| lib\\blocs\\trip | 3 | 181 | 1 | 47 | 229 |
|
||||
| lib\\blocs\\user | 3 | 0 | 0 | 3 | 3 |
|
||||
| lib\\components | 9 | 1,704 | 53 | 172 | 1,929 |
|
||||
| lib\\components\\count | 1 | 25 | 0 | 3 | 28 |
|
||||
| lib\\components\\group | 1 | 115 | 2 | 12 | 129 |
|
||||
| lib\\components\\home | 3 | 953 | 35 | 97 | 1,085 |
|
||||
| lib\\components\\map | 1 | 100 | 4 | 11 | 115 |
|
||||
| lib\\components\\profile | 1 | 328 | 6 | 29 | 363 |
|
||||
| lib\\components\\settings | 2 | 183 | 6 | 20 | 209 |
|
||||
| lib\\data | 6 | 274 | 22 | 43 | 339 |
|
||||
| lib\\data\\data_sources | 2 | 0 | 0 | 2 | 2 |
|
||||
| lib\\data\\models | 4 | 274 | 22 | 41 | 337 |
|
||||
| lib\\pages | 4 | 780 | 24 | 74 | 878 |
|
||||
| lib\\providers | 2 | 135 | 10 | 27 | 172 |
|
||||
| lib\\repositories | 3 | 284 | 27 | 45 | 356 |
|
||||
| lib\\services | 4 | 346 | 28 | 64 | 438 |
|
||||
| test | 1 | 14 | 10 | 7 | 31 |
|
||||
|
||||
Summary / [Details](details.md) / [Diff Summary](diff.md) / [Diff Details](diff-details.md)
|
||||
@@ -1,151 +0,0 @@
|
||||
Date : 2025-10-14 11:10:48
|
||||
Directory : c:\Users\dayro\Documents\coding\travel_mate
|
||||
Total : 67 files, 5159 codes, 328 comments, 739 blanks, all 6226 lines
|
||||
|
||||
Languages
|
||||
+------------+------------+------------+------------+------------+------------+
|
||||
| language | files | code | comment | blank | total |
|
||||
+------------+------------+------------+------------+------------+------------+
|
||||
| Dart | 43 | 4,134 | 189 | 557 | 4,880 |
|
||||
| HTML | 1 | 548 | 2 | 114 | 664 |
|
||||
| JSON | 4 | 200 | 0 | 2 | 202 |
|
||||
| XML | 9 | 133 | 53 | 11 | 197 |
|
||||
| Markdown | 2 | 48 | 0 | 18 | 66 |
|
||||
| YAML | 2 | 34 | 80 | 18 | 132 |
|
||||
| Ruby | 1 | 32 | 2 | 10 | 44 |
|
||||
| Swift | 2 | 21 | 2 | 6 | 29 |
|
||||
| Properties | 2 | 8 | 0 | 2 | 10 |
|
||||
| C++ | 1 | 1 | 0 | 1 | 2 |
|
||||
+------------+------------+------------+------------+------------+------------+
|
||||
|
||||
Directories
|
||||
+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
|
||||
| path | files | code | comment | blank | total |
|
||||
+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
|
||||
| . | 67 | 5,159 | 328 | 739 | 6,226 |
|
||||
| . (Files) | 4 | 80 | 80 | 34 | 194 |
|
||||
| android | 11 | 682 | 53 | 125 | 860 |
|
||||
| android (Files) | 1 | 3 | 0 | 1 | 4 |
|
||||
| android\app | 8 | 126 | 51 | 9 | 186 |
|
||||
| android\app (Files) | 1 | 54 | 0 | 0 | 54 |
|
||||
| android\app\src | 7 | 72 | 51 | 9 | 132 |
|
||||
| android\app\src\debug | 1 | 3 | 4 | 1 | 8 |
|
||||
| android\app\src\main | 5 | 66 | 43 | 7 | 116 |
|
||||
| android\app\src\main (Files) | 1 | 40 | 11 | 1 | 52 |
|
||||
| android\app\src\main\res | 4 | 26 | 32 | 6 | 64 |
|
||||
| android\app\src\main\res\drawable | 1 | 4 | 7 | 2 | 13 |
|
||||
| android\app\src\main\res\drawable-v21 | 1 | 4 | 7 | 2 | 13 |
|
||||
| android\app\src\main\res\values | 1 | 9 | 9 | 1 | 19 |
|
||||
| android\app\src\main\res\values-night | 1 | 9 | 9 | 1 | 19 |
|
||||
| android\app\src\profile | 1 | 3 | 4 | 1 | 8 |
|
||||
| android\build | 1 | 548 | 2 | 114 | 664 |
|
||||
| android\build\reports | 1 | 548 | 2 | 114 | 664 |
|
||||
| android\build\reports\problems | 1 | 548 | 2 | 114 | 664 |
|
||||
| android\gradle | 1 | 5 | 0 | 1 | 6 |
|
||||
| android\gradle\wrapper | 1 | 5 | 0 | 1 | 6 |
|
||||
| ios | 9 | 263 | 6 | 23 | 292 |
|
||||
| ios (Files) | 1 | 32 | 2 | 10 | 44 |
|
||||
| ios\Runner | 7 | 224 | 2 | 9 | 235 |
|
||||
| ios\Runner (Files) | 2 | 15 | 0 | 3 | 18 |
|
||||
| ios\RunnerTests | 1 | 7 | 2 | 4 | 13 |
|
||||
| ios\Runner\Assets.xcassets | 3 | 148 | 0 | 4 | 152 |
|
||||
| ios\Runner\Assets.xcassets\AppIcon.appiconset | 1 | 122 | 0 | 1 | 123 |
|
||||
| ios\Runner\Assets.xcassets\LaunchImage.imageset | 2 | 26 | 0 | 3 | 29 |
|
||||
| ios\Runner\Base.lproj | 2 | 61 | 2 | 2 | 65 |
|
||||
| lib | 42 | 4,120 | 179 | 550 | 4,849 |
|
||||
| lib (Files) | 2 | 149 | 12 | 10 | 171 |
|
||||
| lib\blocs | 12 | 448 | 3 | 115 | 566 |
|
||||
| lib\blocs\auth | 3 | 197 | 1 | 49 | 247 |
|
||||
| lib\blocs\theme | 3 | 70 | 1 | 16 | 87 |
|
||||
| lib\blocs\trip | 3 | 181 | 1 | 47 | 229 |
|
||||
| lib\blocs\user | 3 | 0 | 0 | 3 | 3 |
|
||||
| lib\components | 9 | 1,704 | 53 | 172 | 1,929 |
|
||||
| lib\components\count | 1 | 25 | 0 | 3 | 28 |
|
||||
| lib\components\group | 1 | 115 | 2 | 12 | 129 |
|
||||
| lib\components\home | 3 | 953 | 35 | 97 | 1,085 |
|
||||
| lib\components\map | 1 | 100 | 4 | 11 | 115 |
|
||||
| lib\components\profile | 1 | 328 | 6 | 29 | 363 |
|
||||
| lib\components\settings | 2 | 183 | 6 | 20 | 209 |
|
||||
| lib\data | 6 | 274 | 22 | 43 | 339 |
|
||||
| lib\data\data_sources | 2 | 0 | 0 | 2 | 2 |
|
||||
| lib\data\models | 4 | 274 | 22 | 41 | 337 |
|
||||
| lib\pages | 4 | 780 | 24 | 74 | 878 |
|
||||
| lib\providers | 2 | 135 | 10 | 27 | 172 |
|
||||
| lib\repositories | 3 | 284 | 27 | 45 | 356 |
|
||||
| lib\services | 4 | 346 | 28 | 64 | 438 |
|
||||
| test | 1 | 14 | 10 | 7 | 31 |
|
||||
+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
|
||||
|
||||
Files
|
||||
+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
|
||||
| filename | language | code | comment | blank | total |
|
||||
+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\README.md | Markdown | 45 | 0 | 16 | 61 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\analysis_options.yaml | YAML | 3 | 22 | 4 | 29 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\google-services.json | JSON | 54 | 0 | 0 | 54 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\debug\AndroidManifest.xml | XML | 3 | 4 | 1 | 8 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\AndroidManifest.xml | XML | 40 | 11 | 1 | 52 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable-v21\launch_background.xml | XML | 4 | 7 | 2 | 13 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable\launch_background.xml | XML | 4 | 7 | 2 | 13 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values-night\styles.xml | XML | 9 | 9 | 1 | 19 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values\styles.xml | XML | 9 | 9 | 1 | 19 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\profile\AndroidManifest.xml | XML | 3 | 4 | 1 | 8 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\build\reports\problems\problems-report.html | HTML | 548 | 2 | 114 | 664 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\gradle.properties | Properties | 3 | 0 | 1 | 4 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\android\gradle\wrapper\gradle-wrapper.properties | Properties | 5 | 0 | 1 | 6 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\firebase.json | JSON | 1 | 0 | 0 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Podfile | Ruby | 32 | 2 | 10 | 44 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\RunnerTests\RunnerTests.swift | Swift | 7 | 2 | 4 | 13 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\AppDelegate.swift | Swift | 14 | 0 | 2 | 16 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\AppIcon.appiconset\Contents.json | JSON | 122 | 0 | 1 | 123 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\Contents.json | JSON | 23 | 0 | 1 | 24 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\README.md | Markdown | 3 | 0 | 2 | 5 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\LaunchScreen.storyboard | XML | 36 | 1 | 1 | 38 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\Main.storyboard | XML | 25 | 1 | 1 | 27 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Runner-Bridging-Header.h | C++ | 1 | 0 | 1 | 2 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_bloc.dart | Dart | 129 | 1 | 20 | 150 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_event.dart | Dart | 40 | 0 | 15 | 55 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_state.dart | Dart | 28 | 0 | 14 | 42 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_bloc.dart | Dart | 40 | 1 | 5 | 46 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_event.dart | Dart | 14 | 0 | 6 | 20 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_state.dart | Dart | 16 | 0 | 5 | 21 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_bloc.dart | Dart | 103 | 1 | 14 | 118 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_event.dart | Dart | 51 | 0 | 20 | 71 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_state.dart | Dart | 27 | 0 | 13 | 40 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_bloc.dart | Dart | 0 | 0 | 1 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_event.dart | Dart | 0 | 0 | 1 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_state.dart | Dart | 0 | 0 | 1 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\count\count_content.dart | Dart | 25 | 0 | 3 | 28 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\group\group_content.dart | Dart | 115 | 2 | 12 | 129 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\create_trip_content.dart | Dart | 481 | 21 | 63 | 565 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\home_content.dart | Dart | 366 | 12 | 30 | 408 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\show_trip_details_content.dart | Dart | 106 | 2 | 4 | 112 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\map\map_content.dart | Dart | 100 | 4 | 11 | 115 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\profile\profile_content.dart | Dart | 328 | 6 | 29 | 363 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_content.dart | Dart | 60 | 2 | 10 | 72 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_theme_content.dart | Dart | 123 | 4 | 10 | 137 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\firestore_data_source.dart | Dart | 0 | 0 | 1 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\local_data_source.dart | Dart | 0 | 0 | 1 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\group.dart | Dart | 23 | 0 | 3 | 26 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\message.dart | Dart | 14 | 0 | 1 | 15 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\trip.dart | Dart | 176 | 16 | 24 | 216 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\user.dart | Dart | 61 | 6 | 13 | 80 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\firebase_options.dart | Dart | 60 | 12 | 5 | 77 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\main.dart | Dart | 89 | 0 | 5 | 94 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\home.dart | Dart | 147 | 6 | 13 | 166 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\login.dart | Dart | 285 | 9 | 28 | 322 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\resetpswd.dart | Dart | 92 | 2 | 13 | 107 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\signup.dart | Dart | 256 | 7 | 20 | 283 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\providers\theme_provider.dart | Dart | 41 | 1 | 9 | 51 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\providers\user_provider.dart | Dart | 94 | 9 | 18 | 121 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\auth_repository.dart | Dart | 115 | 11 | 22 | 148 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\trip_repository.dart | Dart | 92 | 9 | 12 | 113 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\user_repository.dart | Dart | 77 | 7 | 11 | 95 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\services\auth_service.dart | Dart | 84 | 6 | 18 | 108 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\services\group_service.dart | Dart | 53 | 1 | 6 | 60 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\services\message_service.dart | Dart | 0 | 0 | 1 | 1 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\lib\services\trip_service.dart | Dart | 209 | 21 | 39 | 269 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\pubspec.yaml | YAML | 31 | 58 | 14 | 103 |
|
||||
| c:\Users\dayro\Documents\coding\travel_mate\test\widget_test.dart | Dart | 14 | 10 | 7 | 31 |
|
||||
| Total | | 5,159 | 328 | 739 | 6,226 |
|
||||
+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
|
||||
226
.gitea/workflows/deploy.yaml
Normal file
226
.gitea/workflows/deploy.yaml
Normal file
@@ -0,0 +1,226 @@
|
||||
name: Deploy TravelMate (Full Mobile)
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- release
|
||||
|
||||
jobs:
|
||||
# --- JOB 1 : ANDROID (Génération APK) ---
|
||||
deploy-android:
|
||||
runs-on: macos-latest
|
||||
steps:
|
||||
- name: Checkout code
|
||||
uses: actions/checkout@v3
|
||||
|
||||
- name: Configuration Flutter & Secrets
|
||||
run: |
|
||||
flutter pub get
|
||||
echo "${{ secrets.ENV_FILE }}" > .env
|
||||
printf '%s' '${{ secrets.FIREBASE_CREDENTIALS }}' > ./android/firebase_credentials.json
|
||||
|
||||
- name: Build & Deploy Android
|
||||
working-directory: ./android
|
||||
env:
|
||||
ANDROID_KEYSTORE_BASE64: ${{ secrets.ANDROID_KEYSTORE_BASE64 }}
|
||||
RAW_PROPERTIES: ${{ secrets.ANDROID_KEY_PROPERTIES }}
|
||||
FIREBASE_ANDROID_APP_ID: ${{ secrets.FIREBASE_ANDROID_APP_ID }}
|
||||
run: |
|
||||
# 1. Keystore
|
||||
echo "$ANDROID_KEYSTORE_BASE64" | base64 -D > keystore.jks
|
||||
echo "$RAW_PROPERTIES" > temp_props.txt
|
||||
echo "storePassword=$(grep 'storePassword' temp_props.txt | cut -d'=' -f2 | tr -d '\r')" > key.properties
|
||||
echo "keyPassword=$(grep 'keyPassword' temp_props.txt | cut -d'=' -f2 | tr -d '\r')" >> key.properties
|
||||
echo "keyAlias=$(grep 'keyAlias' temp_props.txt | cut -d'=' -f2 | tr -d '\r')" >> key.properties
|
||||
echo "storeFile=$(pwd)/keystore.jks" >> key.properties
|
||||
|
||||
# 2. Gemfile (Correctifs Ruby 3.4 inclus)
|
||||
echo "source 'https://rubygems.org'" > Gemfile
|
||||
echo "gem 'fastlane', '>= 2.230.0'" >> Gemfile
|
||||
echo "gem 'fastlane-plugin-firebase_app_distribution'" >> Gemfile
|
||||
for g in abbrev ostruct mutex_m base64 csv bigdecimal drb nkf reline logger; do echo "gem '$g'" >> Gemfile; done
|
||||
|
||||
gem install bundler -v 2.7.2 --no-document
|
||||
bundle _2.7.2_ update
|
||||
|
||||
# 3. Build & Envoi
|
||||
cd .. && flutter build apk --release && cd android
|
||||
bundle _2.7.2_ exec fastlane run firebase_app_distribution \
|
||||
app:"$FIREBASE_ANDROID_APP_ID" \
|
||||
android_artifact_path:"../build/app/outputs/flutter-apk/app-release.apk" \
|
||||
service_credentials_file:"firebase_credentials.json"
|
||||
|
||||
# --- JOB 2 : IOS (Génération IPA) ---
|
||||
deploy-ios:
|
||||
runs-on: macos-latest
|
||||
steps:
|
||||
- name: Checkout code
|
||||
uses: actions/checkout@v3
|
||||
|
||||
- name: Dépendances iOS & Secrets
|
||||
run: |
|
||||
flutter pub get
|
||||
echo "${{ secrets.ENV_FILE }}" > .env
|
||||
printf '%s' '${{ secrets.FIREBASE_CREDENTIALS }}' > ./ios/firebase_credentials.json
|
||||
cd ios && (pod install --repo-update || pod update)
|
||||
|
||||
- name: Préparer le Code Signing
|
||||
env:
|
||||
P12_BASE: ${{ secrets.IOS_P12_BASE64 }}
|
||||
P12_PASS: ${{ secrets.IOS_P12_PASSWORD }}
|
||||
PROV_BASE: ${{ secrets.IOS_PROVISION_BASE64 }}
|
||||
TEAM_ID: ${{ secrets.IOS_TEAM_ID }}
|
||||
run: |
|
||||
# Créer et configurer le keychain
|
||||
security delete-keychain build.keychain || true
|
||||
security create-keychain -p "" build.keychain
|
||||
security unlock-keychain -p "" build.keychain
|
||||
security list-keychains -d user -s build.keychain $(security list-keychains -d user | xargs)
|
||||
security set-keychain-settings -lut 21600 build.keychain
|
||||
|
||||
# Importer le certificat
|
||||
echo "$P12_BASE" | base64 -D -o cert.p12
|
||||
security import cert.p12 -k build.keychain -P "$P12_PASS" -T /usr/bin/codesign
|
||||
security set-key-partition-list -S apple-tool:,apple: -s -k "" build.keychain
|
||||
|
||||
# Installer le profil de provisioning
|
||||
mkdir -p ~/Library/MobileDevice/Provisioning\ Profiles
|
||||
PROFILE_PATH=~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision
|
||||
echo "$PROV_BASE" | base64 -D -o "$PROFILE_PATH"
|
||||
|
||||
# Extraire l'UUID du profil
|
||||
PROFILE_UUID=$(/usr/libexec/PlistBuddy -c "Print UUID" /dev/stdin <<< $(/usr/bin/security cms -D -i "$PROFILE_PATH"))
|
||||
echo "Profile UUID: $PROFILE_UUID"
|
||||
|
||||
# Copier avec l'UUID correct
|
||||
cp "$PROFILE_PATH" ~/Library/MobileDevice/Provisioning\ Profiles/$PROFILE_UUID.mobileprovision
|
||||
|
||||
- name: Configurer le projet Xcode
|
||||
env:
|
||||
TEAM_ID: ${{ secrets.IOS_TEAM_ID }}
|
||||
BUNDLE_ID: ${{ secrets.IOS_BUNDLE_ID }}
|
||||
run: |
|
||||
cd ios
|
||||
|
||||
# Extraire le nom du profil de provisioning
|
||||
PROV_NAME=$(/usr/libexec/PlistBuddy -c "Print Name" /dev/stdin <<< $(/usr/bin/security cms -D -i ~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision))
|
||||
echo "📝 Provisioning Profile Name: $PROV_NAME"
|
||||
|
||||
# Obtenir l'UUID du profil
|
||||
PROFILE_UUID=$(/usr/libexec/PlistBuddy -c "Print UUID" /dev/stdin <<< $(/usr/bin/security cms -D -i ~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision))
|
||||
echo "🔑 Profile UUID: $PROFILE_UUID"
|
||||
|
||||
# Sauvegarder les variables pour la prochaine étape
|
||||
echo "$PROV_NAME" > /tmp/prov_name.txt
|
||||
echo "$TEAM_ID" > /tmp/team_id.txt
|
||||
echo "$BUNDLE_ID" > /tmp/bundle_id.txt
|
||||
|
||||
echo "✅ Configuration des paramètres de signing prête"
|
||||
|
||||
- name: Créer exportOptions.plist
|
||||
env:
|
||||
TEAM_ID: ${{ secrets.IOS_TEAM_ID }}
|
||||
BUNDLE_ID: ${{ secrets.IOS_BUNDLE_ID }}
|
||||
run: |
|
||||
# Extraire le nom du profil
|
||||
PROV_NAME=$(/usr/libexec/PlistBuddy -c "Print Name" /dev/stdin <<< $(/usr/bin/security cms -D -i ~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision))
|
||||
|
||||
cat > ios/exportOptions.plist <<EOF
|
||||
<?xml version="1.0" encoding="UTF-8"?>
|
||||
<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
|
||||
<plist version="1.0">
|
||||
<dict>
|
||||
<key>method</key>
|
||||
<string>ad-hoc</string>
|
||||
<key>teamID</key>
|
||||
<string>$TEAM_ID</string>
|
||||
<key>signingStyle</key>
|
||||
<string>manual</string>
|
||||
<key>provisioningProfiles</key>
|
||||
<dict>
|
||||
<key>$BUNDLE_ID</key>
|
||||
<string>$PROV_NAME</string>
|
||||
</dict>
|
||||
</dict>
|
||||
</plist>
|
||||
EOF
|
||||
|
||||
- name: Build IPA avec Flutter
|
||||
run: |
|
||||
# Récupérer les variables sauvegardées
|
||||
PROV_NAME=$(cat /tmp/prov_name.txt)
|
||||
TEAM_ID=$(cat /tmp/team_id.txt)
|
||||
BUNDLE_ID=$(cat /tmp/bundle_id.txt)
|
||||
|
||||
echo "📝 Provisioning Profile: $PROV_NAME"
|
||||
echo "🔑 Team ID: $TEAM_ID"
|
||||
echo "📦 Bundle ID: $BUNDLE_ID"
|
||||
|
||||
# Clean
|
||||
flutter clean
|
||||
flutter pub get
|
||||
|
||||
echo "🔨 Build de l'IPA avec Flutter..."
|
||||
|
||||
# Flutter build ipa gère automatiquement le signing des Pods
|
||||
# On utilise SEULEMENT --export-options-plist (pas --export-method)
|
||||
flutter build ipa \
|
||||
--release \
|
||||
--export-options-plist=ios/exportOptions.plist
|
||||
|
||||
echo "✅ Build terminé"
|
||||
echo "📂 Recherche de l'IPA..."
|
||||
|
||||
# L'IPA devrait être dans build/ios/ipa/
|
||||
find build/ios -name "*.ipa" -type f
|
||||
|
||||
IPA_FILE=$(find build/ios/ipa -name "*.ipa" | head -n 1)
|
||||
|
||||
if [ -z "$IPA_FILE" ]; then
|
||||
echo "❌ ERREUR: Aucun fichier IPA trouvé !"
|
||||
echo "📂 Contenu de build/ios/ :"
|
||||
ls -R build/ios/
|
||||
exit 1
|
||||
fi
|
||||
|
||||
echo "✅ IPA trouvée : $IPA_FILE"
|
||||
echo "📊 Taille : $(du -h "$IPA_FILE" | cut -f1)"
|
||||
|
||||
- name: Vérification et Upload Firebase
|
||||
env:
|
||||
FIREBASE_IOS_APP_ID: ${{ secrets.FIREBASE_IOS_APP_ID }}
|
||||
run: |
|
||||
cd ios
|
||||
|
||||
# Configuration Fastlane
|
||||
echo "source 'https://rubygems.org'" > Gemfile
|
||||
echo "gem 'fastlane', '>= 2.230.0'" >> Gemfile
|
||||
echo "gem 'fastlane-plugin-firebase_app_distribution'" >> Gemfile
|
||||
for g in abbrev ostruct mutex_m base64 csv bigdecimal drb nkf reline logger; do echo "gem '$g'" >> Gemfile; done
|
||||
|
||||
gem install bundler -v 2.7.2 --no-document
|
||||
bundle _2.7.2_ update
|
||||
|
||||
# Recherche de l'IPA
|
||||
IPA_FILE=$(find ../build/ios/ipa -name "*.ipa" | head -n 1)
|
||||
|
||||
if [ -z "$IPA_FILE" ]; then
|
||||
echo "❌ ERREUR : Aucun fichier IPA trouvé !"
|
||||
echo "📂 Structure complète du dossier build :"
|
||||
ls -R ../build/
|
||||
exit 1
|
||||
fi
|
||||
|
||||
echo "✅ IPA trouvée : $IPA_FILE"
|
||||
echo "📊 Taille : $(du -h "$IPA_FILE" | cut -f1)"
|
||||
|
||||
# Upload vers Firebase
|
||||
bundle _2.7.2_ exec fastlane run firebase_app_distribution \
|
||||
app:"$FIREBASE_IOS_APP_ID" \
|
||||
ipa_path:"$IPA_FILE" \
|
||||
service_credentials_file:"firebase_credentials.json"
|
||||
|
||||
- name: Nettoyage Final
|
||||
if: always()
|
||||
run: |
|
||||
security list-keychains -d user -s login.keychain
|
||||
security delete-keychain build.keychain || true
|
||||
55
.github/workflows/deploy-playstore.yml
vendored
55
.github/workflows/deploy-playstore.yml
vendored
@@ -1,55 +0,0 @@
|
||||
name: Deploy to Play Store
|
||||
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- release # L'action se déclenche uniquement sur la branche 'release'
|
||||
|
||||
jobs:
|
||||
build_and_deploy:
|
||||
runs-on: ubuntu-latest
|
||||
|
||||
steps:
|
||||
# 1. Récupérer le code
|
||||
- uses: actions/checkout@v4
|
||||
|
||||
# 2. Installer Java (requis pour Android build)
|
||||
- uses: actions/setup-java@v4
|
||||
with:
|
||||
distribution: 'zulu'
|
||||
java-version: '17'
|
||||
|
||||
# 3. Installer Flutter
|
||||
- uses: subosito/flutter-action@v2
|
||||
with:
|
||||
channel: 'stable'
|
||||
|
||||
# 4. Gérer les dépendances
|
||||
- run: flutter pub get
|
||||
|
||||
# 5. Créer le Keystore depuis le secret (Décodage)
|
||||
- name: Decode Keystore
|
||||
run: |
|
||||
echo "${{ secrets.ANDROID_KEYSTORE_BASE64 }}" | base64 --decode > android/app/upload-keystore.jks
|
||||
|
||||
# 6. Créer le fichier key.properties pour que Gradle trouve la clé
|
||||
- name: Create key.properties
|
||||
run: |
|
||||
echo "storePassword=${{ secrets.ANDROID_KEYSTORE_PASSWORD }}" > android/key.properties
|
||||
echo "keyPassword=${{ secrets.ANDROID_KEY_PASSWORD }}" >> android/key.properties
|
||||
echo "keyAlias=${{ secrets.ANDROID_KEY_ALIAS }}" >> android/key.properties
|
||||
echo "storeFile=upload-keystore.jks" >> android/key.properties
|
||||
|
||||
# 7. Construire l'AppBundle (.aab)
|
||||
- name: Build AppBundle
|
||||
run: flutter build appbundle --release
|
||||
|
||||
# 8. Uploader sur le Play Store (Track: alpha = Test fermé)
|
||||
- name: Upload to Play Store
|
||||
uses: r0adkll/upload-google-play@v1
|
||||
with:
|
||||
serviceAccountJsonPlainText: ${{ secrets.PLAY_STORE_CONFIG_JSON }}
|
||||
packageName: be.devdayronvl.travel_mate
|
||||
releaseFiles: build/app/outputs/bundle/release/app-release.aab
|
||||
track: alpha # 'alpha' correspond souvent au Test Fermé. Sinon 'internal' ou 'beta'.
|
||||
status: completed
|
||||
5
.gitignore
vendored
5
.gitignore
vendored
@@ -51,3 +51,8 @@ app.*.map.json
|
||||
firestore.rules
|
||||
storage.rules
|
||||
/functions/node_modules
|
||||
|
||||
.idea
|
||||
.vscode
|
||||
.VSCodeCounter
|
||||
|
||||
|
||||
@@ -56,3 +56,7 @@ Travel Mate est une application mobile conçue pour simplifier l'organisation de
|
||||
- **Google Places API** - Recherche de lieux et points d'intérêt
|
||||
- **Google Maps API** - Cartes et navigation
|
||||
- **Google Directions API** - Calcul d'itinéraires
|
||||
|
||||
## 🚀 CI/CD & Déploiement
|
||||
|
||||
Les versions de test interne Android et IOS sont automatiquement distribuées via **Firebase App Distribution**.
|
||||
|
||||
6
android/Gemfile
Normal file
6
android/Gemfile
Normal file
@@ -0,0 +1,6 @@
|
||||
source "https://rubygems.org"
|
||||
|
||||
gem "fastlane"
|
||||
|
||||
plugins_path = File.join(File.dirname(__FILE__), 'fastlane', 'Pluginfile')
|
||||
eval_gemfile(plugins_path) if File.exist?(plugins_path)
|
||||
@@ -30,10 +30,7 @@ android {
|
||||
}
|
||||
|
||||
defaultConfig {
|
||||
// TODO: Specify your own unique Application ID (https://developer.android.com/studio/build/application-id.html).
|
||||
applicationId = "be.devdayronvl.travel_mate"
|
||||
// You can update the following values to match your application needs.
|
||||
// For more information, see: https://flutter.dev/to/review-gradle-config.
|
||||
minSdk = flutter.minSdkVersion
|
||||
targetSdk = flutter.targetSdkVersion
|
||||
versionCode = flutter.versionCode
|
||||
@@ -45,16 +42,18 @@ android {
|
||||
keyAlias = keystoreProperties["keyAlias"] as String?
|
||||
keyPassword = keystoreProperties["keyPassword"] as String?
|
||||
storeFile = if (keystoreProperties["storeFile"] != null) {
|
||||
file(keystoreProperties["storeFile"] as String)
|
||||
rootProject.file(keystoreProperties["storeFile"] as String)
|
||||
} else {
|
||||
null
|
||||
}
|
||||
|
||||
storePassword = keystoreProperties["storePassword"] as String?
|
||||
}
|
||||
}
|
||||
|
||||
buildTypes {
|
||||
release {
|
||||
// Applique la configuration de signature définie au-dessus
|
||||
signingConfig = signingConfigs.getByName("release")
|
||||
}
|
||||
}
|
||||
|
||||
@@ -21,6 +21,7 @@
|
||||
android:icon="@mipmap/ic_launcher">
|
||||
<activity
|
||||
android:name=".MainActivity"
|
||||
android:screenOrientation="portrait"
|
||||
android:exported="true"
|
||||
android:launchMode="singleTop"
|
||||
android:taskAffinity=""
|
||||
@@ -62,7 +63,7 @@
|
||||
android:value="2" />
|
||||
<meta-data
|
||||
android:name="com.google.android.geo.API_KEY"
|
||||
android:value="AIzaSyCAtz1_d5K0ANwxAA_T84iq7Ac_gsUs_oM"/>
|
||||
android:value="AIzaSyAON_ol0Jr34tKbETvdDK9JCQdKNawxBeQ"/>
|
||||
<meta-data
|
||||
android:name="com.google.firebase.messaging.default_notification_channel_id"
|
||||
android:value="high_importance_channel" />
|
||||
|
||||
2
android/fastlane/Appfile
Normal file
2
android/fastlane/Appfile
Normal file
@@ -0,0 +1,2 @@
|
||||
json_key_file("'/Users/dayronvanleemput/Documents/Coding/clé/travelmate-a47f5-1e4759031f2d.json'") # Path to the json secret file - Follow https://docs.fastlane.tools/actions/supply/#setup to get one
|
||||
package_name("be.devdayronvl.travel_mate") # e.g. com.krausefx.app
|
||||
28
android/fastlane/Fastfile
Normal file
28
android/fastlane/Fastfile
Normal file
@@ -0,0 +1,28 @@
|
||||
default_platform(:android)
|
||||
|
||||
platform :android do
|
||||
desc "Deploy to Firebase from Mac"
|
||||
lane :deploy_firebase do
|
||||
|
||||
# 1. Création du Keystore depuis le secret Gitea
|
||||
if ENV['ANDROID_KEYSTORE_BASE64']
|
||||
File.open("upload-keystore.jks", "wb") do |f|
|
||||
f.write(Base64.decode64(ENV['ANDROID_KEYSTORE_BASE64']))
|
||||
end
|
||||
else
|
||||
UI.error("Secret Keystore manquant !")
|
||||
end
|
||||
|
||||
# 2. Build de l'App Bundle (AAB)
|
||||
sh("flutter build appbundle --release")
|
||||
|
||||
# 3. Envoi vers Firebase App Distribution
|
||||
firebase_app_distribution(
|
||||
app: ENV["FIREBASE_ANDROID_APP_ID"],
|
||||
service_credentials_file: "firebase_credentials.json",
|
||||
groups: "testers",
|
||||
android_artifact_path: "../build/app/outputs/bundle/release/app-release.aab",
|
||||
release_notes: "Build depuis Mac M1/M2. Commit: #{ENV['GITHUB_SHA']}"
|
||||
)
|
||||
end
|
||||
end
|
||||
5
android/fastlane/Pluginfile
Normal file
5
android/fastlane/Pluginfile
Normal file
@@ -0,0 +1,5 @@
|
||||
# Autogenerated by fastlane
|
||||
#
|
||||
# Ensure this file is checked in to source control!
|
||||
|
||||
gem 'fastlane-plugin-firebase_app_distribution'
|
||||
BIN
assets/icons/Icône de l'application.png
Normal file
BIN
assets/icons/Icône de l'application.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 137 KiB |
BIN
assets/icons/presentation_image.jpg
Normal file
BIN
assets/icons/presentation_image.jpg
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 182 KiB |
196
ios/Podfile.lock
196
ios/Podfile.lock
@@ -1205,63 +1205,85 @@ PODS:
|
||||
- BoringSSL-GRPC/Interface (= 0.0.37)
|
||||
- BoringSSL-GRPC/Interface (0.0.37)
|
||||
- cloud_firestore (6.0.3):
|
||||
- Firebase/Firestore (= 12.4.0)
|
||||
- Firebase/Firestore (= 12.6.0)
|
||||
- firebase_core
|
||||
- Flutter
|
||||
- Firebase/Auth (12.4.0):
|
||||
- Firebase/Auth (12.6.0):
|
||||
- Firebase/CoreOnly
|
||||
- FirebaseAuth (~> 12.4.0)
|
||||
- Firebase/CoreOnly (12.4.0):
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- Firebase/Firestore (12.4.0):
|
||||
- FirebaseAuth (~> 12.6.0)
|
||||
- Firebase/CoreOnly (12.6.0):
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- Firebase/Firestore (12.6.0):
|
||||
- Firebase/CoreOnly
|
||||
- FirebaseFirestore (~> 12.4.0)
|
||||
- Firebase/Messaging (12.4.0):
|
||||
- FirebaseFirestore (~> 12.6.0)
|
||||
- Firebase/Messaging (12.6.0):
|
||||
- Firebase/CoreOnly
|
||||
- FirebaseMessaging (~> 12.4.0)
|
||||
- Firebase/Storage (12.4.0):
|
||||
- FirebaseMessaging (~> 12.6.0)
|
||||
- Firebase/Storage (12.6.0):
|
||||
- Firebase/CoreOnly
|
||||
- FirebaseStorage (~> 12.4.0)
|
||||
- FirebaseStorage (~> 12.6.0)
|
||||
- firebase_analytics (12.1.0):
|
||||
- firebase_core
|
||||
- FirebaseAnalytics (= 12.6.0)
|
||||
- Flutter
|
||||
- firebase_auth (6.1.1):
|
||||
- Firebase/Auth (= 12.4.0)
|
||||
- Firebase/Auth (= 12.6.0)
|
||||
- firebase_core
|
||||
- Flutter
|
||||
- firebase_core (4.2.1):
|
||||
- Firebase/CoreOnly (= 12.4.0)
|
||||
- firebase_core (4.3.0):
|
||||
- Firebase/CoreOnly (= 12.6.0)
|
||||
- Flutter
|
||||
- firebase_messaging (16.0.4):
|
||||
- Firebase/Messaging (= 12.4.0)
|
||||
- Firebase/Messaging (= 12.6.0)
|
||||
- firebase_core
|
||||
- Flutter
|
||||
- firebase_storage (13.0.3):
|
||||
- Firebase/Storage (= 12.4.0)
|
||||
- Firebase/Storage (= 12.6.0)
|
||||
- firebase_core
|
||||
- Flutter
|
||||
- FirebaseAppCheckInterop (12.4.0)
|
||||
- FirebaseAuth (12.4.0):
|
||||
- FirebaseAppCheckInterop (~> 12.4.0)
|
||||
- FirebaseAuthInterop (~> 12.4.0)
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseCoreExtension (~> 12.4.0)
|
||||
- FirebaseAnalytics (12.6.0):
|
||||
- FirebaseAnalytics/Default (= 12.6.0)
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseInstallations (~> 12.6.0)
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/MethodSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Network (~> 8.1)
|
||||
- "GoogleUtilities/NSData+zlib (~> 8.1)"
|
||||
- nanopb (~> 3.30910.0)
|
||||
- FirebaseAnalytics/Default (12.6.0):
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseInstallations (~> 12.6.0)
|
||||
- GoogleAppMeasurement/Default (= 12.6.0)
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/MethodSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Network (~> 8.1)
|
||||
- "GoogleUtilities/NSData+zlib (~> 8.1)"
|
||||
- nanopb (~> 3.30910.0)
|
||||
- FirebaseAppCheckInterop (12.6.0)
|
||||
- FirebaseAuth (12.6.0):
|
||||
- FirebaseAppCheckInterop (~> 12.6.0)
|
||||
- FirebaseAuthInterop (~> 12.6.0)
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseCoreExtension (~> 12.6.0)
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Environment (~> 8.1)
|
||||
- GTMSessionFetcher/Core (< 6.0, >= 3.4)
|
||||
- RecaptchaInterop (~> 101.0)
|
||||
- FirebaseAuthInterop (12.4.0)
|
||||
- FirebaseCore (12.4.0):
|
||||
- FirebaseCoreInternal (~> 12.4.0)
|
||||
- FirebaseAuthInterop (12.6.0)
|
||||
- FirebaseCore (12.6.0):
|
||||
- FirebaseCoreInternal (~> 12.6.0)
|
||||
- GoogleUtilities/Environment (~> 8.1)
|
||||
- GoogleUtilities/Logger (~> 8.1)
|
||||
- FirebaseCoreExtension (12.4.0):
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseCoreInternal (12.4.0):
|
||||
- FirebaseCoreExtension (12.6.0):
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseCoreInternal (12.6.0):
|
||||
- "GoogleUtilities/NSData+zlib (~> 8.1)"
|
||||
- FirebaseFirestore (12.4.0):
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseCoreExtension (~> 12.4.0)
|
||||
- FirebaseFirestoreInternal (~> 12.4.0)
|
||||
- FirebaseSharedSwift (~> 12.4.0)
|
||||
- FirebaseFirestoreInternal (12.4.0):
|
||||
- FirebaseFirestore (12.6.0):
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseCoreExtension (~> 12.6.0)
|
||||
- FirebaseFirestoreInternal (~> 12.6.0)
|
||||
- FirebaseSharedSwift (~> 12.6.0)
|
||||
- FirebaseFirestoreInternal (12.6.0):
|
||||
- abseil/algorithm (~> 1.20240722.0)
|
||||
- abseil/base (~> 1.20240722.0)
|
||||
- abseil/container/flat_hash_map (~> 1.20240722.0)
|
||||
@@ -1270,32 +1292,32 @@ PODS:
|
||||
- abseil/strings/strings (~> 1.20240722.0)
|
||||
- abseil/time (~> 1.20240722.0)
|
||||
- abseil/types (~> 1.20240722.0)
|
||||
- FirebaseAppCheckInterop (~> 12.4.0)
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseAppCheckInterop (~> 12.6.0)
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- "gRPC-C++ (~> 1.69.0)"
|
||||
- gRPC-Core (~> 1.69.0)
|
||||
- leveldb-library (~> 1.22)
|
||||
- nanopb (~> 3.30910.0)
|
||||
- FirebaseInstallations (12.4.0):
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseInstallations (12.6.0):
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- GoogleUtilities/Environment (~> 8.1)
|
||||
- GoogleUtilities/UserDefaults (~> 8.1)
|
||||
- PromisesObjC (~> 2.4)
|
||||
- FirebaseMessaging (12.4.0):
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseInstallations (~> 12.4.0)
|
||||
- FirebaseMessaging (12.6.0):
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseInstallations (~> 12.6.0)
|
||||
- GoogleDataTransport (~> 10.1)
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Environment (~> 8.1)
|
||||
- GoogleUtilities/Reachability (~> 8.1)
|
||||
- GoogleUtilities/UserDefaults (~> 8.1)
|
||||
- nanopb (~> 3.30910.0)
|
||||
- FirebaseSharedSwift (12.4.0)
|
||||
- FirebaseStorage (12.4.0):
|
||||
- FirebaseAppCheckInterop (~> 12.4.0)
|
||||
- FirebaseAuthInterop (~> 12.4.0)
|
||||
- FirebaseCore (~> 12.4.0)
|
||||
- FirebaseCoreExtension (~> 12.4.0)
|
||||
- FirebaseSharedSwift (12.6.0)
|
||||
- FirebaseStorage (12.6.0):
|
||||
- FirebaseAppCheckInterop (~> 12.6.0)
|
||||
- FirebaseAuthInterop (~> 12.6.0)
|
||||
- FirebaseCore (~> 12.6.0)
|
||||
- FirebaseCoreExtension (~> 12.6.0)
|
||||
- GoogleUtilities/Environment (~> 8.1)
|
||||
- GTMSessionFetcher/Core (< 6.0, >= 3.4)
|
||||
- Flutter (1.0.0)
|
||||
@@ -1315,13 +1337,40 @@ PODS:
|
||||
- FlutterMacOS
|
||||
- GoogleSignIn (~> 9.0)
|
||||
- GTMSessionFetcher (>= 3.4.0)
|
||||
- GoogleAdsOnDeviceConversion (3.2.0):
|
||||
- GoogleUtilities/Environment (~> 8.1)
|
||||
- GoogleUtilities/Logger (~> 8.1)
|
||||
- GoogleUtilities/Network (~> 8.1)
|
||||
- nanopb (~> 3.30910.0)
|
||||
- GoogleAppMeasurement/Core (12.6.0):
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/MethodSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Network (~> 8.1)
|
||||
- "GoogleUtilities/NSData+zlib (~> 8.1)"
|
||||
- nanopb (~> 3.30910.0)
|
||||
- GoogleAppMeasurement/Default (12.6.0):
|
||||
- GoogleAdsOnDeviceConversion (~> 3.2.0)
|
||||
- GoogleAppMeasurement/Core (= 12.6.0)
|
||||
- GoogleAppMeasurement/IdentitySupport (= 12.6.0)
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/MethodSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Network (~> 8.1)
|
||||
- "GoogleUtilities/NSData+zlib (~> 8.1)"
|
||||
- nanopb (~> 3.30910.0)
|
||||
- GoogleAppMeasurement/IdentitySupport (12.6.0):
|
||||
- GoogleAppMeasurement/Core (= 12.6.0)
|
||||
- GoogleUtilities/AppDelegateSwizzler (~> 8.1)
|
||||
- GoogleUtilities/MethodSwizzler (~> 8.1)
|
||||
- GoogleUtilities/Network (~> 8.1)
|
||||
- "GoogleUtilities/NSData+zlib (~> 8.1)"
|
||||
- nanopb (~> 3.30910.0)
|
||||
- GoogleDataTransport (10.1.0):
|
||||
- nanopb (~> 3.30910.0)
|
||||
- PromisesObjC (~> 2.4)
|
||||
- GoogleMaps (9.4.0):
|
||||
- GoogleMaps/Maps (= 9.4.0)
|
||||
- GoogleMaps/Maps (9.4.0)
|
||||
- GoogleSignIn (9.0.0):
|
||||
- GoogleSignIn (9.1.0):
|
||||
- AppAuth (~> 2.0)
|
||||
- AppCheckCore (~> 11.0)
|
||||
- GTMAppAuth (~> 5.0)
|
||||
@@ -1336,6 +1385,9 @@ PODS:
|
||||
- GoogleUtilities/Logger (8.1.0):
|
||||
- GoogleUtilities/Environment
|
||||
- GoogleUtilities/Privacy
|
||||
- GoogleUtilities/MethodSwizzler (8.1.0):
|
||||
- GoogleUtilities/Logger
|
||||
- GoogleUtilities/Privacy
|
||||
- GoogleUtilities/Network (8.1.0):
|
||||
- GoogleUtilities/Logger
|
||||
- "GoogleUtilities/NSData+zlib"
|
||||
@@ -1480,6 +1532,7 @@ PODS:
|
||||
|
||||
DEPENDENCIES:
|
||||
- cloud_firestore (from `.symlinks/plugins/cloud_firestore/ios`)
|
||||
- firebase_analytics (from `.symlinks/plugins/firebase_analytics/ios`)
|
||||
- firebase_auth (from `.symlinks/plugins/firebase_auth/ios`)
|
||||
- firebase_core (from `.symlinks/plugins/firebase_core/ios`)
|
||||
- firebase_messaging (from `.symlinks/plugins/firebase_messaging/ios`)
|
||||
@@ -1505,6 +1558,7 @@ SPEC REPOS:
|
||||
- AppCheckCore
|
||||
- BoringSSL-GRPC
|
||||
- Firebase
|
||||
- FirebaseAnalytics
|
||||
- FirebaseAppCheckInterop
|
||||
- FirebaseAuth
|
||||
- FirebaseAuthInterop
|
||||
@@ -1518,6 +1572,8 @@ SPEC REPOS:
|
||||
- FirebaseSharedSwift
|
||||
- FirebaseStorage
|
||||
- Google-Maps-iOS-Utils
|
||||
- GoogleAdsOnDeviceConversion
|
||||
- GoogleAppMeasurement
|
||||
- GoogleDataTransport
|
||||
- GoogleMaps
|
||||
- GoogleSignIn
|
||||
@@ -1534,6 +1590,8 @@ SPEC REPOS:
|
||||
EXTERNAL SOURCES:
|
||||
cloud_firestore:
|
||||
:path: ".symlinks/plugins/cloud_firestore/ios"
|
||||
firebase_analytics:
|
||||
:path: ".symlinks/plugins/firebase_analytics/ios"
|
||||
firebase_auth:
|
||||
:path: ".symlinks/plugins/firebase_auth/ios"
|
||||
firebase_core:
|
||||
@@ -1574,33 +1632,37 @@ SPEC CHECKSUMS:
|
||||
AppAuth: 1c1a8afa7e12f2ec3a294d9882dfa5ab7d3cb063
|
||||
AppCheckCore: cc8fd0a3a230ddd401f326489c99990b013f0c4f
|
||||
BoringSSL-GRPC: dded2a44897e45f28f08ae87a55ee4bcd19bc508
|
||||
cloud_firestore: 79014bb3b303d451717ed5fe69fded8a2b2e8dc2
|
||||
Firebase: f07b15ae5a6ec0f93713e30b923d9970d144af3e
|
||||
firebase_auth: c2b8be95d602d4e8a9148fae72333ef78e69cc20
|
||||
firebase_core: f1aafb21c14f497e5498f7ffc4dc63cbb52b2594
|
||||
firebase_messaging: c17a29984eafce4b2997fe078bb0a9e0b06f5dde
|
||||
firebase_storage: 0ba617a05b24aec050395e4d5d3773c0d7518a15
|
||||
FirebaseAppCheckInterop: f734c802f21fe1da0837708f0f9a27218c8a4ed0
|
||||
FirebaseAuth: 4a2aed737c84114a9d9b33d11ae1b147d6b94889
|
||||
FirebaseAuthInterop: 858e6b754966e70740a4370dd1503dfffe6dbb49
|
||||
FirebaseCore: bb595f3114953664e3c1dc032f008a244147cfd3
|
||||
FirebaseCoreExtension: 7e1f7118ee970e001a8013719fb90950ee5e0018
|
||||
FirebaseCoreInternal: d7f5a043c2cd01a08103ab586587c1468047bca6
|
||||
FirebaseFirestore: 2a6183381cf7679b1bb000eb76a8e3178e25dee2
|
||||
FirebaseFirestoreInternal: 6577a27cd5dc3722b900042527f86d4ea1626134
|
||||
FirebaseInstallations: ae9f4902cb5bf1d0c5eaa31ec1f4e5495a0714e2
|
||||
FirebaseMessaging: d33971b7bb252745ea6cd31ab190d1a1df4b8ed5
|
||||
FirebaseSharedSwift: 93426a1de92f19e1199fac5295a4f8df16458daa
|
||||
FirebaseStorage: 20d6b56fb8a40ebaa03d6a2889fe33dac64adb73
|
||||
cloud_firestore: d7598ff2b1b2064e810f839dbdde2765c0f2052a
|
||||
Firebase: a451a7b61536298fd5cbfe3a746fd40443a50679
|
||||
firebase_analytics: 4f9cca09e65f6c2944a862c6dc86f6bed9fb769c
|
||||
firebase_auth: cfb7237c0d01e87360cb3bf61e02a417c36e19e8
|
||||
firebase_core: ba00a168e719694f38960502ceb560285603d073
|
||||
firebase_messaging: 752f1df5294ead9d72091d4974362d00d4aec201
|
||||
firebase_storage: 5716627614e95c75e243134f65c1b0d6f66a4315
|
||||
FirebaseAnalytics: d0a97a0db6425e5a5d966340b87f92ca7b13a557
|
||||
FirebaseAppCheckInterop: e2178171b4145013c7c1a3cc464d1d446d3a1896
|
||||
FirebaseAuth: 613c463cb43545a7fd2cd99ade09b78ac472c544
|
||||
FirebaseAuthInterop: db06756ef028006d034b6004dc0c37c24f7828d4
|
||||
FirebaseCore: 0e38ad5d62d980a47a64b8e9301ffa311457be04
|
||||
FirebaseCoreExtension: 032fd6f8509e591fda8cb76f6651f20d926b121f
|
||||
FirebaseCoreInternal: 69bf1306a05b8ac43004f6cc1f804bb7b05b229e
|
||||
FirebaseFirestore: 51ce079b9ddcaa481644164eda649d362c2a6396
|
||||
FirebaseFirestoreInternal: 8b1d2b0a1b859b2ddbd63f448c416c5be7367405
|
||||
FirebaseInstallations: 631b38da2e11a83daa4bfb482f79d286a5dfa7ad
|
||||
FirebaseMessaging: a61bc42dcab3f7a346d94bbb54dab2c9435b18b2
|
||||
FirebaseSharedSwift: 79f27fff0addd15c3de19b87fba426f3cc2c964f
|
||||
FirebaseStorage: 550349b1e8f7315834ea08308696e9469d77135d
|
||||
Flutter: cabc95a1d2626b1b06e7179b784ebcf0c0cde467
|
||||
flutter_local_notifications: a5a732f069baa862e728d839dd2ebb904737effb
|
||||
geolocator_apple: ab36aa0e8b7d7a2d7639b3b4e48308394e8cef5e
|
||||
Google-Maps-iOS-Utils: 0a484b05ed21d88c9f9ebbacb007956edd508a96
|
||||
google_maps_flutter_ios: 0291eb2aa252298a769b04d075e4a9d747ff7264
|
||||
google_sign_in_ios: 205742c688aea0e64db9da03c33121694a365109
|
||||
GoogleAdsOnDeviceConversion: d68c69dd9581a0f5da02617b6f377e5be483970f
|
||||
GoogleAppMeasurement: 3bf40aff49a601af5da1c3345702fcb4991d35ee
|
||||
GoogleDataTransport: aae35b7ea0c09004c3797d53c8c41f66f219d6a7
|
||||
GoogleMaps: 0608099d4870cac8754bdba9b6953db543432438
|
||||
GoogleSignIn: c7f09cfbc85a1abf69187be091997c317cc33b77
|
||||
GoogleSignIn: fcee2257188d5eda57a5e2b6a715550ffff9206d
|
||||
GoogleUtilities: 00c88b9a86066ef77f0da2fab05f65d7768ed8e1
|
||||
"gRPC-C++": cc207623316fb041a7a3e774c252cf68a058b9e8
|
||||
gRPC-Core: 860978b7db482de8b4f5e10677216309b5ff6330
|
||||
|
||||
@@ -490,7 +490,11 @@
|
||||
ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
|
||||
CLANG_ENABLE_MODULES = YES;
|
||||
CODE_SIGN_ENTITLEMENTS = Runner/Runner.entitlements;
|
||||
"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Distribution";
|
||||
CODE_SIGN_STYLE = Manual;
|
||||
CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
|
||||
DEVELOPMENT_TEAM = "";
|
||||
"DEVELOPMENT_TEAM[sdk=iphoneos*]" = 456VVYXDFN;
|
||||
ENABLE_BITCODE = NO;
|
||||
INFOPLIST_FILE = Runner/Info.plist;
|
||||
LD_RUNPATH_SEARCH_PATHS = (
|
||||
@@ -499,6 +503,8 @@
|
||||
);
|
||||
PRODUCT_BUNDLE_IDENTIFIER = be.devdayronvl.TravelMate;
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
"PROVISIONING_PROFILE_SPECIFIER[sdk=iphoneos*]" = myiphone;
|
||||
SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
|
||||
SWIFT_VERSION = 5.0;
|
||||
VERSIONING_SYSTEM = "apple-generic";
|
||||
@@ -673,7 +679,11 @@
|
||||
ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
|
||||
CLANG_ENABLE_MODULES = YES;
|
||||
CODE_SIGN_ENTITLEMENTS = Runner/Runner.entitlements;
|
||||
"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Distribution";
|
||||
CODE_SIGN_STYLE = Manual;
|
||||
CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
|
||||
DEVELOPMENT_TEAM = "";
|
||||
"DEVELOPMENT_TEAM[sdk=iphoneos*]" = 456VVYXDFN;
|
||||
ENABLE_BITCODE = NO;
|
||||
INFOPLIST_FILE = Runner/Info.plist;
|
||||
LD_RUNPATH_SEARCH_PATHS = (
|
||||
@@ -682,6 +692,8 @@
|
||||
);
|
||||
PRODUCT_BUNDLE_IDENTIFIER = be.devdayronvl.TravelMate;
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
"PROVISIONING_PROFILE_SPECIFIER[sdk=iphoneos*]" = myiphone;
|
||||
SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
|
||||
SWIFT_OPTIMIZATION_LEVEL = "-Onone";
|
||||
SWIFT_VERSION = 5.0;
|
||||
@@ -696,7 +708,11 @@
|
||||
ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
|
||||
CLANG_ENABLE_MODULES = YES;
|
||||
CODE_SIGN_ENTITLEMENTS = Runner/Runner.entitlements;
|
||||
"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Distribution";
|
||||
CODE_SIGN_STYLE = Manual;
|
||||
CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
|
||||
DEVELOPMENT_TEAM = "";
|
||||
"DEVELOPMENT_TEAM[sdk=iphoneos*]" = 456VVYXDFN;
|
||||
ENABLE_BITCODE = NO;
|
||||
INFOPLIST_FILE = Runner/Info.plist;
|
||||
LD_RUNPATH_SEARCH_PATHS = (
|
||||
@@ -705,6 +721,8 @@
|
||||
);
|
||||
PRODUCT_BUNDLE_IDENTIFIER = be.devdayronvl.TravelMate;
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
"PROVISIONING_PROFILE_SPECIFIER[sdk=iphoneos*]" = myiphone;
|
||||
SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
|
||||
SWIFT_VERSION = 5.0;
|
||||
VERSIONING_SYSTEM = "apple-generic";
|
||||
|
||||
@@ -65,15 +65,11 @@
|
||||
<key>UISupportedInterfaceOrientations</key>
|
||||
<array>
|
||||
<string>UIInterfaceOrientationPortrait</string>
|
||||
<string>UIInterfaceOrientationLandscapeLeft</string>
|
||||
<string>UIInterfaceOrientationLandscapeRight</string>
|
||||
</array>
|
||||
<key>UISupportedInterfaceOrientations~ipad</key>
|
||||
<array>
|
||||
<string>UIInterfaceOrientationPortrait</string>
|
||||
<string>UIInterfaceOrientationPortraitUpsideDown</string>
|
||||
<string>UIInterfaceOrientationLandscapeLeft</string>
|
||||
<string>UIInterfaceOrientationLandscapeRight</string>
|
||||
</array>
|
||||
|
||||
<key>LSApplicationQueriesSchemes</key>
|
||||
|
||||
@@ -174,7 +174,11 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
|
||||
'Erreur recherche activités: $e',
|
||||
stackTrace,
|
||||
);
|
||||
emit(const ActivityError('Impossible de rechercher les activités'));
|
||||
// Extraire le message d'erreur si disponible
|
||||
final errorMessage = e.toString().replaceAll('Exception: ', '');
|
||||
emit(
|
||||
ActivityError('Impossible de rechercher les activités: $errorMessage'),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -26,12 +26,14 @@ import '../../repositories/auth_repository.dart';
|
||||
import 'auth_event.dart';
|
||||
import 'auth_state.dart';
|
||||
import '../../services/notification_service.dart';
|
||||
import '../../services/analytics_service.dart';
|
||||
|
||||
/// BLoC for managing authentication state and operations.
|
||||
class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
/// Repository for authentication operations.
|
||||
final AuthRepository _authRepository;
|
||||
final NotificationService _notificationService;
|
||||
final AnalyticsService _analyticsService;
|
||||
|
||||
/// Creates an [AuthBloc] with the provided [authRepository].
|
||||
///
|
||||
@@ -40,8 +42,10 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
AuthBloc({
|
||||
required AuthRepository authRepository,
|
||||
NotificationService? notificationService,
|
||||
AnalyticsService? analyticsService,
|
||||
}) : _authRepository = authRepository,
|
||||
_notificationService = notificationService ?? NotificationService(),
|
||||
_analyticsService = analyticsService ?? AnalyticsService(),
|
||||
super(AuthInitial()) {
|
||||
on<AuthCheckRequested>(_onAuthCheckRequested);
|
||||
on<AuthSignInRequested>(_onSignInRequested);
|
||||
@@ -76,6 +80,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
if (user != null) {
|
||||
// Save FCM Token on auto-login
|
||||
await _notificationService.saveTokenToFirestore(user.id!);
|
||||
await _analyticsService.setUserId(user.id);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(AuthUnauthenticated());
|
||||
@@ -107,6 +112,11 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
if (user != null) {
|
||||
// Save FCM Token
|
||||
await NotificationService().saveTokenToFirestore(user.id!);
|
||||
await _analyticsService.setUserId(user.id);
|
||||
await _analyticsService.logEvent(
|
||||
name: 'login',
|
||||
parameters: {'method': 'email'},
|
||||
);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(const AuthError(message: 'Invalid email or password'));
|
||||
@@ -138,6 +148,11 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
if (user != null) {
|
||||
// Save FCM Token
|
||||
await NotificationService().saveTokenToFirestore(user.id!);
|
||||
await _analyticsService.setUserId(user.id);
|
||||
await _analyticsService.logEvent(
|
||||
name: 'sign_up',
|
||||
parameters: {'method': 'email'},
|
||||
);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(const AuthError(message: 'Failed to create account'));
|
||||
@@ -163,6 +178,11 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
if (user != null) {
|
||||
// Save FCM Token
|
||||
await NotificationService().saveTokenToFirestore(user.id!);
|
||||
await _analyticsService.setUserId(user.id);
|
||||
await _analyticsService.logEvent(
|
||||
name: 'login',
|
||||
parameters: {'method': 'google'},
|
||||
);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(
|
||||
@@ -191,6 +211,11 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
);
|
||||
|
||||
if (user != null) {
|
||||
await _analyticsService.setUserId(user.id);
|
||||
await _analyticsService.logEvent(
|
||||
name: 'sign_up',
|
||||
parameters: {'method': 'google'},
|
||||
);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(const AuthError(message: 'Failed to create account with Google'));
|
||||
@@ -214,6 +239,11 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
);
|
||||
|
||||
if (user != null) {
|
||||
await _analyticsService.setUserId(user.id);
|
||||
await _analyticsService.logEvent(
|
||||
name: 'sign_up',
|
||||
parameters: {'method': 'apple'},
|
||||
);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(const AuthError(message: 'Failed to create account with Apple'));
|
||||
@@ -239,6 +269,11 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
if (user != null) {
|
||||
// Save FCM Token
|
||||
await NotificationService().saveTokenToFirestore(user.id!);
|
||||
await _analyticsService.setUserId(user.id);
|
||||
await _analyticsService.logEvent(
|
||||
name: 'login',
|
||||
parameters: {'method': 'apple'},
|
||||
);
|
||||
emit(AuthAuthenticated(user: user));
|
||||
} else {
|
||||
emit(
|
||||
@@ -261,6 +296,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
|
||||
Emitter<AuthState> emit,
|
||||
) async {
|
||||
await _authRepository.signOut();
|
||||
await _analyticsService.setUserId(null); // Clear user ID
|
||||
emit(AuthUnauthenticated());
|
||||
}
|
||||
|
||||
|
||||
@@ -1,6 +1,8 @@
|
||||
import 'package:flutter_bloc/flutter_bloc.dart';
|
||||
import 'package:firebase_auth/firebase_auth.dart';
|
||||
import 'package:cloud_firestore/cloud_firestore.dart';
|
||||
|
||||
import 'package:travel_mate/repositories/group_repository.dart';
|
||||
import 'package:travel_mate/services/notification_service.dart';
|
||||
import 'package:travel_mate/services/logger_service.dart';
|
||||
import 'package:travel_mate/services/error_service.dart';
|
||||
@@ -19,6 +21,8 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
|
||||
/// Firestore instance for user data operations.
|
||||
final FirebaseFirestore _firestore = FirebaseFirestore.instance;
|
||||
|
||||
final GroupRepository _groupRepository = GroupRepository();
|
||||
|
||||
final _errorService = ErrorService();
|
||||
|
||||
/// Creates a new [UserBloc] with initial state.
|
||||
@@ -164,6 +168,16 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
|
||||
});
|
||||
|
||||
emit(state.UserLoaded(updatedUser));
|
||||
|
||||
// Propager les changements aux groupes
|
||||
await _groupRepository.updateMemberDetails(
|
||||
userId: currentUser.id,
|
||||
firstName: event
|
||||
.userData['prenom'], // 'prenom' dans Firestore map map to firstName usually? Wait, UserModel has prenom/nom.
|
||||
lastName: event.userData['nom'],
|
||||
profilePictureUrl: event
|
||||
.userData['profilePictureUrl'], // Key was 'profilePictureUrl' in ProfileContent
|
||||
);
|
||||
} catch (e, stackTrace) {
|
||||
_errorService.logError(
|
||||
'UserBloc',
|
||||
|
||||
@@ -18,6 +18,7 @@
|
||||
///
|
||||
/// The component automatically loads account data when initialized and
|
||||
/// provides a clean interface for managing group-based expenses.
|
||||
///
|
||||
library;
|
||||
|
||||
import 'package:flutter/material.dart';
|
||||
|
||||
@@ -85,6 +85,18 @@ class AddExpenseDialog extends StatefulWidget {
|
||||
/// The expense to edit (null for new expense).
|
||||
final Expense? expenseToEdit;
|
||||
|
||||
/// Optional initial category for a new expense.
|
||||
final ExpenseCategory? initialCategory;
|
||||
|
||||
/// Optional initial amount for a new expense.
|
||||
final double? initialAmount;
|
||||
|
||||
/// Optional initial splits (userId -> amount) for a new expense.
|
||||
final Map<String, double>? initialSplits;
|
||||
|
||||
/// Optional initial description for a new expense.
|
||||
final String? initialDescription;
|
||||
|
||||
/// Creates an AddExpenseDialog.
|
||||
///
|
||||
/// [group] is the group for the expense.
|
||||
@@ -95,6 +107,10 @@ class AddExpenseDialog extends StatefulWidget {
|
||||
required this.group,
|
||||
required this.currentUser,
|
||||
this.expenseToEdit,
|
||||
this.initialCategory,
|
||||
this.initialAmount,
|
||||
this.initialSplits,
|
||||
this.initialDescription,
|
||||
});
|
||||
|
||||
@override
|
||||
@@ -146,7 +162,10 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
|
||||
super.initState();
|
||||
// Initialize form fields and splits based on whether editing or creating
|
||||
_selectedDate = widget.expenseToEdit?.date ?? DateTime.now();
|
||||
_selectedCategory = widget.expenseToEdit?.category ?? ExpenseCategory.other;
|
||||
_selectedCategory =
|
||||
widget.expenseToEdit?.category ??
|
||||
widget.initialCategory ??
|
||||
ExpenseCategory.other;
|
||||
_selectedCurrency = widget.expenseToEdit?.currency ?? ExpenseCurrency.eur;
|
||||
_paidById = widget.expenseToEdit?.paidById ?? widget.currentUser.id;
|
||||
|
||||
@@ -159,12 +178,35 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
|
||||
}
|
||||
_splitEqually = false;
|
||||
} else {
|
||||
// Creating: initialize splits for all group members
|
||||
// Creating: initialize splits
|
||||
if (widget.initialDescription != null) {
|
||||
_descriptionController.text = widget.initialDescription!;
|
||||
}
|
||||
|
||||
if (widget.initialAmount != null) {
|
||||
_amountController.text = widget.initialAmount.toString();
|
||||
}
|
||||
|
||||
if (widget.initialSplits != null) {
|
||||
_splits.addAll(widget.initialSplits!);
|
||||
// Fill remaining members with 0 if not in initialSplits
|
||||
for (final member in widget.group.members) {
|
||||
if (!_splits.containsKey(member.userId)) {
|
||||
_splits[member.userId] = 0;
|
||||
} else {
|
||||
// If we have specific splits, we probably aren't splitting equally by default logic
|
||||
// unless we want to force it. For reimbursement, we likely set exact amounts.
|
||||
_splitEqually = false;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Default behavior: initialize splits for all group members
|
||||
for (final member in widget.group.members) {
|
||||
_splits[member.userId] = 0;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@override
|
||||
void dispose() {
|
||||
|
||||
@@ -6,7 +6,13 @@
|
||||
library;
|
||||
|
||||
import 'package:flutter/material.dart';
|
||||
import 'package:provider/provider.dart';
|
||||
import '../../blocs/user/user_bloc.dart';
|
||||
import '../../blocs/user/user_state.dart' as user_state;
|
||||
import '../../models/expense.dart';
|
||||
import '../../models/group.dart';
|
||||
import '../../models/user_balance.dart';
|
||||
import 'add_expense_dialog.dart';
|
||||
|
||||
/// A stateless widget that displays a list of user balances in a group.
|
||||
///
|
||||
@@ -18,21 +24,19 @@ class BalancesTab extends StatelessWidget {
|
||||
/// The list of user balances to display.
|
||||
final List<UserBalance> balances;
|
||||
|
||||
/// The group associated with these balances.
|
||||
final Group group;
|
||||
|
||||
/// Creates a `BalancesTab` widget.
|
||||
///
|
||||
/// The [balances] parameter must not be null.
|
||||
const BalancesTab({
|
||||
super.key,
|
||||
required this.balances,
|
||||
});
|
||||
const BalancesTab({super.key, required this.balances, required this.group});
|
||||
|
||||
@override
|
||||
Widget build(BuildContext context) {
|
||||
// Check if the balances list is empty and display a placeholder message if true.
|
||||
if (balances.isEmpty) {
|
||||
return const Center(
|
||||
child: Text('Aucune balance à afficher'),
|
||||
);
|
||||
return const Center(child: Text('Aucune balance à afficher'));
|
||||
}
|
||||
|
||||
// Render the list of balances as a scrollable list.
|
||||
@@ -79,7 +83,9 @@ class BalancesTab extends StatelessWidget {
|
||||
margin: const EdgeInsets.only(bottom: 12),
|
||||
child: Padding(
|
||||
padding: const EdgeInsets.all(16),
|
||||
child: Row(
|
||||
child: Column(
|
||||
children: [
|
||||
Row(
|
||||
children: [
|
||||
// Display the user's initial in a circular avatar.
|
||||
CircleAvatar(
|
||||
@@ -144,15 +150,81 @@ class BalancesTab extends StatelessWidget {
|
||||
// Text indicating the balance status (e.g., "À recevoir").
|
||||
Text(
|
||||
balanceText,
|
||||
style: TextStyle(
|
||||
fontSize: 12,
|
||||
color: balanceColor,
|
||||
),
|
||||
style: TextStyle(fontSize: 12, color: balanceColor),
|
||||
),
|
||||
],
|
||||
),
|
||||
],
|
||||
),
|
||||
// "Rembourser" button (Only show if this user is owed money and current user is looking at list?
|
||||
// Wait, this list shows balances of everyone.
|
||||
// Requirement: "Il faut un bouton dans la page qui permet de régler l'argent qu'on doit à une certaine personne"
|
||||
// So if I look at "Alice", and Alice "shouldReceive" (is green), it implies the group owes Alice.
|
||||
// But does it mean *I* owe Alice?
|
||||
// The BalancesTab shows the *Group's* balances.
|
||||
// However, usually settlement is 1-on-1. The requirement says: "régler l'argent qu'on doit à une certaine personne".
|
||||
// If the user displayed here 'shouldReceive' money, it means they are owed money.
|
||||
// If I click 'Rembourser', it implies *I* am paying them.
|
||||
// This button should probably be available if the user on the card is POSITIVE (shouldReceive)
|
||||
// AND I am not that user.
|
||||
if (balance.shouldReceive) ...[
|
||||
const SizedBox(height: 12),
|
||||
SizedBox(
|
||||
width: double.infinity,
|
||||
child: OutlinedButton.icon(
|
||||
onPressed: () => _showReimbursementDialog(context, balance),
|
||||
icon: const Icon(Icons.monetization_on_outlined),
|
||||
label: Text('Rembourser ${balance.userName}'),
|
||||
style: OutlinedButton.styleFrom(
|
||||
foregroundColor: Colors.green,
|
||||
side: const BorderSide(color: Colors.green),
|
||||
),
|
||||
),
|
||||
),
|
||||
],
|
||||
],
|
||||
),
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
void _showReimbursementDialog(
|
||||
BuildContext context,
|
||||
UserBalance payeeBalance,
|
||||
) {
|
||||
final userState = context.read<UserBloc>().state;
|
||||
|
||||
if (userState is! user_state.UserLoaded) {
|
||||
ScaffoldMessenger.of(context).showSnackBar(
|
||||
const SnackBar(content: Text('Erreur: utilisateur non connecté')),
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
final currentUser = userState.user;
|
||||
|
||||
// Prevent reimbursing yourself
|
||||
if (payeeBalance.userId == currentUser.id) {
|
||||
ScaffoldMessenger.of(context).showSnackBar(
|
||||
const SnackBar(
|
||||
content: Text('Vous ne pouvez pas vous rembourser vous-même'),
|
||||
),
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
showDialog(
|
||||
context: context,
|
||||
builder: (context) => AddExpenseDialog(
|
||||
group: group,
|
||||
currentUser: currentUser,
|
||||
initialCategory: ExpenseCategory.reimbursement,
|
||||
initialDescription: 'Remboursement',
|
||||
initialAmount: payeeBalance.absoluteBalance,
|
||||
initialSplits: {
|
||||
payeeBalance.userId: payeeBalance
|
||||
.absoluteBalance, // The payee receives the full amount (as split)
|
||||
},
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
@@ -194,6 +194,8 @@ class ExpensesTab extends StatelessWidget {
|
||||
return Colors.teal;
|
||||
case ExpenseCategory.other:
|
||||
return Colors.grey;
|
||||
case ExpenseCategory.reimbursement:
|
||||
return Colors.green;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -80,14 +80,7 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
|
||||
icon: const Icon(Icons.arrow_back),
|
||||
onPressed: () => Navigator.pop(context),
|
||||
),
|
||||
actions: [
|
||||
IconButton(
|
||||
icon: const Icon(Icons.filter_list),
|
||||
onPressed: () {
|
||||
_showFilterDialog();
|
||||
},
|
||||
),
|
||||
],
|
||||
actions: [],
|
||||
),
|
||||
body: MultiBlocListener(
|
||||
listeners: [
|
||||
@@ -193,7 +186,10 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
|
||||
if (state is BalanceLoading) {
|
||||
return const Center(child: CircularProgressIndicator());
|
||||
} else if (state is GroupBalancesLoaded) {
|
||||
return BalancesTab(balances: state.balances);
|
||||
return BalancesTab(
|
||||
balances: state.balances,
|
||||
group: widget.group,
|
||||
);
|
||||
} else if (state is BalanceError) {
|
||||
return _buildErrorState('Erreur: ${state.message}');
|
||||
}
|
||||
@@ -390,96 +386,4 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
|
||||
ErrorService().showError(message: 'Erreur: utilisateur non connecté');
|
||||
}
|
||||
}
|
||||
|
||||
void _showFilterDialog() {
|
||||
showDialog(
|
||||
context: context,
|
||||
builder: (context) {
|
||||
return StatefulBuilder(
|
||||
builder: (context, setState) {
|
||||
return AlertDialog(
|
||||
title: const Text('Filtrer les dépenses'),
|
||||
content: Column(
|
||||
mainAxisSize: MainAxisSize.min,
|
||||
children: [
|
||||
DropdownButtonFormField<ExpenseCategory>(
|
||||
// ignore: deprecated_member_use
|
||||
value: _selectedCategory,
|
||||
decoration: const InputDecoration(
|
||||
labelText: 'Catégorie',
|
||||
border: OutlineInputBorder(),
|
||||
),
|
||||
items: [
|
||||
const DropdownMenuItem<ExpenseCategory>(
|
||||
value: null,
|
||||
child: Text('Toutes'),
|
||||
),
|
||||
...ExpenseCategory.values.map((category) {
|
||||
return DropdownMenuItem(
|
||||
value: category,
|
||||
child: Text(category.displayName),
|
||||
);
|
||||
}),
|
||||
],
|
||||
onChanged: (value) {
|
||||
setState(() => _selectedCategory = value);
|
||||
},
|
||||
),
|
||||
const SizedBox(height: 16),
|
||||
DropdownButtonFormField<String>(
|
||||
// ignore: deprecated_member_use
|
||||
value: _selectedPayerId,
|
||||
decoration: const InputDecoration(
|
||||
labelText: 'Payé par',
|
||||
border: OutlineInputBorder(),
|
||||
),
|
||||
items: [
|
||||
const DropdownMenuItem<String>(
|
||||
value: null,
|
||||
child: Text('Tous'),
|
||||
),
|
||||
...widget.group.members.map((member) {
|
||||
return DropdownMenuItem(
|
||||
value: member.userId,
|
||||
child: Text(member.firstName),
|
||||
);
|
||||
}),
|
||||
],
|
||||
onChanged: (value) {
|
||||
setState(() => _selectedPayerId = value);
|
||||
},
|
||||
),
|
||||
],
|
||||
),
|
||||
actions: [
|
||||
TextButton(
|
||||
onPressed: () {
|
||||
setState(() {
|
||||
_selectedCategory = null;
|
||||
_selectedPayerId = null;
|
||||
});
|
||||
// Also update parent state
|
||||
this.setState(() {
|
||||
_selectedCategory = null;
|
||||
_selectedPayerId = null;
|
||||
});
|
||||
Navigator.pop(context);
|
||||
},
|
||||
child: const Text('Réinitialiser'),
|
||||
),
|
||||
ElevatedButton(
|
||||
onPressed: () {
|
||||
// Update parent state
|
||||
this.setState(() {});
|
||||
Navigator.pop(context);
|
||||
},
|
||||
child: const Text('Appliquer'),
|
||||
),
|
||||
],
|
||||
);
|
||||
},
|
||||
);
|
||||
},
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -7,12 +7,15 @@ import '../../blocs/activity/activity_state.dart';
|
||||
import '../../models/trip.dart';
|
||||
import '../../models/activity.dart';
|
||||
import '../../services/activity_cache_service.dart';
|
||||
import '../../services/activity_places_service.dart';
|
||||
import 'dart:async';
|
||||
|
||||
import '../loading/laoding_content.dart';
|
||||
import '../../blocs/user/user_bloc.dart';
|
||||
import '../../blocs/user/user_state.dart';
|
||||
import '../../services/error_service.dart';
|
||||
import 'activity_detail_dialog.dart';
|
||||
import 'package:geolocator/geolocator.dart';
|
||||
|
||||
class ActivitiesPage extends StatefulWidget {
|
||||
final Trip trip;
|
||||
@@ -38,6 +41,14 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
List<Activity> _approvedActivities = [];
|
||||
bool _isLoadingTripActivities = false;
|
||||
|
||||
// Autocomplete variables
|
||||
List<Map<String, String>> _suggestions = [];
|
||||
final LayerLink _layerLink = LayerLink();
|
||||
OverlayEntry? _overlayEntry;
|
||||
final FocusNode _searchFocusNode = FocusNode();
|
||||
Timer? _debounceTimer;
|
||||
bool _isLoadingSuggestions = false;
|
||||
|
||||
bool _autoReloadInProgress =
|
||||
false; // Protection contre les rechargements en boucle
|
||||
int _lastAutoReloadTriggerCount =
|
||||
@@ -104,6 +115,9 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
void dispose() {
|
||||
_tabController.dispose();
|
||||
_searchController.dispose();
|
||||
_searchFocusNode.dispose();
|
||||
_debounceTimer?.cancel();
|
||||
_hideSuggestions();
|
||||
super.dispose();
|
||||
}
|
||||
|
||||
@@ -277,9 +291,13 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
}
|
||||
|
||||
Widget _buildSearchBar(ThemeData theme) {
|
||||
return Container(
|
||||
padding: const EdgeInsets.all(16),
|
||||
return CompositedTransformTarget(
|
||||
link: _layerLink,
|
||||
child: Container(
|
||||
padding: const EdgeInsets.all(16),
|
||||
child: Column(
|
||||
children: [
|
||||
Container(
|
||||
decoration: BoxDecoration(
|
||||
color: theme.colorScheme.surfaceContainerHighest.withValues(
|
||||
alpha: 0.3,
|
||||
@@ -288,6 +306,7 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
),
|
||||
child: TextField(
|
||||
controller: _searchController,
|
||||
focusNode: _searchFocusNode,
|
||||
decoration: InputDecoration(
|
||||
hintText: 'Rechercher restaurants, musées...',
|
||||
hintStyle: TextStyle(
|
||||
@@ -302,17 +321,174 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
horizontal: 16,
|
||||
vertical: 12,
|
||||
),
|
||||
suffixIcon: _isLoadingSuggestions
|
||||
? const SizedBox(
|
||||
width: 20,
|
||||
height: 20,
|
||||
child: Padding(
|
||||
padding: EdgeInsets.all(10.0),
|
||||
child: CircularProgressIndicator(strokeWidth: 2),
|
||||
),
|
||||
)
|
||||
: null,
|
||||
),
|
||||
onChanged: _onSearchChanged,
|
||||
onSubmitted: (value) {
|
||||
_hideSuggestions();
|
||||
if (value.isNotEmpty) {
|
||||
_performSearch(value);
|
||||
}
|
||||
},
|
||||
),
|
||||
),
|
||||
],
|
||||
),
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
void _onSearchChanged(String value) {
|
||||
if (_debounceTimer?.isActive ?? false) _debounceTimer!.cancel();
|
||||
|
||||
if (value.isEmpty) {
|
||||
_hideSuggestions();
|
||||
return;
|
||||
}
|
||||
|
||||
_debounceTimer = Timer(const Duration(milliseconds: 300), () async {
|
||||
setState(() {
|
||||
_isLoadingSuggestions = true;
|
||||
});
|
||||
|
||||
try {
|
||||
final suggestions = await ActivityPlacesService().fetchSuggestions(
|
||||
query: value,
|
||||
lat: widget.trip.latitude,
|
||||
lng: widget.trip.longitude,
|
||||
);
|
||||
|
||||
if (mounted) {
|
||||
setState(() {
|
||||
_suggestions = suggestions;
|
||||
_isLoadingSuggestions = false;
|
||||
});
|
||||
|
||||
if (_suggestions.isNotEmpty) {
|
||||
_showSuggestions();
|
||||
} else {
|
||||
_hideSuggestions();
|
||||
}
|
||||
}
|
||||
} catch (e) {
|
||||
if (mounted) {
|
||||
setState(() {
|
||||
_isLoadingSuggestions = false;
|
||||
});
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
void _showSuggestions() {
|
||||
_overlayEntry?.remove();
|
||||
_overlayEntry = _createOverlayEntry();
|
||||
Overlay.of(context).insert(_overlayEntry!);
|
||||
}
|
||||
|
||||
void _hideSuggestions() {
|
||||
_overlayEntry?.remove();
|
||||
_overlayEntry = null;
|
||||
}
|
||||
|
||||
OverlayEntry _createOverlayEntry() {
|
||||
final renderBox = context.findRenderObject() as RenderBox;
|
||||
final theme = Theme.of(context);
|
||||
final size = renderBox.size;
|
||||
final width = size.width - 32; // padding 16 * 2
|
||||
|
||||
return OverlayEntry(
|
||||
builder: (context) => Positioned(
|
||||
width: width,
|
||||
child: CompositedTransformFollower(
|
||||
link: _layerLink,
|
||||
showWhenUnlinked: false,
|
||||
offset: const Offset(16, 80), // Adjust vertical offset
|
||||
child: Material(
|
||||
elevation: 4,
|
||||
borderRadius: BorderRadius.circular(12),
|
||||
color: theme.colorScheme.surface,
|
||||
child: ConstrainedBox(
|
||||
constraints: const BoxConstraints(maxHeight: 250),
|
||||
child: ListView.separated(
|
||||
padding: EdgeInsets.zero,
|
||||
shrinkWrap: true,
|
||||
itemCount: _suggestions.length,
|
||||
separatorBuilder: (context, index) => const Divider(height: 1),
|
||||
itemBuilder: (context, index) {
|
||||
final suggestion = _suggestions[index];
|
||||
return ListTile(
|
||||
leading: const Icon(Icons.location_on_outlined),
|
||||
title: Text(
|
||||
suggestion['description'] ?? '',
|
||||
maxLines: 2,
|
||||
overflow: TextOverflow.ellipsis,
|
||||
),
|
||||
onTap: () {
|
||||
_selectSuggestion(suggestion);
|
||||
},
|
||||
);
|
||||
},
|
||||
),
|
||||
),
|
||||
),
|
||||
),
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
Future<void> _selectSuggestion(Map<String, String> suggestion) async {
|
||||
_hideSuggestions();
|
||||
_searchController.text = suggestion['description']!;
|
||||
_searchFocusNode.unfocus();
|
||||
|
||||
// Passer à l'onglet "Suggestion" si ce n'est pas déjà fait
|
||||
if (_tabController.index != 2) {
|
||||
_tabController.animateTo(2);
|
||||
}
|
||||
|
||||
// Charger l'activité spécifique via le Bloc ou Service
|
||||
// Ici on va utiliser le Bloc pour ajouter l'activité aux résultats de recherche
|
||||
// Pour ça, il faudrait idéalement un événement "LoadSingleActivity" dans le Bloc
|
||||
// Mais pour faire simple et rapide, on peut faire une recherche "exacte" ou hack:
|
||||
// On charge l'activité manuellement et on l'ajoute comme si c'était un résultat de recherche.
|
||||
|
||||
setState(() {
|
||||
_isLoadingSuggestions = true;
|
||||
});
|
||||
|
||||
try {
|
||||
final activity = await ActivityPlacesService().getActivityByPlaceId(
|
||||
placeId: suggestion['placeId']!,
|
||||
tripId: widget.trip.id!,
|
||||
);
|
||||
|
||||
if (mounted && activity != null) {
|
||||
// Injecter ce résultat unique dans le Bloc
|
||||
context.read<ActivityBloc>().add(
|
||||
RestoreCachedSearchResults(searchResults: [activity]),
|
||||
);
|
||||
}
|
||||
} catch (e) {
|
||||
ErrorService().showError(message: "Impossible de charger l'activité");
|
||||
} finally {
|
||||
if (mounted) {
|
||||
setState(() {
|
||||
_isLoadingSuggestions = false;
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Widget _buildCategoryTabs(ThemeData theme) {
|
||||
return Container(
|
||||
padding: const EdgeInsets.all(16),
|
||||
@@ -637,6 +813,23 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
activity.name.toLowerCase().trim(),
|
||||
);
|
||||
|
||||
// Calculer la distance si c'est une suggestion Google et que le voyage a des coordonnées
|
||||
double? distanceInKm;
|
||||
if (isGoogleSuggestion &&
|
||||
widget.trip.hasCoordinates &&
|
||||
activity.latitude != null &&
|
||||
activity.longitude != null) {
|
||||
final distanceInMeters = Geolocator.distanceBetween(
|
||||
widget.trip.latitude!,
|
||||
widget.trip.longitude!,
|
||||
activity.latitude!,
|
||||
activity.longitude!,
|
||||
);
|
||||
distanceInKm = distanceInMeters / 1000;
|
||||
}
|
||||
|
||||
final isFar = distanceInKm != null && distanceInKm > 50;
|
||||
|
||||
return GestureDetector(
|
||||
onTap: () {
|
||||
showDialog(
|
||||
@@ -709,6 +902,40 @@ class _ActivitiesPageState extends State<ActivitiesPage>
|
||||
child: Column(
|
||||
crossAxisAlignment: CrossAxisAlignment.start,
|
||||
children: [
|
||||
if (isFar)
|
||||
Container(
|
||||
margin: const EdgeInsets.only(bottom: 12),
|
||||
padding: const EdgeInsets.symmetric(
|
||||
horizontal: 12,
|
||||
vertical: 8,
|
||||
),
|
||||
decoration: BoxDecoration(
|
||||
color: theme.colorScheme.errorContainer,
|
||||
borderRadius: BorderRadius.circular(8),
|
||||
border: Border.all(
|
||||
color: theme.colorScheme.error.withValues(alpha: 0.5),
|
||||
),
|
||||
),
|
||||
child: Row(
|
||||
children: [
|
||||
Icon(
|
||||
Icons.warning_amber_rounded,
|
||||
color: theme.colorScheme.error,
|
||||
size: 20,
|
||||
),
|
||||
const SizedBox(width: 8),
|
||||
Expanded(
|
||||
child: Text(
|
||||
'Activité éloignée : ${distanceInKm!.toStringAsFixed(0)} km du lieu du voyage',
|
||||
style: theme.textTheme.bodySmall?.copyWith(
|
||||
color: theme.colorScheme.onErrorContainer,
|
||||
fontWeight: FontWeight.w600,
|
||||
),
|
||||
),
|
||||
),
|
||||
],
|
||||
),
|
||||
),
|
||||
Row(
|
||||
children: [
|
||||
// Icône de catégorie
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
import 'dart:io';
|
||||
import 'dart:convert';
|
||||
import 'package:flutter/material.dart';
|
||||
import 'package:flutter_bloc/flutter_bloc.dart';
|
||||
@@ -23,6 +24,7 @@ import 'package:flutter_dotenv/flutter_dotenv.dart';
|
||||
import '../../services/place_image_service.dart';
|
||||
import '../../services/trip_geocoding_service.dart';
|
||||
import '../../services/logger_service.dart';
|
||||
import '../../firebase_options.dart';
|
||||
|
||||
/// Create trip content widget for trip creation and editing functionality.
|
||||
///
|
||||
@@ -84,7 +86,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
|
||||
String? _selectedImageUrl;
|
||||
|
||||
/// Google Maps API key for location services
|
||||
static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
static String get _apiKey {
|
||||
return DefaultFirebaseOptions.currentPlatform.apiKey;
|
||||
}
|
||||
|
||||
/// Participant management
|
||||
final List<String> _participants = [];
|
||||
@@ -123,7 +127,11 @@ class _CreateTripContentState extends State<CreateTripContent> {
|
||||
}
|
||||
}
|
||||
|
||||
bool _isProgrammaticUpdate = false;
|
||||
|
||||
void _onLocationChanged() {
|
||||
if (_isProgrammaticUpdate) return;
|
||||
|
||||
final query = _locationController.text.trim();
|
||||
|
||||
if (query.length < 2) {
|
||||
@@ -203,15 +211,18 @@ class _CreateTripContentState extends State<CreateTripContent> {
|
||||
|
||||
if (_placeSuggestions.isEmpty) return;
|
||||
|
||||
final overlay = Overlay.of(context);
|
||||
|
||||
// Calculer la largeur correcte en fonction du padding parent (16 margin + 24 padding = 40 de chaque côté)
|
||||
final width = MediaQuery.of(context).size.width - 80;
|
||||
|
||||
_suggestionsOverlay = OverlayEntry(
|
||||
builder: (context) => Positioned(
|
||||
width:
|
||||
MediaQuery.of(context).size.width -
|
||||
32, // Largeur du champ avec padding
|
||||
width: width,
|
||||
child: CompositedTransformFollower(
|
||||
link: _layerLink,
|
||||
showWhenUnlinked: false,
|
||||
offset: const Offset(0, 60), // Position sous le champ
|
||||
targetAnchor: Alignment.bottomLeft,
|
||||
child: Material(
|
||||
elevation: 4,
|
||||
borderRadius: BorderRadius.circular(8),
|
||||
@@ -224,6 +235,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
|
||||
),
|
||||
child: ListView.builder(
|
||||
shrinkWrap: true,
|
||||
padding: EdgeInsets.zero,
|
||||
itemCount: _placeSuggestions.length,
|
||||
itemBuilder: (context, index) {
|
||||
final suggestion = _placeSuggestions[index];
|
||||
@@ -244,7 +256,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
|
||||
),
|
||||
);
|
||||
|
||||
Overlay.of(context).insert(_suggestionsOverlay!);
|
||||
overlay.insert(_suggestionsOverlay!);
|
||||
}
|
||||
|
||||
void _hideSuggestions() {
|
||||
@@ -253,7 +265,10 @@ class _CreateTripContentState extends State<CreateTripContent> {
|
||||
}
|
||||
|
||||
void _selectSuggestion(PlaceSuggestion suggestion) {
|
||||
_isProgrammaticUpdate = true;
|
||||
_locationController.text = suggestion.description;
|
||||
_isProgrammaticUpdate = false;
|
||||
|
||||
_hideSuggestions();
|
||||
setState(() {
|
||||
_placeSuggestions = [];
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
import 'package:flutter/material.dart';
|
||||
import 'package:flutter/services.dart';
|
||||
|
||||
import 'package:flutter_bloc/flutter_bloc.dart';
|
||||
import 'package:travel_mate/blocs/trip/trip_bloc.dart';
|
||||
@@ -26,6 +25,8 @@ import 'package:travel_mate/blocs/activity/activity_state.dart';
|
||||
import 'package:travel_mate/blocs/balance/balance_bloc.dart';
|
||||
import 'package:travel_mate/blocs/balance/balance_event.dart';
|
||||
import 'package:travel_mate/blocs/balance/balance_state.dart';
|
||||
import 'package:travel_mate/blocs/group/group_bloc.dart';
|
||||
import 'package:travel_mate/blocs/group/group_event.dart';
|
||||
|
||||
import 'package:travel_mate/blocs/user/user_bloc.dart';
|
||||
import 'package:travel_mate/blocs/user/user_state.dart' as user_state;
|
||||
@@ -641,36 +642,18 @@ class _ShowTripDetailsContentState extends State<ShowTripDetailsContent> {
|
||||
),
|
||||
const Divider(),
|
||||
],
|
||||
if (!isCreator)
|
||||
ListTile(
|
||||
leading: Icon(
|
||||
Icons.share,
|
||||
color: theme.colorScheme.onSurface,
|
||||
),
|
||||
leading: Icon(Icons.exit_to_app, color: Colors.red[400]),
|
||||
title: Text(
|
||||
'Partager le code',
|
||||
'Quitter le voyage',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: theme.colorScheme.onSurface,
|
||||
color: Colors.red[400],
|
||||
),
|
||||
),
|
||||
onTap: () {
|
||||
Navigator.pop(context);
|
||||
// Implement share functionality
|
||||
if (_group != null) {
|
||||
// Use share_plus package to share the code
|
||||
ScaffoldMessenger.of(context).showSnackBar(
|
||||
SnackBar(
|
||||
content: Text('ID du groupe : ${_group!.id}'),
|
||||
action: SnackBarAction(
|
||||
label: 'Copier',
|
||||
onPressed: () {
|
||||
Clipboard.setData(
|
||||
ClipboardData(text: _group!.id),
|
||||
);
|
||||
},
|
||||
),
|
||||
),
|
||||
);
|
||||
}
|
||||
_handleLeaveTrip(currentUser);
|
||||
},
|
||||
),
|
||||
],
|
||||
@@ -682,6 +665,91 @@ class _ShowTripDetailsContentState extends State<ShowTripDetailsContent> {
|
||||
);
|
||||
}
|
||||
|
||||
void _handleLeaveTrip(user_state.UserModel? currentUser) {
|
||||
if (currentUser == null || _group == null) return;
|
||||
|
||||
// Vérifier les dettes
|
||||
final balanceState = context.read<BalanceBloc>().state;
|
||||
if (balanceState is GroupBalancesLoaded) {
|
||||
final myBalance = balanceState.balances.firstWhere(
|
||||
(b) => b.userId == currentUser.id,
|
||||
orElse: () => const UserBalance(
|
||||
userId: '',
|
||||
userName: '',
|
||||
totalPaid: 0,
|
||||
totalOwed: 0,
|
||||
balance: 0,
|
||||
),
|
||||
);
|
||||
|
||||
// Tolérance pour les arrondis (0.01€)
|
||||
if (myBalance.balance.abs() > 0.01) {
|
||||
_errorService.showError(
|
||||
message:
|
||||
'Vous devez régler vos dettes (ou récupérer votre argent) avant de quitter le voyage. Solde: ${myBalance.formattedBalance}',
|
||||
);
|
||||
return;
|
||||
}
|
||||
|
||||
_confirmLeaveTrip(currentUser.id);
|
||||
} else {
|
||||
// Si les balances ne sont pas chargées, on essaie de les charger et on demande de rééssayer
|
||||
context.read<BalanceBloc>().add(LoadGroupBalances(_group!.id));
|
||||
_errorService.showError(
|
||||
message:
|
||||
'Impossible de vérifier votre solde. Veuillez réessayer dans un instant.',
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
void _confirmLeaveTrip(String userId) {
|
||||
final theme = Theme.of(context);
|
||||
|
||||
showDialog(
|
||||
context: context,
|
||||
builder: (context) => AlertDialog(
|
||||
backgroundColor:
|
||||
theme.dialogTheme.backgroundColor ?? theme.colorScheme.surface,
|
||||
title: Text(
|
||||
'Quitter le voyage',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
color: theme.colorScheme.onSurface,
|
||||
),
|
||||
),
|
||||
content: Text(
|
||||
'Êtes-vous sûr de vouloir quitter ce voyage ? Vous ne pourrez plus voir les détails ni les dépenses.',
|
||||
style: theme.textTheme.bodyMedium?.copyWith(
|
||||
color: theme.colorScheme.onSurface,
|
||||
),
|
||||
),
|
||||
actions: [
|
||||
TextButton(
|
||||
onPressed: () => Navigator.pop(context),
|
||||
child: Text(
|
||||
'Annuler',
|
||||
style: TextStyle(color: theme.colorScheme.primary),
|
||||
),
|
||||
),
|
||||
TextButton(
|
||||
onPressed: () {
|
||||
Navigator.pop(context); // Fermer le dialog
|
||||
|
||||
if (_group != null) {
|
||||
context.read<GroupBloc>().add(
|
||||
RemoveMemberFromGroup(_group!.id, userId),
|
||||
);
|
||||
|
||||
// Retourner à l'écran d'accueil
|
||||
Navigator.pop(context);
|
||||
}
|
||||
},
|
||||
child: const Text('Quitter', style: TextStyle(color: Colors.red)),
|
||||
),
|
||||
],
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
void _confirmDeleteTrip() {
|
||||
final theme = Theme.of(context);
|
||||
|
||||
|
||||
@@ -41,12 +41,9 @@ class _TripCardState extends State<TripCard> {
|
||||
});
|
||||
|
||||
try {
|
||||
// D'abord vérifier si une image existe déjà dans le Storage
|
||||
String? imageUrl = await _placeImageService.getExistingImageUrl(
|
||||
widget.trip.location,
|
||||
);
|
||||
|
||||
// Si aucune image n'existe, en télécharger une nouvelle
|
||||
imageUrl ??= await _placeImageService.getPlaceImageUrl(
|
||||
widget.trip.location,
|
||||
);
|
||||
@@ -57,7 +54,6 @@ class _TripCardState extends State<TripCard> {
|
||||
_isLoadingImage = false;
|
||||
});
|
||||
|
||||
// Mettre à jour le voyage dans la base de données avec l'imageUrl
|
||||
_updateTripWithImage(imageUrl);
|
||||
} else {
|
||||
setState(() {
|
||||
@@ -76,18 +72,13 @@ class _TripCardState extends State<TripCard> {
|
||||
Future<void> _updateTripWithImage(String imageUrl) async {
|
||||
try {
|
||||
if (widget.trip.id != null) {
|
||||
// Créer une copie du voyage avec la nouvelle imageUrl
|
||||
final updatedTrip = widget.trip.copyWith(
|
||||
imageUrl: imageUrl,
|
||||
updatedAt: DateTime.now(),
|
||||
);
|
||||
|
||||
// Mettre à jour dans la base de données
|
||||
await _tripRepository.updateTrip(widget.trip.id!, updatedTrip);
|
||||
}
|
||||
} catch (e) {
|
||||
// En cas d'erreur, on continue sans échec - l'image reste affichée localement
|
||||
}
|
||||
} catch (e) {}
|
||||
}
|
||||
|
||||
Widget _buildImageWidget() {
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
import 'dart:io';
|
||||
import 'package:flutter/material.dart';
|
||||
import 'package:google_maps_flutter/google_maps_flutter.dart';
|
||||
import 'package:geolocator/geolocator.dart';
|
||||
@@ -5,6 +6,7 @@ import 'dart:convert';
|
||||
import 'package:http/http.dart' as http;
|
||||
import 'dart:ui' as ui;
|
||||
import 'package:flutter_dotenv/flutter_dotenv.dart';
|
||||
import '../../firebase_options.dart';
|
||||
import '../../services/error_service.dart';
|
||||
import '../../services/map_navigation_service.dart';
|
||||
import '../../services/logger_service.dart';
|
||||
@@ -21,6 +23,7 @@ class MapContent extends StatefulWidget {
|
||||
class _MapContentState extends State<MapContent> {
|
||||
GoogleMapController? _mapController;
|
||||
LatLng _initialPosition = const LatLng(48.8566, 2.3522);
|
||||
LatLng? _currentMapCenter;
|
||||
final TextEditingController _searchController = TextEditingController();
|
||||
bool _isLoadingLocation = false;
|
||||
bool _isSearching = false;
|
||||
@@ -31,7 +34,9 @@ class _MapContentState extends State<MapContent> {
|
||||
|
||||
List<PlaceSuggestion> _suggestions = [];
|
||||
|
||||
static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
static String get _apiKey {
|
||||
return DefaultFirebaseOptions.currentPlatform.apiKey;
|
||||
}
|
||||
|
||||
@override
|
||||
void initState() {
|
||||
@@ -309,20 +314,30 @@ class _MapContentState extends State<MapContent> {
|
||||
}
|
||||
}
|
||||
|
||||
// Créer une icône personnalisée à partir de l'icône Material
|
||||
Future<BitmapDescriptor> _createCustomMarkerIcon() async {
|
||||
// Créer une icône personnalisée
|
||||
Future<BitmapDescriptor> _createMarkerIcon(
|
||||
IconData iconData,
|
||||
Color color, {
|
||||
double size = 60.0,
|
||||
}) async {
|
||||
final pictureRecorder = ui.PictureRecorder();
|
||||
final canvas = Canvas(pictureRecorder);
|
||||
const size = 120.0;
|
||||
|
||||
// Dessiner l'icône person_pin_circle en bleu
|
||||
final iconPainter = TextPainter(textDirection: TextDirection.ltr);
|
||||
iconPainter.text = TextSpan(
|
||||
text: String.fromCharCode(Icons.person_pin_circle.codePoint),
|
||||
text: String.fromCharCode(iconData.codePoint),
|
||||
style: TextStyle(
|
||||
fontSize: 100,
|
||||
fontFamily: Icons.person_pin_circle.fontFamily,
|
||||
color: Colors.blue[700],
|
||||
fontSize: size,
|
||||
fontFamily: iconData.fontFamily,
|
||||
package: iconData.fontPackage,
|
||||
color: color,
|
||||
shadows: [
|
||||
Shadow(
|
||||
offset: const Offset(1, 1),
|
||||
blurRadius: 2,
|
||||
color: Colors.black.withValues(alpha: 0.3),
|
||||
),
|
||||
],
|
||||
),
|
||||
);
|
||||
iconPainter.layout();
|
||||
@@ -352,8 +367,12 @@ class _MapContentState extends State<MapContent> {
|
||||
),
|
||||
);
|
||||
|
||||
// Créer l'icône personnalisée
|
||||
final icon = await _createCustomMarkerIcon();
|
||||
// Créer l'icône personnalisée (plus petite: 60 au lieu de 80)
|
||||
final icon = await _createMarkerIcon(
|
||||
Icons.person_pin_circle,
|
||||
Colors.blue[700]!,
|
||||
size: 60.0,
|
||||
);
|
||||
|
||||
// Ajouter le marqueur avec l'icône
|
||||
setState(() {
|
||||
@@ -362,10 +381,7 @@ class _MapContentState extends State<MapContent> {
|
||||
markerId: const MarkerId('user_location'),
|
||||
position: position,
|
||||
icon: icon,
|
||||
anchor: const Offset(
|
||||
0.5,
|
||||
0.85,
|
||||
), // Ancrer au bas de l'icône (le point du pin)
|
||||
anchor: const Offset(0.5, 0.85), // Ancrer au bas de l'icône
|
||||
infoWindow: InfoWindow(
|
||||
title: 'Ma position',
|
||||
snippet:
|
||||
@@ -389,10 +405,21 @@ class _MapContentState extends State<MapContent> {
|
||||
});
|
||||
|
||||
try {
|
||||
final apiKey = _apiKey;
|
||||
LoggerService.info('MapContent: Searching places with query "$query"');
|
||||
if (apiKey.isEmpty) {
|
||||
LoggerService.error('MapContent: API Key is empty!');
|
||||
} else {
|
||||
// Log first few chars to verify correct key is loaded without leaking full key
|
||||
LoggerService.info(
|
||||
'MapContent: Using API Key starting with ${apiKey.substring(0, 5)}...',
|
||||
);
|
||||
}
|
||||
|
||||
final url = Uri.parse(
|
||||
'https://maps.googleapis.com/maps/api/place/autocomplete/json'
|
||||
'?input=${Uri.encodeComponent(query)}'
|
||||
'&key=$_apiKey'
|
||||
'&key=$apiKey'
|
||||
'&language=fr',
|
||||
);
|
||||
|
||||
@@ -400,11 +427,21 @@ class _MapContentState extends State<MapContent> {
|
||||
|
||||
if (!mounted) return;
|
||||
|
||||
LoggerService.info(
|
||||
'MapContent: Response status code: ${response.statusCode}',
|
||||
);
|
||||
|
||||
if (response.statusCode == 200) {
|
||||
final data = json.decode(response.body);
|
||||
final status = data['status'];
|
||||
|
||||
if (data['status'] == 'OK') {
|
||||
LoggerService.info('MapContent: API Status: $status');
|
||||
|
||||
if (status == 'OK') {
|
||||
final predictions = data['predictions'] as List;
|
||||
LoggerService.info(
|
||||
'MapContent: Found ${predictions.length} predictions',
|
||||
);
|
||||
|
||||
setState(() {
|
||||
_suggestions = predictions
|
||||
@@ -418,13 +455,19 @@ class _MapContentState extends State<MapContent> {
|
||||
_isSearching = false;
|
||||
});
|
||||
} else {
|
||||
LoggerService.error(
|
||||
'MapContent: API Error: $status - ${data['error_message'] ?? "No error message"}',
|
||||
);
|
||||
setState(() {
|
||||
_suggestions = [];
|
||||
_isSearching = false;
|
||||
});
|
||||
}
|
||||
} else {
|
||||
LoggerService.error('MapContent: HTTP Error ${response.statusCode}');
|
||||
}
|
||||
} catch (e) {
|
||||
LoggerService.error('MapContent: Exception during search: $e');
|
||||
_showError('Erreur lors de la recherche de lieux: $e');
|
||||
setState(() {
|
||||
_isSearching = false;
|
||||
@@ -432,6 +475,128 @@ class _MapContentState extends State<MapContent> {
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> _performTextSearch(String query) async {
|
||||
if (query.isEmpty) return;
|
||||
|
||||
setState(() {
|
||||
_isSearching = true;
|
||||
_suggestions = []; // Hide suggestions
|
||||
});
|
||||
|
||||
try {
|
||||
final apiKey = _apiKey;
|
||||
// Utiliser le centre actuel de la carte ou la position initiale
|
||||
final center = _currentMapCenter ?? _initialPosition;
|
||||
|
||||
final url = Uri.parse(
|
||||
'https://maps.googleapis.com/maps/api/place/textsearch/json'
|
||||
'?query=${Uri.encodeComponent(query)}'
|
||||
'&location=${center.latitude},${center.longitude}'
|
||||
'&radius=5000' // Rechercher dans un rayon de 5km autour du centre
|
||||
'&key=$apiKey'
|
||||
'&language=fr',
|
||||
);
|
||||
|
||||
final response = await http.get(url);
|
||||
|
||||
if (!mounted) return;
|
||||
|
||||
if (response.statusCode == 200) {
|
||||
final data = json.decode(response.body);
|
||||
|
||||
if (data['status'] == 'OK') {
|
||||
final results = data['results'] as List;
|
||||
final List<Marker> newMarkers = [];
|
||||
|
||||
// Garder le marqueur de position utilisateur
|
||||
final userMarker = _markers
|
||||
.where((m) => m.markerId.value == 'user_location')
|
||||
.toList();
|
||||
|
||||
double minLat = center.latitude;
|
||||
double maxLat = center.latitude;
|
||||
double minLng = center.longitude;
|
||||
double maxLng = center.longitude;
|
||||
|
||||
// Créer le marqueur rouge standard personnalisé
|
||||
final markerIcon = await _createMarkerIcon(
|
||||
Icons.location_on,
|
||||
Colors.red,
|
||||
size: 50.0,
|
||||
);
|
||||
|
||||
for (final place in results) {
|
||||
final geometry = place['geometry']['location'];
|
||||
final lat = geometry['lat'];
|
||||
final lng = geometry['lng'];
|
||||
final name = place['name'];
|
||||
final placeId = place['place_id'];
|
||||
|
||||
final position = LatLng(lat, lng);
|
||||
|
||||
// Mettre à jour les bornes
|
||||
if (lat < minLat) minLat = lat;
|
||||
if (lat > maxLat) maxLat = lat;
|
||||
if (lng < minLng) minLng = lng;
|
||||
if (lng > maxLng) maxLng = lng;
|
||||
|
||||
newMarkers.add(
|
||||
Marker(
|
||||
markerId: MarkerId(placeId),
|
||||
position: position,
|
||||
icon: markerIcon,
|
||||
anchor: const Offset(0.5, 0.85), // Standard anchor for pins
|
||||
infoWindow: InfoWindow(
|
||||
title: name,
|
||||
snippet: place['formatted_address'] ?? 'Lieu trouvé',
|
||||
),
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
setState(() {
|
||||
_markers.clear();
|
||||
if (userMarker.isNotEmpty) {
|
||||
_markers.add(userMarker.first);
|
||||
}
|
||||
_markers.addAll(newMarkers);
|
||||
_isSearching = false;
|
||||
});
|
||||
|
||||
// Ajuster la caméra pour montrer tous les résultats
|
||||
if (newMarkers.isNotEmpty) {
|
||||
_mapController?.animateCamera(
|
||||
CameraUpdate.newLatLngBounds(
|
||||
LatLngBounds(
|
||||
southwest: LatLng(minLat, minLng),
|
||||
northeast: LatLng(maxLat, maxLng),
|
||||
),
|
||||
50.0, // padding
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
FocusScope.of(context).unfocus();
|
||||
} else {
|
||||
_showError('Aucun résultat trouvé pour "$query"');
|
||||
setState(() {
|
||||
_isSearching = false;
|
||||
});
|
||||
}
|
||||
} else {
|
||||
_showError('Erreur lors de la recherche: ${response.statusCode}');
|
||||
setState(() {
|
||||
_isSearching = false;
|
||||
});
|
||||
}
|
||||
} catch (e) {
|
||||
_showError('Erreur lors de la recherche: $e');
|
||||
setState(() {
|
||||
_isSearching = false;
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> _selectPlace(PlaceSuggestion suggestion) async {
|
||||
setState(() {
|
||||
_isSearching = true;
|
||||
@@ -455,13 +620,21 @@ class _MapContentState extends State<MapContent> {
|
||||
final data = json.decode(response.body);
|
||||
|
||||
if (data['status'] == 'OK') {
|
||||
final location = data['result']['geometry']['location'];
|
||||
final result = data['result'];
|
||||
final location = result['geometry']['location'];
|
||||
final lat = location['lat'];
|
||||
final lng = location['lng'];
|
||||
final name = data['result']['name'];
|
||||
final name = result['name'];
|
||||
|
||||
final newPosition = LatLng(lat, lng);
|
||||
|
||||
// Utiliser le marqueur rouge standard personnalisé
|
||||
final markerIcon = await _createMarkerIcon(
|
||||
Icons.location_on,
|
||||
Colors.red,
|
||||
size: 50.0,
|
||||
);
|
||||
|
||||
// Ajouter un marqueur pour le lieu recherché (ne pas supprimer le marqueur de position)
|
||||
setState(() {
|
||||
// Garder le marqueur de position utilisateur
|
||||
@@ -472,6 +645,8 @@ class _MapContentState extends State<MapContent> {
|
||||
Marker(
|
||||
markerId: MarkerId(suggestion.placeId),
|
||||
position: newPosition,
|
||||
icon: markerIcon,
|
||||
anchor: const Offset(0.5, 0.85),
|
||||
infoWindow: InfoWindow(title: name),
|
||||
),
|
||||
);
|
||||
@@ -521,6 +696,9 @@ class _MapContentState extends State<MapContent> {
|
||||
onMapCreated: (GoogleMapController controller) {
|
||||
_mapController = controller;
|
||||
},
|
||||
onCameraMove: (CameraPosition position) {
|
||||
_currentMapCenter = position.target;
|
||||
},
|
||||
markers: _markers,
|
||||
circles: _circles,
|
||||
myLocationEnabled: false,
|
||||
@@ -652,6 +830,10 @@ class _MapContentState extends State<MapContent> {
|
||||
vertical: 14,
|
||||
),
|
||||
),
|
||||
textInputAction: TextInputAction.search,
|
||||
onSubmitted: (value) {
|
||||
_performTextSearch(value);
|
||||
},
|
||||
onChanged: (value) {
|
||||
// Ne pas rechercher si c'est juste le remplissage initial
|
||||
if (widget.initialSearchQuery != null &&
|
||||
|
||||
@@ -11,6 +11,13 @@ class PoliciesContent extends StatelessWidget {
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> _launchCustomPrivacyPolicy() async {
|
||||
final Uri url = Uri.parse('https://xeewy.be/travelmate/policies');
|
||||
if (!await launchUrl(url)) {
|
||||
throw Exception('Could not launch $url');
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> _onBackPressed(BuildContext context) async {
|
||||
if (Navigator.canPop(context)) {
|
||||
Navigator.pop(context);
|
||||
@@ -44,108 +51,8 @@ class PoliciesContent extends StatelessWidget {
|
||||
child: Column(
|
||||
crossAxisAlignment: CrossAxisAlignment.start,
|
||||
children: [
|
||||
// Section Collecte d'informations
|
||||
Text(
|
||||
'Collecte d\'informations',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
color: isDark ? Colors.white : Colors.black,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 10),
|
||||
Text(
|
||||
'Nous collectons des informations que vous nous fournissez directement, comme votre nom, adresse e-mail et préférences de voyage.',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: isDark ? Colors.grey[300] : Colors.grey[800],
|
||||
),
|
||||
),
|
||||
// Keep only the buttons
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Section Utilisation des données
|
||||
Text(
|
||||
'Utilisation des données',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
color: isDark ? Colors.white : Colors.black,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 10),
|
||||
Text(
|
||||
'Vos données sont utilisées pour améliorer votre expérience utilisateur et vous proposer des recommandations personnalisées.',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: isDark ? Colors.grey[300] : Colors.grey[800],
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Section Protection des données
|
||||
Text(
|
||||
'Protection des données',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
color: isDark ? Colors.white : Colors.black,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 10),
|
||||
Text(
|
||||
'Nous mettons en place des mesures de sécurité appropriées pour protéger vos informations personnelles.',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: isDark ? Colors.grey[300] : Colors.grey[800],
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Section Partage des données
|
||||
Text(
|
||||
'Partage des données',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
color: isDark ? Colors.white : Colors.black,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 10),
|
||||
Text(
|
||||
'Nous ne partageons pas vos informations personnelles avec des tiers sans votre consentement explicite.',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: isDark ? Colors.grey[300] : Colors.grey[800],
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Section Droits de l'utilisateur
|
||||
Text(
|
||||
'Vos droits',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
color: isDark ? Colors.white : Colors.black,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 10),
|
||||
Text(
|
||||
'Vous avez le droit d\'accéder, de corriger ou de supprimer vos données personnelles à tout moment. Veuillez nous contacter pour toute demande.',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: isDark ? Colors.grey[300] : Colors.grey[800],
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Section Contact
|
||||
Text(
|
||||
'Nous contacter',
|
||||
style: theme.textTheme.titleLarge?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
color: isDark ? Colors.white : Colors.black,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 10),
|
||||
Text(
|
||||
'Pour toute question concernant cette politique de confidentialité, veuillez nous contacter à support@travelmate.com',
|
||||
style: theme.textTheme.bodyLarge?.copyWith(
|
||||
color: isDark ? Colors.grey[300] : Colors.grey[800],
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Bouton Google Privacy Policy
|
||||
SizedBox(
|
||||
width: double.infinity,
|
||||
@@ -163,6 +70,24 @@ class PoliciesContent extends StatelessWidget {
|
||||
),
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 12),
|
||||
// Bouton Nos politiques de confidentialité
|
||||
SizedBox(
|
||||
width: double.infinity,
|
||||
child: ElevatedButton.icon(
|
||||
onPressed: _launchCustomPrivacyPolicy,
|
||||
icon: const Icon(Icons.policy),
|
||||
label: const Text('Nos politiques de confidentialités'),
|
||||
style: ElevatedButton.styleFrom(
|
||||
backgroundColor: theme.primaryColor,
|
||||
foregroundColor: Colors.white,
|
||||
padding: const EdgeInsets.symmetric(vertical: 12),
|
||||
shape: RoundedRectangleBorder(
|
||||
borderRadius: BorderRadius.circular(8),
|
||||
),
|
||||
),
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 32),
|
||||
],
|
||||
),
|
||||
|
||||
@@ -150,7 +150,9 @@ class ProfileContent extends StatelessWidget {
|
||||
style: TextStyle(
|
||||
fontSize: 16,
|
||||
fontWeight: FontWeight.bold,
|
||||
color: Colors.black87,
|
||||
color: Theme.of(context).brightness == Brightness.dark
|
||||
? Colors.white
|
||||
: Colors.black87,
|
||||
),
|
||||
),
|
||||
],
|
||||
|
||||
@@ -3,9 +3,33 @@ import 'package:travel_mate/components/settings/policies/policies_content.dart';
|
||||
import 'theme/settings_theme_content.dart';
|
||||
import 'profile/profile_content.dart';
|
||||
|
||||
class SettingsContent extends StatelessWidget {
|
||||
import 'package:package_info_plus/package_info_plus.dart';
|
||||
|
||||
class SettingsContent extends StatefulWidget {
|
||||
const SettingsContent({super.key});
|
||||
|
||||
@override
|
||||
State<SettingsContent> createState() => _SettingsContentState();
|
||||
}
|
||||
|
||||
class _SettingsContentState extends State<SettingsContent> {
|
||||
String _version = '...';
|
||||
|
||||
@override
|
||||
void initState() {
|
||||
super.initState();
|
||||
_loadVersion();
|
||||
}
|
||||
|
||||
Future<void> _loadVersion() async {
|
||||
final packageInfo = await PackageInfo.fromPlatform();
|
||||
if (mounted) {
|
||||
setState(() {
|
||||
_version = packageInfo.version;
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> changePage(BuildContext context, Widget page) async {
|
||||
Navigator.push(context, MaterialPageRoute(builder: (context) => page));
|
||||
}
|
||||
@@ -46,13 +70,6 @@ class SettingsContent extends StatelessWidget {
|
||||
},
|
||||
),
|
||||
|
||||
ListTile(
|
||||
leading: const Icon(Icons.notifications),
|
||||
title: const Text('Notifications'),
|
||||
trailing: const Icon(Icons.arrow_forward_ios),
|
||||
onTap: () {},
|
||||
),
|
||||
|
||||
ListTile(
|
||||
leading: const Icon(Icons.privacy_tip),
|
||||
title: const Text('Confidentialité'),
|
||||
@@ -77,7 +94,7 @@ class SettingsContent extends StatelessWidget {
|
||||
),
|
||||
const SizedBox(height: 4),
|
||||
Text(
|
||||
'1.0.0',
|
||||
_version,
|
||||
style: TextStyle(fontSize: 14, color: Colors.grey[500]),
|
||||
),
|
||||
],
|
||||
|
||||
57
lib/components/signup/password_requirements.dart
Normal file
57
lib/components/signup/password_requirements.dart
Normal file
@@ -0,0 +1,57 @@
|
||||
import 'package:flutter/material.dart';
|
||||
|
||||
class PasswordRequirements extends StatelessWidget {
|
||||
final String password;
|
||||
|
||||
const PasswordRequirements({super.key, required this.password});
|
||||
|
||||
bool get _hasMinLength => password.length >= 8;
|
||||
bool get _hasUppercase => password.contains(RegExp(r'[A-Z]'));
|
||||
bool get _hasLowercase => password.contains(RegExp(r'[a-z]'));
|
||||
bool get _hasDigit => password.contains(RegExp(r'[0-9]'));
|
||||
bool get _hasSpecialChar =>
|
||||
password.contains(RegExp(r'[!@#\$%^&*(),.?":{}|<>]'));
|
||||
|
||||
@override
|
||||
Widget build(BuildContext context) {
|
||||
return Column(
|
||||
crossAxisAlignment: CrossAxisAlignment.start,
|
||||
children: [
|
||||
const SizedBox(height: 10),
|
||||
const Text(
|
||||
'Votre mot de passe doit contenir :',
|
||||
style: TextStyle(fontSize: 14, fontWeight: FontWeight.bold),
|
||||
),
|
||||
const SizedBox(height: 8),
|
||||
_buildRequirement(_hasMinLength, 'Au moins 8 caractères'),
|
||||
_buildRequirement(_hasUppercase, 'Une majuscule'),
|
||||
_buildRequirement(_hasLowercase, 'Une minuscule'),
|
||||
_buildRequirement(_hasDigit, 'Un chiffre'),
|
||||
_buildRequirement(_hasSpecialChar, 'Un caractère spécial'),
|
||||
],
|
||||
);
|
||||
}
|
||||
|
||||
Widget _buildRequirement(bool isMet, String text) {
|
||||
return Padding(
|
||||
padding: const EdgeInsets.symmetric(vertical: 2.0),
|
||||
child: Row(
|
||||
children: [
|
||||
Icon(
|
||||
isMet ? Icons.check_circle : Icons.circle_outlined,
|
||||
color: isMet ? Colors.green : Colors.grey,
|
||||
size: 16,
|
||||
),
|
||||
const SizedBox(width: 8),
|
||||
Text(
|
||||
text,
|
||||
style: TextStyle(
|
||||
color: isMet ? Colors.green : Colors.grey,
|
||||
fontSize: 12,
|
||||
),
|
||||
),
|
||||
],
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
140
lib/components/whats_new_dialog.dart
Normal file
140
lib/components/whats_new_dialog.dart
Normal file
@@ -0,0 +1,140 @@
|
||||
import 'package:flutter/material.dart';
|
||||
import '../../services/whats_new_service.dart';
|
||||
|
||||
class WhatsNewDialog extends StatelessWidget {
|
||||
final VoidCallback onDismiss;
|
||||
final List<WhatsNewItem> features;
|
||||
|
||||
const WhatsNewDialog({
|
||||
super.key,
|
||||
required this.onDismiss,
|
||||
required this.features,
|
||||
});
|
||||
|
||||
@override
|
||||
Widget build(BuildContext context) {
|
||||
final theme = Theme.of(context);
|
||||
|
||||
return Dialog(
|
||||
shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(20)),
|
||||
backgroundColor: theme.colorScheme.surface,
|
||||
child: Padding(
|
||||
padding: const EdgeInsets.all(24.0),
|
||||
child: Column(
|
||||
mainAxisSize: MainAxisSize.min,
|
||||
crossAxisAlignment: CrossAxisAlignment.start,
|
||||
children: [
|
||||
// Header
|
||||
Row(
|
||||
children: [
|
||||
Container(
|
||||
padding: const EdgeInsets.all(8),
|
||||
decoration: BoxDecoration(
|
||||
color: theme.colorScheme.primaryContainer,
|
||||
shape: BoxShape.circle,
|
||||
),
|
||||
child: Icon(
|
||||
Icons.auto_awesome,
|
||||
color: theme.colorScheme.primary,
|
||||
size: 24,
|
||||
),
|
||||
),
|
||||
const SizedBox(width: 16),
|
||||
Expanded(
|
||||
child: Text(
|
||||
'Quoi de neuf ?',
|
||||
style: theme.textTheme.headlineSmall?.copyWith(
|
||||
fontWeight: FontWeight.bold,
|
||||
),
|
||||
),
|
||||
),
|
||||
],
|
||||
),
|
||||
const SizedBox(height: 24),
|
||||
|
||||
// Features List
|
||||
Flexible(
|
||||
child: ListView.separated(
|
||||
shrinkWrap: true,
|
||||
itemCount: features.length,
|
||||
separatorBuilder: (_, __) => const SizedBox(height: 16),
|
||||
itemBuilder: (context, index) {
|
||||
final feature = features[index];
|
||||
return Row(
|
||||
crossAxisAlignment: CrossAxisAlignment.start,
|
||||
children: [
|
||||
Icon(
|
||||
feature.icon,
|
||||
color: theme.colorScheme.primary,
|
||||
size: 20,
|
||||
),
|
||||
const SizedBox(width: 12),
|
||||
Expanded(
|
||||
child: Column(
|
||||
crossAxisAlignment: CrossAxisAlignment.start,
|
||||
children: [
|
||||
Text(
|
||||
feature.title,
|
||||
style: theme.textTheme.titleMedium?.copyWith(
|
||||
fontWeight: FontWeight.w600,
|
||||
),
|
||||
),
|
||||
const SizedBox(height: 4),
|
||||
Text(
|
||||
feature.description,
|
||||
style: theme.textTheme.bodyMedium?.copyWith(
|
||||
color: theme.colorScheme.onSurfaceVariant,
|
||||
),
|
||||
),
|
||||
],
|
||||
),
|
||||
),
|
||||
],
|
||||
);
|
||||
},
|
||||
),
|
||||
),
|
||||
|
||||
const SizedBox(height: 32),
|
||||
|
||||
// Button
|
||||
SizedBox(
|
||||
width: double.infinity,
|
||||
height: 50,
|
||||
child: ElevatedButton(
|
||||
onPressed: () {
|
||||
// Marquer comme vu via le service
|
||||
WhatsNewService().markCurrentVersionAsSeen();
|
||||
onDismiss();
|
||||
},
|
||||
style: ElevatedButton.styleFrom(
|
||||
backgroundColor: theme.colorScheme.primary,
|
||||
foregroundColor: theme.colorScheme.onPrimary,
|
||||
shape: RoundedRectangleBorder(
|
||||
borderRadius: BorderRadius.circular(12),
|
||||
),
|
||||
),
|
||||
child: const Text(
|
||||
'C\'est parti !',
|
||||
style: TextStyle(fontSize: 16, fontWeight: FontWeight.bold),
|
||||
),
|
||||
),
|
||||
),
|
||||
],
|
||||
),
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
class WhatsNewItem {
|
||||
final IconData icon;
|
||||
final String title;
|
||||
final String description;
|
||||
|
||||
const WhatsNewItem({
|
||||
required this.icon,
|
||||
required this.title,
|
||||
required this.description,
|
||||
});
|
||||
}
|
||||
@@ -27,18 +27,6 @@ class DefaultFirebaseOptions {
|
||||
return android;
|
||||
case TargetPlatform.iOS:
|
||||
return ios;
|
||||
case TargetPlatform.macOS:
|
||||
throw UnsupportedError(
|
||||
'DefaultFirebaseOptions have not been configured for macos - '
|
||||
'you can reconfigure this by running the FlutterFire CLI again.',
|
||||
);
|
||||
case TargetPlatform.windows:
|
||||
return windows;
|
||||
case TargetPlatform.linux:
|
||||
throw UnsupportedError(
|
||||
'DefaultFirebaseOptions have not been configured for linux - '
|
||||
'you can reconfigure this by running the FlutterFire CLI again.',
|
||||
);
|
||||
default:
|
||||
throw UnsupportedError(
|
||||
'DefaultFirebaseOptions are not supported for this platform.',
|
||||
@@ -63,15 +51,4 @@ class DefaultFirebaseOptions {
|
||||
iosClientId: '521527250907-3i1qe2656eojs8k9hjdi573j09i9p41m.apps.googleusercontent.com',
|
||||
iosBundleId: 'com.example.travelMate',
|
||||
);
|
||||
|
||||
static const FirebaseOptions windows = FirebaseOptions(
|
||||
apiKey: 'AIzaSyC4t-WOvp22zns9b9t58urznsNAhSHRAag',
|
||||
appId: '1:521527250907:web:53ff98bcdb8c218f7da1fe',
|
||||
messagingSenderId: '521527250907',
|
||||
projectId: 'travelmate-a47f5',
|
||||
authDomain: 'travelmate-a47f5.firebaseapp.com',
|
||||
storageBucket: 'travelmate-a47f5.firebasestorage.app',
|
||||
measurementId: 'G-J246Y7J61M',
|
||||
);
|
||||
|
||||
}
|
||||
@@ -1,8 +1,11 @@
|
||||
import 'package:flutter/material.dart';
|
||||
import 'package:flutter/services.dart';
|
||||
import 'package:flutter_bloc/flutter_bloc.dart';
|
||||
import 'package:firebase_core/firebase_core.dart';
|
||||
import 'package:travel_mate/blocs/balance/balance_bloc.dart';
|
||||
import 'package:travel_mate/blocs/expense/expense_bloc.dart';
|
||||
import 'package:google_maps_flutter_android/google_maps_flutter_android.dart';
|
||||
import 'package:google_maps_flutter_platform_interface/google_maps_flutter_platform_interface.dart';
|
||||
import 'package:travel_mate/blocs/message/message_bloc.dart';
|
||||
import 'package:travel_mate/blocs/activity/activity_bloc.dart';
|
||||
import 'package:travel_mate/firebase_options.dart';
|
||||
@@ -14,6 +17,7 @@ import 'package:travel_mate/services/expense_service.dart';
|
||||
import 'package:firebase_messaging/firebase_messaging.dart';
|
||||
import 'package:travel_mate/services/notification_service.dart';
|
||||
import 'package:travel_mate/services/map_navigation_service.dart';
|
||||
import 'package:travel_mate/services/analytics_service.dart';
|
||||
import 'blocs/auth/auth_bloc.dart';
|
||||
import 'blocs/auth/auth_event.dart';
|
||||
import 'blocs/theme/theme_bloc.dart';
|
||||
@@ -45,6 +49,10 @@ import 'package:intl/date_symbol_data_local.dart';
|
||||
/// initializes Firebase, and starts the application.
|
||||
void main() async {
|
||||
WidgetsFlutterBinding.ensureInitialized();
|
||||
await SystemChrome.setPreferredOrientations([
|
||||
DeviceOrientation.portraitUp,
|
||||
DeviceOrientation.portraitDown,
|
||||
]);
|
||||
await dotenv.load(fileName: ".env");
|
||||
await Firebase.initializeApp(options: DefaultFirebaseOptions.currentPlatform);
|
||||
await initializeDateFormatting('fr_FR', null);
|
||||
@@ -54,6 +62,13 @@ void main() async {
|
||||
|
||||
await NotificationService().initialize();
|
||||
|
||||
// Requirements for Google Maps on Android (Hybrid Composition)
|
||||
final GoogleMapsFlutterPlatform mapsImplementation =
|
||||
GoogleMapsFlutterPlatform.instance;
|
||||
if (mapsImplementation is GoogleMapsFlutterAndroid) {
|
||||
mapsImplementation.useAndroidViewSurface = true;
|
||||
}
|
||||
|
||||
runApp(const MyApp());
|
||||
}
|
||||
|
||||
@@ -132,6 +147,10 @@ class MyApp extends StatelessWidget {
|
||||
RepositoryProvider<MapNavigationService>(
|
||||
create: (context) => MapNavigationService(),
|
||||
),
|
||||
// Analysis service
|
||||
RepositoryProvider<AnalyticsService>(
|
||||
create: (context) => AnalyticsService(),
|
||||
),
|
||||
],
|
||||
child: MultiBlocProvider(
|
||||
providers: [
|
||||
@@ -192,6 +211,9 @@ class MyApp extends StatelessWidget {
|
||||
title: 'Travel Mate',
|
||||
navigatorKey: ErrorService.navigatorKey,
|
||||
themeMode: themeState.themeMode,
|
||||
navigatorObservers: [
|
||||
context.read<AnalyticsService>().getAnalyticsObserver(),
|
||||
],
|
||||
// Light theme configuration
|
||||
theme: ThemeData(
|
||||
colorScheme: ColorScheme.fromSeed(
|
||||
|
||||
@@ -45,7 +45,10 @@ enum ExpenseCategory {
|
||||
shopping('Shopping', Icons.shopping_bag),
|
||||
|
||||
/// Other miscellaneous expenses
|
||||
other('Other', Icons.category);
|
||||
other('Other', Icons.category),
|
||||
|
||||
/// Reimbursement for settling debts
|
||||
reimbursement('Remboursement', Icons.monetization_on);
|
||||
|
||||
const ExpenseCategory(this.displayName, this.icon);
|
||||
|
||||
|
||||
@@ -14,6 +14,8 @@ import '../blocs/auth/auth_event.dart';
|
||||
import '../services/error_service.dart';
|
||||
import '../services/notification_service.dart';
|
||||
import '../services/map_navigation_service.dart';
|
||||
import '../services/whats_new_service.dart';
|
||||
import '../components/whats_new_dialog.dart';
|
||||
|
||||
class HomePage extends StatefulWidget {
|
||||
const HomePage({super.key});
|
||||
@@ -57,6 +59,45 @@ class _HomePageState extends State<HomePage> {
|
||||
});
|
||||
}
|
||||
});
|
||||
|
||||
// Vérifier les nouveautés
|
||||
WidgetsBinding.instance.addPostFrameCallback((_) async {
|
||||
await _checkAndShowWhatsNew();
|
||||
});
|
||||
}
|
||||
|
||||
Future<void> _checkAndShowWhatsNew() async {
|
||||
final service = WhatsNewService();
|
||||
if (await service.shouldShowWhatsNew()) {
|
||||
if (!mounted) return;
|
||||
showDialog(
|
||||
context: context,
|
||||
barrierDismissible: false,
|
||||
builder: (context) => WhatsNewDialog(
|
||||
onDismiss: () => Navigator.pop(context),
|
||||
features: const [
|
||||
WhatsNewItem(
|
||||
icon: Icons.map_outlined,
|
||||
title: 'Recherche globale',
|
||||
description:
|
||||
'Recherchez des restaurants, musées et plus encore directement depuis la carte.',
|
||||
),
|
||||
WhatsNewItem(
|
||||
icon: Icons.search,
|
||||
title: 'Autocomplétion améliorée',
|
||||
description:
|
||||
'Découvrez des suggestions intelligentes lors de la recherche de lieux et d\'activités.',
|
||||
),
|
||||
WhatsNewItem(
|
||||
icon: Icons.warning_amber_rounded,
|
||||
title: 'Alertes de distance',
|
||||
description:
|
||||
'Soyez averti si une activité est trop éloignée de votre lieu de séjour.',
|
||||
),
|
||||
],
|
||||
),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
Widget _buildPage(int index) {
|
||||
|
||||
@@ -88,7 +88,11 @@ class _LoginPageState extends State<LoginPage> {
|
||||
body: BlocConsumer<AuthBloc, AuthState>(
|
||||
listener: (context, state) {
|
||||
if (state is AuthAuthenticated) {
|
||||
Navigator.pushReplacementNamed(context, '/home');
|
||||
Navigator.pushNamedAndRemoveUntil(
|
||||
context,
|
||||
'/home',
|
||||
(route) => false,
|
||||
);
|
||||
} else if (state is AuthError) {
|
||||
ErrorService().showError(message: state.message);
|
||||
}
|
||||
|
||||
@@ -2,6 +2,7 @@ import 'package:flutter/material.dart';
|
||||
import 'package:flutter_bloc/flutter_bloc.dart';
|
||||
import 'package:sign_in_button/sign_in_button.dart';
|
||||
import 'package:travel_mate/components/loading/laoding_content.dart';
|
||||
import 'package:travel_mate/components/signup/password_requirements.dart';
|
||||
import 'package:travel_mate/components/signup/sign_up_platform_content.dart';
|
||||
import 'package:travel_mate/services/auth_service.dart';
|
||||
import '../blocs/auth/auth_bloc.dart';
|
||||
@@ -66,6 +67,18 @@ class _SignUpPageState extends State<SignUpPage> {
|
||||
if (value.length < 8) {
|
||||
return 'Le mot de passe doit contenir au moins 8 caractères';
|
||||
}
|
||||
if (!value.contains(RegExp(r'[A-Z]'))) {
|
||||
return 'Le mot de passe doit contenir une majuscule';
|
||||
}
|
||||
if (!value.contains(RegExp(r'[a-z]'))) {
|
||||
return 'Le mot de passe doit contenir une minuscule';
|
||||
}
|
||||
if (!value.contains(RegExp(r'[0-9]'))) {
|
||||
return 'Le mot de passe doit contenir un chiffre';
|
||||
}
|
||||
if (!value.contains(RegExp(r'[!@#\$%^&*(),.?":{}|<>]'))) {
|
||||
return 'Le mot de passe doit contenir un caractère spécial';
|
||||
}
|
||||
return null;
|
||||
}
|
||||
|
||||
@@ -115,7 +128,11 @@ class _SignUpPageState extends State<SignUpPage> {
|
||||
backgroundColor: Colors.green,
|
||||
),
|
||||
);
|
||||
Navigator.pushReplacementNamed(context, '/home');
|
||||
Navigator.pushNamedAndRemoveUntil(
|
||||
context,
|
||||
'/home',
|
||||
(route) => false,
|
||||
);
|
||||
} else if (state is AuthError) {
|
||||
_errorService.showError(message: state.message);
|
||||
}
|
||||
@@ -209,6 +226,7 @@ class _SignUpPageState extends State<SignUpPage> {
|
||||
controller: _passwordController,
|
||||
validator: _validatePassword,
|
||||
obscureText: _obscurePassword,
|
||||
onChanged: (value) => setState(() {}),
|
||||
decoration: InputDecoration(
|
||||
labelText: 'Mot de passe',
|
||||
border: const OutlineInputBorder(
|
||||
@@ -229,6 +247,7 @@ class _SignUpPageState extends State<SignUpPage> {
|
||||
),
|
||||
),
|
||||
),
|
||||
PasswordRequirements(password: _passwordController.text),
|
||||
const SizedBox(height: 20),
|
||||
|
||||
// Champ Confirmation mot de passe
|
||||
|
||||
@@ -286,4 +286,42 @@ class GroupRepository {
|
||||
.toList(),
|
||||
);
|
||||
}
|
||||
|
||||
Future<void> updateMemberDetails({
|
||||
required String userId,
|
||||
String? firstName,
|
||||
String? lastName,
|
||||
String? profilePictureUrl,
|
||||
}) async {
|
||||
try {
|
||||
// 1. Trouver tous les groupes où l'utilisateur est membre
|
||||
final groupsSnapshot = await _groupsCollection
|
||||
.where('memberIds', arrayContains: userId)
|
||||
.get();
|
||||
|
||||
// 2. Mettre à jour les infos du membre dans chaque groupe
|
||||
for (final groupDoc in groupsSnapshot.docs) {
|
||||
final memberRef = _membersCollection(groupDoc.id).doc(userId);
|
||||
|
||||
final updates = <String, dynamic>{};
|
||||
if (firstName != null) updates['firstName'] = firstName;
|
||||
if (lastName != null) updates['lastName'] = lastName;
|
||||
if (profilePictureUrl != null) {
|
||||
updates['profilePictureUrl'] = profilePictureUrl;
|
||||
}
|
||||
|
||||
if (updates.isNotEmpty) {
|
||||
await memberRef.update(updates);
|
||||
}
|
||||
}
|
||||
} catch (e, stackTrace) {
|
||||
_errorService.logError(
|
||||
'GroupRepository',
|
||||
'Erreur update member details: $e',
|
||||
stackTrace,
|
||||
);
|
||||
// On ne throw pas d'exception ici pour ne pas bloquer l'update user principal
|
||||
// C'est une opération "best effort"
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
import 'dart:io';
|
||||
import 'dart:convert';
|
||||
import 'package:http/http.dart' as http;
|
||||
import 'package:flutter_dotenv/flutter_dotenv.dart';
|
||||
import '../firebase_options.dart'; // Add this import
|
||||
import '../models/activity.dart';
|
||||
import '../services/error_service.dart';
|
||||
import '../services/logger_service.dart';
|
||||
@@ -13,7 +14,17 @@ class ActivityPlacesService {
|
||||
ActivityPlacesService._internal();
|
||||
|
||||
final ErrorService _errorService = ErrorService();
|
||||
static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
|
||||
static String get _apiKey {
|
||||
try {
|
||||
return DefaultFirebaseOptions.currentPlatform.apiKey;
|
||||
} catch (e) {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Impossible de récupérer la clé API Firebase: $e',
|
||||
);
|
||||
return '';
|
||||
}
|
||||
}
|
||||
|
||||
/// Recherche des activités près d'une destination
|
||||
Future<List<Activity>> searchActivities({
|
||||
@@ -24,7 +35,6 @@ class ActivityPlacesService {
|
||||
int maxResults = 20,
|
||||
int offset = 0,
|
||||
}) async {
|
||||
try {
|
||||
LoggerService.info(
|
||||
'ActivityPlacesService: Recherche d\'activités pour: $destination (max: $maxResults, offset: $offset)',
|
||||
);
|
||||
@@ -94,13 +104,6 @@ class ActivityPlacesService {
|
||||
);
|
||||
|
||||
return paginatedResults;
|
||||
} catch (e) {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Erreur lors de la recherche: $e',
|
||||
);
|
||||
_errorService.logError('activity_places_service', e);
|
||||
return [];
|
||||
}
|
||||
}
|
||||
|
||||
/// Géocode une destination pour obtenir les coordonnées
|
||||
@@ -111,7 +114,13 @@ class ActivityPlacesService {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Clé API Google Maps manquante',
|
||||
);
|
||||
throw Exception('Clé API Google Maps non configurée');
|
||||
throw Exception(
|
||||
'Clé API Google Maps non configurée dans DefaultFirebaseOptions. Platform: ${Platform.isAndroid
|
||||
? 'Android'
|
||||
: Platform.isIOS
|
||||
? 'iOS'
|
||||
: 'Autre'}',
|
||||
);
|
||||
}
|
||||
|
||||
final encodedDestination = Uri.encodeComponent(destination);
|
||||
@@ -178,7 +187,6 @@ class ActivityPlacesService {
|
||||
String tripId,
|
||||
int radius,
|
||||
) async {
|
||||
try {
|
||||
final url =
|
||||
'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
|
||||
'?location=$lat,$lng'
|
||||
@@ -213,15 +221,18 @@ class ActivityPlacesService {
|
||||
}
|
||||
|
||||
return activities;
|
||||
}
|
||||
}
|
||||
|
||||
} else if (data['status'] == 'ZERO_RESULTS') {
|
||||
return [];
|
||||
} catch (e) {
|
||||
} else {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Erreur recherche par catégorie: $e',
|
||||
'ActivityPlacesService: Erreur API Places: ${data['status']} - ${data['error_message']}',
|
||||
);
|
||||
return [];
|
||||
throw Exception(
|
||||
'API Places Error: ${data['status']} - ${data['error_message']}',
|
||||
);
|
||||
}
|
||||
} else {
|
||||
throw Exception('Erreur HTTP ${response.statusCode}');
|
||||
}
|
||||
}
|
||||
|
||||
@@ -344,7 +355,6 @@ class ActivityPlacesService {
|
||||
required String tripId,
|
||||
int radius = 5000,
|
||||
}) async {
|
||||
try {
|
||||
LoggerService.info(
|
||||
'ActivityPlacesService: Recherche textuelle: $query à $destination',
|
||||
);
|
||||
@@ -355,7 +365,7 @@ class ActivityPlacesService {
|
||||
final encodedQuery = Uri.encodeComponent(query);
|
||||
final url =
|
||||
'https://maps.googleapis.com/maps/api/place/textsearch/json'
|
||||
'?query=$encodedQuery in $destination'
|
||||
'?query=$encodedQuery'
|
||||
'&location=${coordinates['lat']},${coordinates['lng']}'
|
||||
'&radius=$radius'
|
||||
'&key=$_apiKey'
|
||||
@@ -391,15 +401,16 @@ class ActivityPlacesService {
|
||||
}
|
||||
|
||||
return activities;
|
||||
}
|
||||
}
|
||||
|
||||
} else if (data['status'] == 'ZERO_RESULTS') {
|
||||
return [];
|
||||
} catch (e) {
|
||||
} else {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Erreur recherche textuelle: $e',
|
||||
'ActivityPlacesService: Erreur API Places Text Search: ${data['status']}',
|
||||
);
|
||||
return [];
|
||||
throw Exception('API Error: ${data['status']}');
|
||||
}
|
||||
} else {
|
||||
throw Exception('Erreur HTTP ${response.statusCode}');
|
||||
}
|
||||
}
|
||||
|
||||
@@ -510,7 +521,6 @@ class ActivityPlacesService {
|
||||
int pageSize,
|
||||
String? nextPageToken,
|
||||
) async {
|
||||
try {
|
||||
String url =
|
||||
'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
|
||||
'?location=$lat,$lng'
|
||||
@@ -557,23 +567,17 @@ class ActivityPlacesService {
|
||||
'nextPageToken': data['next_page_token'],
|
||||
'hasMoreData': data['next_page_token'] != null,
|
||||
};
|
||||
}
|
||||
}
|
||||
|
||||
return {
|
||||
'activities': <Activity>[],
|
||||
'nextPageToken': null,
|
||||
'hasMoreData': false,
|
||||
};
|
||||
} catch (e) {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Erreur recherche catégorie paginée: $e',
|
||||
);
|
||||
} else if (data['status'] == 'ZERO_RESULTS') {
|
||||
return {
|
||||
'activities': <Activity>[],
|
||||
'nextPageToken': null,
|
||||
'hasMoreData': false,
|
||||
};
|
||||
} else {
|
||||
throw Exception('API Error: ${data['status']}');
|
||||
}
|
||||
} else {
|
||||
throw Exception('Erreur HTTP ${response.statusCode}');
|
||||
}
|
||||
}
|
||||
|
||||
@@ -586,7 +590,6 @@ class ActivityPlacesService {
|
||||
int pageSize,
|
||||
String? nextPageToken,
|
||||
) async {
|
||||
try {
|
||||
// Pour toutes les catégories, on utilise une recherche plus générale
|
||||
String url =
|
||||
'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
|
||||
@@ -638,23 +641,85 @@ class ActivityPlacesService {
|
||||
'nextPageToken': data['next_page_token'],
|
||||
'hasMoreData': data['next_page_token'] != null,
|
||||
};
|
||||
} else if (data['status'] == 'ZERO_RESULTS') {
|
||||
return {
|
||||
'activities': <Activity>[],
|
||||
'nextPageToken': null,
|
||||
'hasMoreData': false,
|
||||
};
|
||||
} else {
|
||||
throw Exception('API Error: ${data['status']}');
|
||||
}
|
||||
} else {
|
||||
throw Exception('Erreur HTTP ${response.statusCode}');
|
||||
}
|
||||
}
|
||||
|
||||
/// Récupère des suggestions d'autocomplétion
|
||||
Future<List<Map<String, String>>> fetchSuggestions({
|
||||
required String query,
|
||||
double? lat,
|
||||
double? lng,
|
||||
}) async {
|
||||
if (query.isEmpty) return [];
|
||||
|
||||
try {
|
||||
String url =
|
||||
'https://maps.googleapis.com/maps/api/place/autocomplete/json'
|
||||
'?input=${Uri.encodeComponent(query)}'
|
||||
'&key=$_apiKey'
|
||||
'&language=fr';
|
||||
|
||||
if (lat != null && lng != null) {
|
||||
url += '&location=$lat,$lng&radius=50000'; // 50km bias
|
||||
}
|
||||
|
||||
final response = await http.get(Uri.parse(url));
|
||||
|
||||
if (response.statusCode == 200) {
|
||||
final data = json.decode(response.body);
|
||||
if (data['status'] == 'OK') {
|
||||
return (data['predictions'] as List).map<Map<String, String>>((p) {
|
||||
return {
|
||||
'activities': <Activity>[],
|
||||
'nextPageToken': null,
|
||||
'hasMoreData': false,
|
||||
'description': p['description'] as String,
|
||||
'placeId': p['place_id'] as String,
|
||||
};
|
||||
}).toList();
|
||||
}
|
||||
}
|
||||
return [];
|
||||
} catch (e) {
|
||||
LoggerService.error(
|
||||
'ActivityPlacesService: Erreur recherche toutes catégories paginée: $e',
|
||||
LoggerService.error('ActivityPlacesService: Erreur autocomplete: $e');
|
||||
return [];
|
||||
}
|
||||
}
|
||||
|
||||
/// Récupère une activité via son Place ID
|
||||
Future<Activity?> getActivityByPlaceId({
|
||||
required String placeId,
|
||||
required String tripId,
|
||||
}) async {
|
||||
try {
|
||||
final details = await _getPlaceDetails(placeId);
|
||||
if (details == null) return null;
|
||||
|
||||
// Créer une map simulant la structure "place" attendue par _convertPlaceToActivity
|
||||
// Note: _getPlaceDetails retourne "result", qui est déjà ce qu'on veut,
|
||||
// mais _convertPlaceToActivity attend le format "search result" qui a geometry au premier niveau.
|
||||
// Heureusement _getPlaceDetails retourne une structure compatible pour geometry/photos etc.
|
||||
|
||||
// On doit s'assurer d'avoir les types pour déterminer la catégorie
|
||||
final types = List<String>.from(details['types'] ?? []);
|
||||
final category = _determineCategoryFromTypes(types);
|
||||
|
||||
return await _convertPlaceToActivity(
|
||||
details, // details a la structure nécessaire (geometry, name, etc)
|
||||
tripId,
|
||||
category,
|
||||
);
|
||||
return {
|
||||
'activities': <Activity>[],
|
||||
'nextPageToken': null,
|
||||
'hasMoreData': false,
|
||||
};
|
||||
} catch (e) {
|
||||
LoggerService.error('ActivityPlacesService: Erreur get details: $e');
|
||||
return null;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
54
lib/services/analytics_service.dart
Normal file
54
lib/services/analytics_service.dart
Normal file
@@ -0,0 +1,54 @@
|
||||
import 'package:firebase_analytics/firebase_analytics.dart';
|
||||
import 'package:flutter/foundation.dart';
|
||||
|
||||
/// Service wrapper for Google Analytics
|
||||
class AnalyticsService {
|
||||
final FirebaseAnalytics _analytics = FirebaseAnalytics.instance;
|
||||
|
||||
FirebaseAnalyticsObserver getAnalyticsObserver() =>
|
||||
FirebaseAnalyticsObserver(analytics: _analytics);
|
||||
|
||||
Future<void> logEvent({
|
||||
required String name,
|
||||
Map<String, Object>? parameters,
|
||||
}) async {
|
||||
try {
|
||||
await _analytics.logEvent(name: name, parameters: parameters);
|
||||
} catch (e) {
|
||||
debugPrint('Error logging analytics event: $e');
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> setUserProperty({
|
||||
required String name,
|
||||
required String? value,
|
||||
}) async {
|
||||
try {
|
||||
await _analytics.setUserProperty(name: name, value: value);
|
||||
} catch (e) {
|
||||
debugPrint('Error setting user property: $e');
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> setUserId(String? id) async {
|
||||
try {
|
||||
await _analytics.setUserId(id: id);
|
||||
} catch (e) {
|
||||
debugPrint('Error setting user ID: $e');
|
||||
}
|
||||
}
|
||||
|
||||
Future<void> logScreenView({
|
||||
required String screenName,
|
||||
String? screenClass,
|
||||
}) async {
|
||||
try {
|
||||
await _analytics.logScreenView(
|
||||
screenName: screenName,
|
||||
screenClass: screenClass,
|
||||
);
|
||||
} catch (e) {
|
||||
debugPrint('Error logging screen view: $e');
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,3 +1,4 @@
|
||||
import 'dart:io';
|
||||
import 'dart:convert';
|
||||
import 'package:http/http.dart' as http;
|
||||
import 'package:flutter_dotenv/flutter_dotenv.dart';
|
||||
@@ -5,7 +6,19 @@ import 'package:firebase_storage/firebase_storage.dart';
|
||||
import 'package:travel_mate/services/error_service.dart';
|
||||
|
||||
class PlaceImageService {
|
||||
static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
static String get _apiKey {
|
||||
if (Platform.isAndroid) {
|
||||
return dotenv.env['GOOGLE_MAPS_API_KEY_ANDROID'] ??
|
||||
dotenv.env['GOOGLE_MAPS_API_KEY'] ??
|
||||
'';
|
||||
} else if (Platform.isIOS) {
|
||||
return dotenv.env['GOOGLE_MAPS_API_KEY_IOS'] ??
|
||||
dotenv.env['GOOGLE_MAPS_API_KEY'] ??
|
||||
'';
|
||||
}
|
||||
return dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
}
|
||||
|
||||
final FirebaseStorage _storage = FirebaseStorage.instance;
|
||||
final ErrorService _errorService = ErrorService();
|
||||
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
import 'dart:io';
|
||||
import 'dart:convert';
|
||||
import 'package:http/http.dart' as http;
|
||||
import 'package:flutter_dotenv/flutter_dotenv.dart';
|
||||
@@ -13,7 +14,18 @@ class TripGeocodingService {
|
||||
TripGeocodingService._internal();
|
||||
|
||||
final ErrorService _errorService = ErrorService();
|
||||
static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
static String get _apiKey {
|
||||
if (Platform.isAndroid) {
|
||||
return dotenv.env['GOOGLE_MAPS_API_KEY_ANDROID'] ??
|
||||
dotenv.env['GOOGLE_MAPS_API_KEY'] ??
|
||||
'';
|
||||
} else if (Platform.isIOS) {
|
||||
return dotenv.env['GOOGLE_MAPS_API_KEY_IOS'] ??
|
||||
dotenv.env['GOOGLE_MAPS_API_KEY'] ??
|
||||
'';
|
||||
}
|
||||
return dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
|
||||
}
|
||||
|
||||
/// Géocode la destination d'un voyage et retourne un Trip mis à jour
|
||||
Future<Trip> geocodeTrip(Trip trip) async {
|
||||
|
||||
@@ -5,6 +5,7 @@ import '../blocs/user/user_state.dart';
|
||||
|
||||
/// Service for managing user operations with Firestore and Firebase Auth.
|
||||
///
|
||||
///
|
||||
/// This service provides functionality for user management including creating,
|
||||
/// retrieving, updating, and deleting user data in Firestore. It also handles
|
||||
/// user authentication state and provides methods for user profile management.
|
||||
|
||||
68
lib/services/whats_new_service.dart
Normal file
68
lib/services/whats_new_service.dart
Normal file
@@ -0,0 +1,68 @@
|
||||
import 'package:package_info_plus/package_info_plus.dart';
|
||||
import 'package:shared_preferences/shared_preferences.dart';
|
||||
import '../../services/logger_service.dart';
|
||||
|
||||
class WhatsNewService {
|
||||
static const String _lastVersionKey = 'last_known_version';
|
||||
|
||||
/// Vérifie si le popup "Nouveautés" doit être affiché.
|
||||
///
|
||||
/// Retourne true si:
|
||||
/// - Ce n'est PAS une nouvelle installation
|
||||
/// - ET la version actuelle est plus récente que la version stockée
|
||||
Future<bool> shouldShowWhatsNew() async {
|
||||
try {
|
||||
final prefs = await SharedPreferences.getInstance();
|
||||
final packageInfo = await PackageInfo.fromPlatform();
|
||||
|
||||
final currentVersion = packageInfo.version;
|
||||
final lastVersion = prefs.getString(_lastVersionKey);
|
||||
|
||||
LoggerService.info(
|
||||
'WhatsNewService: Current=$currentVersion, Last=$lastVersion',
|
||||
);
|
||||
|
||||
// Cas 1: Première installation (lastVersion est null)
|
||||
if (lastVersion == null) {
|
||||
// On sauvegarde la version actuelle pour ne pas afficher le popup
|
||||
// la prochaine fois, et on retourne false maintenant.
|
||||
await prefs.setString(_lastVersionKey, currentVersion);
|
||||
LoggerService.info(
|
||||
'WhatsNewService: Fresh install detected. Marking version $currentVersion as read.',
|
||||
);
|
||||
return false;
|
||||
}
|
||||
|
||||
// Cas 2: Mise à jour (lastVersion != currentVersion)
|
||||
if (lastVersion != currentVersion) {
|
||||
// C'est une mise à jour, on doit afficher le popup.
|
||||
// On NE met PAS à jour la version ici, on attend que l'utilisateur ait vu le popup.
|
||||
LoggerService.info(
|
||||
'WhatsNewService: Update detected ($lastVersion -> $currentVersion). Showing popup.',
|
||||
);
|
||||
return true;
|
||||
}
|
||||
|
||||
// Cas 3: Même version
|
||||
return false;
|
||||
} catch (e) {
|
||||
LoggerService.error('WhatsNewService: Error checking version: $e');
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/// Marque la version actuelle comme "Vue".
|
||||
/// À appeler quand l'utilisateur ferme le popup.
|
||||
Future<void> markCurrentVersionAsSeen() async {
|
||||
try {
|
||||
final prefs = await SharedPreferences.getInstance();
|
||||
final packageInfo = await PackageInfo.fromPlatform();
|
||||
await prefs.setString(_lastVersionKey, packageInfo.version);
|
||||
LoggerService.info(
|
||||
'WhatsNewService: Version ${packageInfo.version} marked as seen.',
|
||||
);
|
||||
} catch (e) {
|
||||
LoggerService.error('WhatsNewService: Error marking seen: $e');
|
||||
}
|
||||
}
|
||||
}
|
||||
50
pubspec.lock
50
pubspec.lock
@@ -13,10 +13,10 @@ packages:
|
||||
dependency: transitive
|
||||
description:
|
||||
name: _flutterfire_internals
|
||||
sha256: "8a1f5f3020ef2a74fb93f7ab3ef127a8feea33a7a2276279113660784ee7516a"
|
||||
sha256: e4a1b612fd2955908e26116075b3a4baf10c353418ca645b4deae231c82bf144
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "1.3.64"
|
||||
version: "1.3.65"
|
||||
analyzer:
|
||||
dependency: transitive
|
||||
description:
|
||||
@@ -401,6 +401,30 @@ packages:
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "0.9.3+4"
|
||||
firebase_analytics:
|
||||
dependency: "direct main"
|
||||
description:
|
||||
name: firebase_analytics
|
||||
sha256: "8ca4832c7a6d145ce987fd07d6dfbb8c91d9058178342f20de6305fb77b1b40d"
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "12.1.0"
|
||||
firebase_analytics_platform_interface:
|
||||
dependency: transitive
|
||||
description:
|
||||
name: firebase_analytics_platform_interface
|
||||
sha256: d00234716f415f89eb5c2cefb1238d7fd2f3120275d71414b84ae434dcdb7a19
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "5.0.5"
|
||||
firebase_analytics_web:
|
||||
dependency: transitive
|
||||
description:
|
||||
name: firebase_analytics_web
|
||||
sha256: e42b294e51aedb4bd4b761a886c8d6b473c44b44aa4c0b47cab06b2c66ac3fba
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "0.6.1+1"
|
||||
firebase_auth:
|
||||
dependency: "direct main"
|
||||
description:
|
||||
@@ -429,10 +453,10 @@ packages:
|
||||
dependency: "direct main"
|
||||
description:
|
||||
name: firebase_core
|
||||
sha256: "1f2dfd9f535d81f8b06d7a50ecda6eac1e6922191ed42e09ca2c84bd2288927c"
|
||||
sha256: "29cfa93c771d8105484acac340b5ea0835be371672c91405a300303986f4eba9"
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "4.2.1"
|
||||
version: "4.3.0"
|
||||
firebase_core_platform_interface:
|
||||
dependency: transitive
|
||||
description:
|
||||
@@ -445,10 +469,10 @@ packages:
|
||||
dependency: transitive
|
||||
description:
|
||||
name: firebase_core_web
|
||||
sha256: ff18fabb0ad0ed3595d2f2c85007ecc794aadecdff5b3bb1460b7ee47cded398
|
||||
sha256: a631bbfbfa26963d68046aed949df80b228964020e9155b086eff94f462bbf1f
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "3.3.0"
|
||||
version: "3.3.1"
|
||||
firebase_messaging:
|
||||
dependency: "direct main"
|
||||
description:
|
||||
@@ -713,13 +737,13 @@ packages:
|
||||
source: hosted
|
||||
version: "2.13.1"
|
||||
google_maps_flutter_android:
|
||||
dependency: transitive
|
||||
dependency: "direct main"
|
||||
description:
|
||||
name: google_maps_flutter_android
|
||||
sha256: f820a3990d4ff23e3baf01ce794f7f08cca9a9ce6c875ec96882d605f6f039df
|
||||
sha256: "3835f6ae5e8b8d4d454d913575069513c9f216e088b87aa5c18cb3610951c6b4"
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "2.18.4"
|
||||
version: "2.18.6"
|
||||
google_maps_flutter_ios:
|
||||
dependency: transitive
|
||||
description:
|
||||
@@ -729,13 +753,13 @@ packages:
|
||||
source: hosted
|
||||
version: "2.15.5"
|
||||
google_maps_flutter_platform_interface:
|
||||
dependency: transitive
|
||||
dependency: "direct main"
|
||||
description:
|
||||
name: google_maps_flutter_platform_interface
|
||||
sha256: f4b9b44f7b12a1f6707ffc79d082738e0b7e194bf728ee61d2b3cdf5fdf16081
|
||||
sha256: e8b1232419fcdd35c1fdafff96843f5a40238480365599d8ca661dde96d283dd
|
||||
url: "https://pub.dev"
|
||||
source: hosted
|
||||
version: "2.14.0"
|
||||
version: "2.14.1"
|
||||
google_maps_flutter_web:
|
||||
dependency: transitive
|
||||
description:
|
||||
@@ -1089,7 +1113,7 @@ packages:
|
||||
source: hosted
|
||||
version: "2.2.0"
|
||||
package_info_plus:
|
||||
dependency: transitive
|
||||
dependency: "direct main"
|
||||
description:
|
||||
name: package_info_plus
|
||||
sha256: "16eee997588c60225bda0488b6dcfac69280a6b7a3cf02c741895dd370a02968"
|
||||
|
||||
12
pubspec.yaml
12
pubspec.yaml
@@ -16,7 +16,7 @@ publish_to: 'none' # Remove this line if you wish to publish to pub.dev
|
||||
# https://developer.apple.com/library/archive/documentation/General/Reference/InfoPlistKeyReference/Articles/CoreFoundationKeys.html
|
||||
# In Windows, build-name is used as the major, minor, and patch parts
|
||||
# of the product and file versions while build-number is used as the build suffix.
|
||||
version: 1.0.0+1
|
||||
version: 2026.1.3+1
|
||||
|
||||
environment:
|
||||
sdk: ^3.9.2
|
||||
@@ -63,17 +63,17 @@ dependencies:
|
||||
image: ^4.5.4
|
||||
firebase_messaging: ^16.0.4
|
||||
flutter_local_notifications: ^19.5.0
|
||||
package_info_plus: ^8.3.1
|
||||
google_maps_flutter_platform_interface: ^2.14.1
|
||||
google_maps_flutter_android: ^2.18.6
|
||||
firebase_analytics: ^12.1.0
|
||||
|
||||
dev_dependencies:
|
||||
flutter_launcher_icons: ^0.13.1
|
||||
flutter_test:
|
||||
sdk: flutter
|
||||
|
||||
# The "flutter_lints" package below contains a set of recommended lints to
|
||||
# encourage good coding practices. The lint set provided by the package is
|
||||
# activated in the `analysis_options.yaml` file located at the root of your
|
||||
# package. See that file for information about deactivating specific lint
|
||||
# rules and activating additional ones.
|
||||
|
||||
flutter_lints: ^6.0.0
|
||||
mockito: ^5.4.4
|
||||
build_runner: ^2.4.8
|
||||
|
||||
Reference in New Issue
Block a user