feat(activities): add autocomplete & what's new popup

Features:
- Add autocomplete support for Activity search with Google Places API.
- Add "What's New" popup system to showcase new features on app update.
- Implement logic to detect fresh installs vs updates.

Fixes:
- Switch API key handling to use Firebase config for Release mode support.
- Refactor map pins to be consistent (red pins).
- UI fixes on Create Trip page (overflow issues).

Refactor:
- Make WhatsNewDialog reusable by accepting features list as parameter.

.VSCodeCounter/2025-10-14_11-10-48/details.md

@@ -1,82 +0,0 @@
-# Details
-
-Date : 2025-10-14 11:10:48
-
-Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
-
-Total : 67 files,  5159 codes, 328 comments, 739 blanks, all 6226 lines
-
-[Summary](results.md) / Details / [Diff Summary](diff.md) / [Diff Details](diff-details.md)
-
-## Files
-| filename | language | code | comment | blank | total |
-| :--- | :--- | ---: | ---: | ---: | ---: |
-| [README.md](/README.md) | Markdown | 45 | 0 | 16 | 61 |
-| [analysis\_options.yaml](/analysis_options.yaml) | YAML | 3 | 22 | 4 | 29 |
-| [android/app/google-services.json](/android/app/google-services.json) | JSON | 54 | 0 | 0 | 54 |
-| [android/app/src/debug/AndroidManifest.xml](/android/app/src/debug/AndroidManifest.xml) | XML | 3 | 4 | 1 | 8 |
-| [android/app/src/main/AndroidManifest.xml](/android/app/src/main/AndroidManifest.xml) | XML | 40 | 11 | 1 | 52 |
-| [android/app/src/main/res/drawable-v21/launch\_background.xml](/android/app/src/main/res/drawable-v21/launch_background.xml) | XML | 4 | 7 | 2 | 13 |
-| [android/app/src/main/res/drawable/launch\_background.xml](/android/app/src/main/res/drawable/launch_background.xml) | XML | 4 | 7 | 2 | 13 |
-| [android/app/src/main/res/values-night/styles.xml](/android/app/src/main/res/values-night/styles.xml) | XML | 9 | 9 | 1 | 19 |
-| [android/app/src/main/res/values/styles.xml](/android/app/src/main/res/values/styles.xml) | XML | 9 | 9 | 1 | 19 |
-| [android/app/src/profile/AndroidManifest.xml](/android/app/src/profile/AndroidManifest.xml) | XML | 3 | 4 | 1 | 8 |
-| [android/build/reports/problems/problems-report.html](/android/build/reports/problems/problems-report.html) | HTML | 548 | 2 | 114 | 664 |
-| [android/gradle.properties](/android/gradle.properties) | Properties | 3 | 0 | 1 | 4 |
-| [android/gradle/wrapper/gradle-wrapper.properties](/android/gradle/wrapper/gradle-wrapper.properties) | Properties | 5 | 0 | 1 | 6 |
-| [firebase.json](/firebase.json) | JSON | 1 | 0 | 0 | 1 |
-| [ios/Podfile](/ios/Podfile) | Ruby | 32 | 2 | 10 | 44 |
-| [ios/RunnerTests/RunnerTests.swift](/ios/RunnerTests/RunnerTests.swift) | Swift | 7 | 2 | 4 | 13 |
-| [ios/Runner/AppDelegate.swift](/ios/Runner/AppDelegate.swift) | Swift | 14 | 0 | 2 | 16 |
-| [ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json](/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json) | JSON | 122 | 0 | 1 | 123 |
-| [ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json](/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json) | JSON | 23 | 0 | 1 | 24 |
-| [ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md](/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md) | Markdown | 3 | 0 | 2 | 5 |
-| [ios/Runner/Base.lproj/LaunchScreen.storyboard](/ios/Runner/Base.lproj/LaunchScreen.storyboard) | XML | 36 | 1 | 1 | 38 |
-| [ios/Runner/Base.lproj/Main.storyboard](/ios/Runner/Base.lproj/Main.storyboard) | XML | 25 | 1 | 1 | 27 |
-| [ios/Runner/Runner-Bridging-Header.h](/ios/Runner/Runner-Bridging-Header.h) | C++ | 1 | 0 | 1 | 2 |
-| [lib/blocs/auth/auth\_bloc.dart](/lib/blocs/auth/auth_bloc.dart) | Dart | 129 | 1 | 20 | 150 |
-| [lib/blocs/auth/auth\_event.dart](/lib/blocs/auth/auth_event.dart) | Dart | 40 | 0 | 15 | 55 |
-| [lib/blocs/auth/auth\_state.dart](/lib/blocs/auth/auth_state.dart) | Dart | 28 | 0 | 14 | 42 |
-| [lib/blocs/theme/theme\_bloc.dart](/lib/blocs/theme/theme_bloc.dart) | Dart | 40 | 1 | 5 | 46 |
-| [lib/blocs/theme/theme\_event.dart](/lib/blocs/theme/theme_event.dart) | Dart | 14 | 0 | 6 | 20 |
-| [lib/blocs/theme/theme\_state.dart](/lib/blocs/theme/theme_state.dart) | Dart | 16 | 0 | 5 | 21 |
-| [lib/blocs/trip/trip\_bloc.dart](/lib/blocs/trip/trip_bloc.dart) | Dart | 103 | 1 | 14 | 118 |
-| [lib/blocs/trip/trip\_event.dart](/lib/blocs/trip/trip_event.dart) | Dart | 51 | 0 | 20 | 71 |
-| [lib/blocs/trip/trip\_state.dart](/lib/blocs/trip/trip_state.dart) | Dart | 27 | 0 | 13 | 40 |
-| [lib/blocs/user/user\_bloc.dart](/lib/blocs/user/user_bloc.dart) | Dart | 0 | 0 | 1 | 1 |
-| [lib/blocs/user/user\_event.dart](/lib/blocs/user/user_event.dart) | Dart | 0 | 0 | 1 | 1 |
-| [lib/blocs/user/user\_state.dart](/lib/blocs/user/user_state.dart) | Dart | 0 | 0 | 1 | 1 |
-| [lib/components/count/count\_content.dart](/lib/components/count/count_content.dart) | Dart | 25 | 0 | 3 | 28 |
-| [lib/components/group/group\_content.dart](/lib/components/group/group_content.dart) | Dart | 115 | 2 | 12 | 129 |
-| [lib/components/home/create\_trip\_content.dart](/lib/components/home/create_trip_content.dart) | Dart | 481 | 21 | 63 | 565 |
-| [lib/components/home/home\_content.dart](/lib/components/home/home_content.dart) | Dart | 366 | 12 | 30 | 408 |
-| [lib/components/home/show\_trip\_details\_content.dart](/lib/components/home/show_trip_details_content.dart) | Dart | 106 | 2 | 4 | 112 |
-| [lib/components/map/map\_content.dart](/lib/components/map/map_content.dart) | Dart | 100 | 4 | 11 | 115 |
-| [lib/components/profile/profile\_content.dart](/lib/components/profile/profile_content.dart) | Dart | 328 | 6 | 29 | 363 |
-| [lib/components/settings/settings\_content.dart](/lib/components/settings/settings_content.dart) | Dart | 60 | 2 | 10 | 72 |
-| [lib/components/settings/settings\_theme\_content.dart](/lib/components/settings/settings_theme_content.dart) | Dart | 123 | 4 | 10 | 137 |
-| [lib/data/data\_sources/firestore\_data\_source.dart](/lib/data/data_sources/firestore_data_source.dart) | Dart | 0 | 0 | 1 | 1 |
-| [lib/data/data\_sources/local\_data\_source.dart](/lib/data/data_sources/local_data_source.dart) | Dart | 0 | 0 | 1 | 1 |
-| [lib/data/models/group.dart](/lib/data/models/group.dart) | Dart | 23 | 0 | 3 | 26 |
-| [lib/data/models/message.dart](/lib/data/models/message.dart) | Dart | 14 | 0 | 1 | 15 |
-| [lib/data/models/trip.dart](/lib/data/models/trip.dart) | Dart | 176 | 16 | 24 | 216 |
-| [lib/data/models/user.dart](/lib/data/models/user.dart) | Dart | 61 | 6 | 13 | 80 |
-| [lib/firebase\_options.dart](/lib/firebase_options.dart) | Dart | 60 | 12 | 5 | 77 |
-| [lib/main.dart](/lib/main.dart) | Dart | 89 | 0 | 5 | 94 |
-| [lib/pages/home.dart](/lib/pages/home.dart) | Dart | 147 | 6 | 13 | 166 |
-| [lib/pages/login.dart](/lib/pages/login.dart) | Dart | 285 | 9 | 28 | 322 |
-| [lib/pages/resetpswd.dart](/lib/pages/resetpswd.dart) | Dart | 92 | 2 | 13 | 107 |
-| [lib/pages/signup.dart](/lib/pages/signup.dart) | Dart | 256 | 7 | 20 | 283 |
-| [lib/providers/theme\_provider.dart](/lib/providers/theme_provider.dart) | Dart | 41 | 1 | 9 | 51 |
-| [lib/providers/user\_provider.dart](/lib/providers/user_provider.dart) | Dart | 94 | 9 | 18 | 121 |
-| [lib/repositories/auth\_repository.dart](/lib/repositories/auth_repository.dart) | Dart | 115 | 11 | 22 | 148 |
-| [lib/repositories/trip\_repository.dart](/lib/repositories/trip_repository.dart) | Dart | 92 | 9 | 12 | 113 |
-| [lib/repositories/user\_repository.dart](/lib/repositories/user_repository.dart) | Dart | 77 | 7 | 11 | 95 |
-| [lib/services/auth\_service.dart](/lib/services/auth_service.dart) | Dart | 84 | 6 | 18 | 108 |
-| [lib/services/group\_service.dart](/lib/services/group_service.dart) | Dart | 53 | 1 | 6 | 60 |
-| [lib/services/message\_service.dart](/lib/services/message_service.dart) | Dart | 0 | 0 | 1 | 1 |
-| [lib/services/trip\_service.dart](/lib/services/trip_service.dart) | Dart | 209 | 21 | 39 | 269 |
-| [pubspec.yaml](/pubspec.yaml) | YAML | 31 | 58 | 14 | 103 |
-| [test/widget\_test.dart](/test/widget_test.dart) | Dart | 14 | 10 | 7 | 31 |
-
-[Summary](results.md) / Details / [Diff Summary](diff.md) / [Diff Details](diff-details.md)

.VSCodeCounter/2025-10-14_11-10-48/diff-details.md

@@ -1,15 +0,0 @@
-# Diff Details
-
-Date : 2025-10-14 11:10:48
-
-Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
-
-Total : 0 files,  0 codes, 0 comments, 0 blanks, all 0 lines
-
-[Summary](results.md) / [Details](details.md) / [Diff Summary](diff.md) / Diff Details
-
-## Files
-| filename | language | code | comment | blank | total |
-| :--- | :--- | ---: | ---: | ---: | ---: |
-
-[Summary](results.md) / [Details](details.md) / [Diff Summary](diff.md) / Diff Details

.VSCodeCounter/2025-10-14_11-10-48/diff.csv

@@ -1,2 +0,0 @@
-"filename", "language", "", "comment", "blank", "total"
-"Total", "-", , 0, 0, 0

.VSCodeCounter/2025-10-14_11-10-48/diff.md

@@ -1,19 +0,0 @@
-# Diff Summary
-
-Date : 2025-10-14 11:10:48
-
-Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
-
-Total : 0 files,  0 codes, 0 comments, 0 blanks, all 0 lines
-
-[Summary](results.md) / [Details](details.md) / Diff Summary / [Diff Details](diff-details.md)
-
-## Languages
-| language | files | code | comment | blank | total |
-| :--- | ---: | ---: | ---: | ---: | ---: |
-
-## Directories
-| path | files | code | comment | blank | total |
-| :--- | ---: | ---: | ---: | ---: | ---: |
-
-[Summary](results.md) / [Details](details.md) / Diff Summary / [Diff Details](diff-details.md)

.VSCodeCounter/2025-10-14_11-10-48/diff.txt

@@ -1,22 +0,0 @@
-Date : 2025-10-14 11:10:48
-Directory : c:\Users\dayro\Documents\coding\travel_mate
-Total : 0 files,  0 codes, 0 comments, 0 blanks, all 0 lines
-
-Languages
-+----------+------------+------------+------------+------------+------------+
-| language | files      | code       | comment    | blank      | total      |
-+----------+------------+------------+------------+------------+------------+
-+----------+------------+------------+------------+------------+------------+
-
-Directories
-+------+------------+------------+------------+------------+------------+
-| path | files      | code       | comment    | blank      | total      |
-+------+------------+------------+------------+------------+------------+
-+------+------------+------------+------------+------------+------------+
-
-Files
-+----------+----------+------------+------------+------------+------------+
-| filename | language | code       | comment    | blank      | total      |
-+----------+----------+------------+------------+------------+------------+
-| Total    |          |          0 |          0 |          0 |          0 |
-+----------+----------+------------+------------+------------+------------+

.VSCodeCounter/2025-10-14_11-10-48/results.csv

@@ -1,69 +0,0 @@
-"filename", "language", "YAML", "Markdown", "Dart", "JSON", "Swift", "C++", "XML", "Ruby", "Properties", "HTML", "comment", "blank", "total"
-"c:\Users\dayro\Documents\coding\travel_mate\README.md", "Markdown", 0, 45, 0, 0, 0, 0, 0, 0, 0, 0, 0, 16, 61
-"c:\Users\dayro\Documents\coding\travel_mate\analysis_options.yaml", "YAML", 3, 0, 0, 0, 0, 0, 0, 0, 0, 0, 22, 4, 29
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\google-services.json", "JSON", 0, 0, 0, 54, 0, 0, 0, 0, 0, 0, 0, 0, 54
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\debug\AndroidManifest.xml", "XML", 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 4, 1, 8
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\AndroidManifest.xml", "XML", 0, 0, 0, 0, 0, 0, 40, 0, 0, 0, 11, 1, 52
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable-v21\launch_background.xml", "XML", 0, 0, 0, 0, 0, 0, 4, 0, 0, 0, 7, 2, 13
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable\launch_background.xml", "XML", 0, 0, 0, 0, 0, 0, 4, 0, 0, 0, 7, 2, 13
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values-night\styles.xml", "XML", 0, 0, 0, 0, 0, 0, 9, 0, 0, 0, 9, 1, 19
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values\styles.xml", "XML", 0, 0, 0, 0, 0, 0, 9, 0, 0, 0, 9, 1, 19
-"c:\Users\dayro\Documents\coding\travel_mate\android\app\src\profile\AndroidManifest.xml", "XML", 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 4, 1, 8
-"c:\Users\dayro\Documents\coding\travel_mate\android\build\reports\problems\problems-report.html", "HTML", 0, 0, 0, 0, 0, 0, 0, 0, 0, 548, 2, 114, 664
-"c:\Users\dayro\Documents\coding\travel_mate\android\gradle.properties", "Properties", 0, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 1, 4
-"c:\Users\dayro\Documents\coding\travel_mate\android\gradle\wrapper\gradle-wrapper.properties", "Properties", 0, 0, 0, 0, 0, 0, 0, 0, 5, 0, 0, 1, 6
-"c:\Users\dayro\Documents\coding\travel_mate\firebase.json", "JSON", 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 0, 1
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Podfile", "Ruby", 0, 0, 0, 0, 0, 0, 0, 32, 0, 0, 2, 10, 44
-"c:\Users\dayro\Documents\coding\travel_mate\ios\RunnerTests\RunnerTests.swift", "Swift", 0, 0, 0, 0, 7, 0, 0, 0, 0, 0, 2, 4, 13
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\AppDelegate.swift", "Swift", 0, 0, 0, 0, 14, 0, 0, 0, 0, 0, 0, 2, 16
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\AppIcon.appiconset\Contents.json", "JSON", 0, 0, 0, 122, 0, 0, 0, 0, 0, 0, 0, 1, 123
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\Contents.json", "JSON", 0, 0, 0, 23, 0, 0, 0, 0, 0, 0, 0, 1, 24
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\README.md", "Markdown", 0, 3, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 5
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\LaunchScreen.storyboard", "XML", 0, 0, 0, 0, 0, 0, 36, 0, 0, 0, 1, 1, 38
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\Main.storyboard", "XML", 0, 0, 0, 0, 0, 0, 25, 0, 0, 0, 1, 1, 27
-"c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Runner-Bridging-Header.h", "C++", 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 2
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_bloc.dart", "Dart", 0, 0, 129, 0, 0, 0, 0, 0, 0, 0, 1, 20, 150
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_event.dart", "Dart", 0, 0, 40, 0, 0, 0, 0, 0, 0, 0, 0, 15, 55
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_state.dart", "Dart", 0, 0, 28, 0, 0, 0, 0, 0, 0, 0, 0, 14, 42
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_bloc.dart", "Dart", 0, 0, 40, 0, 0, 0, 0, 0, 0, 0, 1, 5, 46
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_event.dart", "Dart", 0, 0, 14, 0, 0, 0, 0, 0, 0, 0, 0, 6, 20
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_state.dart", "Dart", 0, 0, 16, 0, 0, 0, 0, 0, 0, 0, 0, 5, 21
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_bloc.dart", "Dart", 0, 0, 103, 0, 0, 0, 0, 0, 0, 0, 1, 14, 118
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_event.dart", "Dart", 0, 0, 51, 0, 0, 0, 0, 0, 0, 0, 0, 20, 71
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_state.dart", "Dart", 0, 0, 27, 0, 0, 0, 0, 0, 0, 0, 0, 13, 40
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_bloc.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_event.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
-"c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_state.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\count\count_content.dart", "Dart", 0, 0, 25, 0, 0, 0, 0, 0, 0, 0, 0, 3, 28
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\group\group_content.dart", "Dart", 0, 0, 115, 0, 0, 0, 0, 0, 0, 0, 2, 12, 129
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\create_trip_content.dart", "Dart", 0, 0, 481, 0, 0, 0, 0, 0, 0, 0, 21, 63, 565
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\home_content.dart", "Dart", 0, 0, 366, 0, 0, 0, 0, 0, 0, 0, 12, 30, 408
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\show_trip_details_content.dart", "Dart", 0, 0, 106, 0, 0, 0, 0, 0, 0, 0, 2, 4, 112
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\map\map_content.dart", "Dart", 0, 0, 100, 0, 0, 0, 0, 0, 0, 0, 4, 11, 115
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\profile\profile_content.dart", "Dart", 0, 0, 328, 0, 0, 0, 0, 0, 0, 0, 6, 29, 363
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_content.dart", "Dart", 0, 0, 60, 0, 0, 0, 0, 0, 0, 0, 2, 10, 72
-"c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_theme_content.dart", "Dart", 0, 0, 123, 0, 0, 0, 0, 0, 0, 0, 4, 10, 137
-"c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\firestore_data_source.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
-"c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\local_data_source.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
-"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\group.dart", "Dart", 0, 0, 23, 0, 0, 0, 0, 0, 0, 0, 0, 3, 26
-"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\message.dart", "Dart", 0, 0, 14, 0, 0, 0, 0, 0, 0, 0, 0, 1, 15
-"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\trip.dart", "Dart", 0, 0, 176, 0, 0, 0, 0, 0, 0, 0, 16, 24, 216
-"c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\user.dart", "Dart", 0, 0, 61, 0, 0, 0, 0, 0, 0, 0, 6, 13, 80
-"c:\Users\dayro\Documents\coding\travel_mate\lib\firebase_options.dart", "Dart", 0, 0, 60, 0, 0, 0, 0, 0, 0, 0, 12, 5, 77
-"c:\Users\dayro\Documents\coding\travel_mate\lib\main.dart", "Dart", 0, 0, 89, 0, 0, 0, 0, 0, 0, 0, 0, 5, 94
-"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\home.dart", "Dart", 0, 0, 147, 0, 0, 0, 0, 0, 0, 0, 6, 13, 166
-"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\login.dart", "Dart", 0, 0, 285, 0, 0, 0, 0, 0, 0, 0, 9, 28, 322
-"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\resetpswd.dart", "Dart", 0, 0, 92, 0, 0, 0, 0, 0, 0, 0, 2, 13, 107
-"c:\Users\dayro\Documents\coding\travel_mate\lib\pages\signup.dart", "Dart", 0, 0, 256, 0, 0, 0, 0, 0, 0, 0, 7, 20, 283
-"c:\Users\dayro\Documents\coding\travel_mate\lib\providers\theme_provider.dart", "Dart", 0, 0, 41, 0, 0, 0, 0, 0, 0, 0, 1, 9, 51
-"c:\Users\dayro\Documents\coding\travel_mate\lib\providers\user_provider.dart", "Dart", 0, 0, 94, 0, 0, 0, 0, 0, 0, 0, 9, 18, 121
-"c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\auth_repository.dart", "Dart", 0, 0, 115, 0, 0, 0, 0, 0, 0, 0, 11, 22, 148
-"c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\trip_repository.dart", "Dart", 0, 0, 92, 0, 0, 0, 0, 0, 0, 0, 9, 12, 113
-"c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\user_repository.dart", "Dart", 0, 0, 77, 0, 0, 0, 0, 0, 0, 0, 7, 11, 95
-"c:\Users\dayro\Documents\coding\travel_mate\lib\services\auth_service.dart", "Dart", 0, 0, 84, 0, 0, 0, 0, 0, 0, 0, 6, 18, 108
-"c:\Users\dayro\Documents\coding\travel_mate\lib\services\group_service.dart", "Dart", 0, 0, 53, 0, 0, 0, 0, 0, 0, 0, 1, 6, 60
-"c:\Users\dayro\Documents\coding\travel_mate\lib\services\message_service.dart", "Dart", 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1
-"c:\Users\dayro\Documents\coding\travel_mate\lib\services\trip_service.dart", "Dart", 0, 0, 209, 0, 0, 0, 0, 0, 0, 0, 21, 39, 269
-"c:\Users\dayro\Documents\coding\travel_mate\pubspec.yaml", "YAML", 31, 0, 0, 0, 0, 0, 0, 0, 0, 0, 58, 14, 103
-"c:\Users\dayro\Documents\coding\travel_mate\test\widget_test.dart", "Dart", 0, 0, 14, 0, 0, 0, 0, 0, 0, 0, 10, 7, 31
-"Total", "-", 34, 48, 4134, 200, 21, 1, 133, 32, 8, 548, 328, 739, 6226

.VSCodeCounter/2025-10-14_11-10-48/results.md

@@ -1,81 +0,0 @@
-# Summary
-
-Date : 2025-10-14 11:10:48
-
-Directory c:\\Users\\dayro\\Documents\\coding\\travel_mate
-
-Total : 67 files,  5159 codes, 328 comments, 739 blanks, all 6226 lines
-
-Summary / [Details](details.md) / [Diff Summary](diff.md) / [Diff Details](diff-details.md)
-
-## Languages
-| language | files | code | comment | blank | total |
-| :--- | ---: | ---: | ---: | ---: | ---: |
-| Dart | 43 | 4,134 | 189 | 557 | 4,880 |
-| HTML | 1 | 548 | 2 | 114 | 664 |
-| JSON | 4 | 200 | 0 | 2 | 202 |
-| XML | 9 | 133 | 53 | 11 | 197 |
-| Markdown | 2 | 48 | 0 | 18 | 66 |
-| YAML | 2 | 34 | 80 | 18 | 132 |
-| Ruby | 1 | 32 | 2 | 10 | 44 |
-| Swift | 2 | 21 | 2 | 6 | 29 |
-| Properties | 2 | 8 | 0 | 2 | 10 |
-| C++ | 1 | 1 | 0 | 1 | 2 |
-
-## Directories
-| path | files | code | comment | blank | total |
-| :--- | ---: | ---: | ---: | ---: | ---: |
-| . | 67 | 5,159 | 328 | 739 | 6,226 |
-| . (Files) | 4 | 80 | 80 | 34 | 194 |
-| android | 11 | 682 | 53 | 125 | 860 |
-| android (Files) | 1 | 3 | 0 | 1 | 4 |
-| android\\app | 8 | 126 | 51 | 9 | 186 |
-| android\\app (Files) | 1 | 54 | 0 | 0 | 54 |
-| android\\app\\src | 7 | 72 | 51 | 9 | 132 |
-| android\\app\\src\\debug | 1 | 3 | 4 | 1 | 8 |
-| android\\app\\src\\main | 5 | 66 | 43 | 7 | 116 |
-| android\\app\\src\\main (Files) | 1 | 40 | 11 | 1 | 52 |
-| android\\app\\src\\main\\res | 4 | 26 | 32 | 6 | 64 |
-| android\\app\\src\\main\\res\\drawable | 1 | 4 | 7 | 2 | 13 |
-| android\\app\\src\\main\\res\\drawable-v21 | 1 | 4 | 7 | 2 | 13 |
-| android\\app\\src\\main\\res\\values | 1 | 9 | 9 | 1 | 19 |
-| android\\app\\src\\main\\res\\values-night | 1 | 9 | 9 | 1 | 19 |
-| android\\app\\src\\profile | 1 | 3 | 4 | 1 | 8 |
-| android\\build | 1 | 548 | 2 | 114 | 664 |
-| android\\build\\reports | 1 | 548 | 2 | 114 | 664 |
-| android\\build\\reports\\problems | 1 | 548 | 2 | 114 | 664 |
-| android\\gradle | 1 | 5 | 0 | 1 | 6 |
-| android\\gradle\\wrapper | 1 | 5 | 0 | 1 | 6 |
-| ios | 9 | 263 | 6 | 23 | 292 |
-| ios (Files) | 1 | 32 | 2 | 10 | 44 |
-| ios\\Runner | 7 | 224 | 2 | 9 | 235 |
-| ios\\Runner (Files) | 2 | 15 | 0 | 3 | 18 |
-| ios\\RunnerTests | 1 | 7 | 2 | 4 | 13 |
-| ios\\Runner\\Assets.xcassets | 3 | 148 | 0 | 4 | 152 |
-| ios\\Runner\\Assets.xcassets\\AppIcon.appiconset | 1 | 122 | 0 | 1 | 123 |
-| ios\\Runner\\Assets.xcassets\\LaunchImage.imageset | 2 | 26 | 0 | 3 | 29 |
-| ios\\Runner\\Base.lproj | 2 | 61 | 2 | 2 | 65 |
-| lib | 42 | 4,120 | 179 | 550 | 4,849 |
-| lib (Files) | 2 | 149 | 12 | 10 | 171 |
-| lib\\blocs | 12 | 448 | 3 | 115 | 566 |
-| lib\\blocs\\auth | 3 | 197 | 1 | 49 | 247 |
-| lib\\blocs\\theme | 3 | 70 | 1 | 16 | 87 |
-| lib\\blocs\\trip | 3 | 181 | 1 | 47 | 229 |
-| lib\\blocs\\user | 3 | 0 | 0 | 3 | 3 |
-| lib\\components | 9 | 1,704 | 53 | 172 | 1,929 |
-| lib\\components\\count | 1 | 25 | 0 | 3 | 28 |
-| lib\\components\\group | 1 | 115 | 2 | 12 | 129 |
-| lib\\components\\home | 3 | 953 | 35 | 97 | 1,085 |
-| lib\\components\\map | 1 | 100 | 4 | 11 | 115 |
-| lib\\components\\profile | 1 | 328 | 6 | 29 | 363 |
-| lib\\components\\settings | 2 | 183 | 6 | 20 | 209 |
-| lib\\data | 6 | 274 | 22 | 43 | 339 |
-| lib\\data\\data_sources | 2 | 0 | 0 | 2 | 2 |
-| lib\\data\\models | 4 | 274 | 22 | 41 | 337 |
-| lib\\pages | 4 | 780 | 24 | 74 | 878 |
-| lib\\providers | 2 | 135 | 10 | 27 | 172 |
-| lib\\repositories | 3 | 284 | 27 | 45 | 356 |
-| lib\\services | 4 | 346 | 28 | 64 | 438 |
-| test | 1 | 14 | 10 | 7 | 31 |
-
-Summary / [Details](details.md) / [Diff Summary](diff.md) / [Diff Details](diff-details.md)

.VSCodeCounter/2025-10-14_11-10-48/results.txt

@@ -1,151 +0,0 @@
-Date : 2025-10-14 11:10:48
-Directory : c:\Users\dayro\Documents\coding\travel_mate
-Total : 67 files,  5159 codes, 328 comments, 739 blanks, all 6226 lines
-
-Languages
-+------------+------------+------------+------------+------------+------------+
-| language   | files      | code       | comment    | blank      | total      |
-+------------+------------+------------+------------+------------+------------+
-| Dart       |         43 |      4,134 |        189 |        557 |      4,880 |
-| HTML       |          1 |        548 |          2 |        114 |        664 |
-| JSON       |          4 |        200 |          0 |          2 |        202 |
-| XML        |          9 |        133 |         53 |         11 |        197 |
-| Markdown   |          2 |         48 |          0 |         18 |         66 |
-| YAML       |          2 |         34 |         80 |         18 |        132 |
-| Ruby       |          1 |         32 |          2 |         10 |         44 |
-| Swift      |          2 |         21 |          2 |          6 |         29 |
-| Properties |          2 |          8 |          0 |          2 |         10 |
-| C++        |          1 |          1 |          0 |          1 |          2 |
-+------------+------------+------------+------------+------------+------------+
-
-Directories
-+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
-| path                                                                                                      | files      | code       | comment    | blank      | total      |
-+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
-| .                                                                                                         |         67 |      5,159 |        328 |        739 |      6,226 |
-| . (Files)                                                                                                 |          4 |         80 |         80 |         34 |        194 |
-| android                                                                                                   |         11 |        682 |         53 |        125 |        860 |
-| android (Files)                                                                                           |          1 |          3 |          0 |          1 |          4 |
-| android\app                                                                                               |          8 |        126 |         51 |          9 |        186 |
-| android\app (Files)                                                                                       |          1 |         54 |          0 |          0 |         54 |
-| android\app\src                                                                                           |          7 |         72 |         51 |          9 |        132 |
-| android\app\src\debug                                                                                     |          1 |          3 |          4 |          1 |          8 |
-| android\app\src\main                                                                                      |          5 |         66 |         43 |          7 |        116 |
-| android\app\src\main (Files)                                                                              |          1 |         40 |         11 |          1 |         52 |
-| android\app\src\main\res                                                                                  |          4 |         26 |         32 |          6 |         64 |
-| android\app\src\main\res\drawable                                                                         |          1 |          4 |          7 |          2 |         13 |
-| android\app\src\main\res\drawable-v21                                                                     |          1 |          4 |          7 |          2 |         13 |
-| android\app\src\main\res\values                                                                           |          1 |          9 |          9 |          1 |         19 |
-| android\app\src\main\res\values-night                                                                     |          1 |          9 |          9 |          1 |         19 |
-| android\app\src\profile                                                                                   |          1 |          3 |          4 |          1 |          8 |
-| android\build                                                                                             |          1 |        548 |          2 |        114 |        664 |
-| android\build\reports                                                                                     |          1 |        548 |          2 |        114 |        664 |
-| android\build\reports\problems                                                                            |          1 |        548 |          2 |        114 |        664 |
-| android\gradle                                                                                            |          1 |          5 |          0 |          1 |          6 |
-| android\gradle\wrapper                                                                                    |          1 |          5 |          0 |          1 |          6 |
-| ios                                                                                                       |          9 |        263 |          6 |         23 |        292 |
-| ios (Files)                                                                                               |          1 |         32 |          2 |         10 |         44 |
-| ios\Runner                                                                                                |          7 |        224 |          2 |          9 |        235 |
-| ios\Runner (Files)                                                                                        |          2 |         15 |          0 |          3 |         18 |
-| ios\RunnerTests                                                                                           |          1 |          7 |          2 |          4 |         13 |
-| ios\Runner\Assets.xcassets                                                                                |          3 |        148 |          0 |          4 |        152 |
-| ios\Runner\Assets.xcassets\AppIcon.appiconset                                                             |          1 |        122 |          0 |          1 |        123 |
-| ios\Runner\Assets.xcassets\LaunchImage.imageset                                                           |          2 |         26 |          0 |          3 |         29 |
-| ios\Runner\Base.lproj                                                                                     |          2 |         61 |          2 |          2 |         65 |
-| lib                                                                                                       |         42 |      4,120 |        179 |        550 |      4,849 |
-| lib (Files)                                                                                               |          2 |        149 |         12 |         10 |        171 |
-| lib\blocs                                                                                                 |         12 |        448 |          3 |        115 |        566 |
-| lib\blocs\auth                                                                                            |          3 |        197 |          1 |         49 |        247 |
-| lib\blocs\theme                                                                                           |          3 |         70 |          1 |         16 |         87 |
-| lib\blocs\trip                                                                                            |          3 |        181 |          1 |         47 |        229 |
-| lib\blocs\user                                                                                            |          3 |          0 |          0 |          3 |          3 |
-| lib\components                                                                                            |          9 |      1,704 |         53 |        172 |      1,929 |
-| lib\components\count                                                                                      |          1 |         25 |          0 |          3 |         28 |
-| lib\components\group                                                                                      |          1 |        115 |          2 |         12 |        129 |
-| lib\components\home                                                                                       |          3 |        953 |         35 |         97 |      1,085 |
-| lib\components\map                                                                                        |          1 |        100 |          4 |         11 |        115 |
-| lib\components\profile                                                                                    |          1 |        328 |          6 |         29 |        363 |
-| lib\components\settings                                                                                   |          2 |        183 |          6 |         20 |        209 |
-| lib\data                                                                                                  |          6 |        274 |         22 |         43 |        339 |
-| lib\data\data_sources                                                                                     |          2 |          0 |          0 |          2 |          2 |
-| lib\data\models                                                                                           |          4 |        274 |         22 |         41 |        337 |
-| lib\pages                                                                                                 |          4 |        780 |         24 |         74 |        878 |
-| lib\providers                                                                                             |          2 |        135 |         10 |         27 |        172 |
-| lib\repositories                                                                                          |          3 |        284 |         27 |         45 |        356 |
-| lib\services                                                                                              |          4 |        346 |         28 |         64 |        438 |
-| test                                                                                                      |          1 |         14 |         10 |          7 |         31 |
-+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
-
-Files
-+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
-| filename                                                                                                  | language   | code       | comment    | blank      | total      |
-+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+
-| c:\Users\dayro\Documents\coding\travel_mate\README.md                                                     | Markdown   |         45 |          0 |         16 |         61 |
-| c:\Users\dayro\Documents\coding\travel_mate\analysis_options.yaml                                         | YAML       |          3 |         22 |          4 |         29 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\google-services.json                              | JSON       |         54 |          0 |          0 |         54 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\debug\AndroidManifest.xml                     | XML        |          3 |          4 |          1 |          8 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\AndroidManifest.xml                      | XML        |         40 |         11 |          1 |         52 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable-v21\launch_background.xml   | XML        |          4 |          7 |          2 |         13 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\drawable\launch_background.xml       | XML        |          4 |          7 |          2 |         13 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values-night\styles.xml              | XML        |          9 |          9 |          1 |         19 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\main\res\values\styles.xml                    | XML        |          9 |          9 |          1 |         19 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\app\src\profile\AndroidManifest.xml                   | XML        |          3 |          4 |          1 |          8 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\build\reports\problems\problems-report.html           | HTML       |        548 |          2 |        114 |        664 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\gradle.properties                                     | Properties |          3 |          0 |          1 |          4 |
-| c:\Users\dayro\Documents\coding\travel_mate\android\gradle\wrapper\gradle-wrapper.properties              | Properties |          5 |          0 |          1 |          6 |
-| c:\Users\dayro\Documents\coding\travel_mate\firebase.json                                                 | JSON       |          1 |          0 |          0 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Podfile                                                   | Ruby       |         32 |          2 |         10 |         44 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\RunnerTests\RunnerTests.swift                             | Swift      |          7 |          2 |          4 |         13 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\AppDelegate.swift                                  | Swift      |         14 |          0 |          2 |         16 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\AppIcon.appiconset\Contents.json   | JSON       |        122 |          0 |          1 |        123 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\Contents.json | JSON       |         23 |          0 |          1 |         24 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Assets.xcassets\LaunchImage.imageset\README.md     | Markdown   |          3 |          0 |          2 |          5 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\LaunchScreen.storyboard                 | XML        |         36 |          1 |          1 |         38 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Base.lproj\Main.storyboard                         | XML        |         25 |          1 |          1 |         27 |
-| c:\Users\dayro\Documents\coding\travel_mate\ios\Runner\Runner-Bridging-Header.h                           | C++        |          1 |          0 |          1 |          2 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_bloc.dart                                 | Dart       |        129 |          1 |         20 |        150 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_event.dart                                | Dart       |         40 |          0 |         15 |         55 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\auth\auth_state.dart                                | Dart       |         28 |          0 |         14 |         42 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_bloc.dart                               | Dart       |         40 |          1 |          5 |         46 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_event.dart                              | Dart       |         14 |          0 |          6 |         20 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\theme\theme_state.dart                              | Dart       |         16 |          0 |          5 |         21 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_bloc.dart                                 | Dart       |        103 |          1 |         14 |        118 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_event.dart                                | Dart       |         51 |          0 |         20 |         71 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\trip\trip_state.dart                                | Dart       |         27 |          0 |         13 |         40 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_bloc.dart                                 | Dart       |          0 |          0 |          1 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_event.dart                                | Dart       |          0 |          0 |          1 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\blocs\user\user_state.dart                                | Dart       |          0 |          0 |          1 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\count\count_content.dart                       | Dart       |         25 |          0 |          3 |         28 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\group\group_content.dart                       | Dart       |        115 |          2 |         12 |        129 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\create_trip_content.dart                  | Dart       |        481 |         21 |         63 |        565 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\home_content.dart                         | Dart       |        366 |         12 |         30 |        408 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\home\show_trip_details_content.dart            | Dart       |        106 |          2 |          4 |        112 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\map\map_content.dart                           | Dart       |        100 |          4 |         11 |        115 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\profile\profile_content.dart                   | Dart       |        328 |          6 |         29 |        363 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_content.dart                 | Dart       |         60 |          2 |         10 |         72 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\components\settings\settings_theme_content.dart           | Dart       |        123 |          4 |         10 |        137 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\firestore_data_source.dart              | Dart       |          0 |          0 |          1 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\data\data_sources\local_data_source.dart                  | Dart       |          0 |          0 |          1 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\group.dart                                    | Dart       |         23 |          0 |          3 |         26 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\message.dart                                  | Dart       |         14 |          0 |          1 |         15 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\trip.dart                                     | Dart       |        176 |         16 |         24 |        216 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\data\models\user.dart                                     | Dart       |         61 |          6 |         13 |         80 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\firebase_options.dart                                     | Dart       |         60 |         12 |          5 |         77 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\main.dart                                                 | Dart       |         89 |          0 |          5 |         94 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\home.dart                                           | Dart       |        147 |          6 |         13 |        166 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\login.dart                                          | Dart       |        285 |          9 |         28 |        322 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\resetpswd.dart                                      | Dart       |         92 |          2 |         13 |        107 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\pages\signup.dart                                         | Dart       |        256 |          7 |         20 |        283 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\providers\theme_provider.dart                             | Dart       |         41 |          1 |          9 |         51 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\providers\user_provider.dart                              | Dart       |         94 |          9 |         18 |        121 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\auth_repository.dart                         | Dart       |        115 |         11 |         22 |        148 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\trip_repository.dart                         | Dart       |         92 |          9 |         12 |        113 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\repositories\user_repository.dart                         | Dart       |         77 |          7 |         11 |         95 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\services\auth_service.dart                                | Dart       |         84 |          6 |         18 |        108 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\services\group_service.dart                               | Dart       |         53 |          1 |          6 |         60 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\services\message_service.dart                             | Dart       |          0 |          0 |          1 |          1 |
-| c:\Users\dayro\Documents\coding\travel_mate\lib\services\trip_service.dart                                | Dart       |        209 |         21 |         39 |        269 |
-| c:\Users\dayro\Documents\coding\travel_mate\pubspec.yaml                                                  | YAML       |         31 |         58 |         14 |        103 |
-| c:\Users\dayro\Documents\coding\travel_mate\test\widget_test.dart                                         | Dart       |         14 |         10 |          7 |         31 |
-| Total                                                                                                     |            |      5,159 |        328 |        739 |      6,226 |
-+-----------------------------------------------------------------------------------------------------------+------------+------------+------------+------------+------------+

.firebaserc

@@ -0,0 +1,5 @@
+{
+  "projects": {
+    "default": "travelmate-a47f5"
+  }
+}

.gitea/workflows/deploy.yaml

@@ -0,0 +1,226 @@
+name: Deploy TravelMate (Full Mobile)
+on:
+  push:
+    branches:
+      - release
+
+jobs:
+  # --- JOB 1 : ANDROID (Génération APK) ---
+  deploy-android:
+    runs-on: macos-latest
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v3
+
+      - name: Configuration Flutter & Secrets
+        run: |
+          flutter pub get
+          echo "${{ secrets.ENV_FILE }}" > .env
+          printf '%s' '${{ secrets.FIREBASE_CREDENTIALS }}' > ./android/firebase_credentials.json
+
+      - name: Build & Deploy Android
+        working-directory: ./android
+        env:
+          ANDROID_KEYSTORE_BASE64: ${{ secrets.ANDROID_KEYSTORE_BASE64 }}
+          RAW_PROPERTIES: ${{ secrets.ANDROID_KEY_PROPERTIES }}
+          FIREBASE_ANDROID_APP_ID: ${{ secrets.FIREBASE_ANDROID_APP_ID }}
+        run: |
+          # 1. Keystore
+          echo "$ANDROID_KEYSTORE_BASE64" | base64 -D > keystore.jks
+          echo "$RAW_PROPERTIES" > temp_props.txt
+          echo "storePassword=$(grep 'storePassword' temp_props.txt | cut -d'=' -f2 | tr -d '\r')" > key.properties
+          echo "keyPassword=$(grep 'keyPassword' temp_props.txt | cut -d'=' -f2 | tr -d '\r')" >> key.properties
+          echo "keyAlias=$(grep 'keyAlias' temp_props.txt | cut -d'=' -f2 | tr -d '\r')" >> key.properties
+          echo "storeFile=$(pwd)/keystore.jks" >> key.properties
+
+          # 2. Gemfile (Correctifs Ruby 3.4 inclus)
+          echo "source 'https://rubygems.org'" > Gemfile
+          echo "gem 'fastlane', '>= 2.230.0'" >> Gemfile
+          echo "gem 'fastlane-plugin-firebase_app_distribution'" >> Gemfile
+          for g in abbrev ostruct mutex_m base64 csv bigdecimal drb nkf reline logger; do echo "gem '$g'" >> Gemfile; done
+          
+          gem install bundler -v 2.7.2 --no-document
+          bundle _2.7.2_ update
+
+          # 3. Build & Envoi
+          cd .. && flutter build apk --release && cd android
+          bundle _2.7.2_ exec fastlane run firebase_app_distribution \
+            app:"$FIREBASE_ANDROID_APP_ID" \
+            android_artifact_path:"../build/app/outputs/flutter-apk/app-release.apk" \
+            service_credentials_file:"firebase_credentials.json"
+
+  # --- JOB 2 : IOS (Génération IPA) ---
+  deploy-ios:
+    runs-on: macos-latest
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v3
+
+      - name: Dépendances iOS & Secrets
+        run: |
+          flutter pub get
+          echo "${{ secrets.ENV_FILE }}" > .env
+          printf '%s' '${{ secrets.FIREBASE_CREDENTIALS }}' > ./ios/firebase_credentials.json
+          cd ios && (pod install --repo-update || pod update)
+
+      - name: Préparer le Code Signing
+        env:
+          P12_BASE: ${{ secrets.IOS_P12_BASE64 }}
+          P12_PASS: ${{ secrets.IOS_P12_PASSWORD }}
+          PROV_BASE: ${{ secrets.IOS_PROVISION_BASE64 }}
+          TEAM_ID: ${{ secrets.IOS_TEAM_ID }}
+        run: |
+          # Créer et configurer le keychain
+          security delete-keychain build.keychain || true
+          security create-keychain -p "" build.keychain
+          security unlock-keychain -p "" build.keychain
+          security list-keychains -d user -s build.keychain $(security list-keychains -d user | xargs)
+          security set-keychain-settings -lut 21600 build.keychain
+          
+          # Importer le certificat
+          echo "$P12_BASE" | base64 -D -o cert.p12
+          security import cert.p12 -k build.keychain -P "$P12_PASS" -T /usr/bin/codesign
+          security set-key-partition-list -S apple-tool:,apple: -s -k "" build.keychain
+          
+          # Installer le profil de provisioning
+          mkdir -p ~/Library/MobileDevice/Provisioning\ Profiles
+          PROFILE_PATH=~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision
+          echo "$PROV_BASE" | base64 -D -o "$PROFILE_PATH"
+          
+          # Extraire l'UUID du profil
+          PROFILE_UUID=$(/usr/libexec/PlistBuddy -c "Print UUID" /dev/stdin <<< $(/usr/bin/security cms -D -i "$PROFILE_PATH"))
+          echo "Profile UUID: $PROFILE_UUID"
+          
+          # Copier avec l'UUID correct
+          cp "$PROFILE_PATH" ~/Library/MobileDevice/Provisioning\ Profiles/$PROFILE_UUID.mobileprovision
+
+      - name: Configurer le projet Xcode
+        env:
+          TEAM_ID: ${{ secrets.IOS_TEAM_ID }}
+          BUNDLE_ID: ${{ secrets.IOS_BUNDLE_ID }}
+        run: |
+          cd ios
+          
+          # Extraire le nom du profil de provisioning
+          PROV_NAME=$(/usr/libexec/PlistBuddy -c "Print Name" /dev/stdin <<< $(/usr/bin/security cms -D -i ~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision))
+          echo "📝 Provisioning Profile Name: $PROV_NAME"
+          
+          # Obtenir l'UUID du profil
+          PROFILE_UUID=$(/usr/libexec/PlistBuddy -c "Print UUID" /dev/stdin <<< $(/usr/bin/security cms -D -i ~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision))
+          echo "🔑 Profile UUID: $PROFILE_UUID"
+          
+          # Sauvegarder les variables pour la prochaine étape
+          echo "$PROV_NAME" > /tmp/prov_name.txt
+          echo "$TEAM_ID" > /tmp/team_id.txt
+          echo "$BUNDLE_ID" > /tmp/bundle_id.txt
+          
+          echo "✅ Configuration des paramètres de signing prête"
+
+      - name: Créer exportOptions.plist
+        env:
+          TEAM_ID: ${{ secrets.IOS_TEAM_ID }}
+          BUNDLE_ID: ${{ secrets.IOS_BUNDLE_ID }}
+        run: |
+          # Extraire le nom du profil
+          PROV_NAME=$(/usr/libexec/PlistBuddy -c "Print Name" /dev/stdin <<< $(/usr/bin/security cms -D -i ~/Library/MobileDevice/Provisioning\ Profiles/distribution.mobileprovision))
+          
+          cat > ios/exportOptions.plist <<EOF
+          <?xml version="1.0" encoding="UTF-8"?>
+          <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+          <plist version="1.0">
+          <dict>
+            <key>method</key>
+            <string>ad-hoc</string>
+            <key>teamID</key>
+            <string>$TEAM_ID</string>
+            <key>signingStyle</key>
+            <string>manual</string>
+            <key>provisioningProfiles</key>
+            <dict>
+              <key>$BUNDLE_ID</key>
+              <string>$PROV_NAME</string>
+            </dict>
+          </dict>
+          </plist>
+          EOF
+
+      - name: Build IPA avec Flutter
+        run: |
+          # Récupérer les variables sauvegardées
+          PROV_NAME=$(cat /tmp/prov_name.txt)
+          TEAM_ID=$(cat /tmp/team_id.txt)
+          BUNDLE_ID=$(cat /tmp/bundle_id.txt)
+          
+          echo "📝 Provisioning Profile: $PROV_NAME"
+          echo "🔑 Team ID: $TEAM_ID"
+          echo "📦 Bundle ID: $BUNDLE_ID"
+          
+          # Clean
+          flutter clean
+          flutter pub get
+          
+          echo "🔨 Build de l'IPA avec Flutter..."
+          
+          # Flutter build ipa gère automatiquement le signing des Pods
+          # On utilise SEULEMENT --export-options-plist (pas --export-method)
+          flutter build ipa \
+            --release \
+            --export-options-plist=ios/exportOptions.plist
+          
+          echo "✅ Build terminé"
+          echo "📂 Recherche de l'IPA..."
+          
+          # L'IPA devrait être dans build/ios/ipa/
+          find build/ios -name "*.ipa" -type f
+          
+          IPA_FILE=$(find build/ios/ipa -name "*.ipa" | head -n 1)
+          
+          if [ -z "$IPA_FILE" ]; then
+            echo "❌ ERREUR: Aucun fichier IPA trouvé !"
+            echo "📂 Contenu de build/ios/ :"
+            ls -R build/ios/
+            exit 1
+          fi
+          
+          echo "✅ IPA trouvée : $IPA_FILE"
+          echo "📊 Taille : $(du -h "$IPA_FILE" | cut -f1)"
+
+      - name: Vérification et Upload Firebase
+        env:
+          FIREBASE_IOS_APP_ID: ${{ secrets.FIREBASE_IOS_APP_ID }}
+        run: |
+          cd ios
+          
+          # Configuration Fastlane
+          echo "source 'https://rubygems.org'" > Gemfile
+          echo "gem 'fastlane', '>= 2.230.0'" >> Gemfile
+          echo "gem 'fastlane-plugin-firebase_app_distribution'" >> Gemfile
+          for g in abbrev ostruct mutex_m base64 csv bigdecimal drb nkf reline logger; do echo "gem '$g'" >> Gemfile; done
+          
+          gem install bundler -v 2.7.2 --no-document
+          bundle _2.7.2_ update
+          
+          # Recherche de l'IPA
+          IPA_FILE=$(find ../build/ios/ipa -name "*.ipa" | head -n 1)
+          
+          if [ -z "$IPA_FILE" ]; then
+            echo "❌ ERREUR : Aucun fichier IPA trouvé !"
+            echo "📂 Structure complète du dossier build :"
+            ls -R ../build/
+            exit 1
+          fi
+          
+          echo "✅ IPA trouvée : $IPA_FILE"
+          echo "📊 Taille : $(du -h "$IPA_FILE" | cut -f1)"
+          
+          # Upload vers Firebase
+          bundle _2.7.2_ exec fastlane run firebase_app_distribution \
+            app:"$FIREBASE_IOS_APP_ID" \
+            ipa_path:"$IPA_FILE" \
+            service_credentials_file:"firebase_credentials.json"
+
+      - name: Nettoyage Final
+        if: always()
+        run: |
+          security list-keychains -d user -s login.keychain
+          security delete-keychain build.keychain || true

.gitignore

@@ -44,7 +44,15 @@ app.*.map.json
 /android/app/profile
 /android/app/release
 .vscode
-.VSCodeCounter
+.VSCodeCounter/*
 .env
 .env.local
 .env.*.local
+firestore.rules
+storage.rules
+/functions/node_modules
+
+.idea 
+.vscode
+.VSCodeCounter 
+ 

README.md

@@ -56,3 +56,7 @@ Travel Mate est une application mobile conçue pour simplifier l'organisation de
 - **Google Places API** - Recherche de lieux et points d'intérêt
 - **Google Maps API** - Cartes et navigation
 - **Google Directions API** - Calcul d'itinéraires
+
+## 🚀 CI/CD & Déploiement
+
+Les versions de test interne Android et IOS sont automatiquement distribuées via **Firebase App Distribution**.

android/Gemfile

@@ -0,0 +1,6 @@
+source "https://rubygems.org"
+
+gem "fastlane"
+
+plugins_path = File.join(File.dirname(__FILE__), 'fastlane', 'Pluginfile')
+eval_gemfile(plugins_path) if File.exist?(plugins_path)

android/app/build.gradle.kts

@@ -1,21 +1,28 @@
+import java.util.Properties
+import java.io.FileInputStream
+
 plugins {
     id("com.android.application")
-    // START: FlutterFire Configuration
     id("com.google.gms.google-services")
-    // END: FlutterFire Configuration
     id("kotlin-android")
-    // The Flutter Gradle Plugin must be applied after the Android and Kotlin Gradle plugins.
     id("dev.flutter.flutter-gradle-plugin")
 }
 
+val keystoreProperties = Properties()
+val keystorePropertiesFile = rootProject.file("key.properties")
+if (keystorePropertiesFile.exists()) {
+    keystoreProperties.load(FileInputStream(keystorePropertiesFile))
+}
+
 android {
-    namespace = "com.example.travel_mate"
+    namespace = "be.devdayronvl.travel_mate"
     compileSdk = flutter.compileSdkVersion
     ndkVersion = flutter.ndkVersion
 
     compileOptions {
         sourceCompatibility = JavaVersion.VERSION_17
         targetCompatibility = JavaVersion.VERSION_17
+        isCoreLibraryDesugaringEnabled = true
     }
 
     kotlinOptions {
@@ -23,23 +30,37 @@ android {
     }
 
     defaultConfig {
-        // TODO: Specify your own unique Application ID (https://developer.android.com/studio/build/application-id.html).
+        applicationId = "be.devdayronvl.travel_mate"
-        applicationId = "com.example.travel_mate"
-        // You can update the following values to match your application needs.
-        // For more information, see: https://flutter.dev/to/review-gradle-config.
         minSdk = flutter.minSdkVersion
         targetSdk = flutter.targetSdkVersion
         versionCode = flutter.versionCode
         versionName = flutter.versionName
     }
 
-    buildTypes {
+    signingConfigs {
-        release {
+        create("release") {
-            // TODO: Add your own signing config for the release build.
+            keyAlias = keystoreProperties["keyAlias"] as String?
-            // Signing with the debug keys for now, so `flutter run --release` works.
+            keyPassword = keystoreProperties["keyPassword"] as String?
-            signingConfig = signingConfigs.getByName("debug")
+            storeFile = if (keystoreProperties["storeFile"] != null) {
+                rootProject.file(keystoreProperties["storeFile"] as String)
+            } else {
+                null
+            }
+            
+            storePassword = keystoreProperties["storePassword"] as String?
         }
     }
+
+    buildTypes {
+        release {
+            // Applique la configuration de signature définie au-dessus
+            signingConfig = signingConfigs.getByName("release")
+        }
+    }
+}
+
+dependencies {
+    coreLibraryDesugaring("com.android.tools:desugar_jdk_libs:2.1.4")
 }
 
 flutter {

android/app/google-services.json

@@ -5,6 +5,42 @@
     "storage_bucket": "travelmate-a47f5.firebasestorage.app"
   },
   "client": [
+    {
+      "client_info": {
+        "mobilesdk_app_id": "1:521527250907:android:56c632e98c7826347da1fe",
+        "android_client_info": {
+          "package_name": "be.devdayronvl.travel_mate"
+        }
+      },
+      "oauth_client": [
+        {
+          "client_id": "521527250907-j0kt1hc8hc7qc2kedp4akehau754cn5d.apps.googleusercontent.com",
+          "client_type": 3
+        }
+      ],
+      "api_key": [
+        {
+          "current_key": "AIzaSyAON_ol0Jr34tKbETvdDK9JCQdKNawxBeQ"
+        }
+      ],
+      "services": {
+        "appinvite_service": {
+          "other_platform_oauth_client": [
+            {
+              "client_id": "521527250907-j0kt1hc8hc7qc2kedp4akehau754cn5d.apps.googleusercontent.com",
+              "client_type": 3
+            },
+            {
+              "client_id": "521527250907-196i04qgm4talrosgi0ne0q8en90hkkh.apps.googleusercontent.com",
+              "client_type": 2,
+              "ios_info": {
+                "bundle_id": "be.devdayronvl.TravelMate"
+              }
+            }
+          ]
+        }
+      }
+    },
     {
       "client_info": {
         "mobilesdk_app_id": "1:521527250907:android:be3db7fc84f053ec7da1fe",
@@ -13,6 +49,22 @@
         }
       },
       "oauth_client": [
+        {
+          "client_id": "521527250907-19lrclc10eb0p8li1qutepctfqdohn0b.apps.googleusercontent.com",
+          "client_type": 1,
+          "android_info": {
+            "package_name": "com.example.travel_mate",
+            "certificate_hash": "2374761dc92a30812608c072638510002041eca8"
+          }
+        },
+        {
+          "client_id": "521527250907-5v8l011nod30a6c52nkmk69d00h0ma0q.apps.googleusercontent.com",
+          "client_type": 1,
+          "android_info": {
+            "package_name": "com.example.travel_mate",
+            "certificate_hash": "c98141ab89d42b16c273e611054e7c87aa773d83"
+          }
+        },
         {
           "client_id": "521527250907-lqgj1lmfcsjusm2be9r6kpuanq3jvjcd.apps.googleusercontent.com",
           "client_type": 1,
@@ -39,10 +91,10 @@
               "client_type": 3
             },
             {
-              "client_id": "521527250907-3i1qe2656eojs8k9hjdi573j09i9p41m.apps.googleusercontent.com",
+              "client_id": "521527250907-196i04qgm4talrosgi0ne0q8en90hkkh.apps.googleusercontent.com",
               "client_type": 2,
               "ios_info": {
-                "bundle_id": "com.example.travelMate"
+                "bundle_id": "be.devdayronvl.TravelMate"
               }
             }
           ]

android/app/src/main/AndroidManifest.xml

@@ -13,13 +13,15 @@
     <uses-permission android:name="android.permission.READ_MEDIA_VIDEO" />
     
     <!-- Permissions pour écrire dans le stockage -->
+    <uses-permission android:name="android.permission.POST_NOTIFICATIONS"/>
     <uses-permission android:name="android.permission.WRITE_EXTERNAL_STORAGE" />
     <application
-        android:label="travel_mate"
+        android:label="Travel Mate"
         android:name="${applicationName}"
         android:icon="@mipmap/ic_launcher">
         <activity
             android:name=".MainActivity"
+            android:screenOrientation="portrait"
             android:exported="true"
             android:launchMode="singleTop"
             android:taskAffinity=""
@@ -40,6 +42,20 @@
                 <category android:name="android.intent.category.LAUNCHER"/>
             </intent-filter>
         </activity>
+        
+        <!-- Apple Sign In Callback Activity -->
+        <activity
+            android:name="com.aboutyou.dart_packages.sign_in_with_apple.SignInWithAppleCallback"
+            android:exported="true"
+            android:launchMode="singleTop">
+            <intent-filter>
+                <action android:name="android.intent.action.VIEW" />
+                <category android:name="android.intent.category.DEFAULT" />
+                <category android:name="android.intent.category.BROWSABLE" />
+                <data android:scheme="signinwithapple" />
+                <data android:path="/" />
+            </intent-filter>
+        </activity>
         <!-- Don't delete the meta-data below.
              This is used by the Flutter tool to generate GeneratedPluginRegistrant.java -->
         <meta-data
@@ -47,7 +63,10 @@
             android:value="2" />
         <meta-data
             android:name="com.google.android.geo.API_KEY"
-            android:value="AIzaSyCAtz1_d5K0ANwxAA_T84iq7Ac_gsUs_oM"/>
+            android:value="AIzaSyAON_ol0Jr34tKbETvdDK9JCQdKNawxBeQ"/>
+        <meta-data
+            android:name="com.google.firebase.messaging.default_notification_channel_id"
+            android:value="high_importance_channel" />
     </application>
     <!-- Required to query activities that can process text, see:
          https://developer.android.com/training/package-visibility and
@@ -59,5 +78,23 @@
             <action android:name="android.intent.action.PROCESS_TEXT"/>
             <data android:mimeType="text/plain"/>
         </intent>
+        <!-- Waze -->
+        <intent>
+            <action android:name="android.intent.action.VIEW" />
+            <data android:scheme="waze" />
+        </intent>
+        <intent>
+            <action android:name="android.intent.action.VIEW" />
+            <data android:scheme="https" android:host="www.waze.com" />
+        </intent>
+        <!-- Google Maps -->
+        <intent>
+            <action android:name="android.intent.action.VIEW" />
+            <data android:scheme="google.navigation" />
+        </intent>
+        <intent>
+            <action android:name="android.intent.action.VIEW" />
+            <data android:scheme="https" android:host="www.google.com" />
+        </intent>
     </queries>
 </manifest>

android/app/src/main/kotlin/be/devdayronvl/travel_mate/MainActivity.kt

@@ -1,4 +1,4 @@
-package com.example.travel_mate
+package be.devdayronvl.travel_mate
 
 import io.flutter.embedding.android.FlutterActivity
 

android/fastlane/Appfile

@@ -0,0 +1,2 @@
+json_key_file("'/Users/dayronvanleemput/Documents/Coding/clé/travelmate-a47f5-1e4759031f2d.json'") # Path to the json secret file - Follow https://docs.fastlane.tools/actions/supply/#setup to get one
+package_name("be.devdayronvl.travel_mate") # e.g. com.krausefx.app

android/fastlane/Fastfile

@@ -0,0 +1,28 @@
+default_platform(:android)
+
+platform :android do
+  desc "Deploy to Firebase from Mac"
+  lane :deploy_firebase do
+    
+    # 1. Création du Keystore depuis le secret Gitea 
+    if ENV['ANDROID_KEYSTORE_BASE64']
+      File.open("upload-keystore.jks", "wb") do |f|
+        f.write(Base64.decode64(ENV['ANDROID_KEYSTORE_BASE64']))
+      end
+    else
+        UI.error("Secret Keystore manquant !")
+    end
+
+    # 2. Build de l'App Bundle (AAB)
+    sh("flutter build appbundle --release")
+
+    # 3. Envoi vers Firebase App Distribution
+    firebase_app_distribution(
+      app: ENV["FIREBASE_ANDROID_APP_ID"],
+      service_credentials_file: "firebase_credentials.json",
+      groups: "testers",
+      android_artifact_path: "../build/app/outputs/bundle/release/app-release.aab",
+      release_notes: "Build depuis Mac M1/M2. Commit: #{ENV['GITHUB_SHA']}"
+    )
+  end
+end

android/fastlane/Pluginfile

@@ -0,0 +1,5 @@
+# Autogenerated by fastlane
+#
+# Ensure this file is checked in to source control!
+
+gem 'fastlane-plugin-firebase_app_distribution'

firebase.json

@@ -1 +1,37 @@
-{"flutter":{"platforms":{"android":{"default":{"projectId":"travelmate-a47f5","appId":"1:521527250907:android:be3db7fc84f053ec7da1fe","fileOutput":"android/app/google-services.json"}},"dart":{"lib/firebase_options.dart":{"projectId":"travelmate-a47f5","configurations":{"android":"1:521527250907:android:be3db7fc84f053ec7da1fe","ios":"1:521527250907:ios:64b41be39c54db1c7da1fe","windows":"1:521527250907:web:53ff98bcdb8c218f7da1fe"}}}}}}
+{
+  "flutter": {
+    "platforms": {
+      "android": {
+        "default": {
+          "projectId": "travelmate-a47f5",
+          "appId": "1:521527250907:android:be3db7fc84f053ec7da1fe",
+          "fileOutput": "android/app/google-services.json"
+        }
+      },
+      "dart": {
+        "lib/firebase_options.dart": {
+          "projectId": "travelmate-a47f5",
+          "configurations": {
+            "android": "1:521527250907:android:be3db7fc84f053ec7da1fe",
+            "ios": "1:521527250907:ios:64b41be39c54db1c7da1fe",
+            "windows": "1:521527250907:web:53ff98bcdb8c218f7da1fe"
+          }
+        }
+      }
+    }
+  },
+  "functions": [
+    {
+      "source": "functions",
+      "codebase": "default",
+      "disallowLegacyRuntimeConfig": true,
+      "ignore": [
+        "node_modules",
+        ".git",
+        "firebase-debug.log",
+        "firebase-debug.*.log",
+        "*.local"
+      ]
+    }
+  ]
+}

functions/.gitignore

@@ -0,0 +1,2 @@
+node_modules/
+*.local

functions/index.js

@@ -0,0 +1,196 @@
+const functions = require("firebase-functions/v1");
+const admin = require("firebase-admin");
+
+admin.initializeApp();
+
+// Helper function to send notifications to a list of users
+async function sendNotificationToUsers(userIds, title, body, excludeUserId, data = {}) {
+    console.log(`Starting sendNotificationToUsers. Total users: ${userIds.length}, Exclude: ${excludeUserId}`);
+    try {
+        const tokens = [];
+
+        for (const userId of userIds) {
+            if (userId === excludeUserId) {
+                console.log(`Skipping user ${userId} (sender)`);
+                continue;
+            }
+
+            const userDoc = await admin.firestore().collection("users").doc(userId).get();
+            if (userDoc.exists) {
+                const userData = userDoc.data();
+                if (userData.fcmToken) {
+                    console.log(`Found token for user ${userId}`);
+                    tokens.push(userData.fcmToken);
+                } else {
+                    console.log(`No FCM token found for user ${userId}`);
+                }
+            } else {
+                console.log(`User document not found for ${userId}`);
+            }
+        }
+
+        // De-duplicate tokens
+        const uniqueTokens = [...new Set(tokens)];
+        console.log(`Total unique tokens to send: ${uniqueTokens.length} (from ${tokens.length} found)`);
+
+        if (uniqueTokens.length > 0) {
+            const message = {
+                notification: {
+                    title: title,
+                    body: body,
+                },
+                tokens: uniqueTokens,
+                data: {
+                    click_action: "FLUTTER_NOTIFICATION_CLICK",
+                    ...data
+                },
+                android: {
+                    priority: "high",
+                    notification: {
+                        channelId: "high_importance_channel",
+                    }
+                }
+            };
+
+            const response = await admin.messaging().sendEachForMulticast(message);
+            console.log(`${response.successCount} messages were sent successfully`);
+            if (response.failureCount > 0) {
+                console.log('Failed notifications:', response.responses.filter(r => !r.success));
+            }
+        } else {
+            console.log("No tokens found, skipping notification send.");
+        }
+    } catch (error) {
+        console.error("Error sending notification:", error);
+    }
+}
+
+exports.onActivityCreated = functions.firestore
+    .document("activities/{activityId}")
+    .onCreate(async (snapshot, context) => {
+        console.log(`onActivityCreated triggered for ${context.params.activityId}`);
+        const activity = snapshot.data();
+        const tripId = activity.tripId;
+        const createdBy = activity.createdBy || "Unknown";
+
+        if (!tripId) {
+            console.log("No tripId found in activity");
+            return;
+        }
+
+        // Fetch trip to get participants
+        const tripDoc = await admin.firestore().collection("trips").doc(tripId).get();
+        if (!tripDoc.exists) {
+            console.log(`Trip ${tripId} not found`);
+            return;
+        }
+
+        const trip = tripDoc.data();
+        const participants = trip.participants || [];
+        if (trip.createdBy && !participants.includes(trip.createdBy)) {
+            participants.push(trip.createdBy);
+        }
+
+        console.log(`Found trip participants: ${JSON.stringify(participants)}`);
+
+        // Fetch creator name
+        let creatorName = "Quelqu'un";
+        if (createdBy !== "Unknown") {
+            const userDoc = await admin.firestore().collection("users").doc(createdBy).get();
+            if (userDoc.exists) {
+                creatorName = userDoc.data().prenom || "Quelqu'un";
+            }
+        }
+
+        await sendNotificationToUsers(
+            participants,
+            "Nouvelle activité !",
+            `${creatorName} a ajouté une nouvelle activité : ${activity.name || activity.title}`,
+            createdBy,
+            { tripId: tripId }
+        );
+    });
+
+exports.onMessageCreated = functions.firestore
+    .document("groups/{groupId}/messages/{messageId}")
+    .onCreate(async (snapshot, context) => {
+        console.log(`onMessageCreated triggered for ${context.params.messageId} in group ${context.params.groupId}`);
+        const message = snapshot.data();
+        const groupId = context.params.groupId;
+        const senderId = message.senderId;
+
+        // Fetch group to get members
+        const groupDoc = await admin.firestore().collection("groups").doc(groupId).get();
+        if (!groupDoc.exists) {
+            console.log(`Group ${groupId} not found`);
+            return;
+        }
+
+        const group = groupDoc.data();
+        const memberIds = group.memberIds || [];
+        console.log(`Found group members: ${JSON.stringify(memberIds)}`);
+
+        let senderName = message.senderName || "Quelqu'un";
+
+        await sendNotificationToUsers(
+            memberIds,
+            "Nouveau message",
+            `${senderName} : ${message.text}`,
+            senderId,
+            { groupId: groupId }
+        );
+    });
+
+exports.onExpenseCreated = functions.firestore
+    .document("expenses/{expenseId}")
+    .onCreate(async (snapshot, context) => {
+        console.log(`onExpenseCreated triggered for ${context.params.expenseId}`);
+        const expense = snapshot.data();
+        const groupId = expense.groupId;
+        const paidBy = expense.paidById || expense.paidBy;
+
+        if (!groupId) {
+            console.log("No groupId found in expense");
+            return;
+        }
+
+        // Fetch group to get members
+        const groupDoc = await admin.firestore().collection("groups").doc(groupId).get();
+        if (!groupDoc.exists) {
+            console.log(`Group ${groupId} not found`);
+            return;
+        }
+
+        const group = groupDoc.data();
+        const memberIds = group.memberIds || [];
+        console.log(`Found group members: ${JSON.stringify(memberIds)}`);
+
+        let payerName = expense.paidByName || "Quelqu'un";
+
+        await sendNotificationToUsers(
+            memberIds,
+            "Nouvelle dépense",
+            `${payerName} a ajouté une dépense : ${expense.amount} ${expense.currency || '€'}`,
+            paidBy,
+            { groupId: groupId }
+        );
+    });
+
+exports.callbacks_signInWithApple = functions.https.onRequest((req, res) => {
+    const code = req.body.code;
+    const state = req.body.state;
+    const id_token = req.body.id_token;
+    const user = req.body.user;
+
+    const params = new URLSearchParams();
+    if (code) params.append('code', code);
+    if (state) params.append('state', state);
+    if (id_token) params.append('id_token', id_token);
+    if (user) params.append('user', user);
+
+    const qs = params.toString();
+    const packageName = 'be.devdayronvl.travel_mate';
+    const redirectUrl = `intent://callback?${qs}#Intent;package=${packageName};scheme=signinwithapple;end`;
+
+    res.redirect(302, redirectUrl);
+});

functions/package.json

@@ -0,0 +1,23 @@
+{
+  "name": "functions",
+  "description": "Cloud Functions for Firebase",
+  "scripts": {
+    "serve": "firebase emulators:start --only functions",
+    "shell": "firebase functions:shell",
+    "start": "npm run shell",
+    "deploy": "firebase deploy --only functions",
+    "logs": "firebase functions:log"
+  },
+  "engines": {
+    "node": "20"
+  },
+  "main": "index.js",
+  "dependencies": {
+    "firebase-admin": "^13.6.0",
+    "firebase-functions": "^7.0.0"
+  },
+  "devDependencies": {
+    "firebase-functions-test": "^3.4.1"
+  },
+  "private": true
+}

ios/Podfile.lock

@@ -1205,56 +1205,85 @@ PODS:
     - BoringSSL-GRPC/Interface (= 0.0.37)
   - BoringSSL-GRPC/Interface (0.0.37)
   - cloud_firestore (6.0.3):
-    - Firebase/Firestore (= 12.4.0)
+    - Firebase/Firestore (= 12.6.0)
     - firebase_core
     - Flutter
-  - Firebase/Auth (12.4.0):
+  - Firebase/Auth (12.6.0):
     - Firebase/CoreOnly
-    - FirebaseAuth (~> 12.4.0)
+    - FirebaseAuth (~> 12.6.0)
-  - Firebase/CoreOnly (12.4.0):
+  - Firebase/CoreOnly (12.6.0):
-    - FirebaseCore (~> 12.4.0)
+    - FirebaseCore (~> 12.6.0)
-  - Firebase/Firestore (12.4.0):
+  - Firebase/Firestore (12.6.0):
     - Firebase/CoreOnly
-    - FirebaseFirestore (~> 12.4.0)
+    - FirebaseFirestore (~> 12.6.0)
-  - Firebase/Storage (12.4.0):
+  - Firebase/Messaging (12.6.0):
     - Firebase/CoreOnly
-    - FirebaseStorage (~> 12.4.0)
+    - FirebaseMessaging (~> 12.6.0)
+  - Firebase/Storage (12.6.0):
+    - Firebase/CoreOnly
+    - FirebaseStorage (~> 12.6.0)
+  - firebase_analytics (12.1.0):
+    - firebase_core
+    - FirebaseAnalytics (= 12.6.0)
+    - Flutter
   - firebase_auth (6.1.1):
-    - Firebase/Auth (= 12.4.0)
+    - Firebase/Auth (= 12.6.0)
     - firebase_core
     - Flutter
-  - firebase_core (4.2.0):
+  - firebase_core (4.3.0):
-    - Firebase/CoreOnly (= 12.4.0)
+    - Firebase/CoreOnly (= 12.6.0)
+    - Flutter
+  - firebase_messaging (16.0.4):
+    - Firebase/Messaging (= 12.6.0)
+    - firebase_core
     - Flutter
   - firebase_storage (13.0.3):
-    - Firebase/Storage (= 12.4.0)
+    - Firebase/Storage (= 12.6.0)
     - firebase_core
     - Flutter
-  - FirebaseAppCheckInterop (12.4.0)
+  - FirebaseAnalytics (12.6.0):
-  - FirebaseAuth (12.4.0):
+    - FirebaseAnalytics/Default (= 12.6.0)
-    - FirebaseAppCheckInterop (~> 12.4.0)
+    - FirebaseCore (~> 12.6.0)
-    - FirebaseAuthInterop (~> 12.4.0)
+    - FirebaseInstallations (~> 12.6.0)
-    - FirebaseCore (~> 12.4.0)
+    - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
-    - FirebaseCoreExtension (~> 12.4.0)
+    - GoogleUtilities/MethodSwizzler (~> 8.1)
+    - GoogleUtilities/Network (~> 8.1)
+    - "GoogleUtilities/NSData+zlib (~> 8.1)"
+    - nanopb (~> 3.30910.0)
+  - FirebaseAnalytics/Default (12.6.0):
+    - FirebaseCore (~> 12.6.0)
+    - FirebaseInstallations (~> 12.6.0)
+    - GoogleAppMeasurement/Default (= 12.6.0)
+    - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
+    - GoogleUtilities/MethodSwizzler (~> 8.1)
+    - GoogleUtilities/Network (~> 8.1)
+    - "GoogleUtilities/NSData+zlib (~> 8.1)"
+    - nanopb (~> 3.30910.0)
+  - FirebaseAppCheckInterop (12.6.0)
+  - FirebaseAuth (12.6.0):
+    - FirebaseAppCheckInterop (~> 12.6.0)
+    - FirebaseAuthInterop (~> 12.6.0)
+    - FirebaseCore (~> 12.6.0)
+    - FirebaseCoreExtension (~> 12.6.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
     - GoogleUtilities/Environment (~> 8.1)
     - GTMSessionFetcher/Core (< 6.0, >= 3.4)
     - RecaptchaInterop (~> 101.0)
-  - FirebaseAuthInterop (12.4.0)
+  - FirebaseAuthInterop (12.6.0)
-  - FirebaseCore (12.4.0):
+  - FirebaseCore (12.6.0):
-    - FirebaseCoreInternal (~> 12.4.0)
+    - FirebaseCoreInternal (~> 12.6.0)
     - GoogleUtilities/Environment (~> 8.1)
     - GoogleUtilities/Logger (~> 8.1)
-  - FirebaseCoreExtension (12.4.0):
+  - FirebaseCoreExtension (12.6.0):
-    - FirebaseCore (~> 12.4.0)
+    - FirebaseCore (~> 12.6.0)
-  - FirebaseCoreInternal (12.4.0):
+  - FirebaseCoreInternal (12.6.0):
     - "GoogleUtilities/NSData+zlib (~> 8.1)"
-  - FirebaseFirestore (12.4.0):
+  - FirebaseFirestore (12.6.0):
-    - FirebaseCore (~> 12.4.0)
+    - FirebaseCore (~> 12.6.0)
-    - FirebaseCoreExtension (~> 12.4.0)
+    - FirebaseCoreExtension (~> 12.6.0)
-    - FirebaseFirestoreInternal (~> 12.4.0)
+    - FirebaseFirestoreInternal (~> 12.6.0)
-    - FirebaseSharedSwift (~> 12.4.0)
+    - FirebaseSharedSwift (~> 12.6.0)
-  - FirebaseFirestoreInternal (12.4.0):
+  - FirebaseFirestoreInternal (12.6.0):
     - abseil/algorithm (~> 1.20240722.0)
     - abseil/base (~> 1.20240722.0)
     - abseil/container/flat_hash_map (~> 1.20240722.0)
@@ -1263,21 +1292,37 @@ PODS:
     - abseil/strings/strings (~> 1.20240722.0)
     - abseil/time (~> 1.20240722.0)
     - abseil/types (~> 1.20240722.0)
-    - FirebaseAppCheckInterop (~> 12.4.0)
+    - FirebaseAppCheckInterop (~> 12.6.0)
-    - FirebaseCore (~> 12.4.0)
+    - FirebaseCore (~> 12.6.0)
     - "gRPC-C++ (~> 1.69.0)"
     - gRPC-Core (~> 1.69.0)
     - leveldb-library (~> 1.22)
     - nanopb (~> 3.30910.0)
-  - FirebaseSharedSwift (12.4.0)
+  - FirebaseInstallations (12.6.0):
-  - FirebaseStorage (12.4.0):
+    - FirebaseCore (~> 12.6.0)
-    - FirebaseAppCheckInterop (~> 12.4.0)
+    - GoogleUtilities/Environment (~> 8.1)
-    - FirebaseAuthInterop (~> 12.4.0)
+    - GoogleUtilities/UserDefaults (~> 8.1)
-    - FirebaseCore (~> 12.4.0)
+    - PromisesObjC (~> 2.4)
-    - FirebaseCoreExtension (~> 12.4.0)
+  - FirebaseMessaging (12.6.0):
+    - FirebaseCore (~> 12.6.0)
+    - FirebaseInstallations (~> 12.6.0)
+    - GoogleDataTransport (~> 10.1)
+    - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
+    - GoogleUtilities/Environment (~> 8.1)
+    - GoogleUtilities/Reachability (~> 8.1)
+    - GoogleUtilities/UserDefaults (~> 8.1)
+    - nanopb (~> 3.30910.0)
+  - FirebaseSharedSwift (12.6.0)
+  - FirebaseStorage (12.6.0):
+    - FirebaseAppCheckInterop (~> 12.6.0)
+    - FirebaseAuthInterop (~> 12.6.0)
+    - FirebaseCore (~> 12.6.0)
+    - FirebaseCoreExtension (~> 12.6.0)
     - GoogleUtilities/Environment (~> 8.1)
     - GTMSessionFetcher/Core (< 6.0, >= 3.4)
   - Flutter (1.0.0)
+  - flutter_local_notifications (0.0.1):
+    - Flutter
   - geolocator_apple (1.2.0):
     - Flutter
     - FlutterMacOS
@@ -1292,10 +1337,40 @@ PODS:
     - FlutterMacOS
     - GoogleSignIn (~> 9.0)
     - GTMSessionFetcher (>= 3.4.0)
+  - GoogleAdsOnDeviceConversion (3.2.0):
+    - GoogleUtilities/Environment (~> 8.1)
+    - GoogleUtilities/Logger (~> 8.1)
+    - GoogleUtilities/Network (~> 8.1)
+    - nanopb (~> 3.30910.0)
+  - GoogleAppMeasurement/Core (12.6.0):
+    - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
+    - GoogleUtilities/MethodSwizzler (~> 8.1)
+    - GoogleUtilities/Network (~> 8.1)
+    - "GoogleUtilities/NSData+zlib (~> 8.1)"
+    - nanopb (~> 3.30910.0)
+  - GoogleAppMeasurement/Default (12.6.0):
+    - GoogleAdsOnDeviceConversion (~> 3.2.0)
+    - GoogleAppMeasurement/Core (= 12.6.0)
+    - GoogleAppMeasurement/IdentitySupport (= 12.6.0)
+    - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
+    - GoogleUtilities/MethodSwizzler (~> 8.1)
+    - GoogleUtilities/Network (~> 8.1)
+    - "GoogleUtilities/NSData+zlib (~> 8.1)"
+    - nanopb (~> 3.30910.0)
+  - GoogleAppMeasurement/IdentitySupport (12.6.0):
+    - GoogleAppMeasurement/Core (= 12.6.0)
+    - GoogleUtilities/AppDelegateSwizzler (~> 8.1)
+    - GoogleUtilities/MethodSwizzler (~> 8.1)
+    - GoogleUtilities/Network (~> 8.1)
+    - "GoogleUtilities/NSData+zlib (~> 8.1)"
+    - nanopb (~> 3.30910.0)
+  - GoogleDataTransport (10.1.0):
+    - nanopb (~> 3.30910.0)
+    - PromisesObjC (~> 2.4)
   - GoogleMaps (9.4.0):
     - GoogleMaps/Maps (= 9.4.0)
   - GoogleMaps/Maps (9.4.0)
-  - GoogleSignIn (9.0.0):
+  - GoogleSignIn (9.1.0):
     - AppAuth (~> 2.0)
     - AppCheckCore (~> 11.0)
     - GTMAppAuth (~> 5.0)
@@ -1310,6 +1385,9 @@ PODS:
   - GoogleUtilities/Logger (8.1.0):
     - GoogleUtilities/Environment
     - GoogleUtilities/Privacy
+  - GoogleUtilities/MethodSwizzler (8.1.0):
+    - GoogleUtilities/Logger
+    - GoogleUtilities/Privacy
   - GoogleUtilities/Network (8.1.0):
     - GoogleUtilities/Logger
     - "GoogleUtilities/NSData+zlib"
@@ -1454,10 +1532,13 @@ PODS:
 
 DEPENDENCIES:
   - cloud_firestore (from `.symlinks/plugins/cloud_firestore/ios`)
+  - firebase_analytics (from `.symlinks/plugins/firebase_analytics/ios`)
   - firebase_auth (from `.symlinks/plugins/firebase_auth/ios`)
   - firebase_core (from `.symlinks/plugins/firebase_core/ios`)
+  - firebase_messaging (from `.symlinks/plugins/firebase_messaging/ios`)
   - firebase_storage (from `.symlinks/plugins/firebase_storage/ios`)
   - Flutter (from `Flutter`)
+  - flutter_local_notifications (from `.symlinks/plugins/flutter_local_notifications/ios`)
   - geolocator_apple (from `.symlinks/plugins/geolocator_apple/darwin`)
   - google_maps_flutter_ios (from `.symlinks/plugins/google_maps_flutter_ios/ios`)
   - google_sign_in_ios (from `.symlinks/plugins/google_sign_in_ios/darwin`)
@@ -1477,6 +1558,7 @@ SPEC REPOS:
     - AppCheckCore
     - BoringSSL-GRPC
     - Firebase
+    - FirebaseAnalytics
     - FirebaseAppCheckInterop
     - FirebaseAuth
     - FirebaseAuthInterop
@@ -1485,9 +1567,14 @@ SPEC REPOS:
     - FirebaseCoreInternal
     - FirebaseFirestore
     - FirebaseFirestoreInternal
+    - FirebaseInstallations
+    - FirebaseMessaging
     - FirebaseSharedSwift
     - FirebaseStorage
     - Google-Maps-iOS-Utils
+    - GoogleAdsOnDeviceConversion
+    - GoogleAppMeasurement
+    - GoogleDataTransport
     - GoogleMaps
     - GoogleSignIn
     - GoogleUtilities
@@ -1503,14 +1590,20 @@ SPEC REPOS:
 EXTERNAL SOURCES:
   cloud_firestore:
     :path: ".symlinks/plugins/cloud_firestore/ios"
+  firebase_analytics:
+    :path: ".symlinks/plugins/firebase_analytics/ios"
   firebase_auth:
     :path: ".symlinks/plugins/firebase_auth/ios"
   firebase_core:
     :path: ".symlinks/plugins/firebase_core/ios"
+  firebase_messaging:
+    :path: ".symlinks/plugins/firebase_messaging/ios"
   firebase_storage:
     :path: ".symlinks/plugins/firebase_storage/ios"
   Flutter:
     :path: Flutter
+  flutter_local_notifications:
+    :path: ".symlinks/plugins/flutter_local_notifications/ios"
   geolocator_apple:
     :path: ".symlinks/plugins/geolocator_apple/darwin"
   google_maps_flutter_ios:
@@ -1539,28 +1632,37 @@ SPEC CHECKSUMS:
   AppAuth: 1c1a8afa7e12f2ec3a294d9882dfa5ab7d3cb063
   AppCheckCore: cc8fd0a3a230ddd401f326489c99990b013f0c4f
   BoringSSL-GRPC: dded2a44897e45f28f08ae87a55ee4bcd19bc508
-  cloud_firestore: 79014bb3b303d451717ed5fe69fded8a2b2e8dc2
+  cloud_firestore: d7598ff2b1b2064e810f839dbdde2765c0f2052a
-  Firebase: f07b15ae5a6ec0f93713e30b923d9970d144af3e
+  Firebase: a451a7b61536298fd5cbfe3a746fd40443a50679
-  firebase_auth: c2b8be95d602d4e8a9148fae72333ef78e69cc20
+  firebase_analytics: 4f9cca09e65f6c2944a862c6dc86f6bed9fb769c
-  firebase_core: 744984dbbed8b3036abf34f0b98d80f130a7e464
+  firebase_auth: cfb7237c0d01e87360cb3bf61e02a417c36e19e8
-  firebase_storage: 0ba617a05b24aec050395e4d5d3773c0d7518a15
+  firebase_core: ba00a168e719694f38960502ceb560285603d073
-  FirebaseAppCheckInterop: f734c802f21fe1da0837708f0f9a27218c8a4ed0
+  firebase_messaging: 752f1df5294ead9d72091d4974362d00d4aec201
-  FirebaseAuth: 4a2aed737c84114a9d9b33d11ae1b147d6b94889
+  firebase_storage: 5716627614e95c75e243134f65c1b0d6f66a4315
-  FirebaseAuthInterop: 858e6b754966e70740a4370dd1503dfffe6dbb49
+  FirebaseAnalytics: d0a97a0db6425e5a5d966340b87f92ca7b13a557
-  FirebaseCore: bb595f3114953664e3c1dc032f008a244147cfd3
+  FirebaseAppCheckInterop: e2178171b4145013c7c1a3cc464d1d446d3a1896
-  FirebaseCoreExtension: 7e1f7118ee970e001a8013719fb90950ee5e0018
+  FirebaseAuth: 613c463cb43545a7fd2cd99ade09b78ac472c544
-  FirebaseCoreInternal: d7f5a043c2cd01a08103ab586587c1468047bca6
+  FirebaseAuthInterop: db06756ef028006d034b6004dc0c37c24f7828d4
-  FirebaseFirestore: 2a6183381cf7679b1bb000eb76a8e3178e25dee2
+  FirebaseCore: 0e38ad5d62d980a47a64b8e9301ffa311457be04
-  FirebaseFirestoreInternal: 6577a27cd5dc3722b900042527f86d4ea1626134
+  FirebaseCoreExtension: 032fd6f8509e591fda8cb76f6651f20d926b121f
-  FirebaseSharedSwift: 93426a1de92f19e1199fac5295a4f8df16458daa
+  FirebaseCoreInternal: 69bf1306a05b8ac43004f6cc1f804bb7b05b229e
-  FirebaseStorage: 20d6b56fb8a40ebaa03d6a2889fe33dac64adb73
+  FirebaseFirestore: 51ce079b9ddcaa481644164eda649d362c2a6396
+  FirebaseFirestoreInternal: 8b1d2b0a1b859b2ddbd63f448c416c5be7367405
+  FirebaseInstallations: 631b38da2e11a83daa4bfb482f79d286a5dfa7ad
+  FirebaseMessaging: a61bc42dcab3f7a346d94bbb54dab2c9435b18b2
+  FirebaseSharedSwift: 79f27fff0addd15c3de19b87fba426f3cc2c964f
+  FirebaseStorage: 550349b1e8f7315834ea08308696e9469d77135d
   Flutter: cabc95a1d2626b1b06e7179b784ebcf0c0cde467
+  flutter_local_notifications: a5a732f069baa862e728d839dd2ebb904737effb
   geolocator_apple: ab36aa0e8b7d7a2d7639b3b4e48308394e8cef5e
   Google-Maps-iOS-Utils: 0a484b05ed21d88c9f9ebbacb007956edd508a96
   google_maps_flutter_ios: 0291eb2aa252298a769b04d075e4a9d747ff7264
   google_sign_in_ios: 205742c688aea0e64db9da03c33121694a365109
+  GoogleAdsOnDeviceConversion: d68c69dd9581a0f5da02617b6f377e5be483970f
+  GoogleAppMeasurement: 3bf40aff49a601af5da1c3345702fcb4991d35ee
+  GoogleDataTransport: aae35b7ea0c09004c3797d53c8c41f66f219d6a7
   GoogleMaps: 0608099d4870cac8754bdba9b6953db543432438
-  GoogleSignIn: c7f09cfbc85a1abf69187be091997c317cc33b77
+  GoogleSignIn: fcee2257188d5eda57a5e2b6a715550ffff9206d
   GoogleUtilities: 00c88b9a86066ef77f0da2fab05f65d7768ed8e1
   "gRPC-C++": cc207623316fb041a7a3e774c252cf68a058b9e8
   gRPC-Core: 860978b7db482de8b4f5e10677216309b5ff6330

ios/Runner.xcodeproj/project.pbxproj

@@ -490,7 +490,11 @@
 				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
 				CLANG_ENABLE_MODULES = YES;
 				CODE_SIGN_ENTITLEMENTS = Runner/Runner.entitlements;
+				"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Distribution";
+				CODE_SIGN_STYLE = Manual;
 				CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
+				DEVELOPMENT_TEAM = "";
+				"DEVELOPMENT_TEAM[sdk=iphoneos*]" = 456VVYXDFN;
 				ENABLE_BITCODE = NO;
 				INFOPLIST_FILE = Runner/Info.plist;
 				LD_RUNPATH_SEARCH_PATHS = (
@@ -499,6 +503,8 @@
 				);
 				PRODUCT_BUNDLE_IDENTIFIER = be.devdayronvl.TravelMate;
 				PRODUCT_NAME = "$(TARGET_NAME)";
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				"PROVISIONING_PROFILE_SPECIFIER[sdk=iphoneos*]" = myiphone;
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
 				VERSIONING_SYSTEM = "apple-generic";
@@ -673,7 +679,11 @@
 				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
 				CLANG_ENABLE_MODULES = YES;
 				CODE_SIGN_ENTITLEMENTS = Runner/Runner.entitlements;
+				"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Distribution";
+				CODE_SIGN_STYLE = Manual;
 				CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
+				DEVELOPMENT_TEAM = "";
+				"DEVELOPMENT_TEAM[sdk=iphoneos*]" = 456VVYXDFN;
 				ENABLE_BITCODE = NO;
 				INFOPLIST_FILE = Runner/Info.plist;
 				LD_RUNPATH_SEARCH_PATHS = (
@@ -682,6 +692,8 @@
 				);
 				PRODUCT_BUNDLE_IDENTIFIER = be.devdayronvl.TravelMate;
 				PRODUCT_NAME = "$(TARGET_NAME)";
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				"PROVISIONING_PROFILE_SPECIFIER[sdk=iphoneos*]" = myiphone;
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
 				SWIFT_VERSION = 5.0;
@@ -696,7 +708,11 @@
 				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
 				CLANG_ENABLE_MODULES = YES;
 				CODE_SIGN_ENTITLEMENTS = Runner/Runner.entitlements;
+				"CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Distribution";
+				CODE_SIGN_STYLE = Manual;
 				CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)";
+				DEVELOPMENT_TEAM = "";
+				"DEVELOPMENT_TEAM[sdk=iphoneos*]" = 456VVYXDFN;
 				ENABLE_BITCODE = NO;
 				INFOPLIST_FILE = Runner/Info.plist;
 				LD_RUNPATH_SEARCH_PATHS = (
@@ -705,6 +721,8 @@
 				);
 				PRODUCT_BUNDLE_IDENTIFIER = be.devdayronvl.TravelMate;
 				PRODUCT_NAME = "$(TARGET_NAME)";
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				"PROVISIONING_PROFILE_SPECIFIER[sdk=iphoneos*]" = myiphone;
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
 				VERSIONING_SYSTEM = "apple-generic";

ios/Runner/Info.plist

@@ -32,6 +32,14 @@
 				<string>com.googleusercontent.apps.521527250907-3i1qe2656eojs8k9hjdi573j09i9p41m</string>
 			</array>
 		</dict>
+		<dict>
+			<key>CFBundleURLName</key>
+			<string>Apple Sign-In</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+			</array>
+		</dict>
 	</array>
 	<key>CFBundleVersion</key>
 	<string>$(FLUTTER_BUILD_NUMBER)</string>
@@ -39,6 +47,11 @@
 	<string>521527250907-3i1qe2656eojs8k9hjdi573j09i9p41m.apps.googleusercontent.com</string>
 	<key>LSRequiresIPhoneOS</key>
 	<true/>
+	<key>UIBackgroundModes</key>
+	<array>
+		<string>fetch</string>
+		<string>remote-notification</string>
+	</array>
 	<key>NSLocationAlwaysUsageDescription</key>
 	<string>Cette application a besoin de votre position pour afficher votre localisation sur la carte</string>
 	<key>NSLocationWhenInUseUsageDescription</key>
@@ -52,27 +65,18 @@
 	<key>UISupportedInterfaceOrientations</key>
 	<array>
 		<string>UIInterfaceOrientationPortrait</string>
-		<string>UIInterfaceOrientationLandscapeLeft</string>
-		<string>UIInterfaceOrientationLandscapeRight</string>
 	</array>
 	<key>UISupportedInterfaceOrientations~ipad</key>
 	<array>
 		<string>UIInterfaceOrientationPortrait</string>
 		<string>UIInterfaceOrientationPortraitUpsideDown</string>
-		<string>UIInterfaceOrientationLandscapeLeft</string>
-		<string>UIInterfaceOrientationLandscapeRight</string>
-	</array>
-	<key>CFBundleURLTypes</key>
-	<array>
-		<dict>
-			<key>CFBundleURLName</key>
-			<string>Apple Sign-In</string>
-			<key>CFBundleURLSchemes</key>
-			<array>
-				<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
-			</array>
-		</dict>
 	</array>
+
+    <key>LSApplicationQueriesSchemes</key>
+    <array>
+        <string>comgooglemaps</string>
+        <string>waze</string>
+    </array>
 	<!-- Permission Caméra -->
     <key>NSCameraUsageDescription</key>
     <string>L'application a besoin d'accéder à votre caméra pour prendre des photos de profil.</string>

ios/Runner/Runner.entitlements

@@ -6,5 +6,7 @@
 	<array>
 		<string>Default</string>
 	</array>
+	<key>aps-environment</key>
+	<string>development</string>
 </dict>
 </plist>

lib/blocs/account/account_bloc.dart

@@ -22,6 +22,7 @@
 /// accountBloc.close();
 /// ```
 library;
+
 import 'dart:async';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:travel_mate/services/error_service.dart';
@@ -40,6 +41,8 @@ class AccountBloc extends Bloc<AccountEvent, AccountState> {
     on<_AccountsUpdated>(_onAccountsUpdated);
     on<CreateAccount>(_onCreateAccount);
     on<CreateAccountWithMembers>(_onCreateAccountWithMembers);
+    on<AddMemberToAccount>(_onAddMemberToAccount);
+    on<RemoveMemberFromAccount>(_onRemoveMemberFromAccount);
   }
 
   Future<void> _onLoadAccountsByUserId(
@@ -49,17 +52,23 @@ class AccountBloc extends Bloc<AccountEvent, AccountState> {
     try {
       emit(AccountLoading());
       await _accountsSubscription?.cancel();
-      _accountsSubscription = _repository.getAccountByUserId(event.userId).listen(
+      _accountsSubscription = _repository
-        (accounts) {
+          .getAccountByUserId(event.userId)
-          add(_AccountsUpdated(accounts));
+          .listen(
-        },
+            (accounts) {
-        onError: (error) {
+              add(_AccountsUpdated(accounts));
-          add(_AccountsUpdated([], error: error.toString()));
+            },
-        },
+            onError: (error) {
-      );
+              add(_AccountsUpdated([], error: error.toString()));
+            },
+          );
     } catch (e, stackTrace) {
-      _errorService.logError(e.toString(), stackTrace);
+      _errorService.logError(
-      emit(AccountError(e.toString()));
+        'AccountBloc',
+        'Error loading accounts: $e',
+        stackTrace,
+      );
+      emit(const AccountError('Impossible de charger les comptes'));
     }
   }
 
@@ -87,8 +96,12 @@ class AccountBloc extends Bloc<AccountEvent, AccountState> {
       );
       emit(AccountOperationSuccess('Compte créé avec succès. ID: $accountId'));
     } catch (e, stackTrace) {
-      _errorService.logError(e.toString(), stackTrace);
+      _errorService.logError(
-      emit(AccountError('Erreur lors de la création du compte: ${e.toString()}'));
+        'AccountBloc',
+        'Error creating account: $e',
+        stackTrace,
+      );
+      emit(const AccountError('Impossible de créer le compte'));
     }
   }
 
@@ -96,7 +109,7 @@ class AccountBloc extends Bloc<AccountEvent, AccountState> {
     CreateAccountWithMembers event,
     Emitter<AccountState> emit,
   ) async {
-    try{
+    try {
       emit(AccountLoading());
       final accountId = await _repository.createAccountWithMembers(
         account: event.account,
@@ -104,8 +117,51 @@ class AccountBloc extends Bloc<AccountEvent, AccountState> {
       );
       emit(AccountOperationSuccess('Compte créé avec succès. ID: $accountId'));
     } catch (e, stackTrace) {
-      _errorService.logError(e.toString(), stackTrace);
+      _errorService.logError(
-      emit(AccountError('Erreur lors de la création du compte: ${e.toString()}'));
+        'AccountBloc',
+        'Error creating account with members: $e',
+        stackTrace,
+      );
+      emit(const AccountError('Impossible de créer le compte'));
+    }
+  }
+
+  Future<void> _onAddMemberToAccount(
+    AddMemberToAccount event,
+    Emitter<AccountState> emit,
+  ) async {
+    try {
+      emit(AccountLoading());
+      await _repository.addMemberToAccount(event.accountId, event.member);
+      emit(AccountOperationSuccess('Membre ajouté avec succès'));
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'AccountBloc',
+        'Error adding member: $e',
+        stackTrace,
+      );
+      emit(const AccountError('Impossible d\'ajouter le membre'));
+    }
+  }
+
+  Future<void> _onRemoveMemberFromAccount(
+    RemoveMemberFromAccount event,
+    Emitter<AccountState> emit,
+  ) async {
+    try {
+      emit(AccountLoading());
+      await _repository.removeMemberFromAccount(
+        event.accountId,
+        event.memberId,
+      );
+      emit(AccountOperationSuccess('Membre supprimé avec succès'));
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'AccountBloc',
+        'Error removing member: $e',
+        stackTrace,
+      );
+      emit(const AccountError('Impossible de supprimer le membre'));
     }
   }
 

lib/blocs/account/account_event.dart

@@ -86,3 +86,31 @@ class CreateAccountWithMembers extends AccountEvent {
   @override
   List<Object?> get props => [account, members];
 }
+
+/// Event to add a member to an existing account.
+/// 
+/// This event is dispatched when a new member needs to be added to
+/// an account, typically when editing a trip and adding new participants.
+class AddMemberToAccount extends AccountEvent {
+  final String accountId;
+  final GroupMember member;
+
+  const AddMemberToAccount(this.accountId, this.member);
+
+  @override
+  List<Object?> get props => [accountId, member];
+}
+
+/// Event to remove a member from an existing account.
+/// 
+/// This event is dispatched when a member needs to be removed from
+/// an account, typically when editing a trip and removing participants.
+class RemoveMemberFromAccount extends AccountEvent {
+  final String accountId;
+  final String memberId;
+
+  const RemoveMemberFromAccount(this.accountId, this.memberId);
+
+  @override
+  List<Object?> get props => [accountId, memberId];
+}

lib/blocs/activity/activity_bloc.dart

@@ -17,13 +17,14 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
     required ActivityRepository repository,
     required ActivityPlacesService placesService,
     required ErrorService errorService,
-  })  : _repository = repository,
+  }) : _repository = repository,
-        _placesService = placesService,
+       _placesService = placesService,
-        _errorService = errorService,
+       _errorService = errorService,
-        super(const ActivityInitial()) {
+       super(const ActivityInitial()) {
-    
     on<LoadActivities>(_onLoadActivities);
-    on<LoadTripActivitiesPreservingSearch>(_onLoadTripActivitiesPreservingSearch);
+    on<LoadTripActivitiesPreservingSearch>(
+      _onLoadTripActivitiesPreservingSearch,
+    );
     on<SearchActivities>(_onSearchActivities);
     on<SearchActivitiesWithCoordinates>(_onSearchActivitiesWithCoordinates);
     on<SearchActivitiesByText>(_onSearchActivitiesByText);
@@ -39,6 +40,7 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
     on<RestoreCachedSearchResults>(_onRestoreCachedSearchResults);
     on<RemoveFromSearchResults>(_onRemoveFromSearchResults);
     on<AddActivityAndRemoveFromSearch>(_onAddActivityAndRemoveFromSearch);
+    on<UpdateActivityDate>(_onUpdateActivityDate);
   }
 
   /// Handles loading activities for a trip
@@ -51,12 +53,15 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
 
       final activities = await _repository.getActivitiesByTrip(event.tripId);
 
-      emit(ActivityLoaded(
+      emit(
-        activities: activities,
+        ActivityLoaded(activities: activities, filteredActivities: activities),
-        filteredActivities: activities,
+      );
-      ));
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError(
-      _errorService.logError('activity_bloc', 'Erreur chargement activités: $e');
+        'activity_bloc',
+        'Erreur chargement activités: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible de charger les activités'));
     }
   }
@@ -76,16 +81,49 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       }
 
       // Sinon, on charge normalement
-      emit(ActivityLoaded(
+      emit(
-        activities: activities,
+        ActivityLoaded(activities: activities, filteredActivities: activities),
-        filteredActivities: activities,
+      );
-      ));
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError(
-      _errorService.logError('activity_bloc', 'Erreur chargement activités: $e');
+        'activity_bloc',
+        'Erreur chargement activités: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible de charger les activités'));
     }
   }
 
+  Future<void> _onUpdateActivityDate(
+    UpdateActivityDate event,
+    Emitter<ActivityState> emit,
+  ) async {
+    try {
+      final activity = await _repository.getActivity(
+        event.tripId,
+        event.activityId,
+      );
+
+      if (activity != null) {
+        final updatedActivity = activity.copyWith(
+          date: event.date,
+          clearDate: event.date == null,
+        );
+        await _repository.updateActivity(updatedActivity);
+
+        // Recharger les activités pour mettre à jour l'UI
+        add(LoadActivities(event.tripId));
+      }
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur mise à jour date: $e',
+        stackTrace,
+      );
+      emit(const ActivityError('Impossible de mettre à jour la date'));
+    }
+  }
+
   /// Handles searching activities using Google Places API
   Future<void> _onSearchActivities(
     SearchActivities event,
@@ -104,7 +142,9 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
         destination: event.destination,
         tripId: event.tripId,
         category: event.category,
-        maxResults: event.maxResults ?? 20, // Par défaut 20, ou utiliser la valeur spécifiée
+        maxResults:
+            event.maxResults ??
+            20, // Par défaut 20, ou utiliser la valeur spécifiée
         offset: event.offset ?? 0, // Par défaut 0
       );
 
@@ -121,14 +161,24 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       // Mettre en cache les résultats
       ActivityCacheService().setCachedActivities(event.tripId, finalResults);
 
-      emit(ActivitySearchResults(
+      emit(
-        searchResults: finalResults,
+        ActivitySearchResults(
-        query: event.category?.displayName ?? 'Toutes les activités',
+          searchResults: finalResults,
-        isLoading: false,
+          query: event.category?.displayName ?? 'Toutes les activités',
-      ));
+          isLoading: false,
-    } catch (e) {
+        ),
-      _errorService.logError('activity_bloc', 'Erreur recherche activités: $e');
+      );
-      emit(const ActivityError('Impossible de rechercher les activités'));
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur recherche activités: $e',
+        stackTrace,
+      );
+      // Extraire le message d'erreur si disponible
+      final errorMessage = e.toString().replaceAll('Exception: ', '');
+      emit(
+        ActivityError('Impossible de rechercher les activités: $errorMessage'),
+      );
     }
   }
 
@@ -168,13 +218,19 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       // Mettre en cache les résultats
       ActivityCacheService().setCachedActivities(event.tripId, finalResults);
 
-      emit(ActivitySearchResults(
+      emit(
-        searchResults: finalResults,
+        ActivitySearchResults(
-        query: event.category?.displayName ?? 'Toutes les activités',
+          searchResults: finalResults,
-        isLoading: false,
+          query: event.category?.displayName ?? 'Toutes les activités',
-      ));
+          isLoading: false,
-    } catch (e) {
+        ),
-      _errorService.logError('activity_bloc', 'Erreur recherche activités avec coordonnées: $e');
+      );
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur recherche activités avec coordonnées: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible de rechercher les activités'));
     }
   }
@@ -196,12 +252,15 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       // Mettre en cache les résultats
       ActivityCacheService().setCachedActivities(event.tripId, searchResults);
 
-      emit(ActivitySearchResults(
+      emit(
-        searchResults: searchResults,
+        ActivitySearchResults(searchResults: searchResults, query: event.query),
-        query: event.query,
+      );
-      ));
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError(
-      _errorService.logError('activity_bloc', 'Erreur recherche textuelle: $e');
+        'activity_bloc',
+        'Erreur recherche textuelle: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible de rechercher les activités'));
     }
   }
@@ -230,23 +289,34 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       if (activityId != null) {
         // Si on est en état de recherche (suggestions Google), préserver cet état
         if (state is ActivitySearchResults) {
-          // On ne change rien à l'état de recherche, on le garde tel quel
+          final currentState = state as ActivitySearchResults;
-          // La suppression de l'activité des résultats se fait dans _onRemoveFromSearchResults
+          // On garde l'état de recherche inchangé mais on ajoute l'info de l'activité ajoutée
+          emit(
+            currentState.copyWith(
+              newlyAddedActivity: event.activity.copyWith(id: activityId),
+            ),
+          );
           return;
         }
 
         // Sinon, émettre l'état d'ajout réussi
-        emit(ActivityAdded(
+        emit(
-          activity: event.activity.copyWith(id: activityId),
+          ActivityAdded(
-          message: 'Activité ajoutée avec succès',
+            activity: event.activity.copyWith(id: activityId),
-        ));
+            message: 'Activité ajoutée avec succès',
+          ),
+        );
         // Reload activities while preserving search results
         add(LoadTripActivitiesPreservingSearch(event.activity.tripId));
       } else {
         emit(const ActivityError('Impossible d\'ajouter l\'activité'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('activity_bloc', 'Erreur ajout activité: $e');
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur ajout activité: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible d\'ajouter l\'activité'));
     }
   }
@@ -281,26 +351,34 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
               .where((activity) => activity.id != event.googleActivityId)
               .toList();
 
-          emit(ActivitySearchResults(
+          emit(
-            searchResults: updatedResults,
+            ActivitySearchResults(
-            query: currentState.query,
+              searchResults: updatedResults,
-            isLoading: false,
+              query: currentState.query,
-          ));
+              isLoading: false,
+            ),
+          );
           return;
         }
 
         // Sinon, émettre l'état d'ajout réussi
-        emit(ActivityAdded(
+        emit(
-          activity: event.activity.copyWith(id: activityId),
+          ActivityAdded(
-          message: 'Activité ajoutée avec succès',
+            activity: event.activity.copyWith(id: activityId),
-        ));
+            message: 'Activité ajoutée avec succès',
+          ),
+        );
         // Reload activities while preserving search results
         add(LoadTripActivitiesPreservingSearch(event.activity.tripId));
       } else {
         emit(const ActivityError('Impossible d\'ajouter l\'activité'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('activity_bloc', 'Erreur ajout activité: $e');
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur ajout activité: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible d\'ajouter l\'activité'));
     }
   }
@@ -314,11 +392,13 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       // Filter out existing activities
       final filteredActivities = <Activity>[];
 
-      emit(ActivityBatchAdding(
+      emit(
-        activitiesToAdd: event.activities,
+        ActivityBatchAdding(
-        progress: 0,
+          activitiesToAdd: event.activities,
-        total: event.activities.length,
+          progress: 0,
-      ));
+          total: event.activities.length,
+        ),
+      );
 
       for (int i = 0; i < event.activities.length; i++) {
         final activity = event.activities[i];
@@ -337,11 +417,13 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
         }
 
         // Update progress
-        emit(ActivityBatchAdding(
+        emit(
-          activitiesToAdd: event.activities,
+          ActivityBatchAdding(
-          progress: i + 1,
+            activitiesToAdd: event.activities,
-          total: event.activities.length,
+            progress: i + 1,
-        ));
+            total: event.activities.length,
+          ),
+        );
       }
 
       if (filteredActivities.isEmpty) {
@@ -352,17 +434,23 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       final addedIds = await _repository.addActivitiesBatch(filteredActivities);
 
       if (addedIds.isNotEmpty) {
-        emit(ActivityOperationSuccess(
+        emit(
-          '${addedIds.length} activité(s) ajoutée(s) avec succès',
+          ActivityOperationSuccess(
-          operationType: 'batch_add',
+            '${addedIds.length} activité(s) ajoutée(s) avec succès',
-        ));
+            operationType: 'batch_add',
+          ),
+        );
         // Reload activities
         add(LoadActivities(event.activities.first.tripId));
       } else {
         emit(const ActivityError('Impossible d\'ajouter les activités'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('activity_bloc', 'Erreur ajout en lot: $e');
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur ajout en lot: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible d\'ajouter les activités'));
     }
   }
@@ -376,10 +464,12 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       // Show voting state
       if (state is ActivityLoaded) {
         final currentState = state as ActivityLoaded;
-        emit(ActivityVoting(
+        emit(
-          activityId: event.activityId,
+          ActivityVoting(
-          activities: currentState.activities,
+            activityId: event.activityId,
-        ));
+            activities: currentState.activities,
+          ),
+        );
       }
 
       final success = await _repository.voteForActivity(
@@ -389,11 +479,13 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       );
 
       if (success) {
-        emit(ActivityVoteRecorded(
+        emit(
-          activityId: event.activityId,
+          ActivityVoteRecorded(
-          vote: event.vote,
+            activityId: event.activityId,
-          userId: event.userId,
+            vote: event.vote,
-        ));
+            userId: event.userId,
+          ),
+        );
 
         // Reload activities to reflect the new vote
         if (state is ActivityLoaded) {
@@ -402,22 +494,24 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
             currentState.activities.first.tripId,
           );
 
-          emit(currentState.copyWith(
+          emit(
-            activities: activities,
+            currentState.copyWith(
-            filteredActivities: _applyFilters(
+              activities: activities,
-              activities,
+              filteredActivities: _applyFilters(
-              currentState.activeFilter,
+                activities,
-              currentState.minRating,
+                currentState.activeFilter,
-              currentState.showVotedOnly,
+                currentState.minRating,
-              event.userId,
+                currentState.showVotedOnly,
+                event.userId,
+              ),
             ),
-          ));
+          );
         }
       } else {
         emit(const ActivityError('Impossible d\'enregistrer le vote'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('activity_bloc', 'Erreur vote: $e');
+      _errorService.logError('activity_bloc', 'Erreur vote: $e', stackTrace);
       emit(const ActivityError('Impossible d\'enregistrer le vote'));
     }
   }
@@ -431,10 +525,12 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       final success = await _repository.deleteActivity(event.activityId);
 
       if (success) {
-        emit(ActivityDeleted(
+        emit(
-          activityId: event.activityId,
+          ActivityDeleted(
-          message: 'Activité supprimée avec succès',
+            activityId: event.activityId,
-        ));
+            message: 'Activité supprimée avec succès',
+          ),
+        );
 
         // Reload if we're on the activity list
         if (state is ActivityLoaded) {
@@ -446,8 +542,12 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
       } else {
         emit(const ActivityError('Impossible de supprimer l\'activité'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('activity_bloc', 'Erreur suppression: $e');
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur suppression: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible de supprimer l\'activité'));
     }
   }
@@ -468,12 +568,14 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
         '', // UserId would be needed for showVotedOnly filter
       );
 
-      emit(currentState.copyWith(
+      emit(
-        filteredActivities: filteredActivities,
+        currentState.copyWith(
-        activeFilter: event.category,
+          filteredActivities: filteredActivities,
-        minRating: event.minRating,
+          activeFilter: event.category,
-        showVotedOnly: event.showVotedOnly ?? false,
+          minRating: event.minRating,
-      ));
+          showVotedOnly: event.showVotedOnly ?? false,
+        ),
+      );
     }
   }
 
@@ -503,27 +605,35 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
     try {
       if (state is ActivityLoaded) {
         final currentState = state as ActivityLoaded;
-        emit(ActivityUpdating(
+        emit(
-          activityId: event.activity.id,
+          ActivityUpdating(
-          activities: currentState.activities,
+            activityId: event.activity.id,
-        ));
+            activities: currentState.activities,
+          ),
+        );
       }
 
       final success = await _repository.updateActivity(event.activity);
 
       if (success) {
-        emit(const ActivityOperationSuccess(
+        emit(
-          'Activité mise à jour avec succès',
+          const ActivityOperationSuccess(
-          operationType: 'update',
+            'Activité mise à jour avec succès',
-        ));
+            operationType: 'update',
+          ),
+        );
 
         // Reload activities
         add(LoadActivities(event.activity.tripId));
       } else {
         emit(const ActivityError('Impossible de mettre à jour l\'activité'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('activity_bloc', 'Erreur mise à jour: $e');
+      _errorService.logError(
+        'activity_bloc',
+        'Erreur mise à jour: $e',
+        stackTrace,
+      );
       emit(const ActivityError('Impossible de mettre à jour l\'activité'));
     }
   }
@@ -536,13 +646,15 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
     try {
       // This would require extending the Activity model to include favorites
       // For now, we'll use the voting system as a favorite system
-      add(VoteForActivity(
+      add(
-        activityId: event.activityId,
+        VoteForActivity(
-        userId: event.userId,
+          activityId: event.activityId,
-        vote: 1,
+          userId: event.userId,
-      ));
+          vote: 1,
-    } catch (e) {
+        ),
-      _errorService.logError('activity_bloc', 'Erreur favori: $e');
+      );
+    } catch (e, stackTrace) {
+      _errorService.logError('activity_bloc', 'Erreur favori: $e', stackTrace);
       emit(const ActivityError('Impossible de modifier les favoris'));
     }
   }
@@ -558,7 +670,25 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
     var filtered = activities;
 
     if (category != null) {
-      filtered = filtered.where((a) => a.category == category).toList();
+      filtered = filtered.where((a) {
+        // Check exact match (internal value)
+        if (a.category == category) return true;
+
+        // Check display name match
+        // Find the enum that matches the filter category (which is a display name)
+        try {
+          final categoryEnum = ActivityCategory.values.firstWhere(
+            (e) => e.displayName == category,
+          );
+          // Check if activity category matches the enum's google type or display name
+          return a.category == categoryEnum.googlePlaceType ||
+              a.category == categoryEnum.displayName ||
+              a.category.toLowerCase() == categoryEnum.name.toLowerCase();
+        } catch (_) {
+          // If no matching enum found, fallback to simple string comparison
+          return a.category.toLowerCase() == category.toLowerCase();
+        }
+      }).toList();
     }
 
     if (minRating != null) {
@@ -587,11 +717,13 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
           .toList();
 
       // Émettre le nouvel état avec l'activité retirée
-      emit(ActivitySearchResults(
+      emit(
-        searchResults: updatedResults,
+        ActivitySearchResults(
-        query: currentState.query,
+          searchResults: updatedResults,
-        isLoading: false,
+          query: currentState.query,
-      ));
+          isLoading: false,
+        ),
+      );
     }
   }
 
@@ -600,10 +732,12 @@ class ActivityBloc extends Bloc<ActivityEvent, ActivityState> {
     RestoreCachedSearchResults event,
     Emitter<ActivityState> emit,
   ) async {
-    emit(ActivitySearchResults(
+    emit(
-      searchResults: event.searchResults,
+      ActivitySearchResults(
-      query: 'cached',
+        searchResults: event.searchResults,
-      isLoading: false,
+        query: 'cached',
-    ));
+        isLoading: false,
+      ),
+    );
   }
 }

lib/blocs/activity/activity_event.dart

@@ -50,7 +50,15 @@ class SearchActivities extends ActivityEvent {
   });
 
   @override
-  List<Object?> get props => [tripId, destination, category, maxResults, offset, reset, appendToExisting];
+  List<Object?> get props => [
+    tripId,
+    destination,
+    category,
+    maxResults,
+    offset,
+    reset,
+    appendToExisting,
+  ];
 }
 
 /// Event to search activities using coordinates directly (bypasses geocoding)
@@ -76,7 +84,16 @@ class SearchActivitiesWithCoordinates extends ActivityEvent {
   });
 
   @override
-  List<Object?> get props => [tripId, latitude, longitude, category, maxResults, offset, reset, appendToExisting];
+  List<Object?> get props => [
+    tripId,
+    latitude,
+    longitude,
+    category,
+    maxResults,
+    offset,
+    reset,
+    appendToExisting,
+  ];
 }
 
 /// Event to search activities by text query
@@ -95,6 +112,21 @@ class SearchActivitiesByText extends ActivityEvent {
   List<Object> get props => [tripId, destination, query];
 }
 
+class UpdateActivityDate extends ActivityEvent {
+  final String tripId;
+  final String activityId;
+  final DateTime? date;
+
+  const UpdateActivityDate({
+    required this.tripId,
+    required this.activityId,
+    this.date,
+  });
+
+  @override
+  List<Object?> get props => [tripId, activityId, date];
+}
+
 /// Event to add a single activity to the trip
 class AddActivity extends ActivityEvent {
   final Activity activity;
@@ -147,11 +179,7 @@ class FilterActivities extends ActivityEvent {
   final double? minRating;
   final bool? showVotedOnly;
 
-  const FilterActivities({
+  const FilterActivities({this.category, this.minRating, this.showVotedOnly});
-    this.category,
-    this.minRating,
-    this.showVotedOnly,
-  });
 
   @override
   List<Object?> get props => [category, minRating, showVotedOnly];

lib/blocs/activity/activity_state.dart

@@ -68,7 +68,9 @@ class ActivityLoaded extends ActivityState {
 
   /// Gets activities by category
   List<Activity> getActivitiesByCategory(String category) {
-    return activities.where((activity) => activity.category == category).toList();
+    return activities
+        .where((activity) => activity.category == category)
+        .toList();
   }
 
   /// Gets top rated activities
@@ -94,26 +96,35 @@ class ActivitySearchResults extends ActivityState {
   final List<Activity> searchResults;
   final String query;
   final bool isLoading;
+  final Activity? newlyAddedActivity;
 
   const ActivitySearchResults({
     required this.searchResults,
     required this.query,
     this.isLoading = false,
+    this.newlyAddedActivity,
   });
 
   @override
-  List<Object> get props => [searchResults, query, isLoading];
+  List<Object?> get props => [
+    searchResults,
+    query,
+    isLoading,
+    newlyAddedActivity,
+  ];
 
   /// Creates a copy with optional modifications
   ActivitySearchResults copyWith({
     List<Activity>? searchResults,
     String? query,
     bool? isLoading,
+    Activity? newlyAddedActivity,
   }) {
     return ActivitySearchResults(
       searchResults: searchResults ?? this.searchResults,
       query: query ?? this.query,
       isLoading: isLoading ?? this.isLoading,
+      newlyAddedActivity: newlyAddedActivity ?? this.newlyAddedActivity,
     );
   }
 }
@@ -123,10 +134,7 @@ class ActivityOperationSuccess extends ActivityState {
   final String message;
   final String? operationType;
 
-  const ActivityOperationSuccess(
+  const ActivityOperationSuccess(this.message, {this.operationType});
-    this.message, {
-    this.operationType,
-  });
 
   @override
   List<Object?> get props => [message, operationType];
@@ -138,11 +146,7 @@ class ActivityError extends ActivityState {
   final String? errorCode;
   final dynamic error;
 
-  const ActivityError(
+  const ActivityError(this.message, {this.errorCode, this.error});
-    this.message, {
-    this.errorCode,
-    this.error,
-  });
 
   @override
   List<Object?> get props => [message, errorCode, error];
@@ -153,10 +157,7 @@ class ActivityVoting extends ActivityState {
   final String activityId;
   final List<Activity> activities;
 
-  const ActivityVoting({
+  const ActivityVoting({required this.activityId, required this.activities});
-    required this.activityId,
-    required this.activities,
-  });
 
   @override
   List<Object> get props => [activityId, activities];
@@ -167,10 +168,7 @@ class ActivityUpdating extends ActivityState {
   final String activityId;
   final List<Activity> activities;
 
-  const ActivityUpdating({
+  const ActivityUpdating({required this.activityId, required this.activities});
-    required this.activityId,
-    required this.activities,
-  });
 
   @override
   List<Object> get props => [activityId, activities];
@@ -200,10 +198,7 @@ class ActivityAdded extends ActivityState {
   final Activity activity;
   final String message;
 
-  const ActivityAdded({
+  const ActivityAdded({required this.activity, required this.message});
-    required this.activity,
-    required this.message,
-  });
 
   @override
   List<Object> get props => [activity, message];
@@ -214,10 +209,7 @@ class ActivityDeleted extends ActivityState {
   final String activityId;
   final String message;
 
-  const ActivityDeleted({
+  const ActivityDeleted({required this.activityId, required this.message});
-    required this.activityId,
-    required this.message,
-  });
 
   @override
   List<Object> get props => [activityId, message];

lib/blocs/auth/auth_bloc.dart

@@ -25,19 +25,28 @@ import 'package:flutter_bloc/flutter_bloc.dart';
 import '../../repositories/auth_repository.dart';
 import 'auth_event.dart';
 import 'auth_state.dart';
+import '../../services/notification_service.dart';
+import '../../services/analytics_service.dart';
 
 /// BLoC for managing authentication state and operations.
 class AuthBloc extends Bloc<AuthEvent, AuthState> {
   /// Repository for authentication operations.
   final AuthRepository _authRepository;
+  final NotificationService _notificationService;
+  final AnalyticsService _analyticsService;
 
   /// Creates an [AuthBloc] with the provided [authRepository].
   ///
   /// The bloc starts in the [AuthInitial] state and registers event handlers
   /// for all supported authentication events.
-  AuthBloc({required AuthRepository authRepository})
+  AuthBloc({
-    : _authRepository = authRepository,
+    required AuthRepository authRepository,
-      super(AuthInitial()) {
+    NotificationService? notificationService,
+    AnalyticsService? analyticsService,
+  }) : _authRepository = authRepository,
+       _notificationService = notificationService ?? NotificationService(),
+       _analyticsService = analyticsService ?? AnalyticsService(),
+       super(AuthInitial()) {
     on<AuthCheckRequested>(_onAuthCheckRequested);
     on<AuthSignInRequested>(_onSignInRequested);
     on<AuthSignUpRequested>(_onSignUpRequested);
@@ -69,6 +78,9 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
         );
 
         if (user != null) {
+          // Save FCM Token on auto-login
+          await _notificationService.saveTokenToFirestore(user.id!);
+          await _analyticsService.setUserId(user.id);
           emit(AuthAuthenticated(user: user));
         } else {
           emit(AuthUnauthenticated());
@@ -77,7 +89,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
         emit(AuthUnauthenticated());
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -98,12 +110,19 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       );
 
       if (user != null) {
+        // Save FCM Token
+        await NotificationService().saveTokenToFirestore(user.id!);
+        await _analyticsService.setUserId(user.id);
+        await _analyticsService.logEvent(
+          name: 'login',
+          parameters: {'method': 'email'},
+        );
         emit(AuthAuthenticated(user: user));
       } else {
         emit(const AuthError(message: 'Invalid email or password'));
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -127,12 +146,19 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       );
 
       if (user != null) {
+        // Save FCM Token
+        await NotificationService().saveTokenToFirestore(user.id!);
+        await _analyticsService.setUserId(user.id);
+        await _analyticsService.logEvent(
+          name: 'sign_up',
+          parameters: {'method': 'email'},
+        );
         emit(AuthAuthenticated(user: user));
       } else {
         emit(const AuthError(message: 'Failed to create account'));
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -150,6 +176,13 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       final user = await _authRepository.signInWithGoogle();
 
       if (user != null) {
+        // Save FCM Token
+        await NotificationService().saveTokenToFirestore(user.id!);
+        await _analyticsService.setUserId(user.id);
+        await _analyticsService.logEvent(
+          name: 'login',
+          parameters: {'method': 'google'},
+        );
         emit(AuthAuthenticated(user: user));
       } else {
         emit(
@@ -160,7 +193,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
         );
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -178,12 +211,17 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       );
 
       if (user != null) {
+        await _analyticsService.setUserId(user.id);
+        await _analyticsService.logEvent(
+          name: 'sign_up',
+          parameters: {'method': 'google'},
+        );
         emit(AuthAuthenticated(user: user));
       } else {
         emit(const AuthError(message: 'Failed to create account with Google'));
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -201,12 +239,17 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       );
 
       if (user != null) {
+        await _analyticsService.setUserId(user.id);
+        await _analyticsService.logEvent(
+          name: 'sign_up',
+          parameters: {'method': 'apple'},
+        );
         emit(AuthAuthenticated(user: user));
       } else {
         emit(const AuthError(message: 'Failed to create account with Apple'));
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -224,6 +267,13 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       final user = await _authRepository.signInWithApple();
 
       if (user != null) {
+        // Save FCM Token
+        await NotificationService().saveTokenToFirestore(user.id!);
+        await _analyticsService.setUserId(user.id);
+        await _analyticsService.logEvent(
+          name: 'login',
+          parameters: {'method': 'apple'},
+        );
         emit(AuthAuthenticated(user: user));
       } else {
         emit(
@@ -234,7 +284,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
         );
       }
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 
@@ -246,6 +296,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
     Emitter<AuthState> emit,
   ) async {
     await _authRepository.signOut();
+    await _analyticsService.setUserId(null); // Clear user ID
     emit(AuthUnauthenticated());
   }
 
@@ -261,7 +312,7 @@ class AuthBloc extends Bloc<AuthEvent, AuthState> {
       await _authRepository.resetPassword(event.email);
       emit(AuthPasswordResetSent(email: event.email));
     } catch (e) {
-      emit(AuthError(message: e.toString()));
+      emit(AuthError(message: e.toString().replaceAll('Exception: ', '')));
     }
   }
 }

lib/blocs/balance/balance_bloc.dart

@@ -32,6 +32,7 @@
 /// ));
 /// ```
 library;
+
 import 'package:flutter_bloc/flutter_bloc.dart';
 import '../../repositories/balance_repository.dart';
 import '../../repositories/expense_repository.dart';
@@ -61,7 +62,12 @@ class BalanceBloc extends Bloc<BalanceEvent, BalanceState> {
     BalanceService? balanceService,
     ErrorService? errorService,
   }) : _balanceRepository = balanceRepository,
-       _balanceService = balanceService ?? BalanceService(balanceRepository: balanceRepository, expenseRepository: expenseRepository),
+       _balanceService =
+           balanceService ??
+           BalanceService(
+             balanceRepository: balanceRepository,
+             expenseRepository: expenseRepository,
+           ),
        _errorService = errorService ?? ErrorService(),
        super(BalanceInitial()) {
     on<LoadGroupBalances>(_onLoadGroupBalance);
@@ -83,21 +89,29 @@ class BalanceBloc extends Bloc<BalanceEvent, BalanceState> {
     Emitter<BalanceState> emit,
   ) async {
     try {
-      emit(BalanceLoading());
+      // Emit empty state initially to avoid infinite spinner
+      emit(const GroupBalancesLoaded(balances: [], settlements: []));
 
       // Calculate group user balances
-      final userBalances = await _balanceRepository.calculateGroupUserBalances(event.groupId);
+      final userBalances = await _balanceRepository.calculateGroupUserBalances(
+        event.groupId,
+      );
 
       // Calculate optimal settlements
-      final settlements = await _balanceService.calculateOptimalSettlements(event.groupId);
+      final settlements = await _balanceService.calculateOptimalSettlements(
+        event.groupId,
+      );
 
-      emit(GroupBalancesLoaded(
+      emit(
-        balances: userBalances,
+        GroupBalancesLoaded(balances: userBalances, settlements: settlements),
-        settlements: settlements,
+      );
-      ));
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError(
-      _errorService.logError('BalanceBloc', 'Error loading balance: $e');
+        'BalanceBloc',
-      emit(BalanceError(e.toString()));
+        'Error loading balance: $e',
+        stackTrace,
+      );
+      emit(const BalanceError('Impossible de charger la balance'));
     }
   }
 
@@ -121,18 +135,25 @@ class BalanceBloc extends Bloc<BalanceEvent, BalanceState> {
       }
 
       // Calculate group user balances
-      final userBalances = await _balanceRepository.calculateGroupUserBalances(event.groupId);
+      final userBalances = await _balanceRepository.calculateGroupUserBalances(
+        event.groupId,
+      );
 
       // Calculate optimal settlements
-      final settlements = await _balanceService.calculateOptimalSettlements(event.groupId);
+      final settlements = await _balanceService.calculateOptimalSettlements(
+        event.groupId,
+      );
 
-      emit(GroupBalancesLoaded(
+      emit(
-        balances: userBalances,
+        GroupBalancesLoaded(balances: userBalances, settlements: settlements),
-        settlements: settlements,
+      );
-      ));
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError(
-      _errorService.logError('BalanceBloc', 'Error refreshing balance: $e');
+        'BalanceBloc',
-      emit(BalanceError(e.toString()));
+        'Error refreshing balance: $e',
+        stackTrace,
+      );
+      emit(const BalanceError('Impossible de rafraîchir la balance'));
     }
   }
 
@@ -161,9 +182,15 @@ class BalanceBloc extends Bloc<BalanceEvent, BalanceState> {
 
       // Reload balance after settlement
       add(RefreshBalance(event.groupId));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('BalanceBloc', 'Error marking settlement: $e');
+      _errorService.logError(
-      emit(BalanceError(e.toString()));
+        'BalanceBloc',
+        'Error marking settlement: $e',
+        stackTrace,
+      );
+      emit(
+        const BalanceError('Impossible de marquer le règlement comme terminé'),
+      );
     }
   }
 }

lib/blocs/expense/expense_bloc.dart

@@ -34,10 +34,11 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
     ExpenseService? expenseService,
     ErrorService? errorService,
   }) : _expenseRepository = expenseRepository,
-       _expenseService = expenseService ?? ExpenseService(expenseRepository: expenseRepository),
+       _expenseService =
+           expenseService ??
+           ExpenseService(expenseRepository: expenseRepository),
        _errorService = errorService ?? ErrorService(),
        super(ExpenseInitial()) {
-    
     on<LoadExpensesByGroup>(_onLoadExpensesByGroup);
     on<ExpensesUpdated>(_onExpensesUpdated);
     on<CreateExpense>(_onCreateExpense);
@@ -56,7 +57,9 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
     Emitter<ExpenseState> emit,
   ) async {
     try {
-      emit(ExpenseLoading());
+      // Emit empty state initially to avoid infinite spinner
+      // The stream will update with actual data when available
+      emit(const ExpensesLoaded(expenses: []));
 
       await _expensesSubscription?.cancel();
 
@@ -64,11 +67,12 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
           .getExpensesStream(event.groupId)
           .listen(
             (expenses) => add(ExpensesUpdated(expenses)),
-            onError: (error) => add(ExpensesUpdated([], error: error.toString())),
+            onError: (error) =>
+                add(ExpensesUpdated([], error: error.toString())),
           );
     } catch (e) {
       _errorService.logError('ExpenseBloc', 'Error loading expenses: $e');
-      emit(ExpenseError(e.toString()));
+      emit(const ExpenseError('Impossible de charger les dépenses'));
     }
   }
 
@@ -105,11 +109,14 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
     Emitter<ExpenseState> emit,
   ) async {
     try {
-      await _expenseService.createExpenseWithValidation(event.expense, event.receiptImage);
+      await _expenseService.createExpenseWithValidation(
+        event.expense,
+        event.receiptImage,
+      );
       emit(const ExpenseOperationSuccess('Expense created successfully'));
     } catch (e) {
       _errorService.logError('ExpenseBloc', 'Error creating expense: $e');
-      emit(ExpenseError(e.toString()));
+      emit(const ExpenseError('Impossible de créer la dépense'));
     }
   }
 
@@ -127,11 +134,14 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
     Emitter<ExpenseState> emit,
   ) async {
     try {
-      await _expenseService.updateExpenseWithValidation(event.expense, event.newReceiptImage);
+      await _expenseService.updateExpenseWithValidation(
+        event.expense,
+        event.newReceiptImage,
+      );
       emit(const ExpenseOperationSuccess('Expense updated successfully'));
     } catch (e) {
       _errorService.logError('ExpenseBloc', 'Error updating expense: $e');
-      emit(ExpenseError(e.toString()));
+      emit(const ExpenseError('Impossible de mettre à jour la dépense'));
     }
   }
 
@@ -152,7 +162,7 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
       emit(const ExpenseOperationSuccess('Expense deleted successfully'));
     } catch (e) {
       _errorService.logError('ExpenseBloc', 'Error deleting expense: $e');
-      emit(ExpenseError(e.toString()));
+      emit(const ExpenseError('Impossible de supprimer la dépense'));
     }
   }
 
@@ -174,7 +184,7 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
       emit(const ExpenseOperationSuccess('Payment marked as completed'));
     } catch (e) {
       _errorService.logError('ExpenseBloc', 'Error marking split as paid: $e');
-      emit(ExpenseError(e.toString()));
+      emit(const ExpenseError('Impossible de marquer comme payé'));
     }
   }
 
@@ -196,7 +206,7 @@ class ExpenseBloc extends Bloc<ExpenseEvent, ExpenseState> {
       emit(const ExpenseOperationSuccess('Expense archived successfully'));
     } catch (e) {
       _errorService.logError('ExpenseBloc', 'Error archiving expense: $e');
-      emit(ExpenseError(e.toString()));
+      emit(const ExpenseError('Impossible d\'archiver la dépense'));
     }
   }
 

lib/blocs/group/group_bloc.dart

@@ -32,6 +32,7 @@
 /// ));
 /// ```
 library;
+
 import 'dart:async';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:travel_mate/services/error_service.dart';
@@ -85,17 +86,23 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
     try {
       emit(GroupLoading());
       await _groupsSubscription?.cancel();
-      _groupsSubscription = _repository.getGroupsByUserId(event.userId).listen(
+      _groupsSubscription = _repository
-        (groups) {
+          .getGroupsByUserId(event.userId)
-          add(_GroupsUpdated(groups));
+          .listen(
-        },
+            (groups) {
-        onError: (error) {
+              add(_GroupsUpdated(groups));
-          add(_GroupsUpdated([], error: error.toString()));
+            },
-        },
+            onError: (error) {
-      );
+              add(_GroupsUpdated([], error: error.toString()));
+            },
+          );
     } catch (e, stackTrace) {
-      _errorService.logError(e.toString(), stackTrace);
+      _errorService.logError(
-      emit(GroupError(e.toString()));
+        'GroupBloc',
+        'Error loading groups: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de charger les groupes'));
     }
   }
 
@@ -139,8 +146,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
       } else {
         emit(const GroupsLoaded([]));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError(e.toString()));
+      _errorService.logError(
+        'GroupBloc',
+        'Error loading group by trip: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de charger le groupe du voyage'));
     }
   }
 
@@ -164,8 +176,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
       );
       emit(GroupCreated(groupId: groupId));
       emit(const GroupOperationSuccess('Group created successfully'));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError('Error during creation: $e'));
+      _errorService.logError(
+        'GroupBloc',
+        'Error creating group: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de créer le groupe'));
     }
   }
 
@@ -189,8 +206,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
         members: event.members,
       );
       emit(GroupCreated(groupId: groupId));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError('Error during creation: $e'));
+      _errorService.logError(
+        'GroupBloc',
+        'Error creating group with members: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de créer le groupe'));
     }
   }
 
@@ -209,8 +231,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
     try {
       await _repository.addMember(event.groupId, event.member);
       emit(const GroupOperationSuccess('Member added'));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError('Error during addition: $e'));
+      _errorService.logError(
+        'GroupBloc',
+        'Error adding member: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible d\'ajouter le membre'));
     }
   }
 
@@ -229,8 +256,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
     try {
       await _repository.removeMember(event.groupId, event.userId);
       emit(const GroupOperationSuccess('Member removed'));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError('Error during removal: $e'));
+      _errorService.logError(
+        'GroupBloc',
+        'Error removing member: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de supprimer le membre'));
     }
   }
 
@@ -249,8 +281,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
     try {
       await _repository.updateGroup(event.groupId, event.group);
       emit(const GroupOperationSuccess('Group updated'));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError('Error during update: $e'));
+      _errorService.logError(
+        'GroupBloc',
+        'Error updating group: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de mettre à jour le groupe'));
     }
   }
 
@@ -269,8 +306,13 @@ class GroupBloc extends Bloc<GroupEvent, GroupState> {
     try {
       await _repository.deleteGroup(event.tripId);
       emit(const GroupOperationSuccess('Group deleted'));
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(GroupError('Error during deletion: $e'));
+      _errorService.logError(
+        'GroupBloc',
+        'Error deleting group: $e',
+        stackTrace,
+      );
+      emit(const GroupError('Impossible de supprimer le groupe'));
     }
   }
 

lib/blocs/message/message_bloc.dart

@@ -40,6 +40,7 @@
 /// ));
 /// ```
 library;
+
 import 'dart:async';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import '../../models/message.dart';
@@ -65,10 +66,10 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
   /// Args:
   ///   [messageService]: Optional service for message operations (auto-created if null)
   MessageBloc({MessageService? messageService})
-      : _messageService = messageService ?? MessageService(
+    : _messageService =
-          messageRepository: MessageRepository(),
+          messageService ??
-        ),
+          MessageService(messageRepository: MessageRepository()),
-        super(MessageInitial()) {
+      super(MessageInitial()) {
     on<LoadMessages>(_onLoadMessages);
     on<SendMessage>(_onSendMessage);
     on<DeleteMessage>(_onDeleteMessage);
@@ -101,7 +102,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
             add(_MessagesUpdated(messages: messages, groupId: event.groupId));
           },
           onError: (error) {
-            add(_MessagesError('Error loading messages: $error'));
+            add(const _MessagesError('Impossible de charger les messages'));
           },
         );
   }
@@ -114,10 +115,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
   /// Args:
   ///   [event]: The _MessagesUpdated event containing messages and group ID
   ///   [emit]: State emitter function
-  void _onMessagesUpdated(
+  void _onMessagesUpdated(_MessagesUpdated event, Emitter<MessageState> emit) {
-    _MessagesUpdated event,
-    Emitter<MessageState> emit,
-  ) {
     emit(MessagesLoaded(messages: event.messages, groupId: event.groupId));
   }
 
@@ -142,7 +140,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
         senderName: event.senderName,
       );
     } catch (e) {
-      emit(MessageError('Error sending message: $e'));
+      emit(const MessageError('Impossible d\'envoyer le message'));
     }
   }
 
@@ -166,7 +164,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
         messageId: event.messageId,
       );
     } catch (e) {
-      emit(MessageError('Error deleting message: $e'));
+      emit(const MessageError('Impossible de supprimer le message'));
     }
   }
 
@@ -191,7 +189,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
         newText: event.newText,
       );
     } catch (e) {
-      emit(MessageError('Error updating message: $e'));
+      emit(const MessageError('Impossible de modifier le message'));
     }
   }
 
@@ -217,7 +215,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
         reaction: event.reaction,
       );
     } catch (e) {
-      emit(MessageError('Error adding reaction: $e'));
+      emit(const MessageError('Impossible d\'ajouter la réaction'));
     }
   }
 
@@ -242,7 +240,7 @@ class MessageBloc extends Bloc<MessageEvent, MessageState> {
         userId: event.userId,
       );
     } catch (e) {
-      emit(MessageError('Error removing reaction: $e'));
+      emit(const MessageError('Impossible de supprimer la réaction'));
     }
   }
 
@@ -273,10 +271,7 @@ class _MessagesUpdated extends MessageEvent {
   /// Args:
   ///   [messages]: List of messages from the stream update
   ///   [groupId]: ID of the group these messages belong to
-  const _MessagesUpdated({
+  const _MessagesUpdated({required this.messages, required this.groupId});
-    required this.messages,
-    required this.groupId,
-  });
 
   @override
   List<Object?> get props => [messages, groupId];

lib/blocs/trip/trip_bloc.dart

@@ -36,17 +36,20 @@
 /// tripBloc.add(TripDeleteRequested(tripId: 'tripId456'));
 /// ```
 library;
+
 import 'dart:async';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:travel_mate/models/trip.dart';
 import 'trip_event.dart';
 import 'trip_state.dart';
 import '../../repositories/trip_repository.dart';
+import '../../services/error_service.dart';
 
 /// BLoC that manages trip-related operations and state.
 class TripBloc extends Bloc<TripEvent, TripState> {
   /// Repository for trip data operations
   final TripRepository _repository;
+  final _errorService = ErrorService();
 
   /// Subscription to trip stream for real-time updates
   StreamSubscription? _tripsSubscription;
@@ -88,14 +91,26 @@ class TripBloc extends Bloc<TripEvent, TripState> {
     _currentUserId = event.userId;
     await _tripsSubscription?.cancel();
 
-    _tripsSubscription = _repository.getTripsByUserId(event.userId).listen(
+    _tripsSubscription = _repository
-      (trips) {
+        .getTripsByUserId(event.userId)
-        add(_TripsUpdated(trips));
+        .listen(
-      },
+          (trips) {
-      onError: (error) {
+            add(_TripsUpdated(trips));
-        emit(TripError(error.toString()));
+          },
-      },
+          onError: (error, stackTrace) {
-    );
+            _errorService.logError(
+              'TripBloc',
+              'Error loading trips: $error',
+              stackTrace,
+            );
+            add(
+              const _TripsUpdated(
+                [],
+                error: 'Impossible de charger les voyages',
+              ),
+            );
+          },
+        );
   }
 
   /// Handles [_TripsUpdated] events.
@@ -106,11 +121,12 @@ class TripBloc extends Bloc<TripEvent, TripState> {
   /// Args:
   ///   [event]: The _TripsUpdated event containing the updated trip list
   ///   [emit]: State emitter function
-  void _onTripsUpdated(
+  void _onTripsUpdated(_TripsUpdated event, Emitter<TripState> emit) {
-    _TripsUpdated event,
+    if (event.error != null) {
-    Emitter<TripState> emit,
+      emit(TripError(event.error!));
-  ) {
+    } else {
-    emit(TripLoaded(event.trips));
+      emit(TripLoaded(event.trips));
+    }
   }
 
   /// Handles [TripCreateRequested] events.
@@ -137,9 +153,9 @@ class TripBloc extends Bloc<TripEvent, TripState> {
       if (_currentUserId != null) {
         add(LoadTripsByUserId(userId: _currentUserId!));
       }
-      
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError('TripBloc', 'Error creating trip: $e', stackTrace);
-      emit(TripError('Error during creation: $e'));
+      emit(const TripError('Impossible de créer le voyage'));
     }
   }
 
@@ -163,9 +179,9 @@ class TripBloc extends Bloc<TripEvent, TripState> {
       if (_currentUserId != null) {
         add(LoadTripsByUserId(userId: _currentUserId!));
       }
-      
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError('TripBloc', 'Error updating trip: $e', stackTrace);
-      emit(TripError('Error during update: $e'));
+      emit(const TripError('Impossible de mettre à jour le voyage'));
     }
   }
 
@@ -191,9 +207,9 @@ class TripBloc extends Bloc<TripEvent, TripState> {
       if (_currentUserId != null) {
         add(LoadTripsByUserId(userId: _currentUserId!));
       }
-      
+    } catch (e, stackTrace) {
-    } catch (e) {
+      _errorService.logError('TripBloc', 'Error deleting trip: $e', stackTrace);
-      emit(TripError('Error during deletion: $e'));
+      emit(const TripError('Impossible de supprimer le voyage'));
     }
   }
 
@@ -206,10 +222,7 @@ class TripBloc extends Bloc<TripEvent, TripState> {
   /// Args:
   ///   [event]: The ResetTrips event
   ///   [emit]: State emitter function
-  Future<void> _onResetTrips(
+  Future<void> _onResetTrips(ResetTrips event, Emitter<TripState> emit) async {
-    ResetTrips event,
-    Emitter<TripState> emit,
-  ) async {
     await _tripsSubscription?.cancel();
     _currentUserId = null;
     emit(TripInitial());
@@ -230,16 +243,11 @@ class TripBloc extends Bloc<TripEvent, TripState> {
 ///
 /// This internal event is used to process updates from the trip stream
 /// subscription and emit appropriate states based on the received data.
+/// internal event
 class _TripsUpdated extends TripEvent {
-  /// List of trips received from the stream
   final List<Trip> trips;
-
+  final String? error;
-  /// Creates a _TripsUpdated event.
+  const _TripsUpdated(this.trips, {this.error});
-  /// 
-  /// Args:
-  ///   [trips]: List of trips from the stream update
-  const _TripsUpdated(this.trips);
-
   @override
-  List<Object?> get props => [trips];
+  List<Object?> get props => [trips, error];
 }

lib/blocs/user/user_bloc.dart

@@ -1,6 +1,11 @@
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:firebase_auth/firebase_auth.dart';
 import 'package:cloud_firestore/cloud_firestore.dart';
+
+import 'package:travel_mate/repositories/group_repository.dart';
+import 'package:travel_mate/services/notification_service.dart';
+import 'package:travel_mate/services/logger_service.dart';
+import 'package:travel_mate/services/error_service.dart';
 import 'user_event.dart' as event;
 import 'user_state.dart' as state;
 
@@ -16,6 +21,10 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
   /// Firestore instance for user data operations.
   final FirebaseFirestore _firestore = FirebaseFirestore.instance;
 
+  final GroupRepository _groupRepository = GroupRepository();
+
+  final _errorService = ErrorService();
+
   /// Creates a new [UserBloc] with initial state.
   ///
   /// Registers event handlers for all user-related events.
@@ -45,6 +54,12 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
         return;
       }
 
+      // Initialize notifications and update token
+      final notificationService = NotificationService();
+      await notificationService.initialize();
+      final fcmToken = await notificationService.getFCMToken();
+      LoggerService.info('UserBloc - FCM Token retrieved: $fcmToken');
+
       // Fetch user data from Firestore
       final userDoc = await _firestore
           .collection('users')
@@ -57,6 +72,7 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
           id: currentUser.uid,
           email: currentUser.email ?? '',
           prenom: currentUser.displayName ?? 'Voyageur',
+          fcmToken: fcmToken,
         );
 
         await _firestore
@@ -70,10 +86,25 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
           'id': currentUser.uid,
           ...userDoc.data()!,
         });
+
+        // Update FCM token if it changed
+        if (fcmToken != null && user.fcmToken != fcmToken) {
+          LoggerService.info('UserBloc - Updating FCM token in Firestore');
+          await _firestore.collection('users').doc(currentUser.uid).set({
+            'fcmToken': fcmToken,
+          }, SetOptions(merge: true));
+          LoggerService.info('UserBloc - FCM token updated');
+        } else {
+          LoggerService.info(
+            'UserBloc - FCM token not updated. Local: $fcmToken, Firestore: ${user.fcmToken}',
+          );
+        }
+
         emit(state.UserLoaded(user));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(state.UserError('Error loading user: $e'));
+      _errorService.logError('UserBloc', 'Error loading user: $e', stackTrace);
+      emit(state.UserError('Impossible de charger l\'utilisateur'));
     }
   }
 
@@ -102,8 +133,9 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
       } else {
         emit(state.UserError('User not found'));
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      emit(state.UserError('Error loading user: $e'));
+      _errorService.logError('UserBloc', 'Error loading user: $e', stackTrace);
+      emit(state.UserError('Impossible de charger l\'utilisateur'));
     }
   }
 
@@ -136,8 +168,23 @@ class UserBloc extends Bloc<event.UserEvent, state.UserState> {
         });
 
         emit(state.UserLoaded(updatedUser));
-      } catch (e) {
+
-        emit(state.UserError('Error updating user: $e'));
+        // Propager les changements aux groupes
+        await _groupRepository.updateMemberDetails(
+          userId: currentUser.id,
+          firstName: event
+              .userData['prenom'], // 'prenom' dans Firestore map map to firstName usually? Wait, UserModel has prenom/nom.
+          lastName: event.userData['nom'],
+          profilePictureUrl: event
+              .userData['profilePictureUrl'], // Key was 'profilePictureUrl' in ProfileContent
+        );
+      } catch (e, stackTrace) {
+        _errorService.logError(
+          'UserBloc',
+          'Error updating user: $e',
+          stackTrace,
+        );
+        emit(state.UserError('Impossible de mettre à jour l\'utilisateur'));
       }
     }
   }

lib/blocs/user/user_state.dart

@@ -81,6 +81,9 @@ class UserModel {
   /// User's profile picture URL (optional).
   final String? profilePictureUrl;
 
+  /// Firebase Cloud Messaging token for push notifications.
+  final String? fcmToken;
+
   /// Creates a new [UserModel] instance.
   ///
   /// [id], [email], and [prenom] are required fields.
@@ -93,6 +96,7 @@ class UserModel {
     this.authMethod,
     this.phoneNumber,
     this.profilePictureUrl,
+    this.fcmToken,
   });
 
   /// Creates a [UserModel] instance from a JSON map.
@@ -108,6 +112,7 @@ class UserModel {
       authMethod: json['authMethod'] ?? json['platform'],
       phoneNumber: json['phoneNumber'],
       profilePictureUrl: json['profilePictureUrl'],
+      fcmToken: json['fcmToken'],
     );
   }
 
@@ -123,6 +128,7 @@ class UserModel {
       'authMethod': authMethod,
       'phoneNumber': phoneNumber,
       'profilePictureUrl': profilePictureUrl,
+      'fcmToken': fcmToken,
     };
   }
 }

lib/components/account/account_content.dart

@@ -18,8 +18,11 @@
 ///
 /// The component automatically loads account data when initialized and
 /// provides a clean interface for managing group-based expenses.
+/// 
 library;
+
 import 'package:flutter/material.dart';
+import '../../services/error_service.dart';
 import 'package:travel_mate/blocs/user/user_bloc.dart';
 import '../../models/account.dart';
 import '../../blocs/account/account_bloc.dart';
@@ -28,8 +31,9 @@ import '../../blocs/account/account_state.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:travel_mate/components/error/error_content.dart';
 import '../../blocs/user/user_state.dart' as user_state;
-import '../../repositories/group_repository.dart'; // Ajouter cet import
+import '../../repositories/group_repository.dart';
-import 'group_expenses_page.dart'; // Ajouter cet import
+import '../widgets/user_state_widget.dart';
+import 'group_expenses_page.dart';
 
 /// Widget that displays the account content page with account management functionality.
 class AccountContent extends StatefulWidget {
@@ -69,10 +73,7 @@ class _AccountContentState extends State<AccountContent> {
         throw Exception('User not connected');
       }
     } catch (e) {
-      ErrorContent(
+      ErrorContent(message: 'Error loading accounts: $e', onRetry: () {});
-        message: 'Error loading accounts: $e',
-        onRetry: () {},
-      );
     }
   }
 
@@ -93,30 +94,18 @@ class _AccountContentState extends State<AccountContent> {
         Navigator.push(
           context,
           MaterialPageRoute(
-            builder: (context) => GroupExpensesPage(
+            builder: (context) =>
-              account: account,
+                GroupExpensesPage(account: account, group: group),
-              group: group,
-            ),
           ),
         );
       } else {
         if (mounted) {
-          ScaffoldMessenger.of(context).showSnackBar(
+          ErrorService().showError(message: 'Group not found for this account');
-            const SnackBar(
-              content: Text('Group not found for this account'),
-              backgroundColor: Colors.red,
-            ),
-          );
         }
       }
     } catch (e) {
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        ErrorService().showError(message: 'Error loading group: $e');
-          SnackBar(
-            content: Text('Error loading group: $e'),
-            backgroundColor: Colors.red,
-          ),
-        );
       }
     }
   }
@@ -132,46 +121,36 @@ class _AccountContentState extends State<AccountContent> {
   ///   Widget representing the complete account page UI
   @override
   Widget build(BuildContext context) {
-    return BlocBuilder<UserBloc, user_state.UserState>(
+    return UserStateWrapper(
-      builder: (context, userState) {
+      builder: (context, user) {
-        if (userState is user_state.UserLoading) {
-          return const Scaffold(
-            body: Center(child: CircularProgressIndicator()),
-          );
-        }
-
-        if (userState is user_state.UserError) {
-          return ErrorContent(
-            message: 'User error: ${userState.message}',
-            onRetry: () {},
-          ); 
-        }
-
-        if (userState is! user_state.UserLoaded) {
-          return const Scaffold(
-            body: Center(child: Text('User not connected')),
-          );
-        }
-        final user = userState.user;
-
         return BlocConsumer<AccountBloc, AccountState>(
           listener: (context, accountState) {
             if (accountState is AccountError) {
               ErrorContent(
-                message: 'Account loading error: ${accountState.message}',
+                message:
+                    'Erreur de chargement des comptes : ${accountState.message}',
                 onRetry: () {
-                  context.read<AccountBloc>().add(LoadAccountsByUserId(user.id));
+                  context.read<AccountBloc>().add(
+                    LoadAccountsByUserId(user.id),
+                  );
                 },
               );
             }
           },
           builder: (context, accountState) {
             return Scaffold(
-                body: SafeArea(child: _buildContent(accountState, user.id))
+              body: SafeArea(child: _buildContent(accountState, user.id)),
-              );
+            );
           },
         );
       },
+      loadingWidget: const Scaffold(
+        body: Center(child: CircularProgressIndicator()),
+      ),
+      errorWidget: ErrorContent(message: 'User error', onRetry: () {}),
+      noUserWidget: const Scaffold(
+        body: Center(child: Text('Utilisateur non connecté')),
+      ),
     );
   }
 
@@ -196,7 +175,7 @@ class _AccountContentState extends State<AccountContent> {
           children: [
             CircularProgressIndicator(),
             SizedBox(height: 16),
-            Text('Loading accounts...'),
+            Text('Chargement des comptes...'),
           ],
         ),
       );
@@ -204,7 +183,7 @@ class _AccountContentState extends State<AccountContent> {
 
     if (accountState is AccountError) {
       return ErrorContent(
-        message: 'Account loading error...',
+        message: 'Erreur de chargement des comptes...',
         onRetry: () {
           context.read<AccountBloc>().add(LoadAccountsByUserId(userId));
         },
@@ -222,13 +201,13 @@ class _AccountContentState extends State<AccountContent> {
       child: Column(
         mainAxisAlignment: MainAxisAlignment.center,
         children: [
-          const Text('Unknown state'),
+          const Text('État inconnu'),
           const SizedBox(height: 16),
           ElevatedButton(
             onPressed: () {
               context.read<AccountBloc>().add(LoadAccountsByUserId(userId));
             },
-            child: const Text('Load accounts'),
+            child: const Text('Charger les comptes'),
           ),
         ],
       ),
@@ -250,7 +229,11 @@ class _AccountContentState extends State<AccountContent> {
         child: Column(
           mainAxisAlignment: MainAxisAlignment.center,
           children: [
-            const Icon(Icons.account_balance_wallet, size: 80, color: Colors.grey),
+            const Icon(
+              Icons.account_balance_wallet,
+              size: 80,
+              color: Colors.grey,
+            ),
             const SizedBox(height: 16),
             const Text(
               'No accounts found',
@@ -258,7 +241,7 @@ class _AccountContentState extends State<AccountContent> {
             ),
             const SizedBox(height: 8),
             const Text(
-              'Accounts are automatically created when you create a trip',
+              'Les comptes sont créés automatiquement lorsque vous créez des voyages.',
               style: TextStyle(fontSize: 14, color: Colors.grey),
               textAlign: TextAlign.center,
             ),
@@ -289,25 +272,14 @@ class _AccountContentState extends State<AccountContent> {
       child: ListView(
         padding: const EdgeInsets.all(16),
         children: [
-          const Text(
-            'My accounts',
-            style: TextStyle(fontSize: 28, fontWeight: FontWeight.bold),
-          ),
-          const SizedBox(height: 8),
-          Text(
-            'Manage your travel accounts',
-            style: TextStyle(fontSize: 14, color: Colors.grey[600]),
-          ),
-          const SizedBox(height: 24),
-          
           ...accounts.map((account) {
             return Padding(
               padding: const EdgeInsets.only(bottom: 12),
               child: _buildSimpleAccountCard(account),
             );
-          })
+          }),
         ],
-      )
+      ),
     );
   }
 
@@ -329,9 +301,10 @@ class _AccountContentState extends State<AccountContent> {
       final colors = [Colors.blue, Colors.purple, Colors.green, Colors.orange];
       final color = colors[account.name.hashCode.abs() % colors.length];
 
-      String memberInfo = '${account.members.length} member${account.members.length > 1 ? 's' : ''}';
+      String memberInfo =
+          '${account.members.length} member${account.members.length > 1 ? 's' : ''}';
 
-      if(account.members.isNotEmpty){
+      if (account.members.isNotEmpty) {
         final names = account.members
             .take(2)
             .map((m) => m.pseudo.isNotEmpty ? m.pseudo : m.firstName)
@@ -344,7 +317,10 @@ class _AccountContentState extends State<AccountContent> {
         child: ListTile(
           leading: CircleAvatar(
             backgroundColor: color,
-            child: const Icon(Icons.account_balance_wallet, color: Colors.white),
+            child: const Icon(
+              Icons.account_balance_wallet,
+              color: Colors.white,
+            ),
           ),
           title: Text(
             account.name,
@@ -352,7 +328,8 @@ class _AccountContentState extends State<AccountContent> {
           ),
           subtitle: Text(memberInfo),
           trailing: const Icon(Icons.chevron_right),
-          onTap: () => _navigateToGroupExpenses(account), // Navigate to group expenses
+          onTap: () =>
+              _navigateToGroupExpenses(account), // Navigate to group expenses
         ),
       );
     } catch (e) {
@@ -361,7 +338,7 @@ class _AccountContentState extends State<AccountContent> {
         child: const ListTile(
           leading: Icon(Icons.error, color: Colors.red),
           title: Text('Display error'),
-        )
+        ),
       );
     }
   }

lib/components/account/add_expense_dialog.dart

@@ -56,12 +56,14 @@
 /// - Group
 /// - ExpenseBloc
 library;
+
 import 'dart:io';
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:image_picker/image_picker.dart';
 import 'package:intl/intl.dart';
 import 'package:travel_mate/models/expense_split.dart';
+import '../../services/error_service.dart';
 import '../../blocs/expense/expense_bloc.dart';
 import '../../blocs/expense/expense_event.dart';
 import '../../blocs/expense/expense_state.dart';
@@ -76,11 +78,25 @@ import '../../models/expense.dart';
 class AddExpenseDialog extends StatefulWidget {
   /// The group to which the expense belongs.
   final Group group;
+
   /// The user creating or editing the expense.
   final user_state.UserModel currentUser;
+
   /// The expense to edit (null for new expense).
   final Expense? expenseToEdit;
 
+  /// Optional initial category for a new expense.
+  final ExpenseCategory? initialCategory;
+
+  /// Optional initial amount for a new expense.
+  final double? initialAmount;
+
+  /// Optional initial splits (userId -> amount) for a new expense.
+  final Map<String, double>? initialSplits;
+
+  /// Optional initial description for a new expense.
+  final String? initialDescription;
+
   /// Creates an AddExpenseDialog.
   ///
   /// [group] is the group for the expense.
@@ -91,6 +107,10 @@ class AddExpenseDialog extends StatefulWidget {
     required this.group,
     required this.currentUser,
     this.expenseToEdit,
+    this.initialCategory,
+    this.initialAmount,
+    this.initialSplits,
+    this.initialDescription,
   });
 
   @override
@@ -103,33 +123,49 @@ class AddExpenseDialog extends StatefulWidget {
 class _AddExpenseDialogState extends State<AddExpenseDialog> {
   /// Form key for validating the expense form.
   final _formKey = GlobalKey<FormState>();
+
   /// Controller for the expense description field.
   final _descriptionController = TextEditingController();
+
   /// Controller for the expense amount field.
   final _amountController = TextEditingController();
+
   /// The selected date for the expense.
   late DateTime _selectedDate;
+
   /// The selected category for the expense.
   late ExpenseCategory _selectedCategory;
+
   /// The selected currency for the expense.
   late ExpenseCurrency _selectedCurrency;
+
   /// The user ID of the payer.
   late String _paidById;
+
   /// Map of userId to split amount for each participant.
   final Map<String, double> _splits = {};
+
   /// The selected receipt image file, if any.
   File? _receiptImage;
+
   /// Whether the dialog is currently submitting data.
   bool _isLoading = false;
+
   /// Whether the expense is split equally among participants.
   bool _splitEqually = true;
 
+  /// Whether the existing receipt has been removed.
+  bool _receiptRemoved = false;
+
   @override
   void initState() {
     super.initState();
     // Initialize form fields and splits based on whether editing or creating
     _selectedDate = widget.expenseToEdit?.date ?? DateTime.now();
-    _selectedCategory = widget.expenseToEdit?.category ?? ExpenseCategory.other;
+    _selectedCategory =
+        widget.expenseToEdit?.category ??
+        widget.initialCategory ??
+        ExpenseCategory.other;
     _selectedCurrency = widget.expenseToEdit?.currency ?? ExpenseCurrency.eur;
     _paidById = widget.expenseToEdit?.paidById ?? widget.currentUser.id;
 
@@ -142,9 +178,32 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
       }
       _splitEqually = false;
     } else {
-      // Creating: initialize splits for all group members
+      // Creating: initialize splits
-      for (final member in widget.group.members) {
+      if (widget.initialDescription != null) {
-        _splits[member.userId] = 0;
+        _descriptionController.text = widget.initialDescription!;
+      }
+
+      if (widget.initialAmount != null) {
+        _amountController.text = widget.initialAmount.toString();
+      }
+
+      if (widget.initialSplits != null) {
+        _splits.addAll(widget.initialSplits!);
+        // Fill remaining members with 0 if not in initialSplits
+        for (final member in widget.group.members) {
+          if (!_splits.containsKey(member.userId)) {
+            _splits[member.userId] = 0;
+          } else {
+            // If we have specific splits, we probably aren't splitting equally by default logic
+            // unless we want to force it. For reimbursement, we likely set exact amounts.
+            _splitEqually = false;
+          }
+        }
+      } else {
+        // Default behavior: initialize splits for all group members
+        for (final member in widget.group.members) {
+          _splits[member.userId] = 0;
+        }
       }
     }
   }
@@ -175,11 +234,8 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
 
       if (fileSize > 5 * 1024 * 1024) {
         if (mounted) {
-          ScaffoldMessenger.of(context).showSnackBar(
+          ErrorService().showError(
-            const SnackBar(
+            message: 'L\'image ne doit pas dépasser 5 Mo',
-              content: Text('L\'image ne doit pas dépasser 5 Mo'),
-              backgroundColor: Colors.red,
-            ),
           );
         }
         return;
@@ -221,24 +277,18 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
     if (!_formKey.currentState!.validate()) return;
 
     final amount = double.parse(_amountController.text);
-    final selectedSplits = _splits.entries
+    final selectedSplits = _splits.entries.where((e) => e.value > 0).map((e) {
-        .where((e) => e.value > 0)
+      final member = widget.group.members.firstWhere((m) => m.userId == e.key);
-        .map((e) {
+      return ExpenseSplit(
-          final member = widget.group.members.firstWhere((m) => m.userId == e.key);
+        userId: e.key,
-          return ExpenseSplit(
+        userName: member.firstName,
-            userId: e.key,
+        amount: e.value,
-            userName: member.firstName,
+      );
-            amount: e.value,
+    }).toList();
-          );
-        })
-        .toList();
 
     if (selectedSplits.isEmpty) {
-      ScaffoldMessenger.of(context).showSnackBar(
+      ErrorService().showError(
-        const SnackBar(
+        message: 'Veuillez sélectionner au moins un participant',
-          content: Text('Veuillez sélectionner au moins un participant'),
-          backgroundColor: Colors.red,
-        ),
       );
       return;
     }
@@ -248,11 +298,15 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
     try {
       // Convertir en EUR
       final amountInEur = context.read<ExpenseBloc>().state is ExpensesLoaded
-          ? (context.read<ExpenseBloc>().state as ExpensesLoaded)
+          ? ((context.read<ExpenseBloc>().state as ExpensesLoaded)
-              .exchangeRates[_selectedCurrency]! * amount
+                        .exchangeRates[_selectedCurrency.code] ??
+                    1.0) *
+                amount
           : amount;
 
-      final payer = widget.group.members.firstWhere((m) => m.userId == _paidById);
+      final payer = widget.group.members.firstWhere(
+        (m) => m.userId == _paidById,
+      );
 
       final expense = Expense(
         id: widget.expenseToEdit?.id ?? '',
@@ -266,41 +320,32 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
         paidByName: payer.firstName,
         splits: selectedSplits,
         date: _selectedDate,
-        receiptUrl: widget.expenseToEdit?.receiptUrl,
+        receiptUrl: _receiptRemoved ? null : widget.expenseToEdit?.receiptUrl,
         createdAt: widget.expenseToEdit?.createdAt ?? DateTime.now(),
       );
 
       if (widget.expenseToEdit == null) {
-        context.read<ExpenseBloc>().add(CreateExpense(
+        context.read<ExpenseBloc>().add(
-          expense: expense,
+          CreateExpense(expense: expense, receiptImage: _receiptImage),
-          receiptImage: _receiptImage,
+        );
-        ));
       } else {
-        context.read<ExpenseBloc>().add(UpdateExpense(
+        context.read<ExpenseBloc>().add(
-          expense: expense,
+          UpdateExpense(expense: expense, newReceiptImage: _receiptImage),
-          newReceiptImage: _receiptImage,
+        );
-        ));
       }
 
       if (mounted) {
         Navigator.of(context).pop();
-        ScaffoldMessenger.of(context).showSnackBar(
+        ErrorService().showSnackbar(
-          SnackBar(
+          message: widget.expenseToEdit == null
-            content: Text(widget.expenseToEdit == null
+              ? 'Dépense ajoutée'
-                ? 'Dépense ajoutée'
+              : 'Dépense modifiée',
-                : 'Dépense modifiée'),
+          isError: false,
-            backgroundColor: Colors.green,
-          ),
         );
       }
     } catch (e) {
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        ErrorService().showError(message: 'Erreur: $e');
-          SnackBar(
-            content: Text('Erreur: $e'),
-            backgroundColor: Colors.red,
-          ),
-        );
       }
     } finally {
       if (mounted) {
@@ -314,284 +359,425 @@ class _AddExpenseDialogState extends State<AddExpenseDialog> {
   /// Returns a Dialog widget containing the expense form.
   @override
   Widget build(BuildContext context) {
+    final theme = Theme.of(context);
+    final isDark = theme.brightness == Brightness.dark;
+
     return Dialog(
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(16)),
+      backgroundColor: isDark ? theme.scaffoldBackgroundColor : Colors.white,
+      insetPadding: const EdgeInsets.symmetric(horizontal: 16, vertical: 24),
       child: Container(
-        constraints: const BoxConstraints(maxWidth: 600, maxHeight: 700),
+        constraints: const BoxConstraints(maxWidth: 500, maxHeight: 800),
-        child: Scaffold(
+        child: Column(
-          appBar: AppBar(
+          children: [
-            title: Text(widget.expenseToEdit == null
+            // Header
-                ? 'Nouvelle dépense'
+            Padding(
-                : 'Modifier la dépense'),
+              padding: const EdgeInsets.fromLTRB(24, 24, 16, 16),
-            automaticallyImplyLeading: false,
+              child: Row(
-            actions: [
+                children: [
-              IconButton(
+                  Expanded(
-                icon: const Icon(Icons.close),
+                    child: Text(
-                onPressed: () => Navigator.of(context).pop(),
+                      widget.expenseToEdit == null
+                          ? 'Nouvelle dépense'
+                          : 'Modifier la dépense',
+                      style: const TextStyle(
+                        fontSize: 20,
+                        fontWeight: FontWeight.bold,
+                      ),
+                      textAlign: TextAlign.center,
+                    ),
+                  ),
+                  IconButton(
+                    icon: const Icon(Icons.close),
+                    onPressed: () => Navigator.of(context).pop(),
+                    padding: EdgeInsets.zero,
+                    constraints: const BoxConstraints(),
+                  ),
+                ],
               ),
-            ],
+            ),
-          ),
+            const Divider(height: 1),
-          body: Form(
-            key: _formKey,
-            child: ListView(
-              padding: const EdgeInsets.all(16),
-              children: [
-                // Description
-                TextFormField(
-                  controller: _descriptionController,
-                  decoration: const InputDecoration(
-                    labelText: 'Description',
-                    hintText: 'Ex: Restaurant, Essence...',
-                    border: OutlineInputBorder(),
-                    prefixIcon: Icon(Icons.description),
-                  ),
-                  validator: (value) {
-                    if (value == null || value.trim().isEmpty) {
-                      return 'Veuillez entrer une description';
-                    }
-                    return null;
-                  },
-                ),
-                const SizedBox(height: 16),
 
-                // Montant et devise
+            // Form Content
-                Row(
+            Expanded(
+              child: Form(
+                key: _formKey,
+                child: ListView(
+                  padding: const EdgeInsets.all(24),
                   children: [
-                    Expanded(
+                    // Description
-                      flex: 2,
+                    TextFormField(
-                      child: TextFormField(
+                      controller: _descriptionController,
-                        controller: _amountController,
+                      decoration: InputDecoration(
-                        decoration: const InputDecoration(
+                        labelText: 'Description',
-                          labelText: 'Montant',
+                        hintText: 'Ex: Restaurant, Essence...',
-                          border: OutlineInputBorder(),
+                        prefixIcon: const Icon(Icons.description_outlined),
-                          prefixIcon: Icon(Icons.euro),
+                        border: OutlineInputBorder(
+                          borderRadius: BorderRadius.circular(8),
                         ),
-                        keyboardType: const TextInputType.numberWithOptions(decimal: true),
+                        contentPadding: const EdgeInsets.symmetric(
-                        onChanged: (_) => _calculateSplits(),
+                          horizontal: 16,
-                        validator: (value) {
+                          vertical: 16,
-                          if (value == null || value.isEmpty) {
-                            return 'Requis';
-                          }
-                          if (double.tryParse(value) == null || double.parse(value) <= 0) {
-                            return 'Montant invalide';
-                          }
-                          return null;
-                        },
-                      ),
-                    ),
-                    const SizedBox(width: 8),
-                    Expanded(
-                      child: DropdownButtonFormField<ExpenseCurrency>(
-                        initialValue: _selectedCurrency,
-                        decoration: const InputDecoration(
-                          labelText: 'Devise',
-                          border: OutlineInputBorder(),
                         ),
-                        items: ExpenseCurrency.values.map((currency) {
-                          return DropdownMenuItem(
-                            value: currency,
-                            child: Text(currency.code),
-                          );
-                        }).toList(),
-                        onChanged: (value) {
-                          if (value != null) {
-                            setState(() => _selectedCurrency = value);
-                          }
-                        },
                       ),
+                      validator: (value) {
+                        if (value == null || value.trim().isEmpty) {
+                          return 'Requis';
+                        }
+                        return null;
+                      },
                     ),
-                  ],
+                    const SizedBox(height: 16),
-                ),
-                const SizedBox(height: 16),
 
-                // Catégorie
+                    // Montant et Devise
-                DropdownButtonFormField<ExpenseCategory>(
+                    Row(
-                  initialValue: _selectedCategory,
-                  decoration: const InputDecoration(
-                    labelText: 'Catégorie',
-                    border: OutlineInputBorder(),
-                    prefixIcon: Icon(Icons.category),
-                  ),
-                  items: ExpenseCategory.values.map((category) {
-                    return DropdownMenuItem(
-                      value: category,
-                      child: Row(
-                        children: [
-                          Icon(category.icon, size: 20),
-                          const SizedBox(width: 8),
-                          Text(category.displayName),
-                        ],
-                      ),
-                    );
-                  }).toList(),
-                  onChanged: (value) {
-                    if (value != null) {
-                      setState(() => _selectedCategory = value);
-                    }
-                  },
-                ),
-                const SizedBox(height: 16),
-
-                // Date
-                ListTile(
-                  leading: const Icon(Icons.calendar_today),
-                  title: const Text('Date'),
-                  subtitle: Text(DateFormat('dd/MM/yyyy').format(_selectedDate)),
-                  shape: RoundedRectangleBorder(
-                    side: BorderSide(color: Colors.grey[300]!),
-                    borderRadius: BorderRadius.circular(4),
-                  ),
-                  onTap: () async {
-                    final date = await showDatePicker(
-                      context: context,
-                      initialDate: _selectedDate,
-                      firstDate: DateTime(2020),
-                      lastDate: DateTime.now().add(const Duration(days: 365)),
-                    );
-                    if (date != null) {
-                      setState(() => _selectedDate = date);
-                    }
-                  },
-                ),
-                const SizedBox(height: 16),
-
-                // Payé par
-                DropdownButtonFormField<String>(
-                  initialValue: _paidById,
-                  decoration: const InputDecoration(
-                    labelText: 'Payé par',
-                    border: OutlineInputBorder(),
-                    prefixIcon: Icon(Icons.person),
-                  ),
-                  items: widget.group.members.map((member) {
-                    return DropdownMenuItem(
-                      value: member.userId,
-                      child: Text(member.firstName),
-                    );
-                  }).toList(),
-                  onChanged: (value) {
-                    if (value != null) {
-                      setState(() => _paidById = value);
-                    }
-                  },
-                ),
-                const SizedBox(height: 16),
-
-                // Division
-                Card(
-                  child: Padding(
-                    padding: const EdgeInsets.all(12),
-                    child: Column(
                       crossAxisAlignment: CrossAxisAlignment.start,
                       children: [
-                        Row(
+                        Expanded(
-                          children: [
+                          flex: 2,
-                            const Text(
+                          child: TextFormField(
-                              'Division',
+                            controller: _amountController,
-                              style: TextStyle(
+                            decoration: InputDecoration(
-                                fontSize: 16,
+                              labelText: 'Montant',
-                                fontWeight: FontWeight.bold,
+                              prefixIcon: const Icon(Icons.euro_symbol),
+                              border: OutlineInputBorder(
+                                borderRadius: BorderRadius.circular(8),
+                              ),
+                              contentPadding: const EdgeInsets.symmetric(
+                                horizontal: 16,
+                                vertical: 16,
                               ),
                             ),
+                            keyboardType: const TextInputType.numberWithOptions(
+                              decimal: true,
+                            ),
+                            onChanged: (_) => _calculateSplits(),
+                            validator: (value) {
+                              if (value == null || value.isEmpty) {
+                                return 'Requis';
+                              }
+                              if (double.tryParse(value) == null ||
+                                  double.parse(value) <= 0) {
+                                return 'Invalide';
+                              }
+                              return null;
+                            },
+                          ),
+                        ),
+                        const SizedBox(width: 12),
+                        Expanded(
+                          child: DropdownButtonFormField<ExpenseCurrency>(
+                            initialValue: _selectedCurrency,
+                            decoration: InputDecoration(
+                              labelText: 'Devise',
+                              border: OutlineInputBorder(
+                                borderRadius: BorderRadius.circular(8),
+                              ),
+                              contentPadding: const EdgeInsets.symmetric(
+                                horizontal: 12,
+                                vertical: 16,
+                              ),
+                            ),
+                            items: ExpenseCurrency.values.map((currency) {
+                              return DropdownMenuItem(
+                                value: currency,
+                                child: Text(currency.code),
+                              );
+                            }).toList(),
+                            onChanged: (value) {
+                              if (value != null) {
+                                setState(() => _selectedCurrency = value);
+                              }
+                            },
+                          ),
+                        ),
+                      ],
+                    ),
+                    const SizedBox(height: 16),
+
+                    // Catégorie
+                    DropdownButtonFormField<ExpenseCategory>(
+                      initialValue: _selectedCategory,
+                      decoration: InputDecoration(
+                        labelText: 'Catégorie',
+                        prefixIcon: Icon(_selectedCategory.icon),
+                        border: OutlineInputBorder(
+                          borderRadius: BorderRadius.circular(8),
+                        ),
+                        contentPadding: const EdgeInsets.symmetric(
+                          horizontal: 16,
+                          vertical: 16,
+                        ),
+                      ),
+                      items: ExpenseCategory.values.map((category) {
+                        return DropdownMenuItem(
+                          value: category,
+                          child: Text(category.displayName),
+                        );
+                      }).toList(),
+                      onChanged: (value) {
+                        if (value != null) {
+                          setState(() => _selectedCategory = value);
+                        }
+                      },
+                    ),
+                    const SizedBox(height: 16),
+
+                    // Date
+                    InkWell(
+                      onTap: () async {
+                        final date = await showDatePicker(
+                          context: context,
+                          initialDate: _selectedDate,
+                          firstDate: DateTime(2020),
+                          lastDate: DateTime.now().add(
+                            const Duration(days: 365),
+                          ),
+                        );
+                        if (date != null) setState(() => _selectedDate = date);
+                      },
+                      borderRadius: BorderRadius.circular(8),
+                      child: InputDecorator(
+                        decoration: InputDecoration(
+                          labelText: 'Date',
+                          prefixIcon: const Icon(Icons.calendar_today_outlined),
+                          border: OutlineInputBorder(
+                            borderRadius: BorderRadius.circular(8),
+                          ),
+                          contentPadding: const EdgeInsets.symmetric(
+                            horizontal: 16,
+                            vertical: 16,
+                          ),
+                        ),
+                        child: Text(
+                          DateFormat('dd/MM/yyyy').format(_selectedDate),
+                          style: theme.textTheme.bodyLarge,
+                        ),
+                      ),
+                    ),
+                    const SizedBox(height: 16),
+
+                    // Payé par
+                    DropdownButtonFormField<String>(
+                      initialValue: _paidById,
+                      decoration: InputDecoration(
+                        labelText: 'Payé par',
+                        prefixIcon: const Icon(Icons.person_outline),
+                        border: OutlineInputBorder(
+                          borderRadius: BorderRadius.circular(8),
+                        ),
+                        contentPadding: const EdgeInsets.symmetric(
+                          horizontal: 16,
+                          vertical: 16,
+                        ),
+                      ),
+                      items: widget.group.members.map((member) {
+                        return DropdownMenuItem(
+                          value: member.userId,
+                          child: Text(member.firstName),
+                        );
+                      }).toList(),
+                      onChanged: (value) {
+                        if (value != null) setState(() => _paidById = value);
+                      },
+                    ),
+                    const SizedBox(height: 24),
+
+                    // Division Section
+                    Container(
+                      decoration: BoxDecoration(
+                        color: isDark ? Colors.grey[800] : Colors.grey[50],
+                        borderRadius: BorderRadius.circular(12),
+                        border: Border.all(color: theme.dividerColor),
+                      ),
+                      padding: const EdgeInsets.all(16),
+                      child: Column(
+                        children: [
+                          Row(
+                            children: [
+                              const Text(
+                                'Division',
+                                style: TextStyle(
+                                  fontSize: 16,
+                                  fontWeight: FontWeight.bold,
+                                ),
+                              ),
+                              const Spacer(),
+                              Text(
+                                'Égale',
+                                style: TextStyle(
+                                  color: isDark
+                                      ? Colors.grey[400]
+                                      : Colors.grey[600],
+                                ),
+                              ),
+                              const SizedBox(width: 8),
+                              Switch(
+                                value: _splitEqually,
+                                onChanged: (value) {
+                                  setState(() {
+                                    _splitEqually = value;
+                                    if (value) _calculateSplits();
+                                  });
+                                },
+                                activeThumbColor: theme.colorScheme.primary,
+                              ),
+                            ],
+                          ),
+                          const Divider(),
+                          ...widget.group.members.map((member) {
+                            final isSelected =
+                                _splits.containsKey(member.userId) &&
+                                _splits[member.userId]! >= 0;
+
+                            return Padding(
+                              padding: const EdgeInsets.symmetric(vertical: 4),
+                              child: Row(
+                                children: [
+                                  Expanded(
+                                    child: Text(
+                                      member.firstName,
+                                      style: const TextStyle(fontSize: 16),
+                                    ),
+                                  ),
+                                  if (!_splitEqually && isSelected)
+                                    SizedBox(
+                                      width: 100,
+                                      child: TextFormField(
+                                        initialValue: _splits[member.userId]
+                                            ?.toStringAsFixed(2),
+                                        decoration: const InputDecoration(
+                                          isDense: true,
+                                          contentPadding: EdgeInsets.symmetric(
+                                            horizontal: 8,
+                                            vertical: 8,
+                                          ),
+                                          border: OutlineInputBorder(),
+                                          suffixText: '€',
+                                        ),
+                                        keyboardType:
+                                            const TextInputType.numberWithOptions(
+                                              decimal: true,
+                                            ),
+                                        onChanged: (value) {
+                                          final amount =
+                                              double.tryParse(value) ?? 0;
+                                          setState(
+                                            () =>
+                                                _splits[member.userId] = amount,
+                                          );
+                                        },
+                                      ),
+                                    ),
+                                  Checkbox(
+                                    value: isSelected,
+                                    onChanged: (value) {
+                                      setState(() {
+                                        if (value == true) {
+                                          _splits[member.userId] = 0;
+                                          if (_splitEqually) _calculateSplits();
+                                        } else {
+                                          _splits[member.userId] = -1;
+                                        }
+                                      });
+                                    },
+                                    activeColor: theme.colorScheme.primary,
+                                    shape: RoundedRectangleBorder(
+                                      borderRadius: BorderRadius.circular(4),
+                                    ),
+                                  ),
+                                ],
+                              ),
+                            );
+                          }),
+                        ],
+                      ),
+                    ),
+                    const SizedBox(height: 16),
+
+                    // Reçu (Optional - keeping simple for now as per design focus)
+                    if (_receiptImage != null ||
+                        (widget.expenseToEdit?.receiptUrl != null &&
+                            !_receiptRemoved))
+                      Container(
+                        padding: const EdgeInsets.all(12),
+                        decoration: BoxDecoration(
+                          border: Border.all(color: theme.dividerColor),
+                          borderRadius: BorderRadius.circular(8),
+                        ),
+                        child: Row(
+                          children: [
+                            const Icon(Icons.receipt_long, color: Colors.green),
+                            const SizedBox(width: 8),
+                            const Text('Reçu joint'),
                             const Spacer(),
-                            Text(_splitEqually ? 'Égale' : 'Personnalisée'),
+                            IconButton(
-                            Switch(
+                              icon: const Icon(Icons.close),
-                              value: _splitEqually,
+                              onPressed: () => setState(() {
-                              onChanged: (value) {
+                                _receiptImage = null;
-                                setState(() {
+                                _receiptRemoved = true;
-                                  _splitEqually = value;
+                              }),
-                                  if (value) _calculateSplits();
-                                });
-                              },
                             ),
                           ],
                         ),
-                        const Divider(),
+                      )
-                        ...widget.group.members.map((member) {
+                    else
-                          final isSelected = _splits.containsKey(member.userId) &&
+                      OutlinedButton.icon(
-                              _splits[member.userId]! >= 0;
+                        onPressed: _pickImage,
-                          
+                        icon: const Icon(Icons.camera_alt_outlined),
-                          return CheckboxListTile(
+                        label: const Text('Ajouter un reçu'),
-                            title: Text(member.firstName),
+                        style: OutlinedButton.styleFrom(
-                            subtitle: _splitEqually || !isSelected
+                          padding: const EdgeInsets.symmetric(vertical: 12),
-                                ? null
+                          shape: RoundedRectangleBorder(
-                                : TextFormField(
+                            borderRadius: BorderRadius.circular(8),
-                                    initialValue: _splits[member.userId]?.toStringAsFixed(2),
+                          ),
-                                    decoration: const InputDecoration(
+                        ),
-                                      labelText: 'Montant',
-                                      isDense: true,
-                                    ),
-                                    keyboardType: const TextInputType.numberWithOptions(decimal: true),
-                                    onChanged: (value) {
-                                      final amount = double.tryParse(value) ?? 0;
-                                      setState(() => _splits[member.userId] = amount);
-                                    },
-                                  ),
-                            value: isSelected,
-                            onChanged: (value) {
-                              setState(() {
-                                if (value == true) {
-                                  _splits[member.userId] = 0;
-                                  if (_splitEqually) _calculateSplits();
-                                } else {
-                                  _splits[member.userId] = -1;
-                                }
-                              });
-                            },
-                          );
-                        }),
-                      ],
-                    ),
-                  ),
-                ),
-                const SizedBox(height: 16),
-
-                // Reçu
-                ListTile(
-                  leading: const Icon(Icons.receipt),
-                  title: Text(_receiptImage != null || widget.expenseToEdit?.receiptUrl != null
-                      ? 'Reçu ajouté'
-                      : 'Ajouter un reçu'),
-                  subtitle: _receiptImage != null
-                      ? const Text('Nouveau reçu sélectionné')
-                      : null,
-                  trailing: IconButton(
-                    icon: const Icon(Icons.add_photo_alternate),
-                    onPressed: _pickImage,
-                  ),
-                  shape: RoundedRectangleBorder(
-                    side: BorderSide(color: Colors.grey[300]!),
-                    borderRadius: BorderRadius.circular(4),
-                  ),
-                ),
-                const SizedBox(height: 24),
-
-                // Boutons
-                Row(
-                  children: [
-                    Expanded(
-                      child: OutlinedButton(
-                        onPressed: _isLoading ? null : () => Navigator.of(context).pop(),
-                        child: const Text('Annuler'),
                       ),
-                    ),
-                    const SizedBox(width: 16),
-                    Expanded(
-                      child: ElevatedButton(
-                        onPressed: _isLoading ? null : _submit,
-                        child: _isLoading
-                            ? const SizedBox(
-                                height: 20,
-                                width: 20,
-                                child: CircularProgressIndicator(strokeWidth: 2),
-                              )
-                            : Text(widget.expenseToEdit == null ? 'Ajouter' : 'Modifier'),
-                      ),
-                    ),
                   ],
                 ),
-              ],
+              ),
             ),
-          ),
+
+            // Bottom Button
+            Padding(
+              padding: const EdgeInsets.all(24),
+              child: SizedBox(
+                width: double.infinity,
+                child: ElevatedButton(
+                  onPressed: _isLoading ? null : _submit,
+                  style: ElevatedButton.styleFrom(
+                    padding: const EdgeInsets.symmetric(vertical: 16),
+                    shape: RoundedRectangleBorder(
+                      borderRadius: BorderRadius.circular(12),
+                    ),
+                    backgroundColor: theme.colorScheme.primary,
+                    foregroundColor: Colors.white,
+                    elevation: 0,
+                  ),
+                  child: _isLoading
+                      ? const SizedBox(
+                          height: 20,
+                          width: 20,
+                          child: CircularProgressIndicator(
+                            strokeWidth: 2,
+                            valueColor: AlwaysStoppedAnimation<Color>(
+                              Colors.white,
+                            ),
+                          ),
+                        )
+                      : Text(
+                          widget.expenseToEdit == null
+                              ? 'Ajouter'
+                              : 'Enregistrer',
+                          style: const TextStyle(
+                            fontSize: 16,
+                            fontWeight: FontWeight.bold,
+                          ),
+                        ),
+                ),
+              ),
+            ),
+          ],
         ),
       ),
     );

lib/components/account/balances_tab.dart

@@ -6,7 +6,13 @@
 library;
 
 import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import '../../blocs/user/user_bloc.dart';
+import '../../blocs/user/user_state.dart' as user_state;
+import '../../models/expense.dart';
+import '../../models/group.dart';
 import '../../models/user_balance.dart';
+import 'add_expense_dialog.dart';
 
 /// A stateless widget that displays a list of user balances in a group.
 ///
@@ -18,21 +24,19 @@ class BalancesTab extends StatelessWidget {
   /// The list of user balances to display.
   final List<UserBalance> balances;
 
+  /// The group associated with these balances.
+  final Group group;
+
   /// Creates a `BalancesTab` widget.
   ///
   /// The [balances] parameter must not be null.
-  const BalancesTab({
+  const BalancesTab({super.key, required this.balances, required this.group});
-    super.key,
-    required this.balances,
-  });
 
   @override
   Widget build(BuildContext context) {
     // Check if the balances list is empty and display a placeholder message if true.
     if (balances.isEmpty) {
-      return const Center(
+      return const Center(child: Text('Aucune balance à afficher'));
-        child: Text('Aucune balance à afficher'),
-      );
     }
 
     // Render the list of balances as a scrollable list.
@@ -79,81 +83,149 @@ class BalancesTab extends StatelessWidget {
       margin: const EdgeInsets.only(bottom: 12),
       child: Padding(
         padding: const EdgeInsets.all(16),
-        child: Row(
+        child: Column(
           children: [
-            // Display the user's initial in a circular avatar.
+            Row(
-            CircleAvatar(
+              children: [
-              radius: 24,
+                // Display the user's initial in a circular avatar.
-              backgroundColor: isDark ? Colors.grey[800] : Colors.grey[200],
+                CircleAvatar(
-              child: Text(
+                  radius: 24,
-                balance.userName.isNotEmpty
+                  backgroundColor: isDark ? Colors.grey[800] : Colors.grey[200],
-                    ? balance.userName[0].toUpperCase()
+                  child: Text(
-                    : '?',
+                    balance.userName.isNotEmpty
-                style: const TextStyle(
+                        ? balance.userName[0].toUpperCase()
-                  fontSize: 20,
+                        : '?',
-                  fontWeight: FontWeight.bold,
-                ),
-              ),
-            ),
-            const SizedBox(width: 16),
-            // Display the user's name and financial details.
-            Expanded(
-              child: Column(
-                crossAxisAlignment: CrossAxisAlignment.start,
-                children: [
-                  // User's name.
-                  Text(
-                    balance.userName,
                     style: const TextStyle(
-                      fontSize: 16,
+                      fontSize: 20,
                       fontWeight: FontWeight.bold,
                     ),
                   ),
-                  const SizedBox(height: 4),
+                ),
-                  // User's total paid and owed amounts.
+                const SizedBox(width: 16),
-                  Text(
+                // Display the user's name and financial details.
-                    'Payé: ${balance.totalPaid.toStringAsFixed(2)} € • Doit: ${balance.totalOwed.toStringAsFixed(2)} €',
+                Expanded(
-                    style: TextStyle(
+                  child: Column(
-                      fontSize: 12,
+                    crossAxisAlignment: CrossAxisAlignment.start,
-                      color: isDark ? Colors.grey[400] : Colors.grey[600],
+                    children: [
-                    ),
+                      // User's name.
-                  ),
+                      Text(
-                ],
+                        balance.userName,
-              ),
+                        style: const TextStyle(
-            ),
+                          fontSize: 16,
-            // Display the user's balance status and amount.
+                          fontWeight: FontWeight.bold,
-            Column(
+                        ),
-              crossAxisAlignment: CrossAxisAlignment.end,
-              children: [
-                Row(
-                  children: [
-                    // Icon indicating the balance status.
-                    Icon(balanceIcon, size: 16, color: balanceColor),
-                    const SizedBox(width: 4),
-                    // User's absolute balance amount.
-                    Text(
-                      '${balance.absoluteBalance.toStringAsFixed(2)} €',
-                      style: TextStyle(
-                        fontSize: 18,
-                        fontWeight: FontWeight.bold,
-                        color: balanceColor,
                       ),
+                      const SizedBox(height: 4),
+                      // User's total paid and owed amounts.
+                      Text(
+                        'Payé: ${balance.totalPaid.toStringAsFixed(2)} € • Doit: ${balance.totalOwed.toStringAsFixed(2)} €',
+                        style: TextStyle(
+                          fontSize: 12,
+                          color: isDark ? Colors.grey[400] : Colors.grey[600],
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+                // Display the user's balance status and amount.
+                Column(
+                  crossAxisAlignment: CrossAxisAlignment.end,
+                  children: [
+                    Row(
+                      children: [
+                        // Icon indicating the balance status.
+                        Icon(balanceIcon, size: 16, color: balanceColor),
+                        const SizedBox(width: 4),
+                        // User's absolute balance amount.
+                        Text(
+                          '${balance.absoluteBalance.toStringAsFixed(2)} €',
+                          style: TextStyle(
+                            fontSize: 18,
+                            fontWeight: FontWeight.bold,
+                            color: balanceColor,
+                          ),
+                        ),
+                      ],
+                    ),
+                    // Text indicating the balance status (e.g., "À recevoir").
+                    Text(
+                      balanceText,
+                      style: TextStyle(fontSize: 12, color: balanceColor),
                     ),
                   ],
                 ),
-                // Text indicating the balance status (e.g., "À recevoir").
-                Text(
-                  balanceText,
-                  style: TextStyle(
-                    fontSize: 12,
-                    color: balanceColor,
-                  ),
-                ),
               ],
             ),
+            // "Rembourser" button (Only show if this user is owed money and current user is looking at list?
+            // Wait, this list shows balances of everyone.
+            // Requirement: "Il faut un bouton dans la page qui permet de régler l'argent qu'on doit à une certaine personne"
+            // So if I look at "Alice", and Alice "shouldReceive" (is green), it implies the group owes Alice.
+            // But does it mean *I* owe Alice?
+            // The BalancesTab shows the *Group's* balances.
+            // However, usually settlement is 1-on-1. The requirement says: "régler l'argent qu'on doit à une certaine personne".
+            // If the user displayed here 'shouldReceive' money, it means they are owed money.
+            // If I click 'Rembourser', it implies *I* am paying them.
+            // This button should probably be available if the user on the card is POSITIVE (shouldReceive)
+            // AND I am not that user.
+            if (balance.shouldReceive) ...[
+              const SizedBox(height: 12),
+              SizedBox(
+                width: double.infinity,
+                child: OutlinedButton.icon(
+                  onPressed: () => _showReimbursementDialog(context, balance),
+                  icon: const Icon(Icons.monetization_on_outlined),
+                  label: Text('Rembourser ${balance.userName}'),
+                  style: OutlinedButton.styleFrom(
+                    foregroundColor: Colors.green,
+                    side: const BorderSide(color: Colors.green),
+                  ),
+                ),
+              ),
+            ],
           ],
         ),
       ),
     );
   }
+
+  void _showReimbursementDialog(
+    BuildContext context,
+    UserBalance payeeBalance,
+  ) {
+    final userState = context.read<UserBloc>().state;
+
+    if (userState is! user_state.UserLoaded) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(content: Text('Erreur: utilisateur non connecté')),
+      );
+      return;
+    }
+
+    final currentUser = userState.user;
+
+    // Prevent reimbursing yourself
+    if (payeeBalance.userId == currentUser.id) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(
+          content: Text('Vous ne pouvez pas vous rembourser vous-même'),
+        ),
+      );
+      return;
+    }
+
+    showDialog(
+      context: context,
+      builder: (context) => AddExpenseDialog(
+        group: group,
+        currentUser: currentUser,
+        initialCategory: ExpenseCategory.reimbursement,
+        initialDescription: 'Remboursement',
+        initialAmount: payeeBalance.absoluteBalance,
+        initialSplits: {
+          payeeBalance.userId: payeeBalance
+              .absoluteBalance, // The payee receives the full amount (as split)
+        },
+      ),
+    );
+  }
 }

lib/components/account/expense_detail_dialog.dart

@@ -42,185 +42,351 @@ class ExpenseDetailDialog extends StatelessWidget {
   @override
   Widget build(BuildContext context) {
     // Formatters for displaying dates and times.
-    final dateFormat = DateFormat('dd MMMM yyyy');
+    final dateFormat = DateFormat('dd MMMM yyyy', 'fr_FR');
-    final timeFormat = DateFormat('HH:mm');
+
+    final theme = Theme.of(context);
 
     return BlocBuilder<UserBloc, user_state.UserState>(
       builder: (context, userState) {
         // Determine the current user and their permissions.
-        final currentUser = userState is user_state.UserLoaded ? userState.user : null;
+        final currentUser = userState is user_state.UserLoaded
+            ? userState.user
+            : null;
         final canEdit = currentUser?.id == expense.paidById;
 
         return Dialog(
+          backgroundColor: Colors.transparent,
+          insetPadding: const EdgeInsets.all(16),
           child: Container(
             constraints: const BoxConstraints(maxWidth: 500, maxHeight: 700),
-            child: Scaffold(
+            decoration: BoxDecoration(
-              appBar: AppBar(
+              color: theme.colorScheme.surface,
-                title: const Text('Détails de la dépense'),
+              borderRadius: BorderRadius.circular(28),
-                automaticallyImplyLeading: false,
+              boxShadow: [
-                actions: [
+                BoxShadow(
-                  if (canEdit) ...[
+                  color: Colors.black.withValues(alpha: 0.2),
-                    // Edit button.
+                  blurRadius: 20,
-                    IconButton(
+                  offset: const Offset(0, 10),
-                      icon: const Icon(Icons.edit),
+                ),
-                      onPressed: () {
+              ],
-                        Navigator.of(context).pop();
+            ),
-                        _showEditDialog(context, currentUser!);
+            child: Column(
-                      },
+              children: [
-                    ),
+                // Header with actions
-                    // Delete button.
+                Padding(
-                    IconButton(
+                  padding: const EdgeInsets.fromLTRB(24, 20, 16, 0),
-                      icon: const Icon(Icons.delete, color: Colors.red),
+                  child: Row(
-                      onPressed: () => _confirmDelete(context),
+                    children: [
-                    ),
+                      Text(
-                  ],
+                        'Détails',
-                  // Close button.
+                        style: theme.textTheme.titleLarge?.copyWith(
-                  IconButton(
+                          fontWeight: FontWeight.bold,
-                    icon: const Icon(Icons.close),
+                        ),
-                    onPressed: () => Navigator.of(context).pop(),
+                      ),
-                  ),
+                      const Spacer(),
-                ],
+                      if (canEdit) ...[
-              ),
+                        IconButton(
-              body: ListView(
+                          icon: const Icon(Icons.edit_outlined),
-                padding: const EdgeInsets.all(16),
+                          tooltip: 'Modifier',
-                children: [
+                          onPressed: () {
-                  // Header with icon and description.
+                            Navigator.of(context).pop();
-                  Center(
+                            _showEditDialog(context, currentUser!);
-                    child: Column(
+                          },
-                      children: [
+                        ),
-                        Container(
+                        IconButton(
-                          width: 80,
+                          icon: const Icon(
-                          height: 80,
+                            Icons.delete_outline,
-                          decoration: BoxDecoration(
+                            color: Colors.red,
-                            color: Colors.blue.withValues(alpha: 0.1),
-                            shape: BoxShape.circle,
                           ),
-                          child: Icon(
+                          tooltip: 'Supprimer',
-                            expense.category.icon,
+                          onPressed: () => _confirmDelete(context),
-                            size: 40,
+                        ),
-                            color: Colors.blue,
+                      ],
+                      IconButton(
+                        icon: const Icon(Icons.close),
+                        onPressed: () => Navigator.of(context).pop(),
+                      ),
+                    ],
+                  ),
+                ),
+
+                Expanded(
+                  child: ListView(
+                    padding: const EdgeInsets.fromLTRB(24, 10, 24, 24),
+                    children: [
+                      // Icon and Category
+                      Center(
+                        child: Column(
+                          children: [
+                            Container(
+                              width: 80,
+                              height: 80,
+                              decoration: BoxDecoration(
+                                color: theme.colorScheme.primaryContainer
+                                    .withValues(alpha: 0.3),
+                                shape: BoxShape.circle,
+                              ),
+                              child: Icon(
+                                expense.category.icon,
+                                size: 36,
+                                color: theme.colorScheme.primary,
+                              ),
+                            ),
+                            const SizedBox(height: 16),
+                            Text(
+                              expense.description,
+                              style: theme.textTheme.headlineSmall?.copyWith(
+                                fontWeight: FontWeight.bold,
+                              ),
+                              textAlign: TextAlign.center,
+                            ),
+                            const SizedBox(height: 4),
+                            Container(
+                              padding: const EdgeInsets.symmetric(
+                                horizontal: 12,
+                                vertical: 6,
+                              ),
+                              decoration: BoxDecoration(
+                                color:
+                                    theme.colorScheme.surfaceContainerHighest,
+                                borderRadius: BorderRadius.circular(20),
+                              ),
+                              child: Text(
+                                expense.category.displayName,
+                                style: theme.textTheme.labelMedium?.copyWith(
+                                  color: theme.colorScheme.onSurfaceVariant,
+                                ),
+                              ),
+                            ),
+                          ],
+                        ),
+                      ),
+                      const SizedBox(height: 32),
+
+                      // Amount Display
+                      Container(
+                        padding: const EdgeInsets.all(24),
+                        decoration: BoxDecoration(
+                          color: theme.colorScheme.surfaceContainerHighest
+                              .withValues(alpha: 0.3),
+                          borderRadius: BorderRadius.circular(24),
+                          border: Border.all(
+                            color: theme.colorScheme.outline.withValues(
+                              alpha: 0.1,
+                            ),
                           ),
                         ),
-                        const SizedBox(height: 16),
+                        child: Column(
+                          children: [
+                            Text(
+                              'Montant total',
+                              style: theme.textTheme.labelLarge?.copyWith(
+                                color: theme.colorScheme.onSurfaceVariant,
+                              ),
+                            ),
+                            const SizedBox(height: 8),
+                            Text(
+                              '${expense.amount.toStringAsFixed(2)} ${expense.currency.symbol}',
+                              style: theme.textTheme.displaySmall?.copyWith(
+                                fontWeight: FontWeight.w800,
+                                color: theme.colorScheme.primary,
+                              ),
+                            ),
+                            if (expense.currency != ExpenseCurrency.eur)
+                              Padding(
+                                padding: const EdgeInsets.only(top: 4),
+                                child: Text(
+                                  '≈ ${expense.amountInEur.toStringAsFixed(2)} €',
+                                  style: theme.textTheme.bodyMedium?.copyWith(
+                                    color: theme.colorScheme.onSurfaceVariant,
+                                  ),
+                                ),
+                              ),
+                          ],
+                        ),
+                      ),
+                      const SizedBox(height: 24),
+
+                      // Info Grid
+                      Row(
+                        children: [
+                          Expanded(
+                            child: _buildInfoCard(
+                              context,
+                              Icons.person_outline,
+                              'Payé par',
+                              expense.paidByName,
+                            ),
+                          ),
+                          const SizedBox(width: 12),
+                          Expanded(
+                            child: _buildInfoCard(
+                              context,
+                              Icons.calendar_today_outlined,
+                              'Date',
+                              dateFormat.format(expense.date),
+                            ),
+                          ),
+                        ],
+                      ),
+                      const SizedBox(height: 24),
+
+                      // Splits Section
+                      Text(
+                        'Répartition',
+                        style: theme.textTheme.titleMedium?.copyWith(
+                          fontWeight: FontWeight.bold,
+                        ),
+                      ),
+                      const SizedBox(height: 12),
+                      Container(
+                        decoration: BoxDecoration(
+                          color: theme.colorScheme.surface,
+                          borderRadius: BorderRadius.circular(16),
+                          border: Border.all(
+                            color: theme.colorScheme.outline.withValues(
+                              alpha: 0.1,
+                            ),
+                          ),
+                        ),
+                        child: Column(
+                          children: expense.splits.asMap().entries.map((entry) {
+                            final index = entry.key;
+                            final split = entry.value;
+                            final isLast = index == expense.splits.length - 1;
+                            return Column(
+                              children: [
+                                _buildSplitTile(context, split),
+                                if (!isLast)
+                                  Divider(
+                                    height: 1,
+                                    indent: 16,
+                                    endIndent: 16,
+                                    color: theme.colorScheme.outline.withValues(
+                                      alpha: 0.1,
+                                    ),
+                                  ),
+                              ],
+                            );
+                          }).toList(),
+                        ),
+                      ),
+
+                      // Receipt Section
+                      if (expense.receiptUrl != null) ...[
+                        const SizedBox(height: 24),
                         Text(
-                          expense.description,
+                          'Reçu',
-                          style: const TextStyle(
+                          style: theme.textTheme.titleMedium?.copyWith(
-                            fontSize: 24,
                             fontWeight: FontWeight.bold,
                           ),
-                          textAlign: TextAlign.center,
                         ),
-                        const SizedBox(height: 8),
+                        const SizedBox(height: 12),
-                        Text(
+                        ClipRRect(
-                          expense.category.displayName,
+                          borderRadius: BorderRadius.circular(16),
-                          style: TextStyle(
+                          child: Stack(
-                            fontSize: 14,
+                            alignment: Alignment.center,
-                            color: Colors.grey[600],
+                            children: [
+                              Image.network(
+                                expense.receiptUrl!,
+                                width: double.infinity,
+                                height: 200,
+                                fit: BoxFit.cover,
+                                loadingBuilder:
+                                    (context, child, loadingProgress) {
+                                      if (loadingProgress == null) return child;
+                                      return Container(
+                                        height: 200,
+                                        color: theme
+                                            .colorScheme
+                                            .surfaceContainerHighest,
+                                        child: const Center(
+                                          child: CircularProgressIndicator(),
+                                        ),
+                                      );
+                                    },
+                                errorBuilder: (context, error, stackTrace) {
+                                  return Container(
+                                    height: 200,
+                                    color: theme
+                                        .colorScheme
+                                        .surfaceContainerHighest,
+                                    child: const Center(
+                                      child: Icon(Icons.broken_image_outlined),
+                                    ),
+                                  );
+                                },
+                              ),
+                              Positioned.fill(
+                                child: Material(
+                                  color: Colors.transparent,
+                                  child: InkWell(
+                                    onTap: () {
+                                      showDialog(
+                                        context: context,
+                                        builder: (context) => Dialog(
+                                          backgroundColor: Colors.transparent,
+                                          insetPadding: EdgeInsets.zero,
+                                          child: Stack(
+                                            alignment: Alignment.center,
+                                            children: [
+                                              InteractiveViewer(
+                                                minScale: 0.5,
+                                                maxScale: 4.0,
+                                                child: Image.network(
+                                                  expense.receiptUrl!,
+                                                  fit: BoxFit.contain,
+                                                ),
+                                              ),
+                                              Positioned(
+                                                top: 40,
+                                                right: 20,
+                                                child: IconButton(
+                                                  icon: const Icon(
+                                                    Icons.close,
+                                                    color: Colors.white,
+                                                    size: 30,
+                                                  ),
+                                                  onPressed: () => Navigator.of(
+                                                    context,
+                                                  ).pop(),
+                                                ),
+                                              ),
+                                            ],
+                                          ),
+                                        ),
+                                      );
+                                    },
+                                  ),
+                                ),
+                              ),
+                            ],
                           ),
                         ),
                       ],
-                    ),
-                  ),
-                  const SizedBox(height: 24),
 
-                  // Amount card.
+                      // Archive Button
-                  Card(
+                      if (!expense.isArchived && canEdit) ...[
-                    child: Padding(
+                        const SizedBox(height: 32),
-                      padding: const EdgeInsets.all(16),
+                        SizedBox(
-                      child: Column(
+                          width: double.infinity,
-                        children: [
+                          child: OutlinedButton.icon(
-                          Text(
+                            onPressed: () => _confirmArchive(context),
-                            '${expense.amount.toStringAsFixed(2)} ${expense.currency.symbol}',
+                            icon: const Icon(Icons.archive_outlined),
-                            style: const TextStyle(
+                            label: const Text('Archiver cette dépense'),
-                              fontSize: 32,
+                            style: OutlinedButton.styleFrom(
-                              fontWeight: FontWeight.bold,
+                              padding: const EdgeInsets.symmetric(vertical: 16),
-                              color: Colors.green,
+                              shape: RoundedRectangleBorder(
-                            ),
+                                borderRadius: BorderRadius.circular(12),
-                          ),
-                          if (expense.currency != ExpenseCurrency.eur)
-                            Text(
-                              '≈ ${expense.amountInEur.toStringAsFixed(2)} €',
-                              style: TextStyle(
-                                fontSize: 16,
-                                color: Colors.grey[600],
                               ),
                             ),
-                        ],
+                          ),
-                      ),
+                        ),
-                    ),
+                      ],
+                    ],
                   ),
-                  const SizedBox(height: 16),
+                ),
-
+              ],
-                  // Information rows.
-                  _buildInfoRow(Icons.person, 'Payé par', expense.paidByName),
-                  _buildInfoRow(Icons.calendar_today, 'Date', dateFormat.format(expense.date)),
-                  _buildInfoRow(Icons.access_time, 'Heure', timeFormat.format(expense.createdAt)),
-
-                  if (expense.isEdited && expense.editedAt != null)
-                    _buildInfoRow(
-                      Icons.edit,
-                      'Modifié le',
-                      dateFormat.format(expense.editedAt!),
-                    ),
-
-                  const SizedBox(height: 16),
-                  const Divider(),
-                  const SizedBox(height: 8),
-
-                  // Splits section.
-                  const Text(
-                    'Répartition',
-                    style: TextStyle(
-                      fontSize: 18,
-                      fontWeight: FontWeight.bold,
-                    ),
-                  ),
-                  const SizedBox(height: 12),
-                  ...expense.splits.map((split) => _buildSplitTile(context, split)),
-
-                  const SizedBox(height: 16),
-
-                  // Receipt section.
-                  if (expense.receiptUrl != null) ...[
-                    const Divider(),
-                    const SizedBox(height: 8),
-                    const Text(
-                      'Reçu',
-                      style: TextStyle(
-                        fontSize: 18,
-                        fontWeight: FontWeight.bold,
-                      ),
-                    ),
-                    const SizedBox(height: 12),
-                    ClipRRect(
-                      borderRadius: BorderRadius.circular(12),
-                      child: Image.network(
-                        expense.receiptUrl!,
-                        fit: BoxFit.cover,
-                        loadingBuilder: (context, child, loadingProgress) {
-                          if (loadingProgress == null) return child;
-                          return const Center(child: CircularProgressIndicator());
-                        },
-                        errorBuilder: (context, error, stackTrace) {
-                          return const Center(
-                            child: Text('Erreur de chargement de l\'image'),
-                          );
-                        },
-                      ),
-                    ),
-                  ],
-
-                  const SizedBox(height: 16),
-
-                  // Archive button.
-                  if (!expense.isArchived && canEdit)
-                    OutlinedButton.icon(
-                      onPressed: () => _confirmArchive(context),
-                      icon: const Icon(Icons.archive),
-                      label: const Text('Archiver cette dépense'),
-                    ),
-                ],
-              ),
             ),
           ),
         );
@@ -228,83 +394,135 @@ class ExpenseDetailDialog extends StatelessWidget {
     );
   }
 
-  /// Builds a row displaying an icon, a label, and a value.
+  Widget _buildInfoCard(
-  Widget _buildInfoRow(IconData icon, String label, String value) {
+    BuildContext context,
-    return Padding(
+    IconData icon,
-      padding: const EdgeInsets.symmetric(vertical: 8),
+    String label,
-      child: Row(
+    String value,
+  ) {
+    final theme = Theme.of(context);
+    return Container(
+      padding: const EdgeInsets.all(16),
+      decoration: BoxDecoration(
+        color: theme.colorScheme.surface,
+        borderRadius: BorderRadius.circular(16),
+        border: Border.all(
+          color: theme.colorScheme.outline.withValues(alpha: 0.1),
+        ),
+      ),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
         children: [
-          Icon(icon, size: 20, color: Colors.grey[600]),
+          Row(
-          const SizedBox(width: 12),
+            children: [
-          Text(
+              Icon(icon, size: 16, color: theme.colorScheme.onSurfaceVariant),
-            label,
+              const SizedBox(width: 8),
-            style: TextStyle(
+              Text(
-              fontSize: 14,
+                label,
-              color: Colors.grey[600],
+                style: theme.textTheme.labelMedium?.copyWith(
-            ),
+                  color: theme.colorScheme.onSurfaceVariant,
+                ),
+              ),
+            ],
           ),
-          const Spacer(),
+          const SizedBox(height: 8),
           Text(
             value,
-            style: const TextStyle(
+            style: theme.textTheme.bodyLarge?.copyWith(
-              fontSize: 14,
+              fontWeight: FontWeight.w600,
-              fontWeight: FontWeight.w500,
             ),
+            maxLines: 1,
+            overflow: TextOverflow.ellipsis,
           ),
         ],
       ),
     );
   }
 
-  /// Builds a tile displaying details about a split in the expense.
-  ///
-  /// The tile shows the user's name, the split amount, and whether the split is paid. If the current user
-  /// is responsible for the split and it is unpaid, a button is provided to mark it as paid.
   Widget _buildSplitTile(BuildContext context, ExpenseSplit split) {
     return BlocBuilder<UserBloc, user_state.UserState>(
       builder: (context, userState) {
-        final currentUser = userState is user_state.UserLoaded ? userState.user : null;
+        final currentUser = userState is user_state.UserLoaded
+            ? userState.user
+            : null;
         final isCurrentUser = currentUser?.id == split.userId;
+        final theme = Theme.of(context);
 
-        return ListTile(
+        return Padding(
-          leading: CircleAvatar(
+          padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
-            backgroundColor: split.isPaid ? Colors.green : Colors.orange,
+          child: Row(
-            child: Icon(
-              split.isPaid ? Icons.check : Icons.pending,
-              color: Colors.white,
-              size: 20,
-            ),
-          ),
-          title: Text(
-            split.userName,
-            style: TextStyle(
-              fontWeight: isCurrentUser ? FontWeight.bold : FontWeight.normal,
-            ),
-          ),
-          subtitle: Text(split.isPaid ? 'Payé' : 'En attente'),
-          trailing: Row(
-            mainAxisSize: MainAxisSize.min,
             children: [
-              Text(
+              Container(
-                '${split.amount.toStringAsFixed(2)} €',
+                width: 40,
-                style: const TextStyle(
+                height: 40,
-                  fontSize: 16,
+                decoration: BoxDecoration(
-                  fontWeight: FontWeight.bold,
+                  color: split.isPaid
+                      ? Colors.green.withValues(alpha: 0.1)
+                      : Colors.orange.withValues(alpha: 0.1),
+                  shape: BoxShape.circle,
+                ),
+                child: Icon(
+                  split.isPaid ? Icons.check : Icons.access_time_rounded,
+                  color: split.isPaid ? Colors.green : Colors.orange,
+                  size: 20,
                 ),
               ),
-              if (!split.isPaid && isCurrentUser) ...[
+              const SizedBox(width: 12),
-                const SizedBox(width: 8),
+              Expanded(
-                IconButton(
+                child: Column(
-                  icon: const Icon(Icons.check_circle, color: Colors.green),
+                  crossAxisAlignment: CrossAxisAlignment.start,
-                  onPressed: () {
+                  children: [
-                    context.read<ExpenseBloc>().add(MarkSplitAsPaid(
+                    Text(
-                      expenseId: expense.id,
+                      isCurrentUser ? 'Moi' : split.userName,
-                      userId: split.userId,
+                      style: theme.textTheme.bodyLarge?.copyWith(
-                    ));
+                        fontWeight: isCurrentUser
-                    Navigator.of(context).pop();
+                            ? FontWeight.bold
-                  },
+                            : FontWeight.w500,
+                      ),
+                    ),
+                    Text(
+                      split.isPaid ? 'Payé' : 'En attente',
+                      style: theme.textTheme.bodySmall?.copyWith(
+                        color: split.isPaid ? Colors.green : Colors.orange,
+                        fontWeight: FontWeight.w500,
+                      ),
+                    ),
+                  ],
                 ),
-              ],
+              ),
+              Column(
+                crossAxisAlignment: CrossAxisAlignment.end,
+                children: [
+                  Text(
+                    '${split.amount.toStringAsFixed(2)} €',
+                    style: theme.textTheme.bodyLarge?.copyWith(
+                      fontWeight: FontWeight.bold,
+                    ),
+                  ),
+                  if (!split.isPaid && isCurrentUser)
+                    GestureDetector(
+                      onTap: () {
+                        context.read<ExpenseBloc>().add(
+                          MarkSplitAsPaid(
+                            expenseId: expense.id,
+                            userId: split.userId,
+                          ),
+                        );
+                        Navigator.of(context).pop();
+                      },
+                      child: Padding(
+                        padding: const EdgeInsets.only(top: 4),
+                        child: Text(
+                          'Marquer payé',
+                          style: theme.textTheme.labelSmall?.copyWith(
+                            color: theme.colorScheme.primary,
+                            fontWeight: FontWeight.bold,
+                          ),
+                        ),
+                      ),
+                    ),
+                ],
+              ),
             ],
           ),
         );
@@ -312,7 +530,6 @@ class ExpenseDetailDialog extends StatelessWidget {
     );
   }
 
-  /// Shows a dialog for editing the expense.
   void _showEditDialog(BuildContext context, user_state.UserModel currentUser) {
     showDialog(
       context: context,
@@ -327,13 +544,14 @@ class ExpenseDetailDialog extends StatelessWidget {
     );
   }
 
-  /// Shows a confirmation dialog for deleting the expense.
   void _confirmDelete(BuildContext context) {
     showDialog(
       context: context,
       builder: (dialogContext) => AlertDialog(
         title: const Text('Supprimer la dépense'),
-        content: const Text('Êtes-vous sûr de vouloir supprimer cette dépense ?'),
+        content: const Text(
+          'Êtes-vous sûr de vouloir supprimer cette dépense ?',
+        ),
         actions: [
           TextButton(
             onPressed: () => Navigator.of(dialogContext).pop(),
@@ -341,9 +559,7 @@ class ExpenseDetailDialog extends StatelessWidget {
           ),
           TextButton(
             onPressed: () {
-              context.read<ExpenseBloc>().add(DeleteExpense(
+              context.read<ExpenseBloc>().add(DeleteExpense(expense.id));
-                expense.id,
-              ));
               Navigator.of(dialogContext).pop();
               Navigator.of(context).pop();
             },
@@ -355,13 +571,14 @@ class ExpenseDetailDialog extends StatelessWidget {
     );
   }
 
-  /// Shows a confirmation dialog for archiving the expense.
   void _confirmArchive(BuildContext context) {
     showDialog(
       context: context,
       builder: (dialogContext) => AlertDialog(
         title: const Text('Archiver la dépense'),
-        content: const Text('Cette dépense sera archivée et n\'apparaîtra plus dans les calculs de balance.'),
+        content: const Text(
+          'Cette dépense sera archivée et n\'apparaîtra plus dans les calculs de balance.',
+        ),
         actions: [
           TextButton(
             onPressed: () => Navigator.of(dialogContext).pop(),
@@ -369,9 +586,7 @@ class ExpenseDetailDialog extends StatelessWidget {
           ),
           TextButton(
             onPressed: () {
-              context.read<ExpenseBloc>().add(ArchiveExpense(
+              context.read<ExpenseBloc>().add(ArchiveExpense(expense.id));
-                expense.id,
-              ));
               Navigator.of(dialogContext).pop();
               Navigator.of(context).pop();
             },

lib/components/account/expenses_tab.dart

@@ -7,11 +7,13 @@ import 'expense_detail_dialog.dart';
 class ExpensesTab extends StatelessWidget {
   final List<Expense> expenses;
   final Group group;
+  final String currentUserId;
 
   const ExpensesTab({
     super.key,
     required this.expenses,
     required this.group,
+    required this.currentUserId,
   });
 
   @override
@@ -48,95 +50,159 @@ class ExpensesTab extends StatelessWidget {
   }
 
   Widget _buildExpenseCard(BuildContext context, Expense expense) {
-    final isDark = Theme.of(context).brightness == Brightness.dark;
+    final theme = Theme.of(context);
-    final dateFormat = DateFormat('dd/MM/yyyy');
+    final isDark = theme.brightness == Brightness.dark;
+    final dateFormat = DateFormat('dd/MM');
 
-    return Card(
+    // Logique pour déterminer l'impact sur l'utilisateur
+    bool isPayer = expense.paidById == currentUserId;
+    double amountToDisplay = expense.amount;
+    bool isPositive = isPayer;
+
+    // Si je suis le payeur, je suis en positif (on me doit de l'argent)
+    // Si je ne suis pas le payeur, je suis en négatif (je dois de l'argent)
+    // Note: Pour être précis, il faudrait calculer ma part exacte, mais pour l'instant
+    // on affiche le total avec la couleur indiquant si j'ai payé ou non.
+
+    final amountColor = isPositive ? Colors.green : Colors.red;
+    final prefix = isPositive ? '+' : '-';
+
+    return Container(
       margin: const EdgeInsets.only(bottom: 12),
-      child: InkWell(
+      decoration: BoxDecoration(
-        onTap: () => _showExpenseDetail(context, expense),
+        color: isDark ? theme.cardColor : Colors.white,
-        borderRadius: BorderRadius.circular(12),
+        borderRadius: BorderRadius.circular(16),
-        child: Padding(
+        boxShadow: [
-          padding: const EdgeInsets.all(16),
+          BoxShadow(
-          child: Row(
+            color: Colors.black.withValues(alpha: 0.05),
-            children: [
+            blurRadius: 8,
-              Container(
+            offset: const Offset(0, 2),
-                width: 48,
+          ),
-                height: 48,
+        ],
-                decoration: BoxDecoration(
+      ),
-                  color: isDark ? Colors.blue[900] : Colors.blue[100],
+      child: Material(
-                  borderRadius: BorderRadius.circular(12),
+        color: Colors.transparent,
+        child: InkWell(
+          onTap: () => _showExpenseDetail(context, expense),
+          borderRadius: BorderRadius.circular(16),
+          child: Padding(
+            padding: const EdgeInsets.all(16),
+            child: Row(
+              children: [
+                // Icone circulaire
+                Container(
+                  width: 48,
+                  height: 48,
+                  decoration: BoxDecoration(
+                    color: _getCategoryColor(
+                      expense.category,
+                    ).withValues(alpha: 0.2),
+                    shape: BoxShape.circle,
+                  ),
+                  child: Icon(
+                    expense.category.icon,
+                    color: _getCategoryColor(expense.category),
+                    size: 24,
+                  ),
                 ),
-                child: Icon(
+                const SizedBox(width: 16),
-                  expense.category.icon,
+
-                  color: Colors.blue,
+                // Détails
+                Expanded(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      Text(
+                        expense.description,
+                        style: const TextStyle(
+                          fontSize: 16,
+                          fontWeight: FontWeight.w600,
+                        ),
+                        maxLines: 1,
+                        overflow: TextOverflow.ellipsis,
+                      ),
+                      const SizedBox(height: 4),
+                      Row(
+                        children: [
+                          Text(
+                            isPayer
+                                ? 'Payé par vous'
+                                : 'Payé par ${expense.paidByName}',
+                            style: TextStyle(
+                              fontSize: 13,
+                              color: isDark
+                                  ? Colors.grey[400]
+                                  : Colors.grey[600],
+                            ),
+                          ),
+                          Text(
+                            ' • ${dateFormat.format(expense.date)}',
+                            style: TextStyle(
+                              fontSize: 13,
+                              color: isDark
+                                  ? Colors.grey[500]
+                                  : Colors.grey[500],
+                            ),
+                          ),
+                        ],
+                      ),
+                    ],
+                  ),
                 ),
-              ),
+
-              const SizedBox(width: 16),
+                // Montant
-              Expanded(
+                Column(
-                child: Column(
+                  crossAxisAlignment: CrossAxisAlignment.end,
-                  crossAxisAlignment: CrossAxisAlignment.start,
                   children: [
                     Text(
-                      expense.description,
+                      '$prefix${amountToDisplay.toStringAsFixed(2)} ${expense.currency.symbol}',
-                      style: const TextStyle(
+                      style: TextStyle(
                         fontSize: 16,
                         fontWeight: FontWeight.bold,
+                        color: amountColor,
                       ),
                     ),
-                    const SizedBox(height: 4),
+                    if (expense.currency != ExpenseCurrency.eur)
-                    Text(
+                      Text(
-                      'Payé par ${expense.paidByName}',
+                        'Total ${expense.amountInEur.toStringAsFixed(2)} €',
-                      style: TextStyle(
+                        style: TextStyle(
-                        fontSize: 14,
+                          fontSize: 11,
-                        color: isDark ? Colors.grey[400] : Colors.grey[600],
+                          color: isDark ? Colors.grey[500] : Colors.grey[400],
+                        ),
                       ),
-                    ),
-                    Text(
-                      dateFormat.format(expense.date),
-                      style: TextStyle(
-                        fontSize: 12,
-                        color: isDark ? Colors.grey[500] : Colors.grey[500],
-                      ),
-                    ),
                   ],
                 ),
-              ),
+              ],
-              Column(
+            ),
-                crossAxisAlignment: CrossAxisAlignment.end,
-                children: [
-                  Text(
-                    '${expense.amount.toStringAsFixed(2)} ${expense.currency.symbol}',
-                    style: const TextStyle(
-                      fontSize: 16,
-                      fontWeight: FontWeight.bold,
-                      color: Colors.green,
-                    ),
-                  ),
-                  if (expense.currency != ExpenseCurrency.eur)
-                    Text(
-                      '${expense.amountInEur.toStringAsFixed(2)} €',
-                      style: TextStyle(
-                        fontSize: 12,
-                        color: isDark ? Colors.grey[400] : Colors.grey[600],
-                      ),
-                    ),
-                ],
-              ),
-            ],
           ),
         ),
       ),
     );
   }
 
+  Color _getCategoryColor(ExpenseCategory category) {
+    switch (category) {
+      case ExpenseCategory.restaurant:
+        return Colors.orange;
+      case ExpenseCategory.transport:
+        return Colors.blue;
+      case ExpenseCategory.accommodation:
+        return Colors.purple;
+      case ExpenseCategory.entertainment:
+        return Colors.pink;
+      case ExpenseCategory.shopping:
+        return Colors.teal;
+      case ExpenseCategory.other:
+        return Colors.grey;
+      case ExpenseCategory.reimbursement:
+        return Colors.green;
+    }
+  }
+
   void _showExpenseDetail(BuildContext context, Expense expense) {
     showDialog(
       context: context,
-      builder: (context) => ExpenseDetailDialog(
+      builder: (context) => ExpenseDetailDialog(expense: expense, group: group),
-        expense: expense,
-        group: group,
-      ),
     );
   }
 }

lib/components/account/group_expenses_page.dart

@@ -13,7 +13,9 @@ import '../../models/group.dart';
 import 'add_expense_dialog.dart';
 import 'balances_tab.dart';
 import 'expenses_tab.dart';
-import 'settlements_tab.dart';
+import '../../models/user_balance.dart';
+import '../../models/expense.dart';
+import '../../services/error_service.dart';
 
 class GroupExpensesPage extends StatefulWidget {
   final Account account;
@@ -31,13 +33,14 @@ class GroupExpensesPage extends StatefulWidget {
 
 class _GroupExpensesPageState extends State<GroupExpensesPage>
     with SingleTickerProviderStateMixin {
-  
   late TabController _tabController;
+  ExpenseCategory? _selectedCategory;
+  String? _selectedPayerId;
 
   @override
   void initState() {
     super.initState();
-    _tabController = TabController(length: 3, vsync: this);
+    _tabController = TabController(length: 2, vsync: this);
     _loadData();
   }
 
@@ -57,111 +60,254 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
 
   @override
   Widget build(BuildContext context) {
+    final theme = Theme.of(context);
+    final isDarkMode = theme.brightness == Brightness.dark;
+
     return Scaffold(
+      backgroundColor: isDarkMode
+          ? theme.scaffoldBackgroundColor
+          : Colors.grey[50],
       appBar: AppBar(
-        title: Text(widget.account.name),
+        title: const Text(
-        backgroundColor: Theme.of(context).primaryColor,
+          'Dépenses du voyage',
-        foregroundColor: Colors.white,
+          style: TextStyle(fontWeight: FontWeight.bold),
-        elevation: 0,
-        bottom: TabBar(
-          controller: _tabController,
-          indicatorColor: Colors.white,
-          labelColor: Colors.white,
-          unselectedLabelColor: Colors.white70,
-          tabs: const [
-            Tab(
-              icon: Icon(Icons.balance),
-              text: 'Balances',
-            ),
-            Tab(
-              icon: Icon(Icons.receipt_long),
-              text: 'Dépenses',
-            ),
-            Tab(
-              icon: Icon(Icons.payment),
-              text: 'Règlements',
-            ),
-          ],
         ),
+        centerTitle: true,
+        backgroundColor: Colors.transparent,
+        elevation: 0,
+        foregroundColor: theme.colorScheme.onSurface,
+        leading: IconButton(
+          icon: const Icon(Icons.arrow_back),
+          onPressed: () => Navigator.pop(context),
+        ),
+        actions: [],
       ),
       body: MultiBlocListener(
         listeners: [
           BlocListener<ExpenseBloc, ExpenseState>(
             listener: (context, state) {
               if (state is ExpenseOperationSuccess) {
-                ScaffoldMessenger.of(context).showSnackBar(
+                ErrorService().showSnackbar(
-                  SnackBar(
+                  message: state.message,
-                    content: Text(state.message),
+                  isError: false,
-                    backgroundColor: Colors.green,
-                  ),
                 );
                 _loadData(); // Recharger les données après une opération
               } else if (state is ExpenseError) {
-                ScaffoldMessenger.of(context).showSnackBar(
+                ErrorService().showError(message: state.message);
-                  SnackBar(
+              } else if (state is ExpensesLoaded) {
-                    content: Text(state.message),
+                // Rafraîchir les balances quand les dépenses changent (ex: via stream)
-                    backgroundColor: Colors.red,
+                context.read<BalanceBloc>().add(
-                  ),
+                  RefreshBalance(widget.group.id),
                 );
               }
             },
           ),
         ],
-        child: TabBarView(
+        child: Column(
-          controller: _tabController,
           children: [
-            // Onglet Balances
+            // Summary Card
             BlocBuilder<BalanceBloc, BalanceState>(
               builder: (context, state) {
-                if (state is BalanceLoading) {
+                if (state is GroupBalancesLoaded) {
-                  return const Center(child: CircularProgressIndicator());
+                  return _buildSummaryCard(state.balances, isDarkMode);
-                } else if (state is GroupBalancesLoaded) {
-                  return BalancesTab(balances: state.balances);
-                } else if (state is BalanceError) {
-                  return _buildErrorState('Erreur lors du chargement des balances: ${state.message}');
                 }
-                return _buildEmptyState('Aucune balance disponible');
+                return const SizedBox.shrink();
               },
             ),
 
-            // Onglet Dépenses
+            // Tabs
-            BlocBuilder<ExpenseBloc, ExpenseState>(
+            Container(
-              builder: (context, state) {
+              decoration: BoxDecoration(
-                if (state is ExpenseLoading) {
+                border: Border(
-                  return const Center(child: CircularProgressIndicator());
+                  bottom: BorderSide(color: theme.dividerColor, width: 1),
-                } else if (state is ExpensesLoaded) {
+                ),
-                  return ExpensesTab(
+              ),
-                    expenses: state.expenses,
+              child: TabBar(
-                    group: widget.group,
+                controller: _tabController,
-                  );
+                labelColor: theme.colorScheme.primary,
-                } else if (state is ExpenseError) {
+                unselectedLabelColor: theme.colorScheme.onSurface.withValues(
-                  return _buildErrorState('Erreur lors du chargement des dépenses: ${state.message}');
+                  alpha: 0.6,
-                }
+                ),
-                return _buildEmptyState('Aucune dépense trouvée');
+                indicatorColor: theme.colorScheme.primary,
-              },
+                indicatorWeight: 3,
+                labelStyle: const TextStyle(fontWeight: FontWeight.bold),
+                tabs: const [
+                  Tab(text: 'Toutes les dépenses'),
+                  Tab(text: 'Mes soldes'),
+                ],
+              ),
             ),
 
-            // Onglet Règlements
+            // Tab View
-            BlocBuilder<BalanceBloc, BalanceState>(
+            Expanded(
-              builder: (context, state) {
+              child: TabBarView(
-                if (state is BalanceLoading) {
+                controller: _tabController,
-                  return const Center(child: CircularProgressIndicator());
+                children: [
-                } else if (state is GroupBalancesLoaded) {
+                  // Onglet Dépenses
-                  return SettlementsTab(settlements: state.settlements);
+                  BlocBuilder<ExpenseBloc, ExpenseState>(
-                } else if (state is BalanceError) {
+                    builder: (context, state) {
-                  return _buildErrorState('Erreur lors du chargement des règlements: ${state.message}');
+                      if (state is ExpenseLoading) {
-                }
+                        return const Center(child: CircularProgressIndicator());
-                return _buildEmptyState('Aucun règlement nécessaire');
+                      } else if (state is ExpensesLoaded) {
-              },
+                        final userState = context.read<UserBloc>().state;
+                        final currentUserId = userState is user_state.UserLoaded
+                            ? userState.user.id
+                            : '';
+
+                        var filteredExpenses = state.expenses;
+
+                        if (_selectedCategory != null) {
+                          filteredExpenses = filteredExpenses
+                              .where((e) => e.category == _selectedCategory)
+                              .toList();
+                        }
+
+                        if (_selectedPayerId != null) {
+                          filteredExpenses = filteredExpenses
+                              .where((e) => e.paidById == _selectedPayerId)
+                              .toList();
+                        }
+
+                        return ExpensesTab(
+                          expenses: filteredExpenses,
+                          group: widget.group,
+                          currentUserId: currentUserId,
+                        );
+                      } else if (state is ExpenseError) {
+                        return _buildErrorState('Erreur: ${state.message}');
+                      }
+                      return _buildEmptyState('Aucune dépense trouvée');
+                    },
+                  ),
+
+                  // Onglet Balances (Combiné)
+                  BlocBuilder<BalanceBloc, BalanceState>(
+                    builder: (context, state) {
+                      if (state is BalanceLoading) {
+                        return const Center(child: CircularProgressIndicator());
+                      } else if (state is GroupBalancesLoaded) {
+                        return BalancesTab(
+                          balances: state.balances,
+                          group: widget.group,
+                        );
+                      } else if (state is BalanceError) {
+                        return _buildErrorState('Erreur: ${state.message}');
+                      }
+                      return _buildEmptyState('Aucune balance disponible');
+                    },
+                  ),
+                ],
+              ),
             ),
           ],
         ),
       ),
       floatingActionButton: FloatingActionButton(
+        heroTag: 'group_expenses_fab',
         onPressed: _showAddExpenseDialog,
-        heroTag: "add_expense_fab",
+        backgroundColor: Colors.blue,
+        foregroundColor: Colors.white,
+        elevation: 4,
+        shape: const CircleBorder(),
         tooltip: 'Ajouter une dépense',
-        child: const Icon(Icons.add),
+        child: const Icon(Icons.add, size: 32),
+      ),
+    );
+  }
+
+  Widget _buildSummaryCard(List<UserBalance> balances, bool isDarkMode) {
+    // Trouver la balance de l'utilisateur courant
+    final userState = context.read<UserBloc>().state;
+    double myBalance = 0;
+
+    if (userState is user_state.UserLoaded) {
+      final myBalanceObj = balances.firstWhere(
+        (b) => b.userId == userState.user.id,
+        orElse: () => const UserBalance(
+          userId: '',
+          userName: '',
+          totalPaid: 0,
+          totalOwed: 0,
+          balance: 0,
+        ),
+      );
+      myBalance = myBalanceObj.balance;
+    }
+
+    final isPositive = myBalance >= 0;
+    final color = isPositive ? Colors.green : Colors.red;
+    final amountStr = '${myBalance.abs().toStringAsFixed(2)} €';
+
+    return Container(
+      margin: const EdgeInsets.all(16),
+      padding: const EdgeInsets.all(20),
+      decoration: BoxDecoration(
+        color: isDarkMode ? Colors.grey[800] : Colors.white,
+        borderRadius: BorderRadius.circular(16),
+        boxShadow: [
+          BoxShadow(
+            color: Colors.black.withValues(alpha: 0.05),
+            blurRadius: 10,
+            offset: const Offset(0, 4),
+          ),
+        ],
+      ),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text(
+            'Votre solde total',
+            style: TextStyle(
+              color: isDarkMode ? Colors.grey[400] : Colors.grey[600],
+              fontSize: 14,
+            ),
+          ),
+          const SizedBox(height: 8),
+          Row(
+            children: [
+              Text(
+                isPositive ? 'On vous doit ' : 'Vous devez ',
+                style: TextStyle(
+                  color: color,
+                  fontSize: 24,
+                  fontWeight: FontWeight.bold,
+                ),
+              ),
+              Text(
+                amountStr,
+                style: TextStyle(
+                  color: color,
+                  fontSize: 24,
+                  fontWeight: FontWeight.bold,
+                ),
+              ),
+            ],
+          ),
+          const SizedBox(height: 8),
+          Text(
+            isPositive
+                ? 'Vous êtes en positif sur ce voyage.'
+                : 'Vous êtes en négatif sur ce voyage.',
+            style: TextStyle(
+              color: isDarkMode ? Colors.grey[400] : Colors.grey[600],
+              fontSize: 14,
+            ),
+          ),
+          const SizedBox(height: 12),
+          InkWell(
+            onTap: () {
+              _tabController.animateTo(1); // Aller à l'onglet Balances
+            },
+            child: Text(
+              'Voir le détail des soldes',
+              style: TextStyle(
+                color: Colors.blue[400],
+                fontWeight: FontWeight.w500,
+                fontSize: 14,
+              ),
+            ),
+          ),
+        ],
       ),
     );
   }
@@ -171,11 +317,7 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
       child: Column(
         mainAxisAlignment: MainAxisAlignment.center,
         children: [
-          Icon(
+          Icon(Icons.error_outline, size: 80, color: Colors.red[300]),
-            Icons.error_outline,
-            size: 80,
-            color: Colors.red[300],
-          ),
           const SizedBox(height: 16),
           Text(
             'Erreur',
@@ -190,10 +332,7 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
             padding: const EdgeInsets.symmetric(horizontal: 32),
             child: Text(
               message,
-              style: TextStyle(
+              style: TextStyle(fontSize: 16, color: Colors.grey[600]),
-                fontSize: 16,
-                color: Colors.grey[600],
-              ),
               textAlign: TextAlign.center,
             ),
           ),
@@ -213,11 +352,7 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
       child: Column(
         mainAxisAlignment: MainAxisAlignment.center,
         children: [
-          Icon(
+          Icon(Icons.info_outline, size: 80, color: Colors.grey[400]),
-            Icons.info_outline,
-            size: 80,
-            color: Colors.grey[400],
-          ),
           const SizedBox(height: 16),
           Text(
             'Aucune donnée',
@@ -230,10 +365,7 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
           const SizedBox(height: 8),
           Text(
             message,
-            style: TextStyle(
+            style: TextStyle(fontSize: 16, color: Colors.grey[500]),
-              fontSize: 16,
-              color: Colors.grey[500],
-            ),
             textAlign: TextAlign.center,
           ),
         ],
@@ -247,18 +379,11 @@ class _GroupExpensesPageState extends State<GroupExpensesPage>
     if (userState is user_state.UserLoaded) {
       showDialog(
         context: context,
-        builder: (context) => AddExpenseDialog(
+        builder: (context) =>
-          group: widget.group,
+            AddExpenseDialog(group: widget.group, currentUser: userState.user),
-          currentUser: userState.user,
-        ),
       );
     } else {
-      ScaffoldMessenger.of(context).showSnackBar(
+      ErrorService().showError(message: 'Erreur: utilisateur non connecté');
-        const SnackBar(
-          content: Text('Erreur: utilisateur non connecté'),
-          backgroundColor: Colors.red,
-        ),
-      );
     }
   }
 }

lib/components/activities/activity_detail_dialog.dart

@@ -0,0 +1,322 @@
+import 'package:flutter/material.dart';
+import 'package:intl/intl.dart';
+import 'package:url_launcher/url_launcher.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import '../../services/map_navigation_service.dart';
+import '../../models/activity.dart';
+
+class ActivityDetailDialog extends StatelessWidget {
+  final Activity activity;
+
+  const ActivityDetailDialog({super.key, required this.activity});
+
+  @override
+  Widget build(BuildContext context) {
+    final theme = Theme.of(context);
+    // final isDarkMode = theme.brightness == Brightness.dark;
+
+    // Traduction de la catégorie
+    String categoryDisplay = activity.category;
+    final categoryEnum = ActivityCategory.values.firstWhere(
+      (e) => e.name == activity.category,
+      orElse: () => ActivityCategory.attraction, // Fallback
+    );
+    categoryDisplay = categoryEnum.displayName;
+
+    return Dialog(
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(16)),
+      backgroundColor: theme.scaffoldBackgroundColor,
+      child: SingleChildScrollView(
+        child: Column(
+          mainAxisSize: MainAxisSize.min,
+          crossAxisAlignment: CrossAxisAlignment.stretch,
+          children: [
+            // Image header
+            if (activity.imageUrl != null && activity.imageUrl!.isNotEmpty)
+              ClipRRect(
+                borderRadius: const BorderRadius.vertical(
+                  top: Radius.circular(16),
+                ),
+                child: Image.network(
+                  activity.imageUrl!,
+                  height: 200,
+                  fit: BoxFit.cover,
+                  errorBuilder: (context, error, stackTrace) => Container(
+                    height: 100,
+                    color: Colors.grey[300],
+                    child: const Icon(Icons.image_not_supported, size: 50),
+                  ),
+                ),
+              ),
+
+            Padding(
+              padding: const EdgeInsets.all(20),
+              child: Column(
+                crossAxisAlignment: CrossAxisAlignment.start,
+                children: [
+                  // Titre et Catégorie
+                  Row(
+                    mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                    children: [
+                      Expanded(
+                        child: Text(
+                          activity.name,
+                          style: theme.textTheme.headlineSmall?.copyWith(
+                            fontWeight: FontWeight.bold,
+                          ),
+                        ),
+                      ),
+                      Container(
+                        padding: const EdgeInsets.symmetric(
+                          horizontal: 10,
+                          vertical: 5,
+                        ),
+                        decoration: BoxDecoration(
+                          color: theme.colorScheme.primary.withValues(
+                            alpha: 0.1,
+                          ),
+                          borderRadius: BorderRadius.circular(20),
+                        ),
+                        child: Text(
+                          categoryDisplay,
+                          style: TextStyle(
+                            color: theme.colorScheme.primary,
+                            fontWeight: FontWeight.bold,
+                            fontSize: 12,
+                          ),
+                        ),
+                      ),
+                    ],
+                  ),
+                  const SizedBox(height: 16),
+
+                  // Date
+                  if (activity.date != null) ...[
+                    Row(
+                      children: [
+                        Icon(
+                          Icons.calendar_today,
+                          size: 20,
+                          color: Colors.grey[600],
+                        ),
+                        const SizedBox(width: 8),
+                        Text(
+                          DateFormat(
+                            'EEEE d MMMM yyyy',
+                            'fr_FR',
+                          ).format(activity.date!),
+                          style: theme.textTheme.bodyMedium,
+                        ),
+                      ],
+                    ),
+                    const SizedBox(height: 16),
+                  ],
+
+                  // Heures d'ouverture
+                  if (activity.openingHours.isNotEmpty) ...[
+                    Row(
+                      crossAxisAlignment: CrossAxisAlignment.start,
+                      children: [
+                        Icon(
+                          Icons.access_time,
+                          size: 20,
+                          color: Colors.grey[600],
+                        ),
+                        const SizedBox(width: 8),
+                        Expanded(
+                          child: Column(
+                            crossAxisAlignment: CrossAxisAlignment.start,
+                            children: activity.openingHours
+                                .map(
+                                  (hour) => Padding(
+                                    padding: const EdgeInsets.only(bottom: 4),
+                                    child: Text(
+                                      hour,
+                                      style: theme.textTheme.bodyMedium,
+                                    ),
+                                  ),
+                                )
+                                .toList(),
+                          ),
+                        ),
+                      ],
+                    ),
+                    const SizedBox(height: 16),
+                  ],
+
+                  // Adresse
+                  if (activity.address != null) ...[
+                    Row(
+                      children: [
+                        Icon(
+                          Icons.location_on,
+                          size: 20,
+                          color: Colors.grey[600],
+                        ),
+                        const SizedBox(width: 8),
+                        Expanded(
+                          child: Text(
+                            activity.address!,
+                            style: theme.textTheme.bodyMedium,
+                          ),
+                        ),
+                      ],
+                    ),
+                    const SizedBox(height: 16),
+                  ],
+
+                  // Description
+                  if (activity.description.isNotEmpty) ...[
+                    Text(
+                      'Description',
+                      style: theme.textTheme.titleMedium?.copyWith(
+                        fontWeight: FontWeight.bold,
+                      ),
+                    ),
+                    const SizedBox(height: 8),
+                    Text(
+                      activity.description,
+                      style: theme.textTheme.bodyMedium,
+                    ),
+                    const SizedBox(height: 16),
+                  ],
+
+                  // Votes
+                  if (activity.votes.isNotEmpty) ...[
+                    const Divider(),
+                    const SizedBox(height: 8),
+                    Row(
+                      mainAxisAlignment: MainAxisAlignment.spaceAround,
+                      children: [
+                        _buildVoteStat(
+                          Icons.thumb_up,
+                          Colors.green,
+                          activity.positiveVotes,
+                          'Pour',
+                        ),
+                        _buildVoteStat(
+                          Icons.thumb_down,
+                          Colors.red,
+                          activity.negativeVotes,
+                          'Contre',
+                        ),
+                      ],
+                    ),
+                  ],
+                ],
+              ),
+            ),
+
+            // Boutons
+            Padding(
+              padding: const EdgeInsets.all(16),
+              child: Column(
+                children: [
+                  if (activity.latitude != null && activity.longitude != null)
+                    Padding(
+                      padding: const EdgeInsets.only(bottom: 8),
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.stretch,
+                        children: [
+                          ElevatedButton.icon(
+                            onPressed: () {
+                              // Déclencher la navigation
+                              context
+                                  .read<MapNavigationService>()
+                                  .navigateToLocation(
+                                    activity.latitude!,
+                                    activity.longitude!,
+                                    name: activity.name,
+                                  );
+
+                              // Revenir à la page d'accueil (fermer le dialog et les pages empilées comme ActivitiesPage)
+                              Navigator.of(
+                                context,
+                              ).popUntil((route) => route.isFirst);
+                            },
+                            icon: const Icon(Icons.map_outlined),
+                            label: const Text('Voir sur la carte de l\'app'),
+                            style: ElevatedButton.styleFrom(
+                              padding: const EdgeInsets.symmetric(
+                                vertical: 12,
+                                horizontal: 24,
+                              ),
+                              backgroundColor:
+                                  theme.colorScheme.secondaryContainer,
+                              foregroundColor:
+                                  theme.colorScheme.onSecondaryContainer,
+                              shape: RoundedRectangleBorder(
+                                borderRadius: BorderRadius.circular(10),
+                              ),
+                            ),
+                          ),
+                          const SizedBox(height: 8),
+                          ElevatedButton.icon(
+                            onPressed: () async {
+                              final url = Uri.parse(
+                                'https://www.google.com/maps/search/?api=1&query=${activity.latitude},${activity.longitude}',
+                              );
+                              if (await canLaunchUrl(url)) {
+                                await launchUrl(
+                                  url,
+                                  mode: LaunchMode.externalApplication,
+                                );
+                              }
+                            },
+                            icon: const Icon(Icons.map),
+                            label: const Text('Voir sur Google Maps'),
+                            style: ElevatedButton.styleFrom(
+                              padding: const EdgeInsets.symmetric(
+                                vertical: 12,
+                                horizontal: 24,
+                              ),
+                              backgroundColor:
+                                  theme.colorScheme.primaryContainer,
+                              foregroundColor:
+                                  theme.colorScheme.onPrimaryContainer,
+                              shape: RoundedRectangleBorder(
+                                borderRadius: BorderRadius.circular(10),
+                              ),
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                  ElevatedButton(
+                    onPressed: () => Navigator.pop(context),
+                    style: ElevatedButton.styleFrom(
+                      padding: const EdgeInsets.symmetric(vertical: 12),
+                      shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(10),
+                      ),
+                      minimumSize: const Size(double.infinity, 45),
+                    ),
+                    child: const Text('Fermer'),
+                  ),
+                ],
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  Widget _buildVoteStat(IconData icon, Color color, int count, String label) {
+    return Column(
+      children: [
+        Icon(icon, color: color),
+        const SizedBox(height: 4),
+        Text(
+          '$count',
+          style: TextStyle(
+            fontSize: 18,
+            fontWeight: FontWeight.bold,
+            color: color,
+          ),
+        ),
+        Text(label, style: const TextStyle(fontSize: 12, color: Colors.grey)),
+      ],
+    );
+  }
+}

lib/components/activities/add_activity_bottom_sheet.dart

@@ -1,5 +1,6 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:firebase_auth/firebase_auth.dart';
 import 'dart:math' as math;
 import '../../blocs/activity/activity_bloc.dart';
 import '../../blocs/activity/activity_event.dart';
@@ -25,6 +26,7 @@ class _AddActivityBottomSheetState extends State<AddActivityBottomSheet> {
   final ErrorService _errorService = ErrorService();
 
   ActivityCategory _selectedCategory = ActivityCategory.attraction;
+  DateTime? _selectedDate;
   bool _isLoading = false;
 
   @override
@@ -57,7 +59,7 @@ class _AddActivityBottomSheetState extends State<AddActivityBottomSheet> {
             height: 4,
             margin: const EdgeInsets.symmetric(vertical: 12),
             decoration: BoxDecoration(
-              color: theme.colorScheme.onSurface.withOpacity(0.3),
+              color: theme.colorScheme.onSurface.withValues(alpha: 0.3),
               borderRadius: BorderRadius.circular(2),
             ),
           ),
@@ -149,6 +151,13 @@ class _AddActivityBottomSheetState extends State<AddActivityBottomSheet> {
                       icon: Icons.location_on,
                     ),
 
+                    const SizedBox(height: 20),
+
+                    // Date et heure (optionnel)
+                    _buildSectionTitle('Date et heure (optionnel)'),
+                    const SizedBox(height: 8),
+                    _buildDateTimePicker(),
+
                     const SizedBox(height: 40),
 
                     // Boutons d'action
@@ -368,6 +377,8 @@ class _AddActivityBottomSheetState extends State<AddActivityBottomSheet> {
         votes: {},
         createdAt: DateTime.now(),
         updatedAt: DateTime.now(),
+        date: _selectedDate,
+        createdBy: FirebaseAuth.instance.currentUser?.uid,
       );
 
       context.read<ActivityBloc>().add(AddActivity(activity));
@@ -412,4 +423,92 @@ class _AddActivityBottomSheetState extends State<AddActivityBottomSheet> {
         return Icons.spa;
     }
   }
+
+  Widget _buildDateTimePicker() {
+    final theme = Theme.of(context);
+    final isDarkMode = theme.brightness == Brightness.dark;
+
+    return InkWell(
+      onTap: _pickDateTime,
+      borderRadius: BorderRadius.circular(12),
+      child: Container(
+        padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 16),
+        decoration: BoxDecoration(
+          color: theme.colorScheme.surface,
+          borderRadius: BorderRadius.circular(12),
+          border: Border.all(
+            color: isDarkMode
+                ? Colors.white.withValues(alpha: 0.2)
+                : Colors.black.withValues(alpha: 0.2),
+          ),
+        ),
+        child: Row(
+          children: [
+            Icon(
+              Icons.calendar_today,
+              color: theme.colorScheme.onSurface.withValues(alpha: 0.6),
+            ),
+            const SizedBox(width: 12),
+            Text(
+              _selectedDate != null
+                  ? '${_selectedDate!.day}/${_selectedDate!.month}/${_selectedDate!.year} à ${_selectedDate!.hour}:${_selectedDate!.minute.toString().padLeft(2, '0')}'
+                  : 'Choisir une date et une heure',
+              style: theme.textTheme.bodyMedium?.copyWith(
+                color: _selectedDate != null
+                    ? theme.colorScheme.onSurface
+                    : theme.colorScheme.onSurface.withValues(alpha: 0.6),
+              ),
+            ),
+            const Spacer(),
+            if (_selectedDate != null)
+              IconButton(
+                icon: const Icon(Icons.clear, size: 20),
+                onPressed: () {
+                  setState(() {
+                    _selectedDate = null;
+                  });
+                },
+                padding: EdgeInsets.zero,
+                constraints: const BoxConstraints(),
+              ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  Future<void> _pickDateTime() async {
+    final now = DateTime.now();
+    final initialDate = widget.trip.startDate.isAfter(now)
+        ? widget.trip.startDate
+        : now;
+
+    final date = await showDatePicker(
+      context: context,
+      initialDate: _selectedDate ?? initialDate,
+      firstDate: now.subtract(const Duration(days: 365)),
+      lastDate: now.add(const Duration(days: 365 * 2)),
+    );
+
+    if (date == null) return;
+
+    if (!mounted) return;
+
+    final time = await showTimePicker(
+      context: context,
+      initialTime: TimeOfDay.fromDateTime(_selectedDate ?? now),
+    );
+
+    if (time == null) return;
+
+    setState(() {
+      _selectedDate = DateTime(
+        date.year,
+        date.month,
+        date.day,
+        time.hour,
+        time.minute,
+      );
+    });
+  }
 }

lib/components/error/error_content.dart

@@ -79,11 +79,7 @@ class ErrorContent extends StatelessWidget {
               color: defaultIconColor?.withValues(alpha: 0.1),
               shape: BoxShape.circle,
             ),
-            child: Icon(
+            child: Icon(icon, size: 48, color: defaultIconColor),
-              icon,
-              size: 48,
-              color: defaultIconColor,
-            ),
           ),
 
           const SizedBox(height: 24),
@@ -167,9 +163,7 @@ void showErrorDialog(
     barrierDismissible: barrierDismissible,
     builder: (BuildContext dialogContext) {
       return Dialog(
-        shape: RoundedRectangleBorder(
+        shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(16)),
-          borderRadius: BorderRadius.circular(16),
-        ),
         child: ErrorContent(
           title: title,
           message: message,
@@ -187,70 +181,3 @@ void showErrorDialog(
     },
   );
 }
-
-// Fonction helper pour afficher l'erreur en bottom sheet
-void showErrorBottomSheet(
-  BuildContext context, {
-  String title = 'Une erreur est survenue',
-  required String message,
-  VoidCallback? onRetry,
-  IconData icon = Icons.error_outline,
-  Color? iconColor,
-  bool isDismissible = true,
-}) {
-  showModalBottomSheet(
-    context: context,
-    isDismissible: isDismissible,
-    enableDrag: isDismissible,
-    shape: const RoundedRectangleBorder(
-      borderRadius: BorderRadius.vertical(top: Radius.circular(20)),
-    ),
-    builder: (BuildContext sheetContext) {
-      return SafeArea(
-        child: Padding(
-          padding: const EdgeInsets.all(16),
-          child: ErrorContent(
-            title: title,
-            message: message,
-            icon: icon,
-            iconColor: iconColor,
-            onRetry: onRetry != null
-                ? () {
-                    Navigator.of(sheetContext).pop();
-                    onRetry();
-                  }
-                : null,
-            onClose: () => Navigator.of(sheetContext).pop(),
-          ),
-        ),
-      );
-    },
-  );
-}
-
-// Fonction helper pour afficher en SnackBar (pour erreurs mineures)
-void showErrorSnackBar(
-  BuildContext context, {
-  required String message,
-  VoidCallback? onRetry,
-  Duration duration = const Duration(seconds: 4),
-}) {
-  ScaffoldMessenger.of(context).showSnackBar(
-    SnackBar(
-      content: Text(message),
-      backgroundColor: Colors.red[400],
-      duration: duration,
-      action: onRetry != null
-          ? SnackBarAction(
-              label: 'Réessayer',
-              textColor: Colors.white,
-              onPressed: onRetry,
-            )
-          : null,
-      behavior: SnackBarBehavior.floating,
-      shape: RoundedRectangleBorder(
-        borderRadius: BorderRadius.circular(10),
-      ),
-    ),
-  );
-}

lib/components/group/chat_group_content.dart

@@ -1,12 +1,16 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
+import 'dart:async';
 import '../../blocs/user/user_bloc.dart';
 import '../../blocs/user/user_state.dart' as user_state;
 import '../../blocs/message/message_bloc.dart';
 import '../../blocs/message/message_event.dart';
 import '../../blocs/message/message_state.dart';
 import '../../models/group.dart';
+import '../../models/group_member.dart';
 import '../../models/message.dart';
+import '../../repositories/group_repository.dart';
+import '../../services/error_service.dart';
 
 /// Chat group content widget for group messaging functionality.
 ///
@@ -28,10 +32,7 @@ class ChatGroupContent extends StatefulWidget {
   ///
   /// Args:
   ///   [group]: The group object containing group details and ID
-  const ChatGroupContent({
+  const ChatGroupContent({super.key, required this.group});
-    super.key,
-    required this.group,
-  });
 
   @override
   State<ChatGroupContent> createState() => _ChatGroupContentState();
@@ -47,17 +48,36 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
   /// Currently selected message for editing (null if not editing)
   Message? _editingMessage;
 
+  /// Repository pour gérer les groupes
+  final _groupRepository = GroupRepository();
+
+  /// Subscription pour écouter les changements des membres du groupe
+  late StreamSubscription<List<GroupMember>> _membersSubscription;
+
   @override
   void initState() {
     super.initState();
     // Load messages when the widget initializes
     context.read<MessageBloc>().add(LoadMessages(widget.group.id));
+
+    // Écouter les changements des membres du groupe
+    _membersSubscription = _groupRepository
+        .watchGroupMembers(widget.group.id)
+        .listen((updatedMembers) {
+          if (mounted) {
+            setState(() {
+              widget.group.members.clear();
+              widget.group.members.addAll(updatedMembers);
+            });
+          }
+        });
   }
 
   @override
   void dispose() {
     _messageController.dispose();
     _scrollController.dispose();
+    _membersSubscription.cancel();
     super.dispose();
   }
 
@@ -76,23 +96,23 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
     if (_editingMessage != null) {
       // Edit mode - update existing message
       context.read<MessageBloc>().add(
-            UpdateMessage(
+        UpdateMessage(
-              groupId: widget.group.id,
+          groupId: widget.group.id,
-              messageId: _editingMessage!.id,
+          messageId: _editingMessage!.id,
-              newText: messageText,
+          newText: messageText,
-            ),
+        ),
-          );
+      );
       _cancelEdit();
     } else {
       // Send mode - create new message
       context.read<MessageBloc>().add(
-            SendMessage(
+        SendMessage(
-              groupId: widget.group.id,
+          groupId: widget.group.id,
-              text: messageText,
+          text: messageText,
-              senderId: currentUser.id,
+          senderId: currentUser.id,
-              senderName: currentUser.prenom,
+          senderName: currentUser.prenom,
-            ),
+        ),
-          );
+      );
     }
 
     _messageController.clear();
@@ -132,32 +152,29 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
   ///   [messageId]: The ID of the message to delete
   void _deleteMessage(String messageId) {
     context.read<MessageBloc>().add(
-          DeleteMessage(
+      DeleteMessage(groupId: widget.group.id, messageId: messageId),
-            groupId: widget.group.id,
+    );
-            messageId: messageId,
-          ),
-        );
   }
 
   void _reactToMessage(String messageId, String userId, String reaction) {
     context.read<MessageBloc>().add(
-          ReactToMessage(
+      ReactToMessage(
-            groupId: widget.group.id,
+        groupId: widget.group.id,
-            messageId: messageId,
+        messageId: messageId,
-            userId: userId,
+        userId: userId,
-            reaction: reaction,
+        reaction: reaction,
-          ),
+      ),
-        );
+    );
   }
 
   void _removeReaction(String messageId, String userId) {
     context.read<MessageBloc>().add(
-          RemoveReaction(
+      RemoveReaction(
-            groupId: widget.group.id,
+        groupId: widget.group.id,
-            messageId: messageId,
+        messageId: messageId,
-            userId: userId,
+        userId: userId,
-          ),
+      ),
-        );
+    );
   }
 
   @override
@@ -183,7 +200,10 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
                 Text(widget.group.name, style: const TextStyle(fontSize: 18)),
                 Text(
                   '${widget.group.members.length} membre${widget.group.members.length > 1 ? 's' : ''}',
-                  style: const TextStyle(fontSize: 12, fontWeight: FontWeight.normal),
+                  style: const TextStyle(
+                    fontSize: 12,
+                    fontWeight: FontWeight.normal,
+                  ),
                 ),
               ],
             ),
@@ -201,12 +221,7 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
                 child: BlocConsumer<MessageBloc, MessageState>(
                   listener: (context, state) {
                     if (state is MessageError) {
-                      ScaffoldMessenger.of(context).showSnackBar(
+                      ErrorService().showError(message: state.message);
-                        SnackBar(
-                          content: Text(state.message),
-                          backgroundColor: Colors.red,
-                        ),
-                      );
                     }
                   },
                   builder: (context, state) {
@@ -235,7 +250,8 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
                         itemBuilder: (context, index) {
                           final message = state.messages[index];
                           final isMe = message.senderId == currentUser.id;
-                          final showDate = index == 0 ||
+                          final showDate =
+                              index == 0 ||
                               !_isSameDay(
                                 state.messages[index - 1].timestamp,
                                 message.timestamp,
@@ -243,8 +259,14 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
 
                           return Column(
                             children: [
-                              if (showDate) _buildDateSeparator(message.timestamp),
+                              if (showDate)
-                              _buildMessageBubble(message, isMe, isDark, currentUser.id),
+                                _buildDateSeparator(message.timestamp),
+                              _buildMessageBubble(
+                                message,
+                                isMe,
+                                isDark,
+                                currentUser.id,
+                              ),
                             ],
                           );
                         },
@@ -260,14 +282,15 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
               if (_editingMessage != null)
                 Container(
                   color: isDark ? Colors.blue[900] : Colors.blue[100],
-                  padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 8),
+                  padding: const EdgeInsets.symmetric(
+                    horizontal: 16,
+                    vertical: 8,
+                  ),
                   child: Row(
                     children: [
                       const Icon(Icons.edit, size: 20),
                       const SizedBox(width: 8),
-                      const Expanded(
+                      const Expanded(child: Text('Modification du message')),
-                        child: Text('Modification du message'),
-                      ),
                       IconButton(
                         icon: const Icon(Icons.close),
                         onPressed: _cancelEdit,
@@ -299,7 +322,9 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
                                 ? 'Modifier le message...'
                                 : 'Écrire un message...',
                             filled: true,
-                            fillColor: isDark ? Colors.grey[850] : Colors.grey[100],
+                            fillColor: isDark
+                                ? Colors.grey[850]
+                                : Colors.grey[100],
                             border: OutlineInputBorder(
                               borderRadius: BorderRadius.circular(24),
                               borderSide: BorderSide.none,
@@ -309,16 +334,21 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
                               vertical: 12,
                             ),
                           ),
-                          maxLines: null,
+                          maxLines: 5,
+                          minLines: 1,
                           textCapitalization: TextCapitalization.sentences,
                         ),
                       ),
                       const SizedBox(width: 8),
                       IconButton(
                         onPressed: () => _sendMessage(currentUser),
-                        icon: Icon(_editingMessage != null ? Icons.check : Icons.send),
+                        icon: Icon(
+                          _editingMessage != null ? Icons.check : Icons.send,
+                        ),
                         style: IconButton.styleFrom(
-                          backgroundColor: Theme.of(context).colorScheme.primary,
+                          backgroundColor: Theme.of(
+                            context,
+                          ).colorScheme.primary,
                           foregroundColor: Colors.white,
                           padding: const EdgeInsets.all(12),
                         ),
@@ -341,27 +371,17 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
         child: Column(
           mainAxisAlignment: MainAxisAlignment.center,
           children: [
-            Icon(
+            Icon(Icons.chat_bubble_outline, size: 80, color: Colors.grey[400]),
-              Icons.chat_bubble_outline,
-              size: 80,
-              color: Colors.grey[400],
-            ),
             const SizedBox(height: 16),
             const Text(
               'Aucun message',
-              style: TextStyle(
+              style: TextStyle(fontSize: 20, fontWeight: FontWeight.bold),
-                fontSize: 20,
-                fontWeight: FontWeight.bold,
-              ),
             ),
             const SizedBox(height: 8),
             Text(
               'Commencez la conversation !',
               textAlign: TextAlign.center,
-              style: TextStyle(
+              style: TextStyle(fontSize: 14, color: Colors.grey[600]),
-                fontSize: 14,
-                color: Colors.grey[600],
-              ),
             ),
           ],
         ),
@@ -369,7 +389,12 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
     );
   }
 
-  Widget _buildMessageBubble(Message message, bool isMe, bool isDark, String currentUserId) {
+  Widget _buildMessageBubble(
+    Message message,
+    bool isMe,
+    bool isDark,
+    String currentUserId,
+  ) {
     final Color bubbleColor;
     final Color textColor;
 
@@ -381,76 +406,139 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
       textColor = isDark ? Colors.white : Colors.black87;
     }
 
+    // Trouver le membre qui a envoyé le message pour récupérer son pseudo actuel
+    final senderMember = widget.group.members.cast<GroupMember?>().firstWhere(
+      (m) => m?.userId == message.senderId,
+      orElse: () => null,
+    );
+
+    // Utiliser le pseudo actuel du membre, ou le senderName en fallback
+    final displayName = senderMember != null
+        ? senderMember.pseudo
+        : message.senderName;
+
     return Align(
       alignment: isMe ? Alignment.centerRight : Alignment.centerLeft,
       child: GestureDetector(
-        onLongPress: () => _showMessageOptions(context, message, isMe, currentUserId),
+        onLongPress: () =>
-        child: Container(
+            _showMessageOptions(context, message, isMe, currentUserId),
-          margin: const EdgeInsets.symmetric(vertical: 4),
+        child: Padding(
-          padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 10),
+          padding: EdgeInsets.symmetric(horizontal: 8, vertical: 4),
-          constraints: BoxConstraints(
+          child: Row(
-            maxWidth: MediaQuery.of(context).size.width * 0.7,
+            mainAxisAlignment: isMe
-          ),
+                ? MainAxisAlignment.end
-          decoration: BoxDecoration(
+                : MainAxisAlignment.start,
-            color: bubbleColor,
+            crossAxisAlignment: CrossAxisAlignment.end,
-            borderRadius: BorderRadius.only(
-              topLeft: const Radius.circular(16),
-              topRight: const Radius.circular(16),
-              bottomLeft: Radius.circular(isMe ? 16 : 4),
-              bottomRight: Radius.circular(isMe ? 4 : 16),
-            ),
-          ),
-          child: Column(
-            crossAxisAlignment: isMe ? CrossAxisAlignment.end : CrossAxisAlignment.start,
             children: [
+              // Avatar du sender (seulement pour les autres messages)
               if (!isMe) ...[
-                Text(
+                CircleAvatar(
-                  message.senderName,
+                  radius: 16,
-                  style: TextStyle(
+                  backgroundImage:
-                    fontSize: 12,
+                      (senderMember != null &&
-                    fontWeight: FontWeight.bold,
+                          senderMember.profilePictureUrl != null &&
-                    color: isDark ? Colors.grey[400] : Colors.grey[700],
+                          senderMember.profilePictureUrl!.isNotEmpty)
+                      ? NetworkImage(senderMember.profilePictureUrl!)
+                      : null,
+                  child:
+                      (senderMember == null ||
+                          senderMember.profilePictureUrl == null ||
+                          senderMember.profilePictureUrl!.isEmpty)
+                      ? Text(
+                          displayName.isNotEmpty
+                              ? displayName[0].toUpperCase()
+                              : '?',
+                          style: const TextStyle(fontSize: 12),
+                        )
+                      : null,
+                ),
+                const SizedBox(width: 8),
+              ],
+
+              Container(
+                margin: const EdgeInsets.symmetric(vertical: 4),
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 16,
+                  vertical: 10,
+                ),
+                constraints: BoxConstraints(
+                  maxWidth: MediaQuery.of(context).size.width * 0.65,
+                ),
+                decoration: BoxDecoration(
+                  color: bubbleColor,
+                  borderRadius: BorderRadius.only(
+                    topLeft: const Radius.circular(16),
+                    topRight: const Radius.circular(16),
+                    bottomLeft: Radius.circular(isMe ? 16 : 4),
+                    bottomRight: Radius.circular(isMe ? 4 : 16),
                   ),
                 ),
-                const SizedBox(height: 4),
+                child: Column(
-              ],
+                  crossAxisAlignment: isMe
-              Text(
+                      ? CrossAxisAlignment.end
-                message.text,
+                      : CrossAxisAlignment.start,
-                style: TextStyle(fontSize: 15, color: textColor),
+                  children: [
-              ),
+                    if (!isMe) ...[
-              const SizedBox(height: 4),
+                      Text(
-              Row(
+                        displayName,
-                mainAxisSize: MainAxisSize.min,
+                        style: TextStyle(
-                children: [
+                          fontSize: 12,
-                  Text(
+                          fontWeight: FontWeight.bold,
-                    _formatTime(message.timestamp),
+                          color: isDark ? Colors.grey[400] : Colors.grey[700],
-                    style: TextStyle(
+                        ),
-                      fontSize: 11,
+                      ),
-                      color: textColor.withValues(alpha: 0.7),
+                      const SizedBox(height: 4),
-                    ),
+                    ],
-                  ),
-                  if (message.isEdited) ...[
-                    const SizedBox(width: 4),
                     Text(
-                      '(modifié)',
+                      message.isDeleted
+                          ? 'a supprimé un message'
+                          : message.text,
                       style: TextStyle(
-                        fontSize: 10,
+                        fontSize: 15,
-                        fontStyle: FontStyle.italic,
+                        color: message.isDeleted
-                        color: textColor.withValues(alpha: 0.6),
+                            ? textColor.withValues(alpha: 0.5)
+                            : textColor,
+                        fontStyle: message.isDeleted
+                            ? FontStyle.italic
+                            : FontStyle.normal,
                       ),
                     ),
+                    const SizedBox(height: 4),
+                    Row(
+                      mainAxisSize: MainAxisSize.min,
+                      children: [
+                        Text(
+                          _formatTime(message.timestamp),
+                          style: TextStyle(
+                            fontSize: 11,
+                            color: textColor.withValues(alpha: 0.7),
+                          ),
+                        ),
+                        if (message.isEdited) ...[
+                          const SizedBox(width: 4),
+                          Text(
+                            '(modifié)',
+                            style: TextStyle(
+                              fontSize: 10,
+                              fontStyle: FontStyle.italic,
+                              color: textColor.withValues(alpha: 0.6),
+                            ),
+                          ),
+                        ],
+                      ],
+                    ),
+                    // Afficher les réactions
+                    if (message.reactions.isNotEmpty)
+                      Padding(
+                        padding: const EdgeInsets.only(top: 4),
+                        child: Wrap(
+                          spacing: 4,
+                          children: _buildReactionChips(message, currentUserId),
+                        ),
+                      ),
                   ],
-                ],
-              ),
-              // Afficher les réactions
-              if (message.reactions.isNotEmpty)
-                Padding(
-                  padding: const EdgeInsets.only(top: 4),
-                  child: Wrap(
-                    spacing: 4,
-                    children: _buildReactionChips(message, currentUserId),
-                  ),
                 ),
+              ),
             ],
           ),
         ),
@@ -497,7 +585,10 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
               const SizedBox(width: 2),
               Text(
                 '${userIds.length}',
-                style: const TextStyle(fontSize: 10, fontWeight: FontWeight.bold),
+                style: const TextStyle(
+                  fontSize: 10,
+                  fontWeight: FontWeight.bold,
+                ),
               ),
             ],
           ),
@@ -506,7 +597,12 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
     }).toList();
   }
 
-  void _showMessageOptions(BuildContext context, Message message, bool isMe, String currentUserId) {
+  void _showMessageOptions(
+    BuildContext context,
+    Message message,
+    bool isMe,
+    String currentUserId,
+  ) {
     showModalBottomSheet(
       context: context,
       builder: (context) => SafeArea(
@@ -541,7 +637,10 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
               ),
               ListTile(
                 leading: const Icon(Icons.delete, color: Colors.red),
-                title: const Text('Supprimer', style: TextStyle(color: Colors.red)),
+                title: const Text(
+                  'Supprimer',
+                  style: TextStyle(color: Colors.red),
+                ),
                 onTap: () {
                   Navigator.pop(context);
                   _showDeleteConfirmation(context, message.id);
@@ -642,11 +741,55 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
             itemCount: widget.group.members.length,
             itemBuilder: (context, index) {
               final member = widget.group.members[index];
+              final initials = member.pseudo.isNotEmpty
+                  ? member.pseudo[0].toUpperCase()
+                  : (member.firstName.isNotEmpty
+                        ? member.firstName[0].toUpperCase()
+                        : '?');
+
+              // Construire le nom complet
+              final fullName = '${member.firstName} ${member.lastName}'.trim();
+
               return ListTile(
                 leading: CircleAvatar(
-                  child: Text(member.pseudo.substring(0, 1).toUpperCase()),
+                  backgroundImage:
+                      (member.profilePictureUrl != null &&
+                          member.profilePictureUrl!.isNotEmpty)
+                      ? NetworkImage(member.profilePictureUrl!)
+                      : null,
+                  child:
+                      (member.profilePictureUrl == null ||
+                          member.profilePictureUrl!.isEmpty)
+                      ? Text(initials)
+                      : null,
+                ),
+                title: Column(
+                  crossAxisAlignment: CrossAxisAlignment.start,
+                  children: [
+                    Text(member.pseudo),
+                    if (fullName.isNotEmpty)
+                      Text(
+                        fullName,
+                        style: const TextStyle(
+                          fontSize: 12,
+                          fontWeight: FontWeight.normal,
+                        ),
+                      ),
+                  ],
+                ),
+                subtitle: member.role == 'admin'
+                    ? const Text(
+                        'Administrateur',
+                        style: TextStyle(fontSize: 12),
+                      )
+                    : null,
+                trailing: IconButton(
+                  icon: const Icon(Icons.edit, size: 18),
+                  onPressed: () {
+                    Navigator.pop(context);
+                    _showChangePseudoDialog(member);
+                  },
                 ),
-                title: Text(member.pseudo),
               );
             },
           ),
@@ -660,4 +803,80 @@ class _ChatGroupContentState extends State<ChatGroupContent> {
       ),
     );
   }
+
+  void _showChangePseudoDialog(dynamic member) {
+    final pseudoController = TextEditingController(text: member.pseudo);
+    final theme = Theme.of(context);
+
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        backgroundColor:
+            theme.dialogTheme.backgroundColor ?? theme.colorScheme.surface,
+        title: Text(
+          'Changer le pseudo',
+          style: theme.textTheme.titleLarge?.copyWith(
+            color: theme.colorScheme.onSurface,
+          ),
+        ),
+        content: TextField(
+          controller: pseudoController,
+          decoration: InputDecoration(
+            hintText: 'Nouveau pseudo',
+            border: OutlineInputBorder(borderRadius: BorderRadius.circular(8)),
+            contentPadding: const EdgeInsets.symmetric(
+              horizontal: 16,
+              vertical: 12,
+            ),
+          ),
+          style: TextStyle(color: theme.colorScheme.onSurface),
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.pop(context),
+            child: Text(
+              'Annuler',
+              style: TextStyle(color: theme.colorScheme.primary),
+            ),
+          ),
+          TextButton(
+            onPressed: () {
+              final newPseudo = pseudoController.text.trim();
+              if (newPseudo.isNotEmpty) {
+                _updateMemberPseudo(member, newPseudo);
+                Navigator.pop(context);
+              }
+            },
+            child: Text(
+              'Valider',
+              style: TextStyle(color: theme.colorScheme.primary),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  Future<void> _updateMemberPseudo(dynamic member, String newPseudo) async {
+    try {
+      final updatedMember = member.copyWith(pseudo: newPseudo);
+      await _groupRepository.addMember(widget.group.id, updatedMember);
+
+      if (mounted) {
+        // Le stream listener va automatiquement mettre à jour les membres
+        // Pas besoin de fermer le dialog ou de faire un refresh manuel
+
+        ErrorService().showSnackbar(
+          message: 'Pseudo modifié en "$newPseudo"',
+          isError: false,
+        );
+      }
+    } catch (e) {
+      if (mounted) {
+        ErrorService().showError(
+          message: 'Erreur lors de la modification du pseudo: $e',
+        );
+      }
+    }
+  }
 }

lib/components/group/group_content.dart

@@ -1,6 +1,6 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
-import 'package:travel_mate/components/error/error_content.dart';
+import '../../services/error_service.dart';
 import 'package:travel_mate/components/group/chat_group_content.dart';
 import 'package:travel_mate/components/widgets/user_state_widget.dart';
 import '../../blocs/user/user_bloc.dart';
@@ -50,19 +50,12 @@ class _GroupContentState extends State<GroupContent> {
         return BlocConsumer<GroupBloc, GroupState>(
           listener: (context, groupState) {
             if (groupState is GroupOperationSuccess) {
-              ScaffoldMessenger.of(context).showSnackBar(
+              ErrorService().showSnackbar(
-                SnackBar(
+                message: groupState.message,
-                  content: Text(groupState.message),
+                isError: false,
-                  backgroundColor: Colors.green,
-                ),
               );
             } else if (groupState is GroupError) {
-              ScaffoldMessenger.of(context).showSnackBar(
+              ErrorService().showError(message: groupState.message);
-                SnackBar(
-                  content: Text(groupState.message),
-                  backgroundColor: Colors.red,
-                ),
-              );
             }
           },
           builder: (context, groupState) {
@@ -127,17 +120,6 @@ class _GroupContentState extends State<GroupContent> {
       child: ListView(
         padding: const EdgeInsets.all(16),
         children: [
-          const Text(
-            'Mes groupes',
-            style: TextStyle(fontSize: 28, fontWeight: FontWeight.bold),
-          ),
-          const SizedBox(height: 8),
-          Text(
-            'Discutez avec les participants',
-            style: TextStyle(fontSize: 14, color: Colors.grey[600]),
-          ),
-          const SizedBox(height: 24),
-
           ...groups.map((group) {
             return Padding(
               padding: const EdgeInsets.only(bottom: 12),
@@ -155,12 +137,9 @@ class _GroupContentState extends State<GroupContent> {
       final color = colors[group.name.hashCode.abs() % colors.length];
 
       // Membres de manière simple
-      String memberInfo = '${group.members.length} membre(s)';
+      String memberInfo = '${group.memberIds.length} membre(s)';
       if (group.members.isNotEmpty) {
-        final names = group.members
+        final names = group.members.take(2).map((m) => m.firstName).join(', ');
-            .take(2)
-            .map((m) => m.pseudo.isNotEmpty ? m.pseudo : m.firstName)
-            .join(', ');
         memberInfo += '\n$names';
       }
 
@@ -223,8 +202,7 @@ class _GroupContentState extends State<GroupContent> {
       if (mounted) {
         if (retry) {
           if (userId == '') {
-            showErrorDialog(
+            ErrorService().showError(
-              context,
               title: 'Erreur utilisateur',
               message: 'Utilisateur non connecté. Veuillez vous reconnecter.',
               icon: Icons.error,
@@ -234,8 +212,7 @@ class _GroupContentState extends State<GroupContent> {
               },
             );
           } else {
-            showErrorDialog(
+            ErrorService().showError(
-              context,
               title: 'Erreur de chargement',
               message: error,
               icon: Icons.cloud_off,
@@ -246,8 +223,7 @@ class _GroupContentState extends State<GroupContent> {
             );
           }
         } else {
-          showErrorDialog(
+          ErrorService().showError(
-            context,
             title: 'Erreur',
             message: error,
             icon: Icons.error,

lib/components/home/calendar/calendar_page.dart

@@ -0,0 +1,487 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import 'package:table_calendar/table_calendar.dart';
+import 'package:intl/intl.dart';
+import '../../../models/trip.dart';
+import '../../../models/activity.dart';
+import '../../../blocs/activity/activity_bloc.dart';
+import '../../../blocs/activity/activity_state.dart';
+import '../../../blocs/activity/activity_event.dart';
+import '../../../repositories/user_repository.dart';
+import '../../../models/user.dart';
+
+class CalendarPage extends StatefulWidget {
+  final Trip trip;
+
+  const CalendarPage({super.key, required this.trip});
+
+  @override
+  State<CalendarPage> createState() => _CalendarPageState();
+}
+
+class _CalendarPageState extends State<CalendarPage> {
+  late DateTime _focusedDay;
+  DateTime? _selectedDay;
+  final CalendarFormat _calendarFormat = CalendarFormat.week;
+
+  @override
+  void initState() {
+    super.initState();
+    _focusedDay = widget.trip.startDate;
+    _selectedDay = _focusedDay;
+  }
+
+  List<Activity> _getActivitiesForDay(DateTime day, List<Activity> activities) {
+    return activities.where((activity) {
+      if (activity.date == null) return false;
+      return isSameDay(activity.date, day);
+    }).toList();
+  }
+
+  Future<void> _selectTimeAndSchedule(Activity activity, DateTime date) async {
+    final TimeOfDay? pickedTime = await showTimePicker(
+      context: context,
+      initialTime: TimeOfDay.now(),
+      builder: (BuildContext context, Widget? child) {
+        return MediaQuery(
+          data: MediaQuery.of(context).copyWith(alwaysUse24HourFormat: true),
+          child: child!,
+        );
+      },
+    );
+
+    if (pickedTime != null && mounted) {
+      final scheduledDate = DateTime(
+        date.year,
+        date.month,
+        date.day,
+        pickedTime.hour,
+        pickedTime.minute,
+      );
+
+      context.read<ActivityBloc>().add(
+        UpdateActivityDate(
+          tripId: widget.trip.id!,
+          activityId: activity.id,
+          date: scheduledDate,
+        ),
+      );
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final theme = Theme.of(context);
+    final isDarkMode = theme.brightness == Brightness.dark;
+
+    return Scaffold(
+      backgroundColor: isDarkMode
+          ? theme.scaffoldBackgroundColor
+          : Colors.white,
+      appBar: AppBar(
+        title: Text(
+          widget.trip.title,
+          style: theme.textTheme.titleLarge?.copyWith(
+            fontWeight: FontWeight.bold,
+          ),
+        ),
+        centerTitle: true,
+        backgroundColor: Colors.transparent,
+        elevation: 0,
+        leading: IconButton(
+          icon: Icon(Icons.arrow_back_ios, color: theme.colorScheme.onSurface),
+          onPressed: () => Navigator.pop(context),
+        ),
+        actions: [
+          IconButton(
+            icon: Icon(Icons.people, color: theme.colorScheme.onSurface),
+            onPressed: () => _showParticipantsDialog(context),
+          ),
+        ],
+      ),
+      body: BlocBuilder<ActivityBloc, ActivityState>(
+        builder: (context, state) {
+          if (state is ActivityLoading) {
+            return const Center(child: CircularProgressIndicator());
+          }
+
+          List<Activity> allActivities = [];
+          if (state is ActivityLoaded) {
+            allActivities = state.activities;
+          } else if (state is ActivitySearchResults) {
+            // Fallback if we are in search state
+          }
+
+          // Filter approved activities
+          final approvedActivities = allActivities.where((a) {
+            return a.isApprovedByAllParticipants([
+              ...widget.trip.participants,
+              widget.trip.createdBy,
+            ]);
+          }).toList();
+
+          final scheduledActivities = approvedActivities
+              .where((a) => a.date != null)
+              .toList();
+
+          final unscheduledActivities = approvedActivities
+              .where((a) => a.date == null)
+              .toList();
+
+          final selectedActivities = _getActivitiesForDay(
+            _selectedDay ?? _focusedDay,
+            scheduledActivities,
+          );
+
+          // Sort by time
+          selectedActivities.sort((a, b) => a.date!.compareTo(b.date!));
+
+          return Column(
+            children: [
+              // Calendar Strip
+              Container(
+                margin: const EdgeInsets.symmetric(horizontal: 16, vertical: 8),
+                decoration: BoxDecoration(
+                  color: isDarkMode ? theme.cardColor : Colors.grey[100],
+                  borderRadius: BorderRadius.circular(12),
+                ),
+                child: TableCalendar(
+                  firstDay: DateTime.now().subtract(const Duration(days: 365)),
+                  lastDay: DateTime.now().add(const Duration(days: 365)),
+                  focusedDay: _focusedDay,
+                  calendarFormat: _calendarFormat,
+                  headerStyle: HeaderStyle(
+                    formatButtonVisible: false,
+                    titleCentered: true,
+                    titleTextStyle: theme.textTheme.titleLarge!.copyWith(
+                      fontWeight: FontWeight.bold,
+                    ),
+                    leftChevronIcon: const Icon(Icons.chevron_left),
+                    rightChevronIcon: const Icon(Icons.chevron_right),
+                  ),
+                  calendarStyle: CalendarStyle(
+                    todayDecoration: BoxDecoration(
+                      color: Colors.blue.withValues(alpha: 0.3),
+                      shape: BoxShape.circle,
+                    ),
+                    selectedDecoration: const BoxDecoration(
+                      color: Colors.blue,
+                      shape: BoxShape.circle,
+                    ),
+                    markerDecoration: const BoxDecoration(
+                      color: Colors.purple,
+                      shape: BoxShape.circle,
+                    ),
+                  ),
+                  selectedDayPredicate: (day) {
+                    return isSameDay(_selectedDay, day);
+                  },
+                  onDaySelected: (selectedDay, focusedDay) {
+                    setState(() {
+                      _selectedDay = selectedDay;
+                      _focusedDay = focusedDay;
+                    });
+                  },
+                  onPageChanged: (focusedDay) {
+                    _focusedDay = focusedDay;
+                  },
+                  eventLoader: (day) {
+                    return _getActivitiesForDay(day, scheduledActivities);
+                  },
+                ),
+              ),
+
+              const SizedBox(height: 16),
+
+              // Timeline View
+              Expanded(
+                child: SingleChildScrollView(
+                  padding: const EdgeInsets.symmetric(horizontal: 16),
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      // Timeline
+                      if (selectedActivities.isEmpty)
+                        Padding(
+                          padding: const EdgeInsets.symmetric(vertical: 32),
+                          child: Center(
+                            child: Text(
+                              'Aucune activité prévue ce jour',
+                              style: theme.textTheme.bodyLarge?.copyWith(
+                                color: theme.colorScheme.onSurface.withValues(
+                                  alpha: 0.5,
+                                ),
+                              ),
+                            ),
+                          ),
+                        )
+                      else
+                        ...selectedActivities.map((activity) {
+                          return _buildTimelineItem(activity, theme);
+                        }),
+
+                      const SizedBox(height: 32),
+
+                      // Unscheduled Activities Section
+                      Text(
+                        'Activités à ajouter',
+                        style: theme.textTheme.titleLarge?.copyWith(
+                          fontWeight: FontWeight.bold,
+                        ),
+                      ),
+                      const SizedBox(height: 16),
+
+                      if (unscheduledActivities.isEmpty)
+                        Padding(
+                          padding: const EdgeInsets.symmetric(vertical: 16),
+                          child: Text(
+                            'Toutes les activités sont planifiées !',
+                            style: theme.textTheme.bodyMedium?.copyWith(
+                              color: theme.colorScheme.onSurface.withValues(
+                                alpha: 0.5,
+                              ),
+                            ),
+                          ),
+                        )
+                      else
+                        ...unscheduledActivities.map((activity) {
+                          return _buildUnscheduledActivityCard(activity, theme);
+                        }),
+
+                      const SizedBox(height: 32),
+                    ],
+                  ),
+                ),
+              ),
+            ],
+          );
+        },
+      ),
+    );
+  }
+
+  Widget _buildTimelineItem(Activity activity, ThemeData theme) {
+    final timeFormat = DateFormat('HH:mm'); // 10:00
+    final endTimeFormat = DateFormat('HH:mm'); // 11:30 (simulated duration)
+
+    // Simulate duration (1h30)
+    final endTime = activity.date!.add(const Duration(hours: 1, minutes: 30));
+
+    return IntrinsicHeight(
+      child: Row(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          // Time Column
+          SizedBox(
+            width: 50,
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [
+                Text(
+                  '${activity.date!.hour}h',
+                  style: theme.textTheme.bodyMedium?.copyWith(
+                    color: theme.colorScheme.onSurface.withValues(alpha: 0.5),
+                  ),
+                ),
+              ],
+            ),
+          ),
+
+          // Timeline Line
+          // Expanded(child: Container()), // Placeholder for line if needed
+
+          // Activity Card
+          Expanded(
+            child: Container(
+              margin: const EdgeInsets.only(bottom: 24),
+              padding: const EdgeInsets.all(16),
+              decoration: BoxDecoration(
+                color: _getCategoryColor(
+                  activity.category,
+                ).withValues(alpha: 0.1),
+                borderRadius: BorderRadius.circular(12),
+                border: Border(
+                  left: BorderSide(
+                    color: _getCategoryColor(activity.category),
+                    width: 4,
+                  ),
+                ),
+              ),
+              child: Column(
+                crossAxisAlignment: CrossAxisAlignment.start,
+                children: [
+                  Text(
+                    activity.name,
+                    style: theme.textTheme.titleMedium?.copyWith(
+                      fontWeight: FontWeight.bold,
+                      color: theme.colorScheme.onSurface,
+                    ),
+                  ),
+                  const SizedBox(height: 4),
+                  Text(
+                    '${timeFormat.format(activity.date!)} - ${endTimeFormat.format(endTime)}',
+                    style: theme.textTheme.bodyMedium?.copyWith(
+                      color: _getCategoryColor(activity.category),
+                      fontWeight: FontWeight.w500,
+                    ),
+                  ),
+                ],
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  Widget _buildUnscheduledActivityCard(Activity activity, ThemeData theme) {
+    return Container(
+      margin: const EdgeInsets.only(bottom: 12),
+      decoration: BoxDecoration(
+        color: theme.cardColor,
+        borderRadius: BorderRadius.circular(16),
+        boxShadow: [
+          BoxShadow(
+            color: Colors.black.withValues(alpha: 0.05),
+            blurRadius: 10,
+            offset: const Offset(0, 2),
+          ),
+        ],
+      ),
+      child: ListTile(
+        contentPadding: const EdgeInsets.all(16),
+        leading: Container(
+          padding: const EdgeInsets.all(12),
+          decoration: BoxDecoration(
+            color: _getCategoryColor(activity.category).withValues(alpha: 0.1),
+            shape: BoxShape.circle,
+          ),
+          child: Icon(
+            _getCategoryIcon(activity.category),
+            color: _getCategoryColor(activity.category),
+          ),
+        ),
+        title: Text(
+          activity.name,
+          style: theme.textTheme.titleMedium?.copyWith(
+            fontWeight: FontWeight.bold,
+          ),
+        ),
+        subtitle: Text(
+          activity.category,
+          style: theme.textTheme.bodyMedium?.copyWith(
+            color: theme.colorScheme.onSurface.withValues(alpha: 0.6),
+          ),
+        ),
+        trailing: IconButton(
+          icon: const Icon(Icons.grid_view), // Drag handle icon
+          onPressed: () {
+            if (_selectedDay != null) {
+              _selectTimeAndSchedule(activity, _selectedDay!);
+            }
+          },
+        ),
+      ),
+    );
+  }
+
+  Color _getCategoryColor(String category) {
+    // Simple mapping based on category name
+    // You might want to use the enum if possible, but category is String in Activity model
+    if (category.toLowerCase().contains('musée') ||
+        category.toLowerCase().contains('museum')) {
+      return Colors.blue;
+    }
+    if (category.toLowerCase().contains('restaurant') ||
+        category.toLowerCase().contains('food')) {
+      return Colors.orange;
+    }
+    if (category.toLowerCase().contains('nature') ||
+        category.toLowerCase().contains('park')) {
+      return Colors.green;
+    }
+    if (category.toLowerCase().contains('photo') ||
+        category.toLowerCase().contains('attraction')) {
+      return Colors.purple;
+    }
+    if (category.toLowerCase().contains('détente') ||
+        category.toLowerCase().contains('relax')) {
+      return Colors.pink;
+    }
+    return Colors.teal;
+  }
+
+  IconData _getCategoryIcon(String category) {
+    if (category.toLowerCase().contains('musée')) return Icons.museum;
+    if (category.toLowerCase().contains('restaurant')) return Icons.restaurant;
+    if (category.toLowerCase().contains('nature')) return Icons.nature;
+    if (category.toLowerCase().contains('photo')) return Icons.camera_alt;
+    if (category.toLowerCase().contains('détente')) {
+      return Icons.icecream; // Gelato icon :)
+    }
+    return Icons.place;
+  }
+
+  void _showParticipantsDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Participants'),
+        content: SizedBox(
+          width: double.maxFinite,
+          child: FutureBuilder<List<User>>(
+            future: UserRepository().getUsersByIds([
+              ...widget.trip.participants,
+              widget.trip.createdBy,
+            ]),
+            builder: (context, snapshot) {
+              if (snapshot.connectionState == ConnectionState.waiting) {
+                return const Center(child: CircularProgressIndicator());
+              }
+
+              if (snapshot.hasError) {
+                return const Center(child: Text('Erreur de chargement'));
+              }
+
+              final users = snapshot.data ?? [];
+              if (users.isEmpty) {
+                return const Center(child: Text('Aucun participant trouvé'));
+              }
+
+              return ListView.builder(
+                shrinkWrap: true,
+                itemCount: users.length,
+                itemBuilder: (context, index) {
+                  final user = users[index];
+                  final isCreator = user.id == widget.trip.createdBy;
+
+                  return ListTile(
+                    leading: CircleAvatar(
+                      backgroundImage: user.profilePictureUrl != null
+                          ? NetworkImage(user.profilePictureUrl!)
+                          : null,
+                      child: user.profilePictureUrl == null
+                          ? Text(
+                              '${user.prenom.isNotEmpty ? user.prenom[0] : ''}${user.nom.isNotEmpty ? user.nom[0] : ''}'
+                                  .toUpperCase(),
+                            )
+                          : null,
+                    ),
+                    title: Text(user.fullName),
+                    subtitle: isCreator ? const Text('Organisateur') : null,
+                  );
+                },
+              );
+            },
+          ),
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.pop(context),
+            child: const Text('Fermer'),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/components/home/calendar/calendar_page.dart_snippet

@@ -0,0 +1,59 @@
+  void _showParticipantsDialog(BuildContext context) {
+    showDialog(
+      context: context,
+      builder: (context) => AlertDialog(
+        title: const Text('Participants'),
+        content: SizedBox(
+          width: double.maxFinite,
+          child: FutureBuilder<List<User>>(
+            future: UserRepository().getUsersByIds([
+              ...widget.trip.participants,
+              widget.trip.createdBy,
+            ]),
+            builder: (context, snapshot) {
+              if (snapshot.connectionState == ConnectionState.waiting) {
+                return const Center(child: CircularProgressIndicator());
+              }
+              
+              if (snapshot.hasError) {
+                return const Center(child: Text('Erreur de chargement'));
+              }
+
+              final users = snapshot.data ?? [];
+              if (users.isEmpty) {
+                return const Center(child: Text('Aucun participant trouvé'));
+              }
+
+              return ListView.builder(
+                shrinkWrap: true,
+                itemCount: users.length,
+                itemBuilder: (context, index) {
+                  final user = users[index];
+                  final isCreator = user.id == widget.trip.createdBy;
+                  
+                  return ListTile(
+                    leading: CircleAvatar(
+                      backgroundImage: user.photoUrl != null
+                          ? NetworkImage(user.photoUrl!)
+                          : null,
+                      child: user.photoUrl == null
+                          ? Text(user.initials)
+                          : null,
+                    ),
+                    title: Text(user.fullName),
+                    subtitle: isCreator ? const Text('Organisateur') : null,
+                  );
+                },
+              );
+            },
+          ),
+        ),
+        actions: [
+          TextButton(
+            onPressed: () => Navigator.pop(context),
+            child: const Text('Fermer'),
+          ),
+        ],
+      ),
+    );
+  }

lib/components/home/create_trip_content.dart

@@ -1,3 +1,4 @@
+import 'dart:io';
 import 'dart:convert';
 import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
@@ -17,10 +18,13 @@ import '../../models/group.dart';
 import '../../models/group_member.dart';
 import '../../services/user_service.dart';
 import '../../repositories/group_repository.dart';
+import '../../repositories/account_repository.dart';
 import 'package:http/http.dart' as http;
 import 'package:flutter_dotenv/flutter_dotenv.dart';
 import '../../services/place_image_service.dart';
 import '../../services/trip_geocoding_service.dart';
+import '../../services/logger_service.dart';
+import '../../firebase_options.dart';
 
 /// Create trip content widget for trip creation and editing functionality.
 ///
@@ -45,10 +49,7 @@ class CreateTripContent extends StatefulWidget {
   /// Args:
   ///   [tripToEdit]: Optional trip to edit. If provided, the form will
   ///                 be populated with existing trip data for editing
-  const CreateTripContent({
+  const CreateTripContent({super.key, this.tripToEdit});
-    super.key,
-    this.tripToEdit,
-  });
 
   @override
   State<CreateTripContent> createState() => _CreateTripContentState();
@@ -71,6 +72,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
   /// Services for user and group operations
   final _userService = UserService();
   final _groupRepository = GroupRepository();
+  final _accountRepository = AccountRepository();
   final _placeImageService = PlaceImageService();
   final _tripGeocodingService = TripGeocodingService();
 
@@ -84,7 +86,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
   String? _selectedImageUrl;
 
   /// Google Maps API key for location services
-  static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
+  static String get _apiKey {
+    return DefaultFirebaseOptions.currentPlatform.apiKey;
+  }
 
   /// Participant management
   final List<String> _participants = [];
@@ -123,7 +127,11 @@ class _CreateTripContentState extends State<CreateTripContent> {
     }
   }
 
+  bool _isProgrammaticUpdate = false;
+
   void _onLocationChanged() {
+    if (_isProgrammaticUpdate) return;
+
     final query = _locationController.text.trim();
 
     if (query.length < 2) {
@@ -149,7 +157,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
         '?input=${Uri.encodeComponent(query)}'
         '&types=(cities)'
         '&language=fr'
-        '&key=$_apiKey'
+        '&key=$_apiKey',
       );
 
       final response = await http.get(url);
@@ -203,13 +211,18 @@ class _CreateTripContentState extends State<CreateTripContent> {
 
     if (_placeSuggestions.isEmpty) return;
 
+    final overlay = Overlay.of(context);
+
+    // Calculer la largeur correcte en fonction du padding parent (16 margin + 24 padding = 40 de chaque côté)
+    final width = MediaQuery.of(context).size.width - 80;
+
     _suggestionsOverlay = OverlayEntry(
       builder: (context) => Positioned(
-        width: MediaQuery.of(context).size.width - 32, // Largeur du champ avec padding
+        width: width,
         child: CompositedTransformFollower(
           link: _layerLink,
           showWhenUnlinked: false,
-          offset: const Offset(0, 60), // Position sous le champ
+          targetAnchor: Alignment.bottomLeft,
           child: Material(
             elevation: 4,
             borderRadius: BorderRadius.circular(8),
@@ -222,6 +235,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
               ),
               child: ListView.builder(
                 shrinkWrap: true,
+                padding: EdgeInsets.zero,
                 itemCount: _placeSuggestions.length,
                 itemBuilder: (context, index) {
                   final suggestion = _placeSuggestions[index];
@@ -242,7 +256,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
       ),
     );
 
-    Overlay.of(context).insert(_suggestionsOverlay!);
+    overlay.insert(_suggestionsOverlay!);
   }
 
   void _hideSuggestions() {
@@ -251,7 +265,10 @@ class _CreateTripContentState extends State<CreateTripContent> {
   }
 
   void _selectSuggestion(PlaceSuggestion suggestion) {
+    _isProgrammaticUpdate = true;
     _locationController.text = suggestion.description;
+    _isProgrammaticUpdate = false;
+
     _hideSuggestions();
     setState(() {
       _placeSuggestions = [];
@@ -263,19 +280,25 @@ class _CreateTripContentState extends State<CreateTripContent> {
 
   /// Charge l'image du lieu depuis Google Places API
   Future<void> _loadPlaceImage(String location) async {
-    print('CreateTripContent: Chargement de l\'image pour: $location');
+    LoggerService.info(
+      'CreateTripContent: Chargement de l\'image pour: $location',
+    );
 
     try {
       final imageUrl = await _placeImageService.getPlaceImageUrl(location);
-      print('CreateTripContent: Image URL reçue: $imageUrl');
+      LoggerService.info('CreateTripContent: Image URL reçue: $imageUrl');
       if (mounted) {
         setState(() {
           _selectedImageUrl = imageUrl;
         });
-        print('CreateTripContent: État mis à jour avec imageUrl: $_selectedImageUrl');
+        LoggerService.info(
+          'CreateTripContent: État mis à jour avec imageUrl: $_selectedImageUrl',
+        );
       }
     } catch (e) {
-      print('CreateTripContent: Erreur lors du chargement de l\'image: $e');
+      LoggerService.error(
+        'CreateTripContent: Erreur lors du chargement de l\'image: $e',
+      );
       if (mounted) {
         _errorService.logError(
           'create_trip_content.dart',
@@ -347,42 +370,36 @@ class _CreateTripContentState extends State<CreateTripContent> {
       decoration: InputDecoration(
         hintText: label,
         hintStyle: theme.textTheme.bodyLarge?.copyWith(
-          color: theme.colorScheme.onSurface.withOpacity(0.5),
+          color: theme.colorScheme.onSurface.withValues(alpha: 0.5),
         ),
         prefixIcon: Icon(
           icon,
-          color: theme.colorScheme.onSurface.withOpacity(0.5),
+          color: theme.colorScheme.onSurface.withValues(alpha: 0.5),
         ),
         suffixIcon: suffixIcon,
         border: OutlineInputBorder(
           borderRadius: BorderRadius.circular(12),
           borderSide: BorderSide(
             color: isDarkMode
-              ? Colors.white.withOpacity(0.2)
+                ? Colors.white.withValues(alpha: 0.2)
-              : Colors.black.withOpacity(0.2),
+                : Colors.black.withValues(alpha: 0.2),
           ),
         ),
         enabledBorder: OutlineInputBorder(
           borderRadius: BorderRadius.circular(12),
           borderSide: BorderSide(
             color: isDarkMode
-              ? Colors.white.withOpacity(0.2)
+                ? Colors.white.withValues(alpha: 0.2)
-              : Colors.black.withOpacity(0.2),
+                : Colors.black.withValues(alpha: 0.2),
           ),
         ),
         focusedBorder: OutlineInputBorder(
           borderRadius: BorderRadius.circular(12),
-          borderSide: BorderSide(
+          borderSide: BorderSide(color: Colors.teal, width: 2),
-            color: Colors.teal,
-            width: 2,
-          ),
         ),
         errorBorder: OutlineInputBorder(
           borderRadius: BorderRadius.circular(12),
-          borderSide: const BorderSide(
+          borderSide: const BorderSide(color: Colors.red, width: 2),
-            color: Colors.red,
-            width: 2,
-          ),
         ),
         filled: true,
         fillColor: theme.cardColor,
@@ -412,26 +429,26 @@ class _CreateTripContentState extends State<CreateTripContent> {
           borderRadius: BorderRadius.circular(12),
           border: Border.all(
             color: isDarkMode
-              ? Colors.white.withOpacity(0.2)
+                ? Colors.white.withValues(alpha: 0.2)
-              : Colors.black.withOpacity(0.2),
+                : Colors.black.withValues(alpha: 0.2),
           ),
         ),
         child: Row(
           children: [
             Icon(
               Icons.calendar_today,
-              color: theme.colorScheme.onSurface.withOpacity(0.5),
+              color: theme.colorScheme.onSurface.withValues(alpha: 0.5),
               size: 20,
             ),
             const SizedBox(width: 12),
             Text(
               date != null
-                ? '${date.day.toString().padLeft(2, '0')}/${date.month.toString().padLeft(2, '0')}/${date.year}'
+                  ? '${date.day.toString().padLeft(2, '0')}/${date.month.toString().padLeft(2, '0')}/${date.year}'
-                : 'mm/dd/yyyy',
+                  : 'mm/dd/yyyy',
               style: theme.textTheme.bodyLarge?.copyWith(
                 color: date != null
-                  ? theme.colorScheme.onSurface
+                    ? theme.colorScheme.onSurface
-                  : theme.colorScheme.onSurface.withOpacity(0.5),
+                    : theme.colorScheme.onSurface.withValues(alpha: 0.5),
               ),
             ),
           ],
@@ -440,7 +457,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
     );
   }
 
- @override
+  @override
   Widget build(BuildContext context) {
     final theme = Theme.of(context);
     final isDarkMode = theme.brightness == Brightness.dark;
@@ -452,7 +469,10 @@ class _CreateTripContentState extends State<CreateTripContent> {
           _createGroupAndAccountForTrip(_createdTripId!);
         } else if (tripState is TripOperationSuccess) {
           if (mounted) {
-            _errorService.showSnackbar(message: tripState.message, isError: false);
+            _errorService.showSnackbar(
+              message: tripState.message,
+              isError: false,
+            );
             setState(() {
               _isLoading = false;
             });
@@ -463,7 +483,10 @@ class _CreateTripContentState extends State<CreateTripContent> {
           }
         } else if (tripState is TripError) {
           if (mounted) {
-            _errorService.showSnackbar(message: tripState.message, isError: true);
+            _errorService.showSnackbar(
+              message: tripState.message,
+              isError: true,
+            );
             setState(() {
               _isLoading = false;
             });
@@ -476,7 +499,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
             return Scaffold(
               backgroundColor: theme.scaffoldBackgroundColor,
               appBar: AppBar(
-                title: Text(isEditing ? 'Modifier le voyage' : 'Créer un voyage'),
+                title: Text(
+                  isEditing ? 'Modifier le voyage' : 'Créer un voyage',
+                ),
                 backgroundColor: theme.appBarTheme.backgroundColor,
                 foregroundColor: theme.appBarTheme.foregroundColor,
               ),
@@ -504,7 +529,10 @@ class _CreateTripContentState extends State<CreateTripContent> {
               backgroundColor: Colors.transparent,
               elevation: 0,
               leading: IconButton(
-                icon: Icon(Icons.arrow_back, color: theme.colorScheme.onSurface),
+                icon: Icon(
+                  Icons.arrow_back,
+                  color: theme.colorScheme.onSurface,
+                ),
                 onPressed: () => Navigator.pop(context),
               ),
             ),
@@ -517,7 +545,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
                   borderRadius: BorderRadius.circular(20),
                   boxShadow: [
                     BoxShadow(
-                      color: Colors.black.withOpacity(isDarkMode ? 0.3 : 0.1),
+                      color: Colors.black.withValues(
+                        alpha: isDarkMode ? 0.3 : 0.1,
+                      ),
                       blurRadius: 10,
                       offset: const Offset(0, 5),
                     ),
@@ -542,7 +572,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
                         Text(
                           'Donne un nom à ton voyage',
                           style: theme.textTheme.bodyMedium?.copyWith(
-                            color: theme.colorScheme.onSurface.withOpacity(0.7),
+                            color: theme.colorScheme.onSurface.withValues(
+                              alpha: 0.7,
+                            ),
                           ),
                         ),
                         const SizedBox(height: 24),
@@ -586,7 +618,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
                                 ? const SizedBox(
                                     width: 20,
                                     height: 20,
-                                    child: CircularProgressIndicator(strokeWidth: 2),
+                                    child: CircularProgressIndicator(
+                                      strokeWidth: 2,
+                                    ),
                                   )
                                 : null,
                           ),
@@ -611,46 +645,42 @@ class _CreateTripContentState extends State<CreateTripContent> {
                         const SizedBox(height: 20),
 
                         // Dates
-                        Row(
+                        Column(
                           children: [
-                            Expanded(
+                            Column(
-                              child: Column(
+                              crossAxisAlignment: CrossAxisAlignment.start,
-                                crossAxisAlignment: CrossAxisAlignment.start,
+                              children: [
-                                children: [
+                                Text(
-                                  Text(
+                                  'Début du voyage',
-                                    'Début du voyage',
+                                  style: theme.textTheme.titleMedium?.copyWith(
-                                    style: theme.textTheme.titleMedium?.copyWith(
+                                    fontWeight: FontWeight.w600,
-                                      fontWeight: FontWeight.w600,
+                                    color: theme.colorScheme.onSurface,
-                                      color: theme.colorScheme.onSurface,
-                                    ),
                                   ),
-                                  const SizedBox(height: 12),
+                                ),
-                                  _buildDateField(
+                                const SizedBox(height: 12),
-                                    date: _startDate,
+                                _buildDateField(
-                                    onTap: () => _selectStartDate(context),
+                                  date: _startDate,
-                                  ),
+                                  onTap: () => _selectStartDate(context),
-                                ],
+                                ),
-                              ),
+                              ],
                             ),
-                            const SizedBox(width: 16),
+                            const SizedBox(height: 20),
-                            Expanded(
+                            Column(
-                              child: Column(
+                              crossAxisAlignment: CrossAxisAlignment.start,
-                                crossAxisAlignment: CrossAxisAlignment.start,
+                              children: [
-                                children: [
+                                Text(
-                                  Text(
+                                  'Fin du voyage',
-                                    'Fin du voyage',
+                                  style: theme.textTheme.titleMedium?.copyWith(
-                                    style: theme.textTheme.titleMedium?.copyWith(
+                                    fontWeight: FontWeight.w600,
-                                      fontWeight: FontWeight.w600,
+                                    color: theme.colorScheme.onSurface,
-                                      color: theme.colorScheme.onSurface,
-                                    ),
                                   ),
-                                  const SizedBox(height: 12),
+                                ),
-                                  _buildDateField(
+                                const SizedBox(height: 12),
-                                    date: _endDate,
+                                _buildDateField(
-                                    onTap: () => _selectEndDate(context),
+                                  date: _endDate,
-                                  ),
+                                  onTap: () => _selectEndDate(context),
-                                ],
+                                ),
-                              ),
+                              ],
                             ),
                           ],
                         ),
@@ -669,86 +699,94 @@ class _CreateTripContentState extends State<CreateTripContent> {
                           controller: _budgetController,
                           label: 'Ex : 500',
                           icon: Icons.euro,
-                          keyboardType: TextInputType.numberWithOptions(decimal: true),
+                          keyboardType: TextInputType.numberWithOptions(
+                            decimal: true,
+                          ),
                         ),
                         const SizedBox(height: 20),
 
-                        // Inviter des amis
+                        // Inviter des amis - seulement en mode création
-                        Text(
+                        if (!isEditing) ...[
-                          'Invite tes amis',
+                          Text(
-                          style: theme.textTheme.titleMedium?.copyWith(
+                            'Invite tes amis',
-                            fontWeight: FontWeight.w600,
+                            style: theme.textTheme.titleMedium?.copyWith(
-                            color: theme.colorScheme.onSurface,
+                              fontWeight: FontWeight.w600,
+                              color: theme.colorScheme.onSurface,
+                            ),
                           ),
-                        ),
+                          const SizedBox(height: 12),
-                        const SizedBox(height: 12),
+                          Row(
-                        Row(
+                            children: [
-                          children: [
+                              Expanded(
-                            Expanded(
+                                child: _buildModernTextField(
-                              child: _buildModernTextField(
+                                  controller: _participantController,
-                                controller: _participantController,
+                                  label: 'adresse@email.com',
-                                label: 'adresse@email.com',
+                                  icon: Icons.alternate_email,
-                                icon: Icons.alternate_email,
+                                  keyboardType: TextInputType.emailAddress,
-                                keyboardType: TextInputType.emailAddress,
-                              ),
-                            ),
-                            const SizedBox(width: 12),
-                            Container(
-                              height: 56,
-                              width: 56,
-                              decoration: BoxDecoration(
-                                color: Colors.teal,
-                                borderRadius: BorderRadius.circular(12),
-                              ),
-                              child: IconButton(
-                                onPressed: _addParticipant,
-                                icon: const Icon(Icons.add, color: Colors.white),
-                              ),
-                            ),
-                          ],
-                        ),
-                        const SizedBox(height: 16),
-
-                        // Participants ajoutés
-                        if (_participants.isNotEmpty) ...[
-                          Wrap(
-                            spacing: 8,
-                            runSpacing: 8,
-                            children: _participants.map((email) {
-                              return Container(
-                                padding: const EdgeInsets.symmetric(
-                                  horizontal: 12,
-                                  vertical: 8,
                                 ),
+                              ),
+                              const SizedBox(width: 12),
+                              Container(
+                                height: 56,
+                                width: 56,
                                 decoration: BoxDecoration(
-                                  color: Colors.teal.withOpacity(0.1),
+                                  color: Colors.teal,
-                                  borderRadius: BorderRadius.circular(20),
+                                  borderRadius: BorderRadius.circular(12),
                                 ),
-                                child: Row(
+                                child: IconButton(
-                                  mainAxisSize: MainAxisSize.min,
+                                  onPressed: _addParticipant,
-                                  children: [
+                                  icon: const Icon(
-                                    Text(
+                                    Icons.add,
-                                      email,
+                                    color: Colors.white,
-                                      style: theme.textTheme.bodySmall?.copyWith(
+                                  ),
-                                        color: Colors.teal,
-                                        fontWeight: FontWeight.w500,
-                                      ),
-                                    ),
-                                    const SizedBox(width: 8),
-                                    GestureDetector(
-                                      onTap: () => _removeParticipant(email),
-                                      child: const Icon(
-                                        Icons.close,
-                                        size: 16,
-                                        color: Colors.teal,
-                                      ),
-                                    ),
-                                  ],
                                 ),
-                              );
+                              ),
-                            }).toList(),
+                            ],
                           ),
-                          const SizedBox(height: 20),
+                          const SizedBox(height: 16),
+
+                          // Participants ajoutés
+                          if (_participants.isNotEmpty) ...[
+                            Wrap(
+                              spacing: 8,
+                              runSpacing: 8,
+                              children: _participants.map((email) {
+                                return Container(
+                                  padding: const EdgeInsets.symmetric(
+                                    horizontal: 12,
+                                    vertical: 8,
+                                  ),
+                                  decoration: BoxDecoration(
+                                    color: Colors.teal.withValues(alpha: 0.1),
+                                    borderRadius: BorderRadius.circular(20),
+                                  ),
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      Text(
+                                        email,
+                                        style: theme.textTheme.bodySmall
+                                            ?.copyWith(
+                                              color: Colors.teal,
+                                              fontWeight: FontWeight.w500,
+                                            ),
+                                      ),
+                                      const SizedBox(width: 8),
+                                      GestureDetector(
+                                        onTap: () => _removeParticipant(email),
+                                        child: const Icon(
+                                          Icons.close,
+                                          size: 16,
+                                          color: Colors.teal,
+                                        ),
+                                      ),
+                                    ],
+                                  ),
+                                );
+                              }).toList(),
+                            ),
+                            const SizedBox(height: 20),
+                          ],
                         ],
 
                         const SizedBox(height: 32),
@@ -758,7 +796,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
                           width: double.infinity,
                           height: 56,
                           child: ElevatedButton(
-                            onPressed: _isLoading ? null : () => _saveTrip(userState.user),
+                            onPressed: _isLoading
+                                ? null
+                                : () => _saveTrip(userState.user),
                             style: ElevatedButton.styleFrom(
                               backgroundColor: Colors.teal,
                               foregroundColor: Colors.white,
@@ -773,15 +813,20 @@ class _CreateTripContentState extends State<CreateTripContent> {
                                     height: 20,
                                     child: CircularProgressIndicator(
                                       strokeWidth: 2,
-                                      valueColor: AlwaysStoppedAnimation<Color>(Colors.white),
+                                      valueColor: AlwaysStoppedAnimation<Color>(
+                                        Colors.white,
+                                      ),
                                     ),
                                   )
                                 : Text(
-                                    isEditing ? 'Modifier le voyage' : 'Créer le voyage',
+                                    isEditing
-                                    style: theme.textTheme.titleMedium?.copyWith(
+                                        ? 'Modifier le voyage'
-                                      color: Colors.white,
+                                        : 'Créer le voyage',
-                                      fontWeight: FontWeight.w600,
+                                    style: theme.textTheme.titleMedium
-                                    ),
+                                        ?.copyWith(
+                                          color: Colors.white,
+                                          fontWeight: FontWeight.w600,
+                                        ),
                                   ),
                           ),
                         ),
@@ -846,15 +891,17 @@ class _CreateTripContentState extends State<CreateTripContent> {
     final emailRegex = RegExp(r'^[\w-\.]+@([\w-]+\.)+[\w-]{2,4}$');
     if (!emailRegex.hasMatch(email)) {
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(SnackBar(content: Text('Email invalide')));
+        _errorService.showError(message: 'Email invalide');
       }
       return;
     }
 
     if (_participants.contains(email)) {
       if (mounted) {
-        ScaffoldMessenger.of(context)
+        _errorService.showSnackbar(
-            .showSnackBar(SnackBar(content: Text('Ce participant est déjà ajouté')));
+          message: 'Ce participant est déjà ajouté',
+          isError: true,
+        );
       }
       return;
     }
@@ -871,13 +918,15 @@ class _CreateTripContentState extends State<CreateTripContent> {
     });
   }
 
-  // Mettre à jour le groupe avec les nouveaux membres
+  // Mettre à jour le groupe ET le compte avec les nouveaux membres
-  Future<void> _updateGroupMembers(
+  Future<void> _updateGroupAndAccountMembers(
     String tripId,
     user_state.UserModel currentUser,
     List<Map<String, dynamic>> participantsData,
   ) async {
     final groupBloc = context.read<GroupBloc>();
+    final accountBloc = context.read<AccountBloc>();
+
     try {
       final group = await _groupRepository.getGroupByTripId(tripId);
 
@@ -889,33 +938,56 @@ class _CreateTripContentState extends State<CreateTripContent> {
         return;
       }
 
+      // Récupérer le compte associé au voyage
+      final account = await _accountRepository.getAccountByTripId(tripId);
+
       final newMembers = await _createMembers();
 
       final currentMembers = await _groupRepository.getGroupMembers(group.id);
       final currentMemberIds = currentMembers.map((m) => m.userId).toSet();
       final newMemberIds = newMembers.map((m) => m.userId).toSet();
 
-      final membersToAdd = newMembers.where((m) => !currentMemberIds.contains(m.userId)).toList();
+      final membersToAdd = newMembers
+          .where((m) => !currentMemberIds.contains(m.userId))
+          .toList();
 
       final membersToRemove = currentMembers
           .where((m) => !newMemberIds.contains(m.userId) && m.role != 'admin')
           .toList();
 
+      // Ajouter les nouveaux membres au groupe ET au compte
       for (final member in membersToAdd) {
         if (mounted) {
           groupBloc.add(AddMemberToGroup(group.id, member));
+          if (account != null) {
+            accountBloc.add(AddMemberToAccount(account.id, member));
+          }
         }
       }
 
+      // Supprimer les membres supprimés du groupe ET du compte
       for (final member in membersToRemove) {
         if (mounted) {
           groupBloc.add(RemoveMemberFromGroup(group.id, member.userId));
+          if (account != null) {
+            accountBloc.add(RemoveMemberFromAccount(account.id, member.userId));
+          }
         }
       }
+
+      if (mounted) {
+        _errorService.showSnackbar(
+          message: 'Groupe et compte mis à jour avec succès !',
+          isError: false,
+        );
+        setState(() {
+          _isLoading = false;
+        });
+      }
     } catch (e) {
       _errorService.logError(
         'create_trip_content.dart',
-        'Erreur lors de la mise à jour du groupe: $e',
+        'Erreur lors de la mise à jour du groupe et du compte: $e',
       );
     }
   }
@@ -931,17 +1003,21 @@ class _CreateTripContentState extends State<CreateTripContent> {
       GroupMember(
         userId: currentUser.id,
         firstName: currentUser.prenom,
+        lastName: currentUser.nom,
         pseudo: currentUser.prenom,
         role: 'admin',
         profilePictureUrl: currentUser.profilePictureUrl,
       ),
-      ...participantsData.map((p) => GroupMember(
+      ...participantsData.map(
-            userId: p['id'] as String,
+        (p) => GroupMember(
-            firstName: p['firstName'] as String,
+          userId: p['id'] as String,
-            pseudo: p['firstName'] as String,
+          firstName: p['firstName'] as String,
-            role: 'member',
+          lastName: p['lastName'] as String? ?? '',
-            profilePictureUrl: p['profilePictureUrl'] as String?,
+          pseudo: p['firstName'] as String,
-          )),
+          role: 'member',
+          profilePictureUrl: p['profilePictureUrl'] as String?,
+        ),
+      ),
     ];
     return groupMembers;
   }
@@ -951,7 +1027,6 @@ class _CreateTripContentState extends State<CreateTripContent> {
     final accountBloc = context.read<AccountBloc>();
 
     try {
-      
       final userState = context.read<UserBloc>().state;
       if (userState is! user_state.UserLoaded) {
         throw Exception('Utilisateur non connecté');
@@ -971,34 +1046,29 @@ class _CreateTripContentState extends State<CreateTripContent> {
         throw Exception('Erreur lors de la création des membres du groupe');
       }
 
-      groupBloc.add(CreateGroupWithMembers(
+      groupBloc.add(
-        group: group,
+        CreateGroupWithMembers(group: group, members: groupMembers),
-        members: groupMembers,
+      );
-      ));
       final account = Account(
         id: '',
         tripId: tripId,
         name: _titleController.text.trim(),
       );
 
-      accountBloc.add(CreateAccountWithMembers(
+      accountBloc.add(
-        account: account,
+        CreateAccountWithMembers(account: account, members: groupMembers),
-        members: groupMembers,
+      );
-      ));
 
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        _errorService.showSnackbar(
-          SnackBar(
+          message: 'Voyage, groupe et compte créés avec succès !',
-            content: Text('Voyage, groupe et compte créés avec succès !'),
+          isError: false,
-            backgroundColor: Colors.green,
-          ),
         );
         setState(() {
           _isLoading = false;
         });
         Navigator.pop(context);
       }
-
     } catch (e) {
       _errorService.logError(
         'create_trip_content.dart',
@@ -1006,12 +1076,7 @@ class _CreateTripContentState extends State<CreateTripContent> {
       );
 
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        _errorService.showError(message: 'Erreur: $e');
-          SnackBar(
-            content: Text('Erreur: $e'),
-            backgroundColor: Colors.red,
-          ),
-        );
         setState(() {
           _isLoading = false;
         });
@@ -1019,8 +1084,6 @@ class _CreateTripContentState extends State<CreateTripContent> {
     }
   }
 
-  
-
   Future<void> _saveTrip(user_state.UserModel currentUser) async {
     if (!_formKey.currentState!.validate()) {
       return;
@@ -1028,8 +1091,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
 
     if (_startDate == null || _endDate == null) {
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        _errorService.showSnackbar(
-          SnackBar(content: Text('Veuillez sélectionner les dates')),
+          message: 'Veuillez sélectionner les dates',
+          isError: true,
         );
       }
       return;
@@ -1043,7 +1107,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
 
     try {
       final participantsData = await _getParticipantsData(_participants);
-      List<String> participantIds = participantsData.map((p) => p['id'] as String).toList();
+      List<String> participantIds = participantsData
+          .map((p) => p['id'] as String)
+          .toList();
 
       if (!participantIds.contains(currentUser.id)) {
         participantIds.insert(0, currentUser.id);
@@ -1067,20 +1133,15 @@ class _CreateTripContentState extends State<CreateTripContent> {
       // Géolocaliser le voyage avant de le sauvegarder
       Trip tripWithCoordinates;
       try {
-        print('🌍 [CreateTrip] Géolocalisation en cours pour: ${trip.location}');
         tripWithCoordinates = await _tripGeocodingService.geocodeTrip(trip);
-        print('✅ [CreateTrip] Géolocalisation réussie: ${tripWithCoordinates.latitude}, ${tripWithCoordinates.longitude}');
       } catch (e) {
-        print('⚠️ [CreateTrip] Erreur de géolocalisation: $e');
         // Continuer sans coordonnées en cas d'erreur
         tripWithCoordinates = trip;
         if (mounted) {
-          ScaffoldMessenger.of(context).showSnackBar(
+          _errorService.showSnackbar(
-            SnackBar(
+            message:
-              content: Text('Voyage créé sans géolocalisation (pas d\'impact sur les fonctionnalités)'),
+                'Voyage créé sans géolocalisation (pas d\'impact sur les fonctionnalités)',
-              backgroundColor: Colors.orange,
+            isError: true, // Warning displayed as error for now
-              duration: Duration(seconds: 2),
-            ),
           );
         }
       }
@@ -1089,27 +1150,29 @@ class _CreateTripContentState extends State<CreateTripContent> {
         // Mode mise à jour
         tripBloc.add(TripUpdateRequested(trip: tripWithCoordinates));
 
-        // Vérifier que l'ID du voyage existe avant de mettre à jour le groupe
+        // Mettre à jour le groupe ET les comptes avec les nouveaux participants
-        if (widget.tripToEdit != null && widget.tripToEdit!.id != null && widget.tripToEdit!.id!.isNotEmpty) {
+        if (widget.tripToEdit != null &&
-          await _updateGroupMembers(
+            widget.tripToEdit!.id != null &&
+            widget.tripToEdit!.id!.isNotEmpty) {
+          LoggerService.info(
+            '🔄 [CreateTrip] Mise à jour du groupe et du compte pour le voyage ID: ${widget.tripToEdit!.id}',
+          );
+          LoggerService.info(
+            '👥 Participants: ${participantsData.map((p) => p['id']).toList()}',
+          );
+          await _updateGroupAndAccountMembers(
             widget.tripToEdit!.id!,
             currentUser,
             participantsData,
           );
         }
-
       } else {
         // Mode création - Le groupe sera créé dans le listener TripCreated
         tripBloc.add(TripCreateRequested(trip: tripWithCoordinates));
       }
     } catch (e) {
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        _errorService.showError(message: 'Erreur: $e');
-          SnackBar(
-            content: Text('Erreur: $e'),
-            backgroundColor: Colors.red,
-          ),
-        );
 
         setState(() {
           _isLoading = false;
@@ -1118,7 +1181,9 @@ class _CreateTripContentState extends State<CreateTripContent> {
     }
   }
 
-  Future<List<Map<String, dynamic>>> _getParticipantsData(List<String> emails) async {
+  Future<List<Map<String, dynamic>>> _getParticipantsData(
+    List<String> emails,
+  ) async {
     List<Map<String, dynamic>> participantsData = [];
 
     for (String email in emails) {
@@ -1127,20 +1192,20 @@ class _CreateTripContentState extends State<CreateTripContent> {
         if (userId != null) {
           final userDoc = await _userService.getUserById(userId);
           final firstName = userDoc?.prenom ?? 'Utilisateur';
+          final lastName = userDoc?.nom ?? '';
           final profilePictureUrl = userDoc?.profilePictureUrl;
 
           participantsData.add({
             'id': userId,
             'firstName': firstName,
+            'lastName': lastName,
             'profilePictureUrl': profilePictureUrl,
           });
         } else {
           if (mounted) {
-            ScaffoldMessenger.of(context).showSnackBar(
+            _errorService.showSnackbar(
-              SnackBar(
+              message: 'Utilisateur non trouvé: $email',
-                content: Text('Utilisateur non trouvé: $email'),
+              isError: true,
-                backgroundColor: Colors.orange,
-              ),
             );
           }
         }
@@ -1160,8 +1225,5 @@ class PlaceSuggestion {
   final String placeId;
   final String description;
 
-  PlaceSuggestion({
+  PlaceSuggestion({required this.placeId, required this.description});
-    required this.placeId,
-    required this.description,
-  });
 }

lib/components/home/home_content.dart

@@ -11,6 +11,7 @@ import '../../blocs/trip/trip_bloc.dart';
 import '../../blocs/trip/trip_state.dart';
 import '../../blocs/trip/trip_event.dart';
 import '../../models/trip.dart';
+import '../../services/error_service.dart';
 
 /// Home content widget for the main application dashboard.
 ///
@@ -79,26 +80,16 @@ class _HomeContentState extends State<HomeContent>
         return BlocConsumer<TripBloc, TripState>(
           listener: (context, tripState) {
             if (tripState is TripOperationSuccess) {
-              ScaffoldMessenger.of(context).showSnackBar(
+              ErrorService().showSnackbar(
-                SnackBar(
+                message: tripState.message,
-                  content: Text(tripState.message),
+                isError: false,
-                  backgroundColor: Colors.green,
-                ),
               );
             } else if (tripState is TripError) {
-              ScaffoldMessenger.of(context).showSnackBar(
+              ErrorService().showError(message: tripState.message);
-                SnackBar(
-                  content: Text(tripState.message),
-                  backgroundColor: Colors.red,
-                ),
-              );
             } else if (tripState is TripCreated) {
-              ScaffoldMessenger.of(context).showSnackBar(
+              ErrorService().showSnackbar(
-                SnackBar(
+                message: 'Voyage en cours de création...',
-                  content: Text('Voyage en cours de création...'),
+                isError: false,
-                  backgroundColor: Colors.blue,
-                  duration: Duration(seconds: 1),
-                ),
               );
             }
           },
@@ -134,17 +125,7 @@ class _HomeContentState extends State<HomeContent>
                               : Colors.black,
                         ),
                       ),
-                      const SizedBox(height: 8),
+                      const SizedBox(height: 16),
-                      Text(
-                        'Vos voyages',
-                        style: TextStyle(
-                          fontSize: 16,
-                          color: Theme.of(context).brightness == Brightness.dark
-                              ? Colors.white70
-                              : Colors.grey[600],
-                        ),
-                      ),
-                      const SizedBox(height: 20),
 
                       if (tripState is TripLoading || tripState is TripCreated)
                         _buildLoadingState()
@@ -165,6 +146,7 @@ class _HomeContentState extends State<HomeContent>
                 ),
               ),
               floatingActionButton: FloatingActionButton(
+                heroTag: 'home_fab',
                 onPressed: () async {
                   final tripBloc = context.read<TripBloc>();
 

lib/components/home/trip_card.dart

@@ -41,12 +41,9 @@ class _TripCardState extends State<TripCard> {
     });
 
     try {
-      // D'abord vérifier si une image existe déjà dans le Storage
       String? imageUrl = await _placeImageService.getExistingImageUrl(
         widget.trip.location,
       );
-
-      // Si aucune image n'existe, en télécharger une nouvelle
       imageUrl ??= await _placeImageService.getPlaceImageUrl(
         widget.trip.location,
       );
@@ -57,7 +54,6 @@ class _TripCardState extends State<TripCard> {
           _isLoadingImage = false;
         });
 
-        // Mettre à jour le voyage dans la base de données avec l'imageUrl
         _updateTripWithImage(imageUrl);
       } else {
         setState(() {
@@ -76,18 +72,13 @@ class _TripCardState extends State<TripCard> {
   Future<void> _updateTripWithImage(String imageUrl) async {
     try {
       if (widget.trip.id != null) {
-        // Créer une copie du voyage avec la nouvelle imageUrl
         final updatedTrip = widget.trip.copyWith(
           imageUrl: imageUrl,
           updatedAt: DateTime.now(),
         );
-
-        // Mettre à jour dans la base de données
         await _tripRepository.updateTrip(widget.trip.id!, updatedTrip);
       }
-    } catch (e) {
+    } catch (e) {}
-      // En cas d'erreur, on continue sans échec - l'image reste affichée localement
-    }
   }
 
   Widget _buildImageWidget() {

lib/components/loading/laoding_content.dart

@@ -57,7 +57,10 @@ class _LoadingContentState extends State<LoadingContent>
           widget.onComplete!();
         }
       } catch (e) {
-        print('Erreur lors de la tâche en arrière-plan: $e');
+        debugPrint('Erreur lors de la tâche en arrière-plan: $e');
+        if (mounted) {
+          Navigator.pop(context);
+        }
       }
     }
   }

lib/components/map/map_content.dart

@@ -1,3 +1,4 @@
+import 'dart:io';
 import 'package:flutter/material.dart';
 import 'package:google_maps_flutter/google_maps_flutter.dart';
 import 'package:geolocator/geolocator.dart';
@@ -5,6 +6,11 @@ import 'dart:convert';
 import 'package:http/http.dart' as http;
 import 'dart:ui' as ui;
 import 'package:flutter_dotenv/flutter_dotenv.dart';
+import '../../firebase_options.dart';
+import '../../services/error_service.dart';
+import '../../services/map_navigation_service.dart';
+import '../../services/logger_service.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
 
 class MapContent extends StatefulWidget {
   final String? initialSearchQuery;
@@ -17,6 +23,7 @@ class MapContent extends StatefulWidget {
 class _MapContentState extends State<MapContent> {
   GoogleMapController? _mapController;
   LatLng _initialPosition = const LatLng(48.8566, 2.3522);
+  LatLng? _currentMapCenter;
   final TextEditingController _searchController = TextEditingController();
   bool _isLoadingLocation = false;
   bool _isSearching = false;
@@ -27,13 +34,45 @@ class _MapContentState extends State<MapContent> {
 
   List<PlaceSuggestion> _suggestions = [];
 
-  static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
+  static String get _apiKey {
+    return DefaultFirebaseOptions.currentPlatform.apiKey;
+  }
 
   @override
   void initState() {
     super.initState();
-    // Si une recherche initiale est fournie, la pré-remplir et lancer la recherche
+
-    if (widget.initialSearchQuery != null && widget.initialSearchQuery!.isNotEmpty) {
+    final mapService = context.read<MapNavigationService>();
+
+    // Écouter les nouvelles demandes
+    mapService.requestStream.listen((request) {
+      LoggerService.info(
+        'MapContent: Received navigation request: ${request.name}',
+      );
+      _handleNavigationRequest(request);
+    });
+
+    // Vérifier s'il y a une demande de navigation en attente
+    if (mapService.lastRequest != null) {
+      LoggerService.info(
+        'MapContent: Found pending navigation request: ${mapService.lastRequest!.name}',
+      );
+      // Handle synchronously for initial build
+      final request = mapService.lastRequest!;
+      final position = LatLng(request.latitude, request.longitude);
+      _initialPosition = position;
+      _markers.add(
+        Marker(
+          markerId: MarkerId(
+            'nav_request_${request.timestamp.millisecondsSinceEpoch}',
+          ),
+          position: position,
+          infoWindow: InfoWindow(title: request.name ?? 'Lieu sélectionné'),
+        ),
+      );
+      // Ne pas lancer _getCurrentLocation() ici pour ne pas écraser la position
+    } else if (widget.initialSearchQuery != null &&
+        widget.initialSearchQuery!.isNotEmpty) {
       _searchController.text = widget.initialSearchQuery!;
       // Lancer la recherche automatiquement après un court délai pour laisser l'interface se charger
       Future.delayed(const Duration(milliseconds: 500), () {
@@ -45,6 +84,54 @@ class _MapContentState extends State<MapContent> {
     }
   }
 
+  void _handleNavigationRequest(MapLocationRequest request) {
+    if (!mounted) return;
+
+    LoggerService.info(
+      'MapContent: Handling navigation request to ${request.latitude}, ${request.longitude}',
+    );
+    final position = LatLng(request.latitude, request.longitude);
+
+    setState(() {
+      // Garder le marqueur de position utilisateur
+      _markers.removeWhere((m) => m.markerId.value != 'user_location');
+
+      // Ajouter le marqueur pour le lieu demandé
+      _markers.add(
+        Marker(
+          markerId: MarkerId(
+            'nav_request_${request.timestamp.millisecondsSinceEpoch}',
+          ),
+          position: position,
+          infoWindow: InfoWindow(title: request.name ?? 'Lieu sélectionné'),
+        ),
+      );
+      _isSearching = false;
+    });
+
+    // Animer la caméra si le contrôleur est prêt
+    if (_mapController != null) {
+      LoggerService.info(
+        'MapContent: Waiting for map to be visible before animating',
+      );
+      // Attendre un peu que l'onglet change et que la carte soit visible
+      Future.delayed(const Duration(milliseconds: 500), () {
+        if (mounted && _mapController != null) {
+          LoggerService.info('MapContent: Animating camera to position');
+          _mapController!.animateCamera(
+            CameraUpdate.newLatLngZoom(position, 15),
+          );
+        }
+      });
+    } else {
+      LoggerService.info(
+        'MapContent: MapController not ready, setting initial position',
+      );
+      // Si le contrôleur n'est pas encore prêt, définir la position initiale
+      _initialPosition = position;
+    }
+  }
+
   @override
   void dispose() {
     _searchController.dispose();
@@ -65,11 +152,13 @@ class _MapContentState extends State<MapContent> {
         'https://maps.googleapis.com/maps/api/place/autocomplete/json'
         '?input=${Uri.encodeComponent(query)}'
         '&key=$_apiKey'
-        '&language=fr'
+        '&language=fr',
       );
 
       final response = await http.get(url);
 
+      if (!mounted) return;
+
       if (response.statusCode == 200) {
         final data = json.decode(response.body);
 
@@ -117,6 +206,8 @@ class _MapContentState extends State<MapContent> {
 
       final response = await http.get(url);
 
+      if (!mounted) return;
+
       if (response.statusCode == 200) {
         final data = json.decode(response.body);
 
@@ -223,38 +314,40 @@ class _MapContentState extends State<MapContent> {
     }
   }
 
-  // Créer une icône personnalisée à partir de l'icône Material
+  // Créer une icône personnalisée
-  Future<BitmapDescriptor> _createCustomMarkerIcon() async {
+  Future<BitmapDescriptor> _createMarkerIcon(
+    IconData iconData,
+    Color color, {
+    double size = 60.0,
+  }) async {
     final pictureRecorder = ui.PictureRecorder();
     final canvas = Canvas(pictureRecorder);
-    const size = 120.0;
 
-    // Dessiner l'icône person_pin_circle en bleu
+    final iconPainter = TextPainter(textDirection: TextDirection.ltr);
-    final iconPainter = TextPainter(
-      textDirection: TextDirection.ltr,
-    );
     iconPainter.text = TextSpan(
-      text: String.fromCharCode(Icons.person_pin_circle.codePoint),
+      text: String.fromCharCode(iconData.codePoint),
       style: TextStyle(
-        fontSize: 100,
+        fontSize: size,
-        fontFamily: Icons.person_pin_circle.fontFamily,
+        fontFamily: iconData.fontFamily,
-        color: Colors.blue[700],
+        package: iconData.fontPackage,
+        color: color,
+        shadows: [
+          Shadow(
+            offset: const Offset(1, 1),
+            blurRadius: 2,
+            color: Colors.black.withValues(alpha: 0.3),
+          ),
+        ],
       ),
     );
     iconPainter.layout();
-    iconPainter.paint(
+    iconPainter.paint(canvas, Offset((size - iconPainter.width) / 2, 0));
-      canvas,
-      Offset(
-        (size - iconPainter.width) / 2,
-        0,
-      ),
-    );
 
     final picture = pictureRecorder.endRecording();
     final image = await picture.toImage(size.toInt(), size.toInt());
     final bytes = await image.toByteData(format: ui.ImageByteFormat.png);
 
-    return BitmapDescriptor.fromBytes(bytes!.buffer.asUint8List());
+    return BitmapDescriptor.bytes(bytes!.buffer.asUint8List());
   }
 
   // Ajouter le marqueur avec l'icône personnalisée
@@ -274,8 +367,12 @@ class _MapContentState extends State<MapContent> {
       ),
     );
 
-    // Créer l'icône personnalisée
+    // Créer l'icône personnalisée (plus petite: 60 au lieu de 80)
-    final icon = await _createCustomMarkerIcon();
+    final icon = await _createMarkerIcon(
+      Icons.person_pin_circle,
+      Colors.blue[700]!,
+      size: 60.0,
+    );
 
     // Ajouter le marqueur avec l'icône
     setState(() {
@@ -284,10 +381,11 @@ class _MapContentState extends State<MapContent> {
           markerId: const MarkerId('user_location'),
           position: position,
           icon: icon,
-          anchor: const Offset(0.5, 0.85), // Ancrer au bas de l'icône (le point du pin)
+          anchor: const Offset(0.5, 0.85), // Ancrer au bas de l'icône
           infoWindow: InfoWindow(
             title: 'Ma position',
-            snippet: 'Lat: ${position.latitude.toStringAsFixed(4)}, Lng: ${position.longitude.toStringAsFixed(4)}',
+            snippet:
+                'Lat: ${position.latitude.toStringAsFixed(4)}, Lng: ${position.longitude.toStringAsFixed(4)}',
           ),
         ),
       );
@@ -307,38 +405,69 @@ class _MapContentState extends State<MapContent> {
     });
 
     try {
+      final apiKey = _apiKey;
+      LoggerService.info('MapContent: Searching places with query "$query"');
+      if (apiKey.isEmpty) {
+        LoggerService.error('MapContent: API Key is empty!');
+      } else {
+        // Log first few chars to verify correct key is loaded without leaking full key
+        LoggerService.info(
+          'MapContent: Using API Key starting with ${apiKey.substring(0, 5)}...',
+        );
+      }
+
       final url = Uri.parse(
         'https://maps.googleapis.com/maps/api/place/autocomplete/json'
         '?input=${Uri.encodeComponent(query)}'
-        '&key=$_apiKey'
+        '&key=$apiKey'
-        '&language=fr'
+        '&language=fr',
       );
 
       final response = await http.get(url);
 
+      if (!mounted) return;
+
+      LoggerService.info(
+        'MapContent: Response status code: ${response.statusCode}',
+      );
+
       if (response.statusCode == 200) {
         final data = json.decode(response.body);
+        final status = data['status'];
 
-        if (data['status'] == 'OK') {
+        LoggerService.info('MapContent: API Status: $status');
+
+        if (status == 'OK') {
           final predictions = data['predictions'] as List;
+          LoggerService.info(
+            'MapContent: Found ${predictions.length} predictions',
+          );
 
           setState(() {
             _suggestions = predictions
-                .map((p) => PlaceSuggestion(
+                .map(
-                      placeId: p['place_id'],
+                  (p) => PlaceSuggestion(
-                      description: p['description'],
+                    placeId: p['place_id'],
-                    ))
+                    description: p['description'],
+                  ),
+                )
                 .toList();
             _isSearching = false;
           });
         } else {
+          LoggerService.error(
+            'MapContent: API Error: $status - ${data['error_message'] ?? "No error message"}',
+          );
           setState(() {
             _suggestions = [];
             _isSearching = false;
           });
         }
+      } else {
+        LoggerService.error('MapContent: HTTP Error ${response.statusCode}');
       }
     } catch (e) {
+      LoggerService.error('MapContent: Exception during search: $e');
       _showError('Erreur lors de la recherche de lieux: $e');
       setState(() {
         _isSearching = false;
@@ -346,6 +475,128 @@ class _MapContentState extends State<MapContent> {
     }
   }
 
+  Future<void> _performTextSearch(String query) async {
+    if (query.isEmpty) return;
+
+    setState(() {
+      _isSearching = true;
+      _suggestions = []; // Hide suggestions
+    });
+
+    try {
+      final apiKey = _apiKey;
+      // Utiliser le centre actuel de la carte ou la position initiale
+      final center = _currentMapCenter ?? _initialPosition;
+
+      final url = Uri.parse(
+        'https://maps.googleapis.com/maps/api/place/textsearch/json'
+        '?query=${Uri.encodeComponent(query)}'
+        '&location=${center.latitude},${center.longitude}'
+        '&radius=5000' // Rechercher dans un rayon de 5km autour du centre
+        '&key=$apiKey'
+        '&language=fr',
+      );
+
+      final response = await http.get(url);
+
+      if (!mounted) return;
+
+      if (response.statusCode == 200) {
+        final data = json.decode(response.body);
+
+        if (data['status'] == 'OK') {
+          final results = data['results'] as List;
+          final List<Marker> newMarkers = [];
+
+          // Garder le marqueur de position utilisateur
+          final userMarker = _markers
+              .where((m) => m.markerId.value == 'user_location')
+              .toList();
+
+          double minLat = center.latitude;
+          double maxLat = center.latitude;
+          double minLng = center.longitude;
+          double maxLng = center.longitude;
+
+          // Créer le marqueur rouge standard personnalisé
+          final markerIcon = await _createMarkerIcon(
+            Icons.location_on,
+            Colors.red,
+            size: 50.0,
+          );
+
+          for (final place in results) {
+            final geometry = place['geometry']['location'];
+            final lat = geometry['lat'];
+            final lng = geometry['lng'];
+            final name = place['name'];
+            final placeId = place['place_id'];
+
+            final position = LatLng(lat, lng);
+
+            // Mettre à jour les bornes
+            if (lat < minLat) minLat = lat;
+            if (lat > maxLat) maxLat = lat;
+            if (lng < minLng) minLng = lng;
+            if (lng > maxLng) maxLng = lng;
+
+            newMarkers.add(
+              Marker(
+                markerId: MarkerId(placeId),
+                position: position,
+                icon: markerIcon,
+                anchor: const Offset(0.5, 0.85), // Standard anchor for pins
+                infoWindow: InfoWindow(
+                  title: name,
+                  snippet: place['formatted_address'] ?? 'Lieu trouvé',
+                ),
+              ),
+            );
+          }
+
+          setState(() {
+            _markers.clear();
+            if (userMarker.isNotEmpty) {
+              _markers.add(userMarker.first);
+            }
+            _markers.addAll(newMarkers);
+            _isSearching = false;
+          });
+
+          // Ajuster la caméra pour montrer tous les résultats
+          if (newMarkers.isNotEmpty) {
+            _mapController?.animateCamera(
+              CameraUpdate.newLatLngBounds(
+                LatLngBounds(
+                  southwest: LatLng(minLat, minLng),
+                  northeast: LatLng(maxLat, maxLng),
+                ),
+                50.0, // padding
+              ),
+            );
+          }
+
+          FocusScope.of(context).unfocus();
+        } else {
+          _showError('Aucun résultat trouvé pour "$query"');
+          setState(() {
+            _isSearching = false;
+          });
+        }
+      } else {
+        _showError('Erreur lors de la recherche: ${response.statusCode}');
+        setState(() {
+          _isSearching = false;
+        });
+      }
+    } catch (e) {
+      _showError('Erreur lors de la recherche: $e');
+      setState(() {
+        _isSearching = false;
+      });
+    }
+  }
+
   Future<void> _selectPlace(PlaceSuggestion suggestion) async {
     setState(() {
       _isSearching = true;
@@ -363,17 +614,27 @@ class _MapContentState extends State<MapContent> {
 
       final response = await http.get(url);
 
+      if (!mounted) return;
+
       if (response.statusCode == 200) {
         final data = json.decode(response.body);
 
         if (data['status'] == 'OK') {
-          final location = data['result']['geometry']['location'];
+          final result = data['result'];
+          final location = result['geometry']['location'];
           final lat = location['lat'];
           final lng = location['lng'];
-          final name = data['result']['name'];
+          final name = result['name'];
 
           final newPosition = LatLng(lat, lng);
 
+          // Utiliser le marqueur rouge standard personnalisé
+          final markerIcon = await _createMarkerIcon(
+            Icons.location_on,
+            Colors.red,
+            size: 50.0,
+          );
+
           // Ajouter un marqueur pour le lieu recherché (ne pas supprimer le marqueur de position)
           setState(() {
             // Garder le marqueur de position utilisateur
@@ -384,6 +645,8 @@ class _MapContentState extends State<MapContent> {
               Marker(
                 markerId: MarkerId(suggestion.placeId),
                 position: newPosition,
+                icon: markerIcon,
+                anchor: const Offset(0.5, 0.85),
                 infoWindow: InfoWindow(title: name),
               ),
             );
@@ -394,7 +657,9 @@ class _MapContentState extends State<MapContent> {
             CameraUpdate.newLatLngZoom(newPosition, 15),
           );
 
-          FocusScope.of(context).unfocus();
+          if (mounted) {
+            FocusScope.of(context).unfocus();
+          }
         }
       }
     } catch (e) {
@@ -407,13 +672,7 @@ class _MapContentState extends State<MapContent> {
 
   void _showError(String message) {
     if (mounted) {
-      ScaffoldMessenger.of(context).showSnackBar(
+      ErrorService().showError(message: message);
-        SnackBar(
-          content: Text(message),
-          backgroundColor: Colors.red,
-          behavior: SnackBarBehavior.floating,
-        ),
-      );
     }
   }
 
@@ -437,6 +696,9 @@ class _MapContentState extends State<MapContent> {
                     onMapCreated: (GoogleMapController controller) {
                       _mapController = controller;
                     },
+                    onCameraMove: (CameraPosition position) {
+                      _currentMapCenter = position.target;
+                    },
                     markers: _markers,
                     circles: _circles,
                     myLocationEnabled: false,
@@ -545,7 +807,10 @@ class _MapContentState extends State<MapContent> {
                               : Icon(Icons.search, color: Colors.grey[700]),
                           suffixIcon: _searchController.text.isNotEmpty
                               ? IconButton(
-                                  icon: Icon(Icons.clear, color: Colors.grey[700]),
+                                  icon: Icon(
+                                    Icons.clear,
+                                    color: Colors.grey[700],
+                                  ),
                                   onPressed: () {
                                     _searchController.clear();
                                     setState(() {
@@ -565,9 +830,14 @@ class _MapContentState extends State<MapContent> {
                             vertical: 14,
                           ),
                         ),
+                        textInputAction: TextInputAction.search,
+                        onSubmitted: (value) {
+                          _performTextSearch(value);
+                        },
                         onChanged: (value) {
                           // Ne pas rechercher si c'est juste le remplissage initial
-                          if (widget.initialSearchQuery != null && value == widget.initialSearchQuery) {
+                          if (widget.initialSearchQuery != null &&
+                              value == widget.initialSearchQuery) {
                             return;
                           }
                           _searchPlaces(value);
@@ -601,10 +871,8 @@ class _MapContentState extends State<MapContent> {
                               shrinkWrap: true,
                               padding: EdgeInsets.zero,
                               itemCount: _suggestions.length,
-                              separatorBuilder: (context, index) => Divider(
+                              separatorBuilder: (context, index) =>
-                                height: 1,
+                                  Divider(height: 1, color: Colors.grey[300]),
-                                color: Colors.grey[300],
-                              ),
                               itemBuilder: (context, index) {
                                 final suggestion = _suggestions[index];
                                 return InkWell(
@@ -652,6 +920,7 @@ class _MapContentState extends State<MapContent> {
       ),
 
       floatingActionButton: FloatingActionButton(
+        heroTag: 'map_fab',
         onPressed: _getCurrentLocation,
         tooltip: 'Ma position',
         child: const Icon(Icons.my_location),
@@ -664,8 +933,5 @@ class PlaceSuggestion {
   final String placeId;
   final String description;
 
-  PlaceSuggestion({
+  PlaceSuggestion({required this.placeId, required this.description});
-    required this.placeId,
-    required this.description,
-  });
 }

lib/components/settings/policies/policies_content.dart

@@ -11,6 +11,13 @@ class PoliciesContent extends StatelessWidget {
     }
   }
 
+  Future<void> _launchCustomPrivacyPolicy() async {
+    final Uri url = Uri.parse('https://xeewy.be/travelmate/policies');
+    if (!await launchUrl(url)) {
+      throw Exception('Could not launch $url');
+    }
+  }
+
   Future<void> _onBackPressed(BuildContext context) async {
     if (Navigator.canPop(context)) {
       Navigator.pop(context);
@@ -44,108 +51,8 @@ class PoliciesContent extends StatelessWidget {
         child: Column(
           crossAxisAlignment: CrossAxisAlignment.start,
           children: [
-            // Section Collecte d'informations
+            // Keep only the buttons
-            Text(
-              'Collecte d\'informations',
-              style: theme.textTheme.titleLarge?.copyWith(
-                fontWeight: FontWeight.w600,
-                color: isDark ? Colors.white : Colors.black,
-              ),
-            ),
-            const SizedBox(height: 10),
-            Text(
-              'Nous collectons des informations que vous nous fournissez directement, comme votre nom, adresse e-mail et préférences de voyage.',
-              style: theme.textTheme.bodyLarge?.copyWith(
-                color: isDark ? Colors.grey[300] : Colors.grey[800],
-              ),
-            ),
             const SizedBox(height: 20),
-
-            // Section Utilisation des données
-            Text(
-              'Utilisation des données',
-              style: theme.textTheme.titleLarge?.copyWith(
-                fontWeight: FontWeight.w600,
-                color: isDark ? Colors.white : Colors.black,
-              ),
-            ),
-            const SizedBox(height: 10),
-            Text(
-              'Vos données sont utilisées pour améliorer votre expérience utilisateur et vous proposer des recommandations personnalisées.',
-              style: theme.textTheme.bodyLarge?.copyWith(
-                color: isDark ? Colors.grey[300] : Colors.grey[800],
-              ),
-            ),
-            const SizedBox(height: 20),
-
-            // Section Protection des données
-            Text(
-              'Protection des données',
-              style: theme.textTheme.titleLarge?.copyWith(
-                fontWeight: FontWeight.w600,
-                color: isDark ? Colors.white : Colors.black,
-              ),
-            ),
-            const SizedBox(height: 10),
-            Text(
-              'Nous mettons en place des mesures de sécurité appropriées pour protéger vos informations personnelles.',
-              style: theme.textTheme.bodyLarge?.copyWith(
-                color: isDark ? Colors.grey[300] : Colors.grey[800],
-              ),
-            ),
-            const SizedBox(height: 20),
-
-            // Section Partage des données
-            Text(
-              'Partage des données',
-              style: theme.textTheme.titleLarge?.copyWith(
-                fontWeight: FontWeight.w600,
-                color: isDark ? Colors.white : Colors.black,
-              ),
-            ),
-            const SizedBox(height: 10),
-            Text(
-              'Nous ne partageons pas vos informations personnelles avec des tiers sans votre consentement explicite.',
-              style: theme.textTheme.bodyLarge?.copyWith(
-                color: isDark ? Colors.grey[300] : Colors.grey[800],
-              ),
-            ),
-            const SizedBox(height: 20),
-
-            // Section Droits de l'utilisateur
-            Text(
-              'Vos droits',
-              style: theme.textTheme.titleLarge?.copyWith(
-                fontWeight: FontWeight.w600,
-                color: isDark ? Colors.white : Colors.black,
-              ),
-            ),
-            const SizedBox(height: 10),
-            Text(
-              'Vous avez le droit d\'accéder, de corriger ou de supprimer vos données personnelles à tout moment. Veuillez nous contacter pour toute demande.',
-              style: theme.textTheme.bodyLarge?.copyWith(
-                color: isDark ? Colors.grey[300] : Colors.grey[800],
-              ),
-            ),
-            const SizedBox(height: 20),
-
-            // Section Contact
-            Text(
-              'Nous contacter',
-              style: theme.textTheme.titleLarge?.copyWith(
-                fontWeight: FontWeight.w600,
-                color: isDark ? Colors.white : Colors.black,
-              ),
-            ),
-            const SizedBox(height: 10),
-            Text(
-              'Pour toute question concernant cette politique de confidentialité, veuillez nous contacter à support@travelmate.com',
-              style: theme.textTheme.bodyLarge?.copyWith(
-                color: isDark ? Colors.grey[300] : Colors.grey[800],
-              ),
-            ),
-            const SizedBox(height: 20),
-
             // Bouton Google Privacy Policy
             SizedBox(
               width: double.infinity,
@@ -163,6 +70,24 @@ class PoliciesContent extends StatelessWidget {
                 ),
               ),
             ),
+            const SizedBox(height: 12),
+            // Bouton Nos politiques de confidentialité
+            SizedBox(
+              width: double.infinity,
+              child: ElevatedButton.icon(
+                onPressed: _launchCustomPrivacyPolicy,
+                icon: const Icon(Icons.policy),
+                label: const Text('Nos politiques de confidentialités'),
+                style: ElevatedButton.styleFrom(
+                  backgroundColor: theme.primaryColor,
+                  foregroundColor: Colors.white,
+                  padding: const EdgeInsets.symmetric(vertical: 12),
+                  shape: RoundedRectangleBorder(
+                    borderRadius: BorderRadius.circular(8),
+                  ),
+                ),
+              ),
+            ),
             const SizedBox(height: 32),
           ],
         ),

lib/components/settings/profile/profile_content.dart

@@ -1,4 +1,5 @@
 import 'package:flutter/material.dart';
+import 'package:firebase_auth/firebase_auth.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:travel_mate/components/widgets/user_state_widget.dart';
 import 'package:travel_mate/services/error_service.dart';
@@ -9,6 +10,7 @@ import '../../../blocs/user/user_bloc.dart';
 import '../../../blocs/user/user_state.dart' as user_state;
 import '../../../blocs/user/user_event.dart' as user_event;
 import '../../../services/auth_service.dart';
+import '../../../services/logger_service.dart';
 
 class ProfileContent extends StatelessWidget {
   ProfileContent({super.key});
@@ -19,7 +21,8 @@ class ProfileContent extends StatelessWidget {
   Widget build(BuildContext context) {
     return UserStateWrapper(
       builder: (context, user) {
-        final isEmailAuth = user.authMethod == 'email' || user.authMethod == null;
+        final isEmailAuth =
+            user.authMethod == 'email' || user.authMethod == null;
 
         return SingleChildScrollView(
           child: Column(
@@ -40,10 +43,12 @@ class ProfileContent extends StatelessWidget {
                             color: Colors.black.withValues(alpha: 0.1),
                             blurRadius: 8,
                             offset: Offset(0, 2),
-                          )
+                          ),
                         ],
                       ),
-                      child: user.profilePictureUrl != null && user.profilePictureUrl!.isNotEmpty
+                      child:
+                          user.profilePictureUrl != null &&
+                              user.profilePictureUrl!.isNotEmpty
                           ? CircleAvatar(
                               radius: 50,
                               backgroundImage: NetworkImage(
@@ -57,7 +62,9 @@ class ProfileContent extends StatelessWidget {
                             )
                           : CircleAvatar(
                               radius: 50,
-                              backgroundColor: Theme.of(context).colorScheme.primary,
+                              backgroundColor: Theme.of(
+                                context,
+                              ).colorScheme.primary,
                               child: Text(
                                 user.prenom.isNotEmpty
                                     ? user.prenom[0].toUpperCase()
@@ -88,10 +95,7 @@ class ProfileContent extends StatelessWidget {
                     // Email
                     Text(
                       user.email,
-                      style: TextStyle(
+                      style: TextStyle(fontSize: 14, color: Colors.grey[600]),
-                        fontSize: 14,
-                        color: Colors.grey[600],
-                      ),
                       textAlign: TextAlign.center,
                     ),
 
@@ -99,7 +103,10 @@ class ProfileContent extends StatelessWidget {
 
                     // Badge de méthode de connexion
                     Container(
-                      padding: EdgeInsets.symmetric(horizontal: 12, vertical: 6),
+                      padding: EdgeInsets.symmetric(
+                        horizontal: 12,
+                        vertical: 6,
+                      ),
                       decoration: BoxDecoration(
                         color: _getAuthMethodColor(user.authMethod, context),
                         borderRadius: BorderRadius.circular(12),
@@ -120,7 +127,10 @@ class ProfileContent extends StatelessWidget {
                             style: TextStyle(
                               fontSize: 12,
                               fontWeight: FontWeight.w600,
-                              color: _getAuthMethodTextColor(user.authMethod, context),
+                              color: _getAuthMethodTextColor(
+                                user.authMethod,
+                                context,
+                              ),
                             ),
                           ),
                         ],
@@ -140,7 +150,9 @@ class ProfileContent extends StatelessWidget {
                       style: TextStyle(
                         fontSize: 16,
                         fontWeight: FontWeight.bold,
-                        color: Colors.black87,
+                        color: Theme.of(context).brightness == Brightness.dark
+                            ? Colors.white
+                            : Colors.black87,
                       ),
                     ),
                   ],
@@ -320,11 +332,7 @@ class ProfileContent extends StatelessWidget {
                 ),
               ),
             ),
-            Icon(
+            Icon(Icons.arrow_forward_ios, size: 16, color: Colors.grey[400]),
-              Icons.arrow_forward_ios,
-              size: 16,
-              color: Colors.grey[400],
-            ),
           ],
         ),
       ),
@@ -401,7 +409,9 @@ class ProfileContent extends StatelessWidget {
                         children: [
                           CircleAvatar(
                             radius: 50,
-                            backgroundColor: Theme.of(context).colorScheme.primary,
+                            backgroundColor: Theme.of(
+                              context,
+                            ).colorScheme.primary,
                             child: Text(
                               prenomController.text.isNotEmpty
                                   ? prenomController.text[0].toUpperCase()
@@ -422,7 +432,11 @@ class ProfileContent extends StatelessWidget {
                                 color: Theme.of(context).colorScheme.primary,
                               ),
                               child: IconButton(
-                                icon: Icon(Icons.camera_alt, color: Colors.white, size: 20),
+                                icon: Icon(
+                                  Icons.camera_alt,
+                                  color: Colors.white,
+                                  size: 20,
+                                ),
                                 onPressed: () {
                                   _showPhotoPickerDialog(dialogContext);
                                 },
@@ -490,11 +504,9 @@ class ProfileContent extends StatelessWidget {
                       );
 
                       Navigator.of(dialogContext).pop();
-                      ScaffoldMessenger.of(context).showSnackBar(
+                      _errorService.showSnackbar(
-                        SnackBar(
+                        message: 'Profil mis à jour !',
-                          content: Text('Profil mis à jour !'),
+                        isError: false,
-                          backgroundColor: Colors.green,
-                        ),
                       );
                     }
                   },
@@ -515,56 +527,62 @@ class ProfileContent extends StatelessWidget {
     showModalBottomSheet(
       context: context,
       builder: (BuildContext sheetContext) {
-        return Container(
+        return Wrap(
-          child: Wrap(
+          children: [
-            children: [
+            ListTile(
-              ListTile(
+              leading: Icon(Icons.photo_library),
-                leading: Icon(Icons.photo_library),
+              title: Text('Galerie'),
-                title: Text('Galerie'),
+              onTap: () {
-                onTap: () {
+                Navigator.pop(sheetContext);
-                  Navigator.pop(sheetContext);
+                _pickImageFromGallery(context, userBloc);
-                  _pickImageFromGallery(context, userBloc);
+              },
-                },
+            ),
-              ),
+            ListTile(
-              ListTile(
+              leading: Icon(Icons.camera_alt),
-                leading: Icon(Icons.camera_alt),
+              title: Text('Caméra'),
-                title: Text('Caméra'),
+              onTap: () {
-                onTap: () {
+                Navigator.pop(sheetContext);
-                  Navigator.pop(sheetContext);
+                _pickImageFromCamera(context, userBloc);
-                  _pickImageFromCamera(context, userBloc);
+              },
-                },
+            ),
-              ),
+            ListTile(
-              ListTile(
+              leading: Icon(Icons.close),
-                leading: Icon(Icons.close),
+              title: Text('Annuler'),
-                title: Text('Annuler'),
+              onTap: () => Navigator.pop(sheetContext),
-                onTap: () => Navigator.pop(sheetContext),
+            ),
-              ),
+          ],
-            ],
-          ),
         );
       },
     );
   }
 
-  Future<void> _pickImageFromGallery(BuildContext context, UserBloc userBloc) async {
+  Future<void> _pickImageFromGallery(
+    BuildContext context,
+    UserBloc userBloc,
+  ) async {
     try {
       final ImagePicker picker = ImagePicker();
       final XFile? image = await picker.pickImage(source: ImageSource.gallery);
 
-      if (image != null) {
+      if (image != null && context.mounted) {
         await _uploadProfilePicture(context, image.path, userBloc);
       }
     } catch (e) {
-      _errorService.showError(message: 'Erreur lors de la sélection de l\'image');
+      _errorService.showError(
+        message: 'Erreur lors de la sélection de l\'image',
+      );
     }
   }
 
-  Future<void> _pickImageFromCamera(BuildContext context, UserBloc userBloc) async {
+  Future<void> _pickImageFromCamera(
+    BuildContext context,
+    UserBloc userBloc,
+  ) async {
     try {
       final ImagePicker picker = ImagePicker();
       final XFile? image = await picker.pickImage(source: ImageSource.camera);
 
-      if (image != null) {
+      if (image != null && context.mounted) {
         await _uploadProfilePicture(context, image.path, userBloc);
       }
     } catch (e) {
@@ -572,7 +590,11 @@ class ProfileContent extends StatelessWidget {
     }
   }
 
-  Future<void> _uploadProfilePicture(BuildContext context, String imagePath, UserBloc userBloc) async {
+  Future<void> _uploadProfilePicture(
+    BuildContext context,
+    String imagePath,
+    UserBloc userBloc,
+  ) async {
     try {
       final File imageFile = File(imagePath);
 
@@ -582,7 +604,9 @@ class ProfileContent extends StatelessWidget {
         return;
       }
 
-      print('DEBUG: Taille du fichier: ${imageFile.lengthSync()} bytes');
+      LoggerService.info(
+        'DEBUG: Taille du fichier: ${imageFile.lengthSync()} bytes',
+      );
 
       final userState = userBloc.state;
       if (userState is! user_state.UserLoaded) {
@@ -593,14 +617,15 @@ class ProfileContent extends StatelessWidget {
       final user = userState.user;
 
       // Créer un nom unique pour la photo
-      final String fileName = 'profile_${user.id}_${DateTime.now().millisecondsSinceEpoch}.jpg';
+      final String fileName =
+          'profile_${user.id}_${DateTime.now().millisecondsSinceEpoch}.jpg';
       final Reference storageRef = FirebaseStorage.instance
           .ref()
           .child('profile_pictures')
           .child(fileName);
 
-      print('DEBUG: Chemin Storage: ${storageRef.fullPath}');
+      LoggerService.info('DEBUG: Chemin Storage: ${storageRef.fullPath}');
-      print('DEBUG: Upload en cours pour $fileName');
+      LoggerService.info('DEBUG: Upload en cours pour $fileName');
 
       // Uploader l'image avec gestion d'erreur détaillée
       try {
@@ -608,13 +633,17 @@ class ProfileContent extends StatelessWidget {
 
         // Écouter la progression
         uploadTask.snapshotEvents.listen((TaskSnapshot snapshot) {
-          print('DEBUG: Progression: ${snapshot.bytesTransferred}/${snapshot.totalBytes}');
+          LoggerService.info(
+            'DEBUG: Progression: ${snapshot.bytesTransferred}/${snapshot.totalBytes}',
+          );
         });
 
         final snapshot = await uploadTask;
-        print('DEBUG: Upload terminé. État: ${snapshot.state}');
+        LoggerService.info('DEBUG: Upload terminé. État: ${snapshot.state}');
       } on FirebaseException catch (e) {
-        print('DEBUG: FirebaseException lors de l\'upload: ${e.code} - ${e.message}');
+        LoggerService.error(
+          'DEBUG: FirebaseException lors de l\'upload: ${e.code} - ${e.message}',
+        );
         if (context.mounted) {
           _errorService.showError(
             message: 'Erreur Firebase: ${e.code}\n${e.message}',
@@ -623,36 +652,30 @@ class ProfileContent extends StatelessWidget {
         return;
       }
 
-      print('DEBUG: Upload terminé, récupération de l\'URL');
+      LoggerService.info('DEBUG: Upload terminé, récupération de l\'URL');
 
       // Récupérer l'URL
       final String downloadUrl = await storageRef.getDownloadURL();
 
-      print('DEBUG: URL obtenue: $downloadUrl');
+      LoggerService.info('DEBUG: URL obtenue: $downloadUrl');
 
       // Mettre à jour le profil avec l'URL en utilisant la référence sauvegardée du BLoC
-      print('DEBUG: Envoi de UserUpdated event au BLoC');
+      LoggerService.info('DEBUG: Envoi de UserUpdated event au BLoC');
-      userBloc.add(
+      userBloc.add(user_event.UserUpdated({'profilePictureUrl': downloadUrl}));
-        user_event.UserUpdated({
-          'profilePictureUrl': downloadUrl,
-        }),
-      );
 
       // Attendre un peu que Firestore se mette à jour
       await Future.delayed(Duration(milliseconds: 500));
 
       if (context.mounted) {
-        print('DEBUG: Affichage du succès');
+        LoggerService.info('DEBUG: Affichage du succès');
-        ScaffoldMessenger.of(context).showSnackBar(
+        _errorService.showSnackbar(
-          SnackBar(
+          message: 'Photo de profil mise à jour !',
-            content: Text('Photo de profil mise à jour !'),
+          isError: false,
-            backgroundColor: Colors.green,
-          ),
         );
       }
     } catch (e, stackTrace) {
-      print('DEBUG: Erreur lors de l\'upload: $e');
+      LoggerService.error('DEBUG: Erreur lors de l\'upload: $e');
-      print('DEBUG: Stack trace: $stackTrace');
+      LoggerService.error('DEBUG: Stack trace: $stackTrace');
       _errorService.logError(
         'ProfileContent - _uploadProfilePicture',
         'Erreur lors de l\'upload de la photo: $e\n$stackTrace',
@@ -711,22 +734,16 @@ class ProfileContent extends StatelessWidget {
                 if (currentPasswordController.text.isEmpty ||
                     newPasswordController.text.isEmpty ||
                     confirmPasswordController.text.isEmpty) {
-                  ScaffoldMessenger.of(context).showSnackBar(
+                  _errorService.showError(
-                    SnackBar(
+                    message: 'Tous les champs sont requis',
-                      content: Text('Tous les champs sont requis'),
-                      backgroundColor: Colors.red,
-                    ),
                   );
                   return;
                 }
 
                 if (newPasswordController.text !=
                     confirmPasswordController.text) {
-                  ScaffoldMessenger.of(context).showSnackBar(
+                  _errorService.showError(
-                    SnackBar(
+                    message: 'Les mots de passe ne correspondent pas',
-                      content: Text('Les mots de passe ne correspondent pas'),
-                      backgroundColor: Colors.red,
-                    ),
                   );
                   return;
                 }
@@ -738,13 +755,13 @@ class ProfileContent extends StatelessWidget {
                     email: user.email,
                   );
 
-                  Navigator.of(dialogContext).pop();
+                  if (context.mounted) {
-                  ScaffoldMessenger.of(context).showSnackBar(
+                    Navigator.of(dialogContext).pop();
-                    SnackBar(
+                    _errorService.showSnackbar(
-                      content: Text('Mot de passe changé !'),
+                      message: 'Mot de passe changé !',
-                      backgroundColor: Colors.green,
+                      isError: false,
-                    ),
+                    );
-                  );
+                  }
                 } catch (e) {
                   _errorService.showError(
                     message: 'Erreur: Mot de passe actuel incorrect',
@@ -763,7 +780,7 @@ class ProfileContent extends StatelessWidget {
     BuildContext context,
     user_state.UserModel user,
   ) {
-    final passwordController = TextEditingController();
+    final confirmationController = TextEditingController();
     final authService = AuthService();
 
     showDialog(
@@ -775,15 +792,15 @@ class ProfileContent extends StatelessWidget {
             mainAxisSize: MainAxisSize.min,
             children: [
               Text(
-                'Êtes-vous sûr de vouloir supprimer votre compte ? Cette action est irréversible.',
+                'Êtes-vous sûr de vouloir supprimer votre compte ? Cette action est irréversible.\n\nPour confirmer, veuillez écrire "CONFIRMER" ci-dessous.',
               ),
               SizedBox(height: 16),
               TextField(
-                controller: passwordController,
+                controller: confirmationController,
-                obscureText: true,
                 decoration: InputDecoration(
-                  labelText: 'Confirmez votre mot de passe',
+                  labelText: 'Écrivez CONFIRMER',
                   border: OutlineInputBorder(),
+                  hintText: 'CONFIRMER',
                 ),
               ),
             ],
@@ -795,23 +812,48 @@ class ProfileContent extends StatelessWidget {
             ),
             TextButton(
               onPressed: () async {
-                try {
+                if (confirmationController.text != 'CONFIRMER') {
-                  await authService.deleteAccount(
-                    password: passwordController.text,
-                    email: user.email,
-                  );
-
-                  Navigator.of(dialogContext).pop();
-                  context.read<UserBloc>().add(user_event.UserLoggedOut());
-                  Navigator.pushNamedAndRemoveUntil(
-                    context,
-                    '/login',
-                    (route) => false,
-                  );
-                } catch (e) {
                   _errorService.showError(
-                    message: 'Erreur: Mot de passe incorrect',
+                    message: 'Veuillez écrire CONFIRMER pour valider',
                   );
+                  return;
+                }
+
+                try {
+                  await authService.deleteAccount();
+
+                  if (context.mounted) {
+                    Navigator.of(dialogContext).pop();
+                    context.read<UserBloc>().add(user_event.UserLoggedOut());
+                    Navigator.pushNamedAndRemoveUntil(
+                      context,
+                      '/login',
+                      (route) => false,
+                    );
+                  }
+                } on FirebaseAuthException catch (e) {
+                  if (e.code == 'requires-recent-login') {
+                    if (context.mounted) {
+                      Navigator.of(dialogContext).pop();
+                      _errorService.showSnackbar(
+                        message:
+                            'Par sécurité, veuillez vous reconnecter avant de supprimer votre compte',
+                        isError: true, // It's a warning/error
+                      );
+                    }
+                  } else {
+                    if (context.mounted) {
+                      _errorService.showError(
+                        message: 'Erreur lors de la suppression: ${e.message}',
+                      );
+                    }
+                  }
+                } catch (e) {
+                  if (context.mounted) {
+                    _errorService.showError(
+                      message: 'Erreur inattendue: ${e.toString()}',
+                    );
+                  }
                 }
               },
               style: TextButton.styleFrom(foregroundColor: Colors.red),

lib/components/settings/settings_content.dart

@@ -3,9 +3,33 @@ import 'package:travel_mate/components/settings/policies/policies_content.dart';
 import 'theme/settings_theme_content.dart';
 import 'profile/profile_content.dart';
 
-class SettingsContent extends StatelessWidget {
+import 'package:package_info_plus/package_info_plus.dart';
+
+class SettingsContent extends StatefulWidget {
   const SettingsContent({super.key});
 
+  @override
+  State<SettingsContent> createState() => _SettingsContentState();
+}
+
+class _SettingsContentState extends State<SettingsContent> {
+  String _version = '...';
+
+  @override
+  void initState() {
+    super.initState();
+    _loadVersion();
+  }
+
+  Future<void> _loadVersion() async {
+    final packageInfo = await PackageInfo.fromPlatform();
+    if (mounted) {
+      setState(() {
+        _version = packageInfo.version;
+      });
+    }
+  }
+
   Future<void> changePage(BuildContext context, Widget page) async {
     Navigator.push(context, MaterialPageRoute(builder: (context) => page));
   }
@@ -46,20 +70,6 @@ class SettingsContent extends StatelessWidget {
           },
         ),
 
-        ListTile(
-          leading: const Icon(Icons.notifications),
-          title: const Text('Notifications'),
-          trailing: const Icon(Icons.arrow_forward_ios),
-          onTap: () {},
-        ),
-
-        ListTile(
-          leading: const Icon(Icons.language),
-          title: const Text('Langue'),
-          trailing: const Icon(Icons.arrow_forward_ios),
-          onTap: () {},
-        ),
-
         ListTile(
           leading: const Icon(Icons.privacy_tip),
           title: const Text('Confidentialité'),
@@ -84,7 +94,7 @@ class SettingsContent extends StatelessWidget {
               ),
               const SizedBox(height: 4),
               Text(
-                '1.0.0',
+                _version,
                 style: TextStyle(fontSize: 14, color: Colors.grey[500]),
               ),
             ],

lib/components/signup/password_requirements.dart

@@ -0,0 +1,57 @@
+import 'package:flutter/material.dart';
+
+class PasswordRequirements extends StatelessWidget {
+  final String password;
+
+  const PasswordRequirements({super.key, required this.password});
+
+  bool get _hasMinLength => password.length >= 8;
+  bool get _hasUppercase => password.contains(RegExp(r'[A-Z]'));
+  bool get _hasLowercase => password.contains(RegExp(r'[a-z]'));
+  bool get _hasDigit => password.contains(RegExp(r'[0-9]'));
+  bool get _hasSpecialChar =>
+      password.contains(RegExp(r'[!@#\$%^&*(),.?":{}|<>]'));
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        const SizedBox(height: 10),
+        const Text(
+          'Votre mot de passe doit contenir :',
+          style: TextStyle(fontSize: 14, fontWeight: FontWeight.bold),
+        ),
+        const SizedBox(height: 8),
+        _buildRequirement(_hasMinLength, 'Au moins 8 caractères'),
+        _buildRequirement(_hasUppercase, 'Une majuscule'),
+        _buildRequirement(_hasLowercase, 'Une minuscule'),
+        _buildRequirement(_hasDigit, 'Un chiffre'),
+        _buildRequirement(_hasSpecialChar, 'Un caractère spécial'),
+      ],
+    );
+  }
+
+  Widget _buildRequirement(bool isMet, String text) {
+    return Padding(
+      padding: const EdgeInsets.symmetric(vertical: 2.0),
+      child: Row(
+        children: [
+          Icon(
+            isMet ? Icons.check_circle : Icons.circle_outlined,
+            color: isMet ? Colors.green : Colors.grey,
+            size: 16,
+          ),
+          const SizedBox(width: 8),
+          Text(
+            text,
+            style: TextStyle(
+              color: isMet ? Colors.green : Colors.grey,
+              fontSize: 12,
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/components/whats_new_dialog.dart

@@ -0,0 +1,140 @@
+import 'package:flutter/material.dart';
+import '../../services/whats_new_service.dart';
+
+class WhatsNewDialog extends StatelessWidget {
+  final VoidCallback onDismiss;
+  final List<WhatsNewItem> features;
+
+  const WhatsNewDialog({
+    super.key,
+    required this.onDismiss,
+    required this.features,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    final theme = Theme.of(context);
+
+    return Dialog(
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(20)),
+      backgroundColor: theme.colorScheme.surface,
+      child: Padding(
+        padding: const EdgeInsets.all(24.0),
+        child: Column(
+          mainAxisSize: MainAxisSize.min,
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            // Header
+            Row(
+              children: [
+                Container(
+                  padding: const EdgeInsets.all(8),
+                  decoration: BoxDecoration(
+                    color: theme.colorScheme.primaryContainer,
+                    shape: BoxShape.circle,
+                  ),
+                  child: Icon(
+                    Icons.auto_awesome,
+                    color: theme.colorScheme.primary,
+                    size: 24,
+                  ),
+                ),
+                const SizedBox(width: 16),
+                Expanded(
+                  child: Text(
+                    'Quoi de neuf ?',
+                    style: theme.textTheme.headlineSmall?.copyWith(
+                      fontWeight: FontWeight.bold,
+                    ),
+                  ),
+                ),
+              ],
+            ),
+            const SizedBox(height: 24),
+
+            // Features List
+            Flexible(
+              child: ListView.separated(
+                shrinkWrap: true,
+                itemCount: features.length,
+                separatorBuilder: (_, __) => const SizedBox(height: 16),
+                itemBuilder: (context, index) {
+                  final feature = features[index];
+                  return Row(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      Icon(
+                        feature.icon,
+                        color: theme.colorScheme.primary,
+                        size: 20,
+                      ),
+                      const SizedBox(width: 12),
+                      Expanded(
+                        child: Column(
+                          crossAxisAlignment: CrossAxisAlignment.start,
+                          children: [
+                            Text(
+                              feature.title,
+                              style: theme.textTheme.titleMedium?.copyWith(
+                                fontWeight: FontWeight.w600,
+                              ),
+                            ),
+                            const SizedBox(height: 4),
+                            Text(
+                              feature.description,
+                              style: theme.textTheme.bodyMedium?.copyWith(
+                                color: theme.colorScheme.onSurfaceVariant,
+                              ),
+                            ),
+                          ],
+                        ),
+                      ),
+                    ],
+                  );
+                },
+              ),
+            ),
+
+            const SizedBox(height: 32),
+
+            // Button
+            SizedBox(
+              width: double.infinity,
+              height: 50,
+              child: ElevatedButton(
+                onPressed: () {
+                  // Marquer comme vu via le service
+                  WhatsNewService().markCurrentVersionAsSeen();
+                  onDismiss();
+                },
+                style: ElevatedButton.styleFrom(
+                  backgroundColor: theme.colorScheme.primary,
+                  foregroundColor: theme.colorScheme.onPrimary,
+                  shape: RoundedRectangleBorder(
+                    borderRadius: BorderRadius.circular(12),
+                  ),
+                ),
+                child: const Text(
+                  'C\'est parti !',
+                  style: TextStyle(fontSize: 16, fontWeight: FontWeight.bold),
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+}
+
+class WhatsNewItem {
+  final IconData icon;
+  final String title;
+  final String description;
+
+  const WhatsNewItem({
+    required this.icon,
+    required this.title,
+    required this.description,
+  });
+}

lib/firebase_options.dart

@@ -27,18 +27,6 @@ class DefaultFirebaseOptions {
         return android;
       case TargetPlatform.iOS:
         return ios;
-      case TargetPlatform.macOS:
-        throw UnsupportedError(
-          'DefaultFirebaseOptions have not been configured for macos - '
-          'you can reconfigure this by running the FlutterFire CLI again.',
-        );
-      case TargetPlatform.windows:
-        return windows;
-      case TargetPlatform.linux:
-        throw UnsupportedError(
-          'DefaultFirebaseOptions have not been configured for linux - '
-          'you can reconfigure this by running the FlutterFire CLI again.',
-        );
       default:
         throw UnsupportedError(
           'DefaultFirebaseOptions are not supported for this platform.',
@@ -63,15 +51,4 @@ class DefaultFirebaseOptions {
     iosClientId: '521527250907-3i1qe2656eojs8k9hjdi573j09i9p41m.apps.googleusercontent.com',
     iosBundleId: 'com.example.travelMate',
   );
-
-  static const FirebaseOptions windows = FirebaseOptions(
-    apiKey: 'AIzaSyC4t-WOvp22zns9b9t58urznsNAhSHRAag',
-    appId: '1:521527250907:web:53ff98bcdb8c218f7da1fe',
-    messagingSenderId: '521527250907',
-    projectId: 'travelmate-a47f5',
-    authDomain: 'travelmate-a47f5.firebaseapp.com',
-    storageBucket: 'travelmate-a47f5.firebasestorage.app',
-    measurementId: 'G-J246Y7J61M',
-  );
-
 }

lib/main.dart

@@ -1,8 +1,11 @@
 import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:firebase_core/firebase_core.dart';
 import 'package:travel_mate/blocs/balance/balance_bloc.dart';
 import 'package:travel_mate/blocs/expense/expense_bloc.dart';
+import 'package:google_maps_flutter_android/google_maps_flutter_android.dart';
+import 'package:google_maps_flutter_platform_interface/google_maps_flutter_platform_interface.dart';
 import 'package:travel_mate/blocs/message/message_bloc.dart';
 import 'package:travel_mate/blocs/activity/activity_bloc.dart';
 import 'package:travel_mate/firebase_options.dart';
@@ -11,6 +14,10 @@ import 'package:travel_mate/services/error_service.dart';
 import 'package:travel_mate/services/activity_places_service.dart';
 import 'package:flutter_dotenv/flutter_dotenv.dart';
 import 'package:travel_mate/services/expense_service.dart';
+import 'package:firebase_messaging/firebase_messaging.dart';
+import 'package:travel_mate/services/notification_service.dart';
+import 'package:travel_mate/services/map_navigation_service.dart';
+import 'package:travel_mate/services/analytics_service.dart';
 import 'blocs/auth/auth_bloc.dart';
 import 'blocs/auth/auth_event.dart';
 import 'blocs/theme/theme_bloc.dart';
@@ -34,14 +41,33 @@ import 'pages/home.dart';
 import 'pages/signup.dart';
 import 'pages/resetpswd.dart';
 
+import 'package:intl/date_symbol_data_local.dart';
+
 /// Entry point of the Travel Mate application.
 ///
 /// This function initializes Flutter widgets, loads environment variables,
 /// initializes Firebase, and starts the application.
 void main() async {
   WidgetsFlutterBinding.ensureInitialized();
+  await SystemChrome.setPreferredOrientations([
+    DeviceOrientation.portraitUp,
+    DeviceOrientation.portraitDown,
+  ]);
   await dotenv.load(fileName: ".env");
   await Firebase.initializeApp(options: DefaultFirebaseOptions.currentPlatform);
+  await initializeDateFormatting('fr_FR', null);
+
+  // Set the background messaging handler early on, as a named top-level function
+  FirebaseMessaging.onBackgroundMessage(firebaseMessagingBackgroundHandler);
+
+  await NotificationService().initialize();
+
+  // Requirements for Google Maps on Android (Hybrid Composition)
+  final GoogleMapsFlutterPlatform mapsImplementation =
+      GoogleMapsFlutterPlatform.instance;
+  if (mapsImplementation is GoogleMapsFlutterAndroid) {
+    mapsImplementation.useAndroidViewSurface = true;
+  }
 
   runApp(const MyApp());
 }
@@ -117,6 +143,14 @@ class MyApp extends StatelessWidget {
             expenseRepository: context.read<ExpenseRepository>(),
           ),
         ),
+        // Map navigation service
+        RepositoryProvider<MapNavigationService>(
+          create: (context) => MapNavigationService(),
+        ),
+        // Analysis service
+        RepositoryProvider<AnalyticsService>(
+          create: (context) => AnalyticsService(),
+        ),
       ],
       child: MultiBlocProvider(
         providers: [
@@ -177,6 +211,9 @@ class MyApp extends StatelessWidget {
               title: 'Travel Mate',
               navigatorKey: ErrorService.navigatorKey,
               themeMode: themeState.themeMode,
+              navigatorObservers: [
+                context.read<AnalyticsService>().getAnalyticsObserver(),
+              ],
               // Light theme configuration
               theme: ThemeData(
                 colorScheme: ColorScheme.fromSeed(

lib/models/activity.dart

@@ -20,6 +20,8 @@ class Activity {
   final Map<String, int> votes; // userId -> vote (1 pour pour, -1 pour contre)
   final DateTime createdAt;
   final DateTime updatedAt;
+  final DateTime? date; // Date prévue pour l'activité
+  final String? createdBy; // ID de l'utilisateur qui a créé l'activité
 
   Activity({
     required this.id,
@@ -40,11 +42,13 @@ class Activity {
     this.votes = const {},
     required this.createdAt,
     required this.updatedAt,
+    this.date,
+    this.createdBy,
   });
 
   /// Calcule le score total des votes
   int get totalVotes {
-    return votes.values.fold(0, (sum, vote) => sum + vote);
+    return votes.values.fold(0, (total, vote) => total + vote);
   }
 
   /// Calcule le nombre de votes positifs
@@ -104,6 +108,9 @@ class Activity {
     Map<String, int>? votes,
     DateTime? createdAt,
     DateTime? updatedAt,
+    DateTime? date,
+    bool clearDate = false,
+    String? createdBy,
   }) {
     return Activity(
       id: id ?? this.id,
@@ -124,6 +131,8 @@ class Activity {
       votes: votes ?? this.votes,
       createdAt: createdAt ?? this.createdAt,
       updatedAt: updatedAt ?? this.updatedAt,
+      date: clearDate ? null : (date ?? this.date),
+      createdBy: createdBy ?? this.createdBy,
     );
   }
 
@@ -148,6 +157,8 @@ class Activity {
       'votes': votes,
       'createdAt': Timestamp.fromDate(createdAt),
       'updatedAt': Timestamp.fromDate(updatedAt),
+      'date': date != null ? Timestamp.fromDate(date!) : null,
+      'createdBy': createdBy,
     };
   }
 
@@ -172,6 +183,8 @@ class Activity {
       votes: Map<String, int>.from(map['votes'] ?? {}),
       createdAt: (map['createdAt'] as Timestamp).toDate(),
       updatedAt: (map['updatedAt'] as Timestamp).toDate(),
+      date: map['date'] != null ? (map['date'] as Timestamp).toDate() : null,
+      createdBy: map['createdBy'],
     );
   }
 

lib/models/expense.dart

@@ -9,8 +9,10 @@ import 'expense_split.dart';
 enum ExpenseCurrency {
   /// Euro currency
   eur('€', 'EUR'),
+
   /// US Dollar currency
   usd('\$', 'USD'),
+
   /// British Pound currency
   gbp('£', 'GBP');
 
@@ -29,16 +31,24 @@ enum ExpenseCurrency {
 enum ExpenseCategory {
   /// Restaurant and food expenses
   restaurant('Restaurant', Icons.restaurant),
+
   /// Transportation expenses
   transport('Transport', Icons.directions_car),
+
   /// Accommodation and lodging expenses
   accommodation('Accommodation', Icons.hotel),
+
   /// Entertainment and activity expenses
   entertainment('Entertainment', Icons.local_activity),
+
   /// Shopping expenses
   shopping('Shopping', Icons.shopping_bag),
+
   /// Other miscellaneous expenses
-  other('Other', Icons.category);
+  other('Other', Icons.category),
+
+  /// Reimbursement for settling debts
+  reimbursement('Remboursement', Icons.monetization_on);
 
   const ExpenseCategory(this.displayName, this.icon);
 
@@ -144,13 +154,17 @@ class Expense extends Equatable {
       paidByName: map['paidByName'] ?? '',
       date: _parseDateTime(map['date']),
       createdAt: _parseDateTime(map['createdAt']),
-      editedAt: map['editedAt'] != null ? _parseDateTime(map['editedAt']) : null,
+      editedAt: map['editedAt'] != null
+          ? _parseDateTime(map['editedAt'])
+          : null,
       isEdited: map['isEdited'] ?? false,
       isArchived: map['isArchived'] ?? false,
       receiptUrl: map['receiptUrl'],
-      splits: (map['splits'] as List?)
+      splits:
-          ?.map((s) => ExpenseSplit.fromMap(s))
+          (map['splits'] as List?)
-          .toList() ?? [],
+              ?.map((s) => ExpenseSplit.fromMap(s))
+              .toList() ??
+          [],
     );
   }
 
@@ -243,25 +257,36 @@ class Expense extends Equatable {
 
   // Marquer comme archivé
   Expense copyWithArchived() {
-    return copyWith(
+    return copyWith(isArchived: true);
-      isArchived: true,
-    );
   }
 
   // Ajouter/mettre à jour l'URL du reçu
   Expense copyWithReceipt(String receiptUrl) {
-    return copyWith(
+    return copyWith(receiptUrl: receiptUrl);
-      receiptUrl: receiptUrl,
-    );
   }
 
   // Mettre à jour les splits
   Expense copyWithSplits(List<ExpenseSplit> newSplits) {
-    return copyWith(
+    return copyWith(splits: newSplits);
-      splits: newSplits,
-    );
   }
 
   @override
-  List<Object?> get props => [id];
+  List<Object?> get props => [
+    id,
+    groupId,
+    description,
+    amount,
+    currency,
+    amountInEur,
+    category,
+    paidById,
+    paidByName,
+    date,
+    createdAt,
+    editedAt,
+    isEdited,
+    isArchived,
+    receiptUrl,
+    splits,
+  ];
 }

lib/models/group.dart

@@ -27,6 +27,9 @@ class Group {
   /// List of members in this group
   final List<GroupMember> members;
 
+  /// List of member IDs for efficient querying and security rules
+  final List<String> memberIds;
+
   /// Creates a new [Group] instance.
   ///
   /// [id], [name], [tripId], and [createdBy] are required.
@@ -40,9 +43,11 @@ class Group {
     DateTime? createdAt,
     DateTime? updatedAt,
     List<GroupMember>? members,
-  })  : createdAt = createdAt ?? DateTime.now(),
+    List<String>? memberIds,
-        updatedAt = updatedAt ?? DateTime.now(),
+  }) : createdAt = createdAt ?? DateTime.now(),
-        members = members ?? [];
+       updatedAt = updatedAt ?? DateTime.now(),
+       members = members ?? [],
+       memberIds = memberIds ?? [];
 
   /// Creates a [Group] instance from a Firestore document map.
   ///
@@ -59,6 +64,7 @@ class Group {
       createdAt: DateTime.fromMillisecondsSinceEpoch(map['createdAt'] ?? 0),
       updatedAt: DateTime.fromMillisecondsSinceEpoch(map['updatedAt'] ?? 0),
       members: [],
+      memberIds: List<String>.from(map['memberIds'] ?? []),
     );
   }
 
@@ -69,6 +75,7 @@ class Group {
       'createdBy': createdBy,
       'createdAt': createdAt.millisecondsSinceEpoch,
       'updatedAt': updatedAt.millisecondsSinceEpoch,
+      'memberIds': memberIds,
     };
   }
 
@@ -80,6 +87,7 @@ class Group {
     DateTime? createdAt,
     DateTime? updatedAt,
     List<GroupMember>? members,
+    List<String>? memberIds,
   }) {
     return Group(
       id: id ?? this.id,
@@ -89,6 +97,7 @@ class Group {
       createdAt: createdAt ?? this.createdAt,
       updatedAt: updatedAt ?? this.updatedAt,
       members: members ?? this.members,
+      memberIds: memberIds ?? this.memberIds,
     );
   }
 }

lib/models/group_balance.dart

@@ -22,12 +22,22 @@ class GroupBalance extends Equatable {
   factory GroupBalance.fromMap(Map<String, dynamic> map) {
     return GroupBalance(
       groupId: map['groupId'] ?? '',
-      userBalances: (map['userBalances'] as List?)
+      userBalances:
-          ?.map((userBalance) => UserBalance.fromMap(userBalance as Map<String, dynamic>))
+          (map['userBalances'] as List?)
-          .toList() ?? [],
+              ?.map(
-      settlements: (map['settlements'] as List?)
+                (userBalance) =>
-          ?.map((settlement) => Settlement.fromMap(settlement as Map<String, dynamic>))
+                    UserBalance.fromMap(userBalance as Map<String, dynamic>),
-          .toList() ?? [],
+              )
+              .toList() ??
+          [],
+      settlements:
+          (map['settlements'] as List?)
+              ?.map(
+                (settlement) =>
+                    Settlement.fromMap(settlement as Map<String, dynamic>),
+              )
+              .toList() ??
+          [],
       totalExpenses: (map['totalExpenses'] as num?)?.toDouble() ?? 0.0,
       calculatedAt: _parseDateTime(map['calculatedAt']),
     );
@@ -37,8 +47,12 @@ class GroupBalance extends Equatable {
   Map<String, dynamic> toMap() {
     return {
       'groupId': groupId,
-      'userBalances': userBalances.map((userBalance) => userBalance.toMap()).toList(),
+      'userBalances': userBalances
-      'settlements': settlements.map((settlement) => settlement.toMap()).toList(),
+          .map((userBalance) => userBalance.toMap())
+          .toList(),
+      'settlements': settlements
+          .map((settlement) => settlement.toMap())
+          .toList(),
       'totalExpenses': totalExpenses,
       'calculatedAt': Timestamp.fromDate(calculatedAt),
     };
@@ -71,15 +85,19 @@ class GroupBalance extends Equatable {
   }
 
   // Méthodes utilitaires pour la logique métier
-  bool get hasUnbalancedUsers => userBalances.any((balance) => !balance.isBalanced);
+  bool get hasUnbalancedUsers =>
+      userBalances.any((balance) => !balance.isBalanced);
 
   bool get hasSettlements => settlements.isNotEmpty;
 
-  double get totalSettlementAmount => settlements.fold(0.0, (sum, settlement) => sum + settlement.amount);
+  double get totalSettlementAmount =>
+      settlements.fold(0.0, (total, settlement) => total + settlement.amount);
 
-  List<UserBalance> get creditors => userBalances.where((b) => b.shouldReceive).toList();
+  List<UserBalance> get creditors =>
+      userBalances.where((b) => b.shouldReceive).toList();
 
-  List<UserBalance> get debtors => userBalances.where((b) => b.shouldPay).toList();
+  List<UserBalance> get debtors =>
+      userBalances.where((b) => b.shouldPay).toList();
 
   int get participantCount => userBalances.length;
 

lib/models/group_member.dart

@@ -1,6 +1,7 @@
 class GroupMember {
   final String userId;
   final String firstName;
+  final String lastName;
   final String pseudo; // Pseudo du membre (par défaut = prénom)
   final String role; // 'admin' ou 'member'
   final DateTime joinedAt;
@@ -9,17 +10,20 @@ class GroupMember {
   GroupMember({
     required this.userId,
     required this.firstName,
+    String? lastName,
     String? pseudo,
     this.role = 'member',
     DateTime? joinedAt,
     this.profilePictureUrl,
-  })  : pseudo = pseudo ?? firstName, // Par défaut, pseudo = prénom
+  })  : lastName = lastName ?? '',
+        pseudo = pseudo ?? firstName,
         joinedAt = joinedAt ?? DateTime.now();
 
   factory GroupMember.fromMap(Map<String, dynamic> map, String userId) {
     return GroupMember(
       userId: userId,
       firstName: map['firstName'] ?? '',
+      lastName: map['lastName'] ?? '',
       pseudo: map['pseudo'] ?? map['firstName'] ?? '',
       role: map['role'] ?? 'member',
       joinedAt: DateTime.fromMillisecondsSinceEpoch(map['joinedAt'] ?? 0),
@@ -30,6 +34,7 @@ class GroupMember {
   Map<String, dynamic> toMap() {
     return {
       'firstName': firstName,
+      'lastName': lastName,
       'pseudo': pseudo,
       'role': role,
       'joinedAt': joinedAt.millisecondsSinceEpoch,
@@ -40,6 +45,7 @@ class GroupMember {
   GroupMember copyWith({
     String? userId,
     String? firstName,
+    String? lastName,
     String? pseudo,
     String? role,
     DateTime? joinedAt,
@@ -48,6 +54,7 @@ class GroupMember {
     return GroupMember(
       userId: userId ?? this.userId,
       firstName: firstName ?? this.firstName,
+      lastName: lastName ?? this.lastName,
       pseudo: pseudo ?? this.pseudo,
       role: role ?? this.role,
       joinedAt: joinedAt ?? this.joinedAt,

lib/models/message.dart

@@ -10,6 +10,7 @@ class Message {
   final Map<String, String> reactions; // userId -> emoji
   final DateTime? editedAt;
   final bool isEdited;
+  final bool isDeleted;
 
   Message({
     this.id = '',
@@ -21,6 +22,7 @@ class Message {
     this.reactions = const {},
     this.editedAt,
     this.isEdited = false,
+    this.isDeleted = false,
   });
 
   factory Message.fromFirestore(DocumentSnapshot doc) {
@@ -39,6 +41,7 @@ class Message {
       reactions: reactionsData?.map((key, value) => MapEntry(key, value.toString())) ?? {},
       editedAt: editedAtTimestamp?.toDate(),
       isEdited: data['isEdited'] ?? false,
+      isDeleted: data['isDeleted'] ?? false,
     );
   }
 
@@ -52,6 +55,7 @@ class Message {
       'reactions': reactions,
       'editedAt': editedAt != null ? Timestamp.fromDate(editedAt!) : null,
       'isEdited': isEdited,
+      'isDeleted': isDeleted,
     };
   }
 
@@ -65,6 +69,7 @@ class Message {
     Map<String, String>? reactions,
     DateTime? editedAt,
     bool? isEdited,
+    bool? isDeleted,
   }) {
     return Message(
       id: id ?? this.id,
@@ -76,6 +81,7 @@ class Message {
       reactions: reactions ?? this.reactions,
       editedAt: editedAt ?? this.editedAt,
       isEdited: isEdited ?? this.isEdited,
+      isDeleted: isDeleted ?? this.isDeleted,
     );
   }
 }

lib/pages/home.dart

@@ -11,6 +11,11 @@ import '../blocs/user/user_bloc.dart';
 import '../blocs/user/user_event.dart';
 import '../blocs/auth/auth_bloc.dart';
 import '../blocs/auth/auth_event.dart';
+import '../services/error_service.dart';
+import '../services/notification_service.dart';
+import '../services/map_navigation_service.dart';
+import '../services/whats_new_service.dart';
+import '../components/whats_new_dialog.dart';
 
 class HomePage extends StatefulWidget {
   const HomePage({super.key});
@@ -36,6 +41,63 @@ class _HomePageState extends State<HomePage> {
     super.initState();
     // Initialiser les données utilisateur
     context.read<UserBloc>().add(UserInitialized());
+
+    // Setup notifications listener and check for initial message
+    final notificationService = NotificationService();
+    notificationService.startListening();
+
+    // Check for initial message after a slight delay to ensure the widget tree is fully built
+    WidgetsBinding.instance.addPostFrameCallback((_) {
+      notificationService.handleInitialMessage();
+    });
+
+    // Écouter les demandes de navigation vers la carte
+    context.read<MapNavigationService>().requestStream.listen((request) {
+      if (_currentIndex != 2) {
+        setState(() {
+          _currentIndex = 2;
+        });
+      }
+    });
+
+    // Vérifier les nouveautés
+    WidgetsBinding.instance.addPostFrameCallback((_) async {
+      await _checkAndShowWhatsNew();
+    });
+  }
+
+  Future<void> _checkAndShowWhatsNew() async {
+    final service = WhatsNewService();
+    if (await service.shouldShowWhatsNew()) {
+      if (!mounted) return;
+      showDialog(
+        context: context,
+        barrierDismissible: false,
+        builder: (context) => WhatsNewDialog(
+          onDismiss: () => Navigator.pop(context),
+          features: const [
+            WhatsNewItem(
+              icon: Icons.map_outlined,
+              title: 'Recherche globale',
+              description:
+                  'Recherchez des restaurants, musées et plus encore directement depuis la carte.',
+            ),
+            WhatsNewItem(
+              icon: Icons.search,
+              title: 'Autocomplétion améliorée',
+              description:
+                  'Découvrez des suggestions intelligentes lors de la recherche de lieux et d\'activités.',
+            ),
+            WhatsNewItem(
+              icon: Icons.warning_amber_rounded,
+              title: 'Alertes de distance',
+              description:
+                  'Soyez averti si une activité est trop éloignée de votre lieu de séjour.',
+            ),
+          ],
+        ),
+      );
+    }
   }
 
   Widget _buildPage(int index) {
@@ -119,12 +181,7 @@ class _HomePageState extends State<HomePage> {
       );
     } catch (e) {
       if (mounted) {
-        ScaffoldMessenger.of(context).showSnackBar(
+        ErrorService().showError(message: 'Erreur lors de la déconnexion: $e');
-          SnackBar(
-            content: Text('Erreur lors de la déconnexion: $e'),
-            backgroundColor: Colors.red,
-          ),
-        );
       }
     }
   }
@@ -132,9 +189,7 @@ class _HomePageState extends State<HomePage> {
   @override
   Widget build(BuildContext context) {
     return Scaffold(
-      appBar: AppBar(
+      appBar: AppBar(title: Text(titles[_currentIndex])),
-        title: Text(titles[_currentIndex]),
-      ),
       drawer: Drawer(
         child: ListView(
           padding: EdgeInsets.zero,
@@ -142,28 +197,43 @@ class _HomePageState extends State<HomePage> {
             DrawerHeader(
               decoration: BoxDecoration(
                 color: Theme.of(context).brightness == Brightness.dark
-                  ? Colors.black 
+                    ? Colors.black
-                  : Colors.white,
+                    : Colors.white,
               ),
               child: Text(
                 "Travel Mate",
                 style: TextStyle(
                   color: Theme.of(context).brightness == Brightness.dark
-                    ? Colors.white 
+                      ? Colors.white
-                    : Colors.black, 
+                      : Colors.black,
                   fontSize: 24,
                 ),
               ),
             ),
             _buildDrawerItem(icon: Icons.home, title: "Mes voyages", index: 0),
-            _buildDrawerItem(icon: Icons.settings, title: "Paramètres", index: 1),
+            _buildDrawerItem(
+              icon: Icons.settings,
+              title: "Paramètres",
+              index: 1,
+            ),
             _buildDrawerItem(icon: Icons.map, title: "Carte", index: 2),
-            _buildDrawerItem(icon: Icons.group, title: "Chat de groupe", index: 3),
+            _buildDrawerItem(
-            _buildDrawerItem(icon: Icons.account_balance_wallet, title: "Comptes", index: 4),
+              icon: Icons.group,
+              title: "Chat de groupe",
+              index: 3,
+            ),
+            _buildDrawerItem(
+              icon: Icons.account_balance_wallet,
+              title: "Comptes",
+              index: 4,
+            ),
             const Divider(),
             ListTile(
               leading: const Icon(Icons.logout, color: Colors.red),
-              title: const Text("Déconnexion", style: TextStyle(color: Colors.red)),
+              title: const Text(
+                "Déconnexion",
+                style: TextStyle(color: Colors.red),
+              ),
               onTap: _handleLogout, // Utiliser la nouvelle méthode
             ),
           ],
@@ -191,7 +261,9 @@ class _HomePageState extends State<HomePage> {
       leading: Icon(icon),
       title: Text(title),
       selected: _currentIndex == index,
-      selectedTileColor: Theme.of(context).colorScheme.primary.withValues(alpha: 0.1),
+      selectedTileColor: Theme.of(
+        context,
+      ).colorScheme.primary.withValues(alpha: 0.1),
       onTap: () => _onNavigationTap(index),
     );
   }

lib/pages/login.dart

@@ -4,6 +4,7 @@ import '../blocs/auth/auth_bloc.dart';
 import '../blocs/auth/auth_event.dart';
 import '../blocs/auth/auth_state.dart';
 import 'package:sign_in_button/sign_in_button.dart';
+import '../services/error_service.dart';
 
 /// Login page widget for user authentication.
 ///
@@ -87,14 +88,13 @@ class _LoginPageState extends State<LoginPage> {
       body: BlocConsumer<AuthBloc, AuthState>(
         listener: (context, state) {
           if (state is AuthAuthenticated) {
-            Navigator.pushReplacementNamed(context, '/home');
+            Navigator.pushNamedAndRemoveUntil(
-          } else if (state is AuthError) {
+              context,
-            ScaffoldMessenger.of(context).showSnackBar(
+              '/home',
-              SnackBar(
+              (route) => false,
-                content: Text(state.message),
-                backgroundColor: Colors.red,
-              ),
             );
+          } else if (state is AuthError) {
+            ErrorService().showError(message: state.message);
           }
         },
         builder: (context, state) {

lib/pages/resetpswd.dart

@@ -1,8 +1,46 @@
 import 'package:flutter/material.dart';
+import 'package:flutter_bloc/flutter_bloc.dart';
+import '../blocs/auth/auth_bloc.dart';
+import '../blocs/auth/auth_event.dart';
+import '../blocs/auth/auth_state.dart';
+import '../services/error_service.dart';
 
-class ForgotPasswordPage extends StatelessWidget {
+class ForgotPasswordPage extends StatefulWidget {
   const ForgotPasswordPage({super.key});
 
+  @override
+  State<ForgotPasswordPage> createState() => _ForgotPasswordPageState();
+}
+
+class _ForgotPasswordPageState extends State<ForgotPasswordPage> {
+  final _emailController = TextEditingController();
+  final _formKey = GlobalKey<FormState>();
+
+  @override
+  void dispose() {
+    _emailController.dispose();
+    super.dispose();
+  }
+
+  String? _validateEmail(String? value) {
+    if (value == null || value.trim().isEmpty) {
+      return 'Email requis';
+    }
+    final emailRegex = RegExp(r'^[\w-\.]+@([\w-]+\.)+[\w-]{2,4}$');
+    if (!emailRegex.hasMatch(value.trim())) {
+      return 'Email invalide';
+    }
+    return null;
+  }
+
+  void _submit() {
+    if (_formKey.currentState!.validate()) {
+      context.read<AuthBloc>().add(
+        AuthPasswordResetRequested(email: _emailController.text.trim()),
+      );
+    }
+  }
+
   @override
   Widget build(BuildContext context) {
     return Scaffold(
@@ -16,87 +54,152 @@ class ForgotPasswordPage extends StatelessWidget {
         backgroundColor: Colors.transparent,
         elevation: 0,
       ),
-      body: SafeArea(
+      body: BlocListener<AuthBloc, AuthState>(
-        child: Padding(
+        listener: (context, state) {
-          padding: const EdgeInsets.all(16.0),
+          if (state is AuthPasswordResetSent) {
-          child: Center(
+            ErrorService().showSnackbar(
-            child: Column(
+              message: 'Email de réinitialisation envoyé !',
-              children: [
+              isError: false,
-                const Text(
+            );
-                  "Travel Mate",
+            Navigator.pop(context);
-                  style: TextStyle(fontSize: 24, fontWeight: FontWeight.bold),
+          } else if (state is AuthError) {
-                ),
+            ErrorService().showError(message: state.message);
-
+          }
-                const SizedBox(height: 24),
+        },
-
+        child: SafeArea(
-                const Text(
+          child: Padding(
-                  "Vous avez oublié votre mot de passe ? \n Ne vous inquiétez pas vous pouvez le réinitaliser !",
+            padding: const EdgeInsets.all(16.0),
-                  textAlign: TextAlign.center,
+            child: Center(
-                  style: TextStyle(fontSize: 14, fontWeight: FontWeight.bold),
+              child: SingleChildScrollView(
-                ),
+                child: Form(
-
+                  key: _formKey,
-                const SizedBox(height: 40),
+                  child: Column(
-
+                    children: [
-                const Text(
+                      const Text(
-                  "Quel est votre email ? \n Si celui-ci existe dans note base de donées, nous vous enverrons un mail avec un mot de passe unique.",
+                        "Travel Mate",
-                  textAlign: TextAlign.center,
-                  style: TextStyle(fontSize: 14, fontWeight: FontWeight.bold),
-                ),
-
-                const SizedBox(height: 24),
-
-                const TextField(
-                  decoration: InputDecoration(
-                    labelText: 'example@travelmate.com',
-                    border: OutlineInputBorder(
-                      borderRadius: BorderRadius.all(Radius.circular(12)),
-                    ),
-                  ),
-                ),
-
-                const SizedBox(height: 40),
-
-                ElevatedButton(
-                  onPressed: () {
-                    // Logique de connexion
-                  },
-                  style: ElevatedButton.styleFrom(
-                    minimumSize: const Size.fromHeight(50),
-                    shape: RoundedRectangleBorder(
-                      borderRadius: BorderRadius.circular(12),
-                    ),
-                  ),
-                  child: const Text('Envoyer', style: TextStyle(fontSize: 18)),
-                ),
-                const SizedBox(height: 20),
-
-                Container(
-                  width: double.infinity,
-                  height: 1,
-                  color: Colors.grey.shade300,
-                ),
-
-                const SizedBox(height: 24),
-                Row(
-                  mainAxisAlignment: MainAxisAlignment.center,
-                  children: [
-                    const Text("Pas encore inscrit ? "),
-                    GestureDetector(
-                      onTap: () {
-                        // Go to sign up page
-                        Navigator.pushNamed(context, '/signup');
-                      },
-                      child: const Text(
-                        'Inscrivez-vous !',
                         style: TextStyle(
-                          color: Color.fromARGB(255, 37, 109, 167),
+                          fontSize: 24,
-                          decoration: TextDecoration.underline,
+                          fontWeight: FontWeight.bold,
                         ),
                       ),
-                    ),
+
-                  ],
+                      const SizedBox(height: 24),
+
+                      const Text(
+                        "Vous avez oublié votre mot de passe ? \n Ne vous inquiétez pas vous pouvez le réinitaliser !",
+                        textAlign: TextAlign.center,
+                        style: TextStyle(
+                          fontSize: 14,
+                          fontWeight: FontWeight.bold,
+                        ),
+                      ),
+
+                      const SizedBox(height: 40),
+
+                      const Text(
+                        "Quel est votre email ? \n Si celui-ci existe dans note base de donées, nous vous enverrons un mail avec un mot de passe unique.",
+                        textAlign: TextAlign.center,
+                        style: TextStyle(
+                          fontSize: 14,
+                          fontWeight: FontWeight.bold,
+                        ),
+                      ),
+
+                      const SizedBox(height: 24),
+
+                      TextFormField(
+                        controller: _emailController,
+                        validator: _validateEmail,
+                        keyboardType: TextInputType.emailAddress,
+                        decoration: const InputDecoration(
+                          labelText: 'Email',
+                          hintText: 'example@travelmate.com',
+                          border: OutlineInputBorder(
+                            borderRadius: BorderRadius.all(Radius.circular(12)),
+                          ),
+                          prefixIcon: Icon(Icons.email_outlined),
+                        ),
+                      ),
+
+                      const SizedBox(height: 40),
+
+                      BlocBuilder<AuthBloc, AuthState>(
+                        builder: (context, state) {
+                          final isLoading = state is AuthLoading;
+
+                          return ElevatedButton(
+                            onPressed: isLoading ? null : _submit,
+                            style: ElevatedButton.styleFrom(
+                              minimumSize: const Size.fromHeight(50),
+                              shape: RoundedRectangleBorder(
+                                borderRadius: BorderRadius.circular(12),
+                              ),
+                              backgroundColor:
+                                  Theme.of(context).brightness ==
+                                      Brightness.dark
+                                  ? Colors.white
+                                  : Colors.black,
+                              foregroundColor:
+                                  Theme.of(context).brightness ==
+                                      Brightness.dark
+                                  ? Colors.black
+                                  : Colors.white,
+                            ),
+                            child: isLoading
+                                ? SizedBox(
+                                    height: 20,
+                                    width: 20,
+                                    child: CircularProgressIndicator(
+                                      strokeWidth: 2,
+                                      color:
+                                          Theme.of(context).brightness ==
+                                              Brightness.dark
+                                          ? Colors.black
+                                          : Colors.white,
+                                    ),
+                                  )
+                                : const Text(
+                                    'Envoyer',
+                                    style: TextStyle(fontSize: 18),
+                                  ),
+                          );
+                        },
+                      ),
+                      const SizedBox(height: 20),
+
+                      Container(
+                        width: double.infinity,
+                        height: 1,
+                        color: Colors.grey.shade300,
+                      ),
+
+                      const SizedBox(height: 24),
+                      Row(
+                        mainAxisAlignment: MainAxisAlignment.center,
+                        children: [
+                          const Text("Pas encore inscrit ? "),
+                          GestureDetector(
+                            onTap: () {
+                              // Go to sign up page
+                              Navigator.pushReplacementNamed(
+                                context,
+                                '/signup',
+                              );
+                            },
+                            child: const Text(
+                              'Inscrivez-vous !',
+                              style: TextStyle(
+                                color: Color.fromARGB(255, 37, 109, 167),
+                                decoration: TextDecoration.underline,
+                              ),
+                            ),
+                          ),
+                        ],
+                      ),
+                    ],
+                  ),
                 ),
-              ],
+              ),
             ),
           ),
         ),

lib/pages/signup.dart

@@ -2,6 +2,7 @@ import 'package:flutter/material.dart';
 import 'package:flutter_bloc/flutter_bloc.dart';
 import 'package:sign_in_button/sign_in_button.dart';
 import 'package:travel_mate/components/loading/laoding_content.dart';
+import 'package:travel_mate/components/signup/password_requirements.dart';
 import 'package:travel_mate/components/signup/sign_up_platform_content.dart';
 import 'package:travel_mate/services/auth_service.dart';
 import '../blocs/auth/auth_bloc.dart';
@@ -66,6 +67,18 @@ class _SignUpPageState extends State<SignUpPage> {
     if (value.length < 8) {
       return 'Le mot de passe doit contenir au moins 8 caractères';
     }
+    if (!value.contains(RegExp(r'[A-Z]'))) {
+      return 'Le mot de passe doit contenir une majuscule';
+    }
+    if (!value.contains(RegExp(r'[a-z]'))) {
+      return 'Le mot de passe doit contenir une minuscule';
+    }
+    if (!value.contains(RegExp(r'[0-9]'))) {
+      return 'Le mot de passe doit contenir un chiffre';
+    }
+    if (!value.contains(RegExp(r'[!@#\$%^&*(),.?":{}|<>]'))) {
+      return 'Le mot de passe doit contenir un caractère spécial';
+    }
     return null;
   }
 
@@ -115,11 +128,13 @@ class _SignUpPageState extends State<SignUpPage> {
                 backgroundColor: Colors.green,
               ),
             );
-            Navigator.pushReplacementNamed(context, '/home');
+            Navigator.pushNamedAndRemoveUntil(
-          } else if (state is AuthError) {
+              context,
-            _errorService.showError(
+              '/home',
-              message: 'Erreur lors de la création du compte',
+              (route) => false,
             );
+          } else if (state is AuthError) {
+            _errorService.showError(message: state.message);
           }
         },
         builder: (context, state) {
@@ -211,6 +226,7 @@ class _SignUpPageState extends State<SignUpPage> {
                         controller: _passwordController,
                         validator: _validatePassword,
                         obscureText: _obscurePassword,
+                        onChanged: (value) => setState(() {}),
                         decoration: InputDecoration(
                           labelText: 'Mot de passe',
                           border: const OutlineInputBorder(
@@ -231,6 +247,7 @@ class _SignUpPageState extends State<SignUpPage> {
                           ),
                         ),
                       ),
+                      PasswordRequirements(password: _passwordController.text),
                       const SizedBox(height: 20),
 
                       // Champ Confirmation mot de passe

lib/repositories/account_repository.dart

@@ -7,7 +7,8 @@ class AccountRepository {
   final FirebaseFirestore _firestore = FirebaseFirestore.instance;
   final _errorService = ErrorService();
 
-  CollectionReference get _accountCollection => _firestore.collection('accounts');
+  CollectionReference get _accountCollection =>
+      _firestore.collection('accounts');
 
   CollectionReference _membersCollection(String accountId) {
     return _accountCollection.doc(accountId).collection('members');
@@ -32,8 +33,13 @@ class AccountRepository {
 
         return accountRef.id;
       });
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la création du compte: $e');
+      _errorService.logError(
+        'account_repository.dart',
+        'Erreur lors de la création du compte: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de créer le compte');
     }
   }
 
@@ -41,7 +47,6 @@ class AccountRepository {
     return _accountCollection
         .snapshots()
         .asyncMap((snapshot) async {
-
           List<Account> userAccounts = [];
 
           for (var accountDoc in snapshot.docs) {
@@ -54,14 +59,24 @@ class AccountRepository {
                   .get();
               if (memberDoc.exists) {
                 final accountData = accountDoc.data() as Map<String, dynamic>;
-                final account = Account.fromMap(accountData, accountId); // ✅ Ajout de l'ID
+                final account = Account.fromMap(
+                  accountData,
+                  accountId,
+                ); // ✅ Ajout de l'ID
                 final members = await getAccountMembers(accountId);
                 userAccounts.add(account.copyWith(members: members));
               } else {
-                _errorService.logInfo('account_repository.dart', 'Utilisateur NON membre de $accountId');
+                _errorService.logInfo(
+                  'account_repository.dart',
+                  'Utilisateur NON membre de $accountId',
+                );
               }
             } catch (e, stackTrace) {
-              _errorService.logError(e.toString(), stackTrace);
+              _errorService.logError(
+                'account_repository.dart',
+                'Erreur processing account doc: $e',
+                stackTrace,
+              );
             }
           }
           return userAccounts;
@@ -71,13 +86,18 @@ class AccountRepository {
           final prevIds = prev.map((a) => a.id).toSet();
           final nextIds = next.map((a) => a.id).toSet();
 
-          final identical = prevIds.difference(nextIds).isEmpty && 
+          final identical =
-                           nextIds.difference(prevIds).isEmpty;
+              prevIds.difference(nextIds).isEmpty &&
+              nextIds.difference(prevIds).isEmpty;
 
           return identical;
         })
         .handleError((error, stackTrace) {
-          _errorService.logError(error, stackTrace);
+          _errorService.logError(
+            'account_repository.dart',
+            'Erreur stream accounts: $error',
+            stackTrace,
+          );
           return <Account>[];
         });
   }
@@ -85,16 +105,16 @@ class AccountRepository {
   Future<List<GroupMember>> getAccountMembers(String accountId) async {
     try {
       final snapshot = await _membersCollection(accountId).get();
-      return snapshot.docs
+      return snapshot.docs.map((doc) {
-          .map((doc) {
+        return GroupMember.fromMap(doc.data() as Map<String, dynamic>, doc.id);
-            return GroupMember.fromMap(
+      }).toList();
-              doc.data() as Map<String, dynamic>,
+    } catch (e, stackTrace) {
-              doc.id,
+      _errorService.logError(
-            );
+        'account_repository.dart',
-          })
+        'Erreur lors de la récupération des membres: $e',
-          .toList();
+        stackTrace,
-    } catch (e) {
+      );
-      throw Exception('Erreur lors de la récupération des membres: $e');
+      throw Exception('Impossible de récupérer les membres');
     }
   }
 
@@ -105,8 +125,13 @@ class AccountRepository {
         return Account.fromMap(doc.data() as Map<String, dynamic>, doc.id);
       }
       return null;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la récupération du compte: $e');
+      _errorService.logError(
+        'account_repository.dart',
+        'Erreur lors de la récupération du compte: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer le compte');
     }
   }
 
@@ -123,8 +148,13 @@ class AccountRepository {
         return Account.fromMap(doc.data(), doc.id);
       }
       return null;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la récupération du compte: $e');
+      _errorService.logError(
+        'account_repository.dart',
+        'Erreur lors de la récupération du compte: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer le compte');
     }
   }
 
@@ -132,10 +162,17 @@ class AccountRepository {
     try {
       // Mettre à jour la date de modification
       final updatedAccount = account.copyWith(updatedAt: DateTime.now());
-      await _firestore.collection('accounts').doc(accountId).update(updatedAccount.toMap());
+      await _firestore
-    } catch (e) {
+          .collection('accounts')
-      _errorService.logError('account_repository.dart', 'Erreur lors de la mise à jour du compte: $e');
+          .doc(accountId)
-      throw Exception('Erreur lors de la mise à jour du compte: $e');
+          .update(updatedAccount.toMap());
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'account_repository.dart',
+        'Erreur lors de la mise à jour du compte: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de mettre à jour le compte');
     }
   }
 
@@ -159,21 +196,25 @@ class AccountRepository {
 
       // Supprimer le compte
       await _accountCollection.doc(docId).delete();
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('account_repository.dart', 'Erreur lors de la suppression du compte: $e');
+      _errorService.logError(
-      throw Exception('Erreur lors de la suppression du compte: $e');
+        'account_repository.dart',
+        'Erreur lors de la suppression du compte: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de supprimer le compte');
     }
   }
 
   Stream<List<GroupMember>> watchGroupMembers(String accountId) {
     return _membersCollection(accountId).snapshots().map(
-          (snapshot) => snapshot.docs
+      (snapshot) => snapshot.docs
-              .map((doc) => GroupMember.fromMap(
+          .map(
-                    doc.data() as Map<String, dynamic>,
+            (doc) =>
-                    doc.id,
+                GroupMember.fromMap(doc.data() as Map<String, dynamic>, doc.id),
-                  ))
+          )
-              .toList(),
+          .toList(),
-        );  
+    );
   }
 
   Stream<Account?> watchAccount(String accountId) {
@@ -198,4 +239,35 @@ class AccountRepository {
           return null;
         });
   }
+
+  Future<void> addMemberToAccount(String accountId, GroupMember member) async {
+    try {
+      await _membersCollection(
+        accountId,
+      ).doc(member.userId).set(member.toMap());
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'account_repository.dart',
+        'Erreur lors de l\'ajout du membre: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible d\'ajouter le membre');
+    }
+  }
+
+  Future<void> removeMemberFromAccount(
+    String accountId,
+    String memberId,
+  ) async {
+    try {
+      await _membersCollection(accountId).doc(memberId).delete();
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'account_repository.dart',
+        'Erreur lors de la suppression du membre: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de supprimer le membre');
+    }
+  }
 }

lib/repositories/activity_repository.dart

@@ -16,18 +16,32 @@ class ActivityRepository {
   /// Ajoute une nouvelle activité
   Future<String?> addActivity(Activity activity) async {
     try {
-      print('ActivityRepository: Ajout d\'une activité: ${activity.name}');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Ajout d\'une activité: ${activity.name}',
+      );
 
-      final docRef = await _firestore.collection(_collection).add(activity.toMap());
+      final docRef = await _firestore
+          .collection(_collection)
+          .add(activity.toMap());
 
       // Mettre à jour l'activité avec l'ID généré
       await docRef.update({'id': docRef.id});
 
-      print('ActivityRepository: Activité ajoutée avec ID: ${docRef.id}');
+      _errorService.logSuccess(
+        'ActivityRepository',
+        'Activité ajoutée avec ID: ${docRef.id}',
+      );
       return docRef.id;
     } catch (e) {
-      print('ActivityRepository: Erreur lors de l\'ajout: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur ajout activité: $e');
+        'ActivityRepository',
+        'Erreur lors de l\'ajout: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur ajout activité: $e',
+      );
       return null;
     }
   }
@@ -35,7 +49,10 @@ class ActivityRepository {
   /// Récupère toutes les activités d'un voyage
   Future<List<Activity>> getActivitiesByTrip(String tripId) async {
     try {
-      print('ActivityRepository: Récupération des activités pour le voyage: $tripId');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Récupération des activités pour le voyage: $tripId',
+      );
 
       // Modifié pour éviter l'erreur d'index composite
       // On récupère d'abord par tripId, puis on trie en mémoire
@@ -51,19 +68,36 @@ class ActivityRepository {
       // Tri en mémoire par date de mise à jour (plus récent en premier)
       activities.sort((a, b) => b.updatedAt.compareTo(a.updatedAt));
 
-      print('ActivityRepository: ${activities.length} activités trouvées');
+      _errorService.logInfo(
+        'ActivityRepository',
+        '${activities.length} activités trouvées',
+      );
       return activities;
     } catch (e) {
-      print('ActivityRepository: Erreur lors de la récupération: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur récupération activités: $e');
+        'ActivityRepository',
+        'Erreur lors de la récupération: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur récupération activités: $e',
+      );
       return [];
     }
   }
 
+  /// Récupère une activité par son ID (alias pour getActivityById pour compatibilité)
+  Future<Activity?> getActivity(String tripId, String activityId) async {
+    return getActivityById(activityId);
+  }
+
   /// Récupère une activité par son ID
   Future<Activity?> getActivityById(String activityId) async {
     try {
-      final doc = await _firestore.collection(_collection).doc(activityId).get();
+      final doc = await _firestore
+          .collection(_collection)
+          .doc(activityId)
+          .get();
 
       if (doc.exists) {
         return Activity.fromSnapshot(doc);
@@ -71,8 +105,14 @@ class ActivityRepository {
 
       return null;
     } catch (e) {
-      print('ActivityRepository: Erreur récupération activité: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur récupération activité: $e');
+        'ActivityRepository',
+        'Erreur récupération activité: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur récupération activité: $e',
+      );
       return null;
     }
   }
@@ -80,18 +120,30 @@ class ActivityRepository {
   /// Met à jour une activité
   Future<bool> updateActivity(Activity activity) async {
     try {
-      print('ActivityRepository: Mise à jour de l\'activité: ${activity.id}');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Mise à jour de l\'activité: ${activity.id}',
+      );
 
       await _firestore
           .collection(_collection)
           .doc(activity.id)
           .update(activity.copyWith(updatedAt: DateTime.now()).toMap());
 
-      print('ActivityRepository: Activité mise à jour avec succès');
+      _errorService.logSuccess(
+        'ActivityRepository',
+        'Activité mise à jour avec succès',
+      );
       return true;
     } catch (e) {
-      print('ActivityRepository: Erreur lors de la mise à jour: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur mise à jour activité: $e');
+        'ActivityRepository',
+        'Erreur lors de la mise à jour: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur mise à jour activité: $e',
+      );
       return false;
     }
   }
@@ -99,36 +151,61 @@ class ActivityRepository {
   /// Supprime une activité
   Future<bool> deleteActivity(String activityId) async {
     try {
-      print('ActivityRepository: Suppression de l\'activité: $activityId');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Suppression de l\'activité: $activityId',
+      );
 
       await _firestore.collection(_collection).doc(activityId).delete();
 
-      print('ActivityRepository: Activité supprimée avec succès');
+      _errorService.logSuccess(
+        'ActivityRepository',
+        'Activité supprimée avec succès',
+      );
       return true;
     } catch (e) {
-      print('ActivityRepository: Erreur lors de la suppression: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur suppression activité: $e');
+        'ActivityRepository',
+        'Erreur lors de la suppression: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur suppression activité: $e',
+      );
       return false;
     }
   }
 
   /// Vote pour une activité
-  Future<bool> voteForActivity(String activityId, String userId, int vote) async {
+  Future<bool> voteForActivity(
+    String activityId,
+    String userId,
+    int vote,
+  ) async {
     try {
       // Validation des paramètres
       if (activityId.isEmpty) {
-        print('ActivityRepository: ID d\'activité vide');
+        _errorService.logError('ActivityRepository', 'ID d\'activité vide');
-        _errorService.logError('activity_repository', 'ID d\'activité vide pour le vote');
+        _errorService.logError(
+          'activity_repository',
+          'ID d\'activité vide pour le vote',
+        );
         return false;
       }
 
       if (userId.isEmpty) {
-        print('ActivityRepository: ID d\'utilisateur vide');
+        _errorService.logError('ActivityRepository', 'ID d\'utilisateur vide');
-        _errorService.logError('activity_repository', 'ID d\'utilisateur vide pour le vote');
+        _errorService.logError(
+          'activity_repository',
+          'ID d\'utilisateur vide pour le vote',
+        );
         return false;
       }
 
-      print('ActivityRepository: Vote pour l\'activité $activityId: $vote');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Vote pour l\'activité $activityId: $vote',
+      );
 
       // vote: 1 pour positif, -1 pour négatif, 0 pour supprimer le vote
       final activityRef = _firestore.collection(_collection).doc(activityId);
@@ -157,10 +234,13 @@ class ActivityRepository {
         });
       });
 
-      print('ActivityRepository: Vote enregistré avec succès');
+      _errorService.logSuccess(
+        'ActivityRepository',
+        'Vote enregistré avec succès',
+      );
       return true;
     } catch (e) {
-      print('ActivityRepository: Erreur lors du vote: $e');
+      _errorService.logError('ActivityRepository', 'Erreur lors du vote: $e');
       _errorService.logError('activity_repository', 'Erreur vote: $e');
       return false;
     }
@@ -174,18 +254,24 @@ class ActivityRepository {
           .where('tripId', isEqualTo: tripId)
           .snapshots()
           .map((snapshot) {
-        final activities = snapshot.docs
+            final activities = snapshot.docs
-            .map((doc) => Activity.fromSnapshot(doc))
+                .map((doc) => Activity.fromSnapshot(doc))
-            .toList();
+                .toList();
 
-        // Tri en mémoire par date de mise à jour (plus récent en premier)
+            // Tri en mémoire par date de mise à jour (plus récent en premier)
-        activities.sort((a, b) => b.updatedAt.compareTo(a.updatedAt));
+            activities.sort((a, b) => b.updatedAt.compareTo(a.updatedAt));
 
-        return activities;
+            return activities;
-      });
+          });
     } catch (e) {
-      print('ActivityRepository: Erreur stream activités: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur stream activités: $e');
+        'ActivityRepository',
+        'Erreur stream activités: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur stream activités: $e',
+      );
       return Stream.value([]);
     }
   }
@@ -193,7 +279,10 @@ class ActivityRepository {
   /// Ajoute plusieurs activités en lot
   Future<List<String>> addActivitiesBatch(List<Activity> activities) async {
     try {
-      print('ActivityRepository: Ajout en lot de ${activities.length} activités');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Ajout en lot de ${activities.length} activités',
+      );
 
       final batch = _firestore.batch();
       final addedIds = <String>[];
@@ -207,19 +296,28 @@ class ActivityRepository {
 
       await batch.commit();
 
-      print('ActivityRepository: ${addedIds.length} activités ajoutées en lot');
+      _errorService.logSuccess(
+        'ActivityRepository',
+        '${addedIds.length} activités ajoutées en lot',
+      );
       return addedIds;
     } catch (e) {
-      print('ActivityRepository: Erreur ajout en lot: $e');
+      _errorService.logError('ActivityRepository', 'Erreur ajout en lot: $e');
       _errorService.logError('activity_repository', 'Erreur ajout en lot: $e');
       return [];
     }
   }
 
   /// Recherche des activités par catégorie
-  Future<List<Activity>> getActivitiesByCategory(String tripId, String category) async {
+  Future<List<Activity>> getActivitiesByCategory(
+    String tripId,
+    String category,
+  ) async {
     try {
-      print('ActivityRepository: Recherche par catégorie: $category pour le voyage: $tripId');
+      _errorService.logInfo(
+        'ActivityRepository',
+        'Recherche par catégorie: $category pour le voyage: $tripId',
+      );
 
       // Récupérer toutes les activités du voyage puis filtrer en mémoire
       final querySnapshot = await _firestore
@@ -237,14 +335,23 @@ class ActivityRepository {
 
       return activities;
     } catch (e) {
-      print('ActivityRepository: Erreur recherche par catégorie: $e');
+      _errorService.logError(
-      _errorService.logError('activity_repository', 'Erreur recherche par catégorie: $e');
+        'ActivityRepository',
+        'Erreur recherche par catégorie: $e',
+      );
+      _errorService.logError(
+        'activity_repository',
+        'Erreur recherche par catégorie: $e',
+      );
       return [];
     }
   }
 
   /// Récupère les activités les mieux notées d'un voyage
-  Future<List<Activity>> getTopRatedActivities(String tripId, {int limit = 10}) async {
+  Future<List<Activity>> getTopRatedActivities(
+    String tripId, {
+    int limit = 10,
+  }) async {
     try {
       final activities = await getActivitiesByTrip(tripId);
 
@@ -262,7 +369,10 @@ class ActivityRepository {
 
       return activities.take(limit).toList();
     } catch (e) {
-      print('ActivityRepository: Erreur activités top rated: $e');
+      _errorService.logError(
+        'ActivityRepository',
+        'Erreur activités top rated: $e',
+      );
       _errorService.logError('activity_repository', 'Erreur top rated: $e');
       return [];
     }
@@ -284,7 +394,10 @@ class ActivityRepository {
 
       return null;
     } catch (e) {
-      print('ActivityRepository: Erreur recherche activité existante: $e');
+      _errorService.logError(
+        'ActivityRepository',
+        'Erreur recherche activité existante: $e',
+      );
       return null;
     }
   }

lib/repositories/auth_repository.dart

@@ -3,6 +3,7 @@ import 'package:cloud_firestore/cloud_firestore.dart';
 import '../models/user.dart';
 import '../services/auth_service.dart';
 import '../services/error_service.dart';
+import '../services/notification_service.dart';
 
 /// Repository for authentication operations and user data management.
 ///
@@ -57,11 +58,12 @@ class AuthRepository {
         email: email,
         password: password,
       );
+      await _saveFCMToken(firebaseUser.user!.uid);
       return await getUserFromFirestore(firebaseUser.user!.uid);
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.showError(message: 'Utilisateur ou mot de passe incorrect');
+      _errorService.logError('AuthRepository', 'SignIn error: $e', stackTrace);
+      throw Exception('Utilisateur ou mot de passe incorrect');
     }
-    return null;
   }
 
   /// Creates a new user account with email and password.
@@ -102,11 +104,14 @@ class AuthRepository {
       );
 
       await _firestore.collection('users').doc(user.id).set(user.toMap());
+      if (user.id != null) {
+        await _saveFCMToken(user.id!);
+      }
       return user;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.showError(message: 'Erreur lors de la création du compte');
+      _errorService.logError('AuthRepository', 'SignUp error: $e', stackTrace);
+      throw Exception('Erreur lors de la création du compte');
     }
-    return null;
   }
 
   /// Signs in a user using Google authentication.
@@ -122,11 +127,16 @@ class AuthRepository {
     String firstname,
   ) async {
     try {
-      final firebaseUser = await _authService.signInWithGoogle();
+      firebase_auth.User? firebaseUser = _authService.currentUser;
 
-      if (firebaseUser.user != null) {
+      if (firebaseUser == null) {
+        final userCredential = await _authService.signInWithGoogle();
+        firebaseUser = userCredential.user;
+      }
+
+      if (firebaseUser != null) {
         // Check if user already exists in Firestore
-        final existingUser = await getUserFromFirestore(firebaseUser.user!.uid);
+        final existingUser = await getUserFromFirestore(firebaseUser.uid);
 
         if (existingUser != null) {
           return existingUser;
@@ -134,23 +144,30 @@ class AuthRepository {
 
         // Create new user document for first-time Google sign-in
         final user = User(
-          id: firebaseUser.user!.uid,
+          id: firebaseUser.uid,
-          email: firebaseUser.user!.email ?? '',
+          email: firebaseUser.email ?? '',
           nom: name,
           prenom: firstname,
           phoneNumber: phoneNumber,
-          profilePictureUrl: firebaseUser.user!.photoURL ?? 'Unknown',
+          profilePictureUrl: firebaseUser.photoURL ?? 'Unknown',
           platform: 'google',
         );
 
         await _firestore.collection('users').doc(user.id).set(user.toMap());
+        if (user.id != null) {
+          await _saveFCMToken(user.id!);
+        }
         return user;
       }
       return null;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.showError(message: 'Erreur lors de la connexion Google');
+      _errorService.logError(
+        'AuthRepository',
+        'Google SignUp error: $e',
+        stackTrace,
+      );
+      throw Exception('Erreur lors de la connexion Google');
     }
-    return null;
   }
 
   Future<User?> signInWithGoogle() async {
@@ -158,14 +175,21 @@ class AuthRepository {
       final firebaseUser = await _authService.signInWithGoogle();
       final user = await getUserFromFirestore(firebaseUser.user!.uid);
       if (user != null) {
+        if (user.id != null) {
+          await _saveFCMToken(user.id!);
+        }
         return user;
       } else {
         throw Exception('Utilisateur non trouvé');
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.showError(message: 'Erreur lors de la connexion Google');
+      _errorService.logError(
+        'AuthRepository',
+        'Google SignIn error: $e',
+        stackTrace,
+      );
+      throw Exception('Erreur lors de la connexion Google');
     }
-    return null;
   }
 
   /// Signs in a user using Apple authentication.
@@ -181,33 +205,45 @@ class AuthRepository {
     String firstname,
   ) async {
     try {
-      final firebaseUser = await _authService.signInWithApple();
+      firebase_auth.User? firebaseUser = _authService.currentUser;
 
-      if (firebaseUser.user != null) {
+      if (firebaseUser == null) {
-        final existingUser = await getUserFromFirestore(firebaseUser.user!.uid);
+        final userCredential = await _authService.signInWithApple();
+        firebaseUser = userCredential.user;
+      }
+
+      if (firebaseUser != null) {
+        final existingUser = await getUserFromFirestore(firebaseUser.uid);
 
         if (existingUser != null) {
           return existingUser;
         }
 
         final user = User(
-          id: firebaseUser.user!.uid,
+          id: firebaseUser.uid,
-          email: firebaseUser.user!.email ?? '',
+          email: firebaseUser.email ?? '',
           nom: name,
           prenom: firstname,
           phoneNumber: phoneNumber,
-          profilePictureUrl: firebaseUser.user!.photoURL ?? 'Unknown',
+          profilePictureUrl: firebaseUser.photoURL ?? 'Unknown',
           platform: 'apple',
         );
 
         await _firestore.collection('users').doc(user.id).set(user.toMap());
+        if (user.id != null) {
+          await _saveFCMToken(user.id!);
+        }
         return user;
       }
       return null;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.showError(message: 'Erreur lors de la connexion Apple');
+      _errorService.logError(
+        'AuthRepository',
+        'Apple SignUp error: $e',
+        stackTrace,
+      );
+      throw Exception('Erreur lors de la connexion Apple');
     }
-    return null;
   }
 
   Future<User?> signInWithApple() async {
@@ -215,14 +251,21 @@ class AuthRepository {
       final firebaseUser = await _authService.signInWithApple();
       final user = await getUserFromFirestore(firebaseUser.user!.uid);
       if (user != null) {
+        if (user.id != null) {
+          await _saveFCMToken(user.id!);
+        }
         return user;
       } else {
         throw Exception('Utilisateur non trouvé');
       }
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.showError(message: 'Erreur lors de la connexion Apple');
+      _errorService.logError(
+        'AuthRepository',
+        'Apple SignIn error: $e',
+        stackTrace,
+      );
+      throw Exception('Erreur lors de la connexion Apple');
     }
-    return null;
   }
 
   /// Signs out the current user.
@@ -248,7 +291,7 @@ class AuthRepository {
   ///
   /// [uid] - The Firebase user ID to look up
   ///
-  /// Returns the [User] model if found, null otherwise.
+  /// Returns the [User] model if successful, null otherwise.
   Future<User?> getUserFromFirestore(String uid) async {
     try {
       final doc = await _firestore.collection('users').doc(uid).get();
@@ -261,4 +304,23 @@ class AuthRepository {
       return null;
     }
   }
+
+  /// Helper method to save the FCM token for the authenticated user.
+  Future<void> _saveFCMToken(String userId) async {
+    try {
+      final token = await NotificationService().getFCMToken();
+      if (token != null) {
+        await _firestore.collection('users').doc(userId).set({
+          'fcmToken': token,
+        }, SetOptions(merge: true));
+      }
+    } catch (e, stackTrace) {
+      // Non-blocking error
+      _errorService.logError(
+        'AuthRepository',
+        'Error saving FCM token: $e',
+        stackTrace,
+      );
+    }
+  }
 }

lib/repositories/balance_repository.dart

@@ -37,9 +37,13 @@ class BalanceRepository {
         totalExpenses: totalExpenses,
         calculatedAt: DateTime.now(),
       );
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('BalanceRepository', 'Erreur calcul balance: $e');
+      _errorService.logError(
-      rethrow;
+        'BalanceRepository',
+        'Erreur calcul balance: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de calculer la balance');
     }
   }
 
@@ -50,9 +54,13 @@ class BalanceRepository {
           .first;
 
       return _calculateUserBalances(expenses);
-    } catch (e) {
+    } catch (e, stackTrace) {
-      _errorService.logError('BalanceRepository', 'Erreur calcul user balances: $e');
+      _errorService.logError(
-      rethrow;
+        'BalanceRepository',
+        'Erreur calcul user balances: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de calculer les balances utilisateurs');
     }
   }
 
@@ -65,19 +73,17 @@ class BalanceRepository {
       if (expense.isArchived) continue;
 
       // Ajouter le payeur
-      userBalanceMap.putIfAbsent(expense.paidById, () => {
+      userBalanceMap.putIfAbsent(
-        'name': expense.paidByName,
+        expense.paidById,
-        'paid': 0.0,
+        () => {'name': expense.paidByName, 'paid': 0.0, 'owed': 0.0},
-        'owed': 0.0,
+      );
-      });
 
       // Ajouter les participants
       for (final split in expense.splits) {
-        userBalanceMap.putIfAbsent(split.userId, () => {
+        userBalanceMap.putIfAbsent(
-          'name': split.userName,
+          split.userId,
-          'paid': 0.0,
+          () => {'name': split.userName, 'paid': 0.0, 'owed': 0.0},
-          'owed': 0.0,
+        );
-        });
       }
     }
 
@@ -125,10 +131,10 @@ class BalanceRepository {
 
     // Créer des copies mutables des montants
     final creditorsRemaining = Map.fromEntries(
-      creditors.map((c) => MapEntry(c.userId, c.balance))
+      creditors.map((c) => MapEntry(c.userId, c.balance)),
     );
     final debtorsRemaining = Map.fromEntries(
-      debtors.map((d) => MapEntry(d.userId, -d.balance))
+      debtors.map((d) => MapEntry(d.userId, -d.balance)),
     );
 
     // Algorithme glouton pour minimiser le nombre de transactions
@@ -139,15 +145,20 @@ class BalanceRepository {
 
         if (creditAmount <= 0.01 || debtAmount <= 0.01) continue;
 
-        final settlementAmount = [creditAmount, debtAmount].reduce((a, b) => a < b ? a : b);
+        final settlementAmount = [
+          creditAmount,
+          debtAmount,
+        ].reduce((a, b) => a < b ? a : b);
 
-        settlements.add(Settlement(
+        settlements.add(
-          fromUserId: debtor.userId,
+          Settlement(
-          fromUserName: debtor.userName,
+            fromUserId: debtor.userId,
-          toUserId: creditor.userId,
+            fromUserName: debtor.userName,
-          toUserName: creditor.userName,
+            toUserId: creditor.userId,
-          amount: settlementAmount,
+            toUserName: creditor.userName,
-        ));
+            amount: settlementAmount,
+          ),
+        );
 
         creditorsRemaining[creditor.userId] = creditAmount - settlementAmount;
         debtorsRemaining[debtor.userId] = debtAmount - settlementAmount;

lib/repositories/group_repository.dart

@@ -1,10 +1,12 @@
 import 'package:cloud_firestore/cloud_firestore.dart';
+import 'package:firebase_auth/firebase_auth.dart';
 import 'package:travel_mate/services/error_service.dart';
 import '../models/group.dart';
 import '../models/group_member.dart';
 
 class GroupRepository {
   final FirebaseFirestore _firestore = FirebaseFirestore.instance;
+  final FirebaseAuth _auth = FirebaseAuth.instance;
   final _errorService = ErrorService();
 
   CollectionReference get _groupsCollection => _firestore.collection('groups');
@@ -21,7 +23,9 @@ class GroupRepository {
       return await _firestore.runTransaction<String>((transaction) async {
         final groupRef = _groupsCollection.doc();
 
-        final groupData = group.toMap();
+        // Ajouter les IDs des membres à la liste memberIds
+        final memberIds = members.map((m) => m.userId).toList();
+        final groupData = group.copyWith(memberIds: memberIds).toMap();
         transaction.set(groupRef, groupData);
 
         for (var member in members) {
@@ -31,60 +35,32 @@ class GroupRepository {
 
         return groupRef.id;
       });
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la création du groupe: $e');
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur création groupe: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de créer le groupe');
     }
   }
 
   Stream<List<Group>> getGroupsByUserId(String userId) {
     return _groupsCollection
+        .where('memberIds', arrayContains: userId)
         .snapshots()
-        .asyncMap((snapshot) async {
+        .map((snapshot) {
-          
+          return snapshot.docs.map((doc) {
-          List<Group> userGroups = [];
+            final groupData = doc.data() as Map<String, dynamic>;
-
+            return Group.fromMap(groupData, doc.id);
-          for (var groupDoc in snapshot.docs) {
+          }).toList();
-            try {
-              final groupId = groupDoc.id;
-              
-              // Vérifier si l'utilisateur est membre
-              final memberDoc = await groupDoc.reference
-                  .collection('members')
-                  .doc(userId)
-                  .get();
-
-              if (memberDoc.exists) {
-                final groupData = groupDoc.data() as Map<String, dynamic>;
-                final group = Group.fromMap(groupData, groupId);
-                
-                final members = await getGroupMembers(groupId);
-                userGroups.add(group.copyWith(members: members));
-              } else {
-                _errorService.logInfo('group_repository.dart','Utilisateur NON membre de $groupId');
-              }
-            } catch (e, stackTrace) {
-              _errorService.logError(e.toString(), stackTrace);
-            }
-          }
-          return userGroups;
-        })
-        .distinct((prev, next) {
-          // Comparer les listes pour éviter les doublons
-          if (prev.length != next.length) {
-            return false;
-          }
-          
-          // Vérifier si les IDs sont identiques
-          final prevIds = prev.map((g) => g.id).toSet();
-          final nextIds = next.map((g) => g.id).toSet();
-          
-          final identical = prevIds.difference(nextIds).isEmpty && 
-                           nextIds.difference(prevIds).isEmpty;
-          
-          return identical;
         })
         .handleError((error, stackTrace) {
-          _errorService.logError(error, stackTrace);
+          _errorService.logError(
+            'GroupRepository',
+            'Erreur stream groups: $error',
+            stackTrace,
+          );
           return <Group>[];
         });
   }
@@ -99,18 +75,42 @@ class GroupRepository {
       final members = await getGroupMembers(groupId);
 
       return group.copyWith(members: members);
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la récupération du groupe: $e');
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur get group: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer le groupe');
     }
   }
 
   Future<Group?> getGroupByTripId(String tripId) async {
     try {
-      final querySnapshot = await _groupsCollection
+      final userId = _auth.currentUser?.uid;
+      if (userId == null) return null;
+
+      // Tentative 1: Requête optimisée avec memberIds
+      var querySnapshot = await _groupsCollection
           .where('tripId', isEqualTo: tripId)
+          .where('memberIds', arrayContains: userId)
           .limit(1)
           .get();
 
+      // Tentative 2: Fallback pour le créateur (si memberIds est manquant - anciennes données)
+      if (querySnapshot.docs.isEmpty) {
+        querySnapshot = await _groupsCollection
+            .where('tripId', isEqualTo: tripId)
+            .where('createdBy', isEqualTo: userId)
+            .limit(1)
+            .get();
+
+        // Si on trouve le groupe via le fallback, on lance une migration
+        if (querySnapshot.docs.isNotEmpty) {
+          _migrateGroupData(querySnapshot.docs.first.id);
+        }
+      }
+
       if (querySnapshot.docs.isEmpty) return null;
 
       final doc = querySnapshot.docs.first;
@@ -118,94 +118,210 @@ class GroupRepository {
       final members = await getGroupMembers(doc.id);
 
       return group.copyWith(members: members);
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la récupération du groupe: $e');
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur get group by trip: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer le groupe du voyage');
+    }
+  }
+
+  /// Méthode utilitaire pour migrer les anciennes données
+  Future<void> _migrateGroupData(String groupId) async {
+    try {
+      final members = await getGroupMembers(groupId);
+      final memberIds = members.map((m) => m.userId).toList();
+
+      if (memberIds.isNotEmpty) {
+        await _groupsCollection.doc(groupId).update({'memberIds': memberIds});
+        _errorService.logSuccess(
+          'GroupRepository',
+          'Migration réussie pour le groupe $groupId',
+        );
+      }
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur de migration pour le groupe $groupId: $e',
+        stackTrace,
+      );
     }
   }
 
   Future<List<GroupMember>> getGroupMembers(String groupId) async {
     try {
       final snapshot = await _membersCollection(groupId).get();
-      return snapshot.docs
+      return snapshot.docs.map((doc) {
-          .map((doc) {
+        return GroupMember.fromMap(doc.data() as Map<String, dynamic>, doc.id);
-            return GroupMember.fromMap(
+      }).toList();
-              doc.data() as Map<String, dynamic>,
+    } catch (e, stackTrace) {
-              doc.id,
+      _errorService.logError(
-            );
+        'GroupRepository',
-          })
+        'Erreur get members: $e',
-          .toList();
+        stackTrace,
-    } catch (e) {
+      );
-      throw Exception('Erreur lors de la récupération des membres: $e');
+      throw Exception('Impossible de récupérer les membres');
     }
   }
 
   Future<void> addMember(String groupId, GroupMember member) async {
     try {
+      // 1. Récupérer le groupe pour avoir le tripId
+      final group = await getGroupById(groupId);
+      if (group == null) throw Exception('Groupe introuvable');
+
+      // 2. Ajouter le membre dans la sous-collection members du groupe
       await _membersCollection(groupId).doc(member.userId).set(member.toMap());
 
+      // 3. Mettre à jour la liste memberIds du groupe
       await _groupsCollection.doc(groupId).update({
         'updatedAt': DateTime.now().millisecondsSinceEpoch,
+        'memberIds': FieldValue.arrayUnion([member.userId]),
       });
-    } catch (e) {
+
-      throw Exception('Erreur lors de l\'ajout du membre: $e');
+      // 4. Mettre à jour la liste participants du voyage
+      await _firestore.collection('trips').doc(group.tripId).update({
+        'participants': FieldValue.arrayUnion([member.userId]),
+      });
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur add member: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible d\'ajouter le membre');
     }
   }
 
   Future<void> removeMember(String groupId, String userId) async {
     try {
+      // 1. Récupérer le groupe pour avoir le tripId
+      final group = await getGroupById(groupId);
+      if (group == null) throw Exception('Groupe introuvable');
+
+      // 2. Supprimer le membre de la sous-collection members du groupe
       await _membersCollection(groupId).doc(userId).delete();
 
+      // 3. Mettre à jour la liste memberIds du groupe
       await _groupsCollection.doc(groupId).update({
         'updatedAt': DateTime.now().millisecondsSinceEpoch,
+        'memberIds': FieldValue.arrayRemove([userId]),
       });
-    } catch (e) {
+
-      throw Exception('Erreur lors de la suppression du membre: $e');
+      // 4. Mettre à jour la liste participants du voyage
+      await _firestore.collection('trips').doc(group.tripId).update({
+        'participants': FieldValue.arrayRemove([userId]),
+      });
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur remove member: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de supprimer le membre');
     }
   }
 
   Future<void> updateGroup(String groupId, Group group) async {
     try {
-      await _groupsCollection.doc(groupId).update(
+      await _groupsCollection
-            group.toMap()..['updatedAt'] = DateTime.now().millisecondsSinceEpoch,
+          .doc(groupId)
+          .update(
+            group.toMap()
+              ..['updatedAt'] = DateTime.now().millisecondsSinceEpoch,
           );
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la mise à jour du groupe: $e');
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur update group: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de mettre à jour le groupe');
     }
   }
 
   Future<void> deleteGroup(String tripId) async {
-  try {
+    try {
-    final querySnapshot = await _groupsCollection
+      final userId = _auth.currentUser?.uid;
-        .where('tripId', isEqualTo: tripId)
+      if (userId == null) throw Exception('Utilisateur non connecté');
-        .limit(1)
-        .get();
 
-    if (querySnapshot.docs.isEmpty) {
+      final querySnapshot = await _groupsCollection
-      throw Exception('Aucun groupe trouvé pour ce voyage');
+          .where('tripId', isEqualTo: tripId)
+          .where('createdBy', isEqualTo: userId)
+          .limit(1)
+          .get();
+
+      if (querySnapshot.docs.isEmpty) {
+        throw Exception('Aucun groupe trouvé pour ce voyage');
+      }
+
+      final groupDoc = querySnapshot.docs.first;
+      final groupId = groupDoc.id;
+
+      final membersSnapshot = await _membersCollection(groupId).get();
+      for (var doc in membersSnapshot.docs) {
+        await doc.reference.delete();
+      }
+
+      await _groupsCollection.doc(groupId).delete();
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur delete group: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de supprimer le groupe');
     }
-
-    final groupDoc = querySnapshot.docs.first;
-    final groupId = groupDoc.id;
-
-    final membersSnapshot = await _membersCollection(groupId).get();
-    for (var doc in membersSnapshot.docs) {
-      await doc.reference.delete();
-    }
-    
-    await _groupsCollection.doc(groupId).delete();
-  } catch (e) {
-    throw Exception('Erreur lors de la suppression du groupe: $e');
   }
-}
 
   Stream<List<GroupMember>> watchGroupMembers(String groupId) {
     return _membersCollection(groupId).snapshots().map(
-          (snapshot) => snapshot.docs
+      (snapshot) => snapshot.docs
-              .map((doc) => GroupMember.fromMap(
+          .map(
-                    doc.data() as Map<String, dynamic>,
+            (doc) =>
-                    doc.id,
+                GroupMember.fromMap(doc.data() as Map<String, dynamic>, doc.id),
-                  ))
+          )
-              .toList(),
+          .toList(),
-        );
+    );
+  }
+
+  Future<void> updateMemberDetails({
+    required String userId,
+    String? firstName,
+    String? lastName,
+    String? profilePictureUrl,
+  }) async {
+    try {
+      // 1. Trouver tous les groupes où l'utilisateur est membre
+      final groupsSnapshot = await _groupsCollection
+          .where('memberIds', arrayContains: userId)
+          .get();
+
+      // 2. Mettre à jour les infos du membre dans chaque groupe
+      for (final groupDoc in groupsSnapshot.docs) {
+        final memberRef = _membersCollection(groupDoc.id).doc(userId);
+
+        final updates = <String, dynamic>{};
+        if (firstName != null) updates['firstName'] = firstName;
+        if (lastName != null) updates['lastName'] = lastName;
+        if (profilePictureUrl != null) {
+          updates['profilePictureUrl'] = profilePictureUrl;
+        }
+
+        if (updates.isNotEmpty) {
+          await memberRef.update(updates);
+        }
+      }
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'GroupRepository',
+        'Erreur update member details: $e',
+        stackTrace,
+      );
+      // On ne throw pas d'exception ici pour ne pas bloquer l'update user principal
+      // C'est une opération "best effort"
+    }
   }
 }

lib/repositories/message_repository.dart

@@ -42,7 +42,7 @@ class MessageRepository {
     });
   }
 
-  // Supprimer un message
+  // Supprimer un message (marquer comme supprimé)
   Future<void> deleteMessage({
     required String groupId,
     required String messageId,
@@ -52,7 +52,10 @@ class MessageRepository {
         .doc(groupId)
         .collection('messages')
         .doc(messageId)
-        .delete();
+        .update({
+      'isDeleted': true,
+      'text': '',
+    });
   }
 
   // Modifier un message

lib/repositories/trip_repository.dart

@@ -1,8 +1,10 @@
 import 'package:cloud_firestore/cloud_firestore.dart';
 import '../models/trip.dart';
+import '../services/error_service.dart';
 
 class TripRepository {
   final FirebaseFirestore _firestore = FirebaseFirestore.instance;
+  final _errorService = ErrorService();
 
   CollectionReference get _tripsCollection => _firestore.collection('trips');
 
@@ -13,21 +15,31 @@ class TripRepository {
           .where('participants', arrayContains: userId)
           .snapshots()
           .map((snapshot) {
-        final trips = snapshot.docs
+            final trips = snapshot.docs
-            .map((doc) {
+                .map((doc) {
-              try {
+                  try {
-                final data = doc.data() as Map<String, dynamic>;
+                    final data = doc.data() as Map<String, dynamic>;
-                return Trip.fromMap(data, doc.id);
+                    return Trip.fromMap(data, doc.id);
-              } catch (e) {
+                  } catch (e, stackTrace) {
-                return null;
+                    _errorService.logError(
-              }
+                      'TripRepository',
-            })
+                      'Erreur parsing trip ${doc.id}: $e',
-            .whereType<Trip>()
+                      stackTrace,
-            .toList();
+                    );
-        return trips;
+                    return null;
-      });
+                  }
-    } catch (e) {
+                })
-      throw Exception('Erreur lors de la récupération des voyages: $e');
+                .whereType<Trip>()
+                .toList();
+            return trips;
+          });
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'TripRepository',
+        'Erreur stream trips: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer les voyages');
     }
   }
 
@@ -38,8 +50,13 @@ class TripRepository {
       // Ne pas modifier les timestamps ici, ils sont déjà au bon format
       final docRef = await _tripsCollection.add(tripData);
       return docRef.id;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la création du voyage: $e');
+      _errorService.logError(
+        'TripRepository',
+        'Erreur création trip: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de créer le voyage');
     }
   }
 
@@ -53,8 +70,13 @@ class TripRepository {
       }
 
       return Trip.fromMap(doc.data() as Map<String, dynamic>, doc.id);
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la récupération du voyage: $e');
+      _errorService.logError(
+        'TripRepository',
+        'Erreur get trip: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer le voyage');
     }
   }
 
@@ -66,8 +88,13 @@ class TripRepository {
       tripData['updatedAt'] = Timestamp.now();
 
       await _tripsCollection.doc(tripId).update(tripData);
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la mise à jour du voyage: $e');
+      _errorService.logError(
+        'TripRepository',
+        'Erreur update trip: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de mettre à jour le voyage');
     }
   }
 
@@ -75,8 +102,13 @@ class TripRepository {
   Future<void> deleteTrip(String tripId) async {
     try {
       await _tripsCollection.doc(tripId).delete();
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la suppression du voyage: $e');
+      _errorService.logError(
+        'TripRepository',
+        'Erreur delete trip: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de supprimer le voyage');
     }
   }
 }

lib/repositories/user_repository.dart

@@ -1,6 +1,7 @@
 import 'package:cloud_firestore/cloud_firestore.dart';
 import '../models/user.dart';
 import '../services/auth_service.dart';
+import '../services/error_service.dart';
 
 /// Repository for user data operations in Firestore.
 ///
@@ -14,14 +15,14 @@ class UserRepository {
   /// Authentication service for user-related operations.
   final AuthService _authService;
 
+  final _errorService = ErrorService();
+
   /// Creates a new [UserRepository] with optional dependencies.
   ///
   /// If [firestore] or [authService] are not provided, default instances will be used.
-  UserRepository({
+  UserRepository({FirebaseFirestore? firestore, AuthService? authService})
-    FirebaseFirestore? firestore,
+    : _firestore = firestore ?? FirebaseFirestore.instance,
-    AuthService? authService,
+      _authService = authService ?? AuthService();
-  })  : _firestore = firestore ?? FirebaseFirestore.instance,
-        _authService = authService ?? AuthService();
 
   /// Retrieves a user by their unique ID.
   ///
@@ -39,8 +40,13 @@ class UserRepository {
         return User.fromMap({...data, 'id': uid});
       }
       return null;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Error retrieving user: $e');
+      _errorService.logError(
+        'UserRepository',
+        'Error retrieving user: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de récupérer l\'utilisateur');
     }
   }
 
@@ -67,8 +73,13 @@ class UserRepository {
         return User.fromMap({...data, 'id': doc.id});
       }
       return null;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Error searching for user: $e');
+      _errorService.logError(
+        'UserRepository',
+        'Error searching for user: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de trouver l\'utilisateur');
     }
   }
 
@@ -87,8 +98,13 @@ class UserRepository {
       await _authService.updateDisplayName(displayName: user.fullName);
 
       return true;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la mise à jour: $e');
+      _errorService.logError(
+        'UserRepository',
+        'Erreur lors de la mise à jour: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de mettre à jour l\'utilisateur');
     }
   }
 
@@ -98,8 +114,13 @@ class UserRepository {
       await _firestore.collection('users').doc(uid).delete();
       // Note: Vous devrez également supprimer le compte Firebase Auth
       return true;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors de la suppression: $e');
+      _errorService.logError(
+        'UserRepository',
+        'Erreur lors de la suppression: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de supprimer l\'utilisateur');
     }
   }
 
@@ -120,8 +141,52 @@ class UserRepository {
         newPassword: newPassword,
       );
       return true;
-    } catch (e) {
+    } catch (e, stackTrace) {
-      throw Exception('Erreur lors du changement de mot de passe: $e');
+      _errorService.logError(
+        'UserRepository',
+        'Erreur lors du changement de mot de passe: $e',
+        stackTrace,
+      );
+      throw Exception('Impossible de changer le mot de passe');
+    }
+  }
+
+  // Récupérer plusieurs utilisateurs par leurs IDs
+  Future<List<User>> getUsersByIds(List<String> uids) async {
+    if (uids.isEmpty) return [];
+
+    try {
+      // Firestore 'in' query supports up to 10 values.
+      // If we have more, we need to split into chunks.
+      List<User> users = [];
+
+      // Remove duplicates
+      final uniqueIds = uids.toSet().toList();
+
+      // Split into chunks of 10
+      for (var i = 0; i < uniqueIds.length; i += 10) {
+        final end = (i + 10 < uniqueIds.length) ? i + 10 : uniqueIds.length;
+        final chunk = uniqueIds.sublist(i, end);
+
+        final querySnapshot = await _firestore
+            .collection('users')
+            .where(FieldPath.documentId, whereIn: chunk)
+            .get();
+
+        for (var doc in querySnapshot.docs) {
+          final data = doc.data();
+          users.add(User.fromMap({...data, 'id': doc.id}));
+        }
+      }
+
+      return users;
+    } catch (e, stackTrace) {
+      _errorService.logError(
+        'UserRepository',
+        'Error retrieving users by IDs: $e',
+        stackTrace,
+      );
+      return [];
     }
   }
 }

lib/services/activity_places_service.dart

@@ -1,8 +1,10 @@
+import 'dart:io';
 import 'dart:convert';
 import 'package:http/http.dart' as http;
-import 'package:flutter_dotenv/flutter_dotenv.dart';
+import '../firebase_options.dart'; // Add this import
 import '../models/activity.dart';
 import '../services/error_service.dart';
+import '../services/logger_service.dart';
 
 /// Service pour rechercher des activités touristiques via Google Places API
 class ActivityPlacesService {
@@ -12,7 +14,17 @@ class ActivityPlacesService {
   ActivityPlacesService._internal();
 
   final ErrorService _errorService = ErrorService();
-  static final String _apiKey = dotenv.env['GOOGLE_MAPS_API_KEY'] ?? '';
+
+  static String get _apiKey {
+    try {
+      return DefaultFirebaseOptions.currentPlatform.apiKey;
+    } catch (e) {
+      LoggerService.error(
+        'ActivityPlacesService: Impossible de récupérer la clé API Firebase: $e',
+      );
+      return '';
+    }
+  }
 
   /// Recherche des activités près d'une destination
   Future<List<Activity>> searchActivities({
@@ -23,81 +35,75 @@ class ActivityPlacesService {
     int maxResults = 20,
     int offset = 0,
   }) async {
-    try {
+    LoggerService.info(
-      print(
+      'ActivityPlacesService: Recherche d\'activités pour: $destination (max: $maxResults, offset: $offset)',
-        'ActivityPlacesService: Recherche d\'activités pour: $destination (max: $maxResults, offset: $offset)',
+    );
+
+    // 1. Géocoder la destination
+    final coordinates = await _geocodeDestination(destination);
+
+    // 2. Rechercher les activités par catégorie ou toutes les catégories
+    List<Activity> allActivities = [];
+
+    if (category != null) {
+      final activities = await _searchByCategory(
+        coordinates['lat']!,
+        coordinates['lng']!,
+        category,
+        tripId,
+        radius,
       );
+      allActivities.addAll(activities);
+    } else {
+      // Rechercher dans toutes les catégories principales
+      final mainCategories = [
+        ActivityCategory.attraction,
+        ActivityCategory.museum,
+        ActivityCategory.restaurant,
+        ActivityCategory.culture,
+        ActivityCategory.nature,
+      ];
 
-      // 1. Géocoder la destination
+      for (final cat in mainCategories) {
-      final coordinates = await _geocodeDestination(destination);
-
-      // 2. Rechercher les activités par catégorie ou toutes les catégories
-      List<Activity> allActivities = [];
-
-      if (category != null) {
         final activities = await _searchByCategory(
           coordinates['lat']!,
           coordinates['lng']!,
-          category,
+          cat,
           tripId,
           radius,
         );
         allActivities.addAll(activities);
-      } else {
-        // Rechercher dans toutes les catégories principales
-        final mainCategories = [
-          ActivityCategory.attraction,
-          ActivityCategory.museum,
-          ActivityCategory.restaurant,
-          ActivityCategory.culture,
-          ActivityCategory.nature,
-        ];
-
-        for (final cat in mainCategories) {
-          final activities = await _searchByCategory(
-            coordinates['lat']!,
-            coordinates['lng']!,
-            cat,
-            tripId,
-            radius,
-          );
-          allActivities.addAll(activities);
-        }
       }
+    }
 
-      // 3. Supprimer les doublons et trier par note
+    // 3. Supprimer les doublons et trier par note
-      final uniqueActivities = _removeDuplicates(allActivities);
+    final uniqueActivities = _removeDuplicates(allActivities);
-      uniqueActivities.sort((a, b) => (b.rating ?? 0).compareTo(a.rating ?? 0));
+    uniqueActivities.sort((a, b) => (b.rating ?? 0).compareTo(a.rating ?? 0));
 
-      print(
+    LoggerService.info(
-        'ActivityPlacesService: ${uniqueActivities.length} activités trouvées au total',
+      'ActivityPlacesService: ${uniqueActivities.length} activités trouvées au total',
+    );
+
+    // 4. Appliquer la pagination
+    final startIndex = offset;
+    final endIndex = (startIndex + maxResults).clamp(
+      0,
+      uniqueActivities.length,
+    );
+
+    if (startIndex >= uniqueActivities.length) {
+      LoggerService.info(
+        'ActivityPlacesService: Offset $startIndex dépasse le nombre total (${uniqueActivities.length})',
       );
-
-      // 4. Appliquer la pagination
-      final startIndex = offset;
-      final endIndex = (startIndex + maxResults).clamp(
-        0,
-        uniqueActivities.length,
-      );
-
-      if (startIndex >= uniqueActivities.length) {
-        print(
-          'ActivityPlacesService: Offset $startIndex dépasse le nombre total (${uniqueActivities.length})',
-        );
-        return [];
-      }
-
-      final paginatedResults = uniqueActivities.sublist(startIndex, endIndex);
-      print(
-        'ActivityPlacesService: Retour de ${paginatedResults.length} activités (offset: $offset, max: $maxResults)',
-      );
-
-      return paginatedResults;
-    } catch (e) {
-      print('ActivityPlacesService: Erreur lors de la recherche: $e');
-      _errorService.logError('activity_places_service', e);
       return [];
     }
+
+    final paginatedResults = uniqueActivities.sublist(startIndex, endIndex);
+    LoggerService.info(
+      'ActivityPlacesService: Retour de ${paginatedResults.length} activités (offset: $offset, max: $maxResults)',
+    );
+
+    return paginatedResults;
   }
 
   /// Géocode une destination pour obtenir les coordonnées
@@ -105,24 +111,36 @@ class ActivityPlacesService {
     try {
       // Vérifier que la clé API est configurée
       if (_apiKey.isEmpty) {
-        print('ActivityPlacesService: Clé API Google Maps manquante');
+        LoggerService.error(
-        throw Exception('Clé API Google Maps non configurée');
+          'ActivityPlacesService: Clé API Google Maps manquante',
+        );
+        throw Exception(
+          'Clé API Google Maps non configurée dans DefaultFirebaseOptions. Platform: ${Platform.isAndroid
+              ? 'Android'
+              : Platform.isIOS
+              ? 'iOS'
+              : 'Autre'}',
+        );
       }
 
       final encodedDestination = Uri.encodeComponent(destination);
       final url =
-          'https://maps.googleapis.com/maps/api/geocode/json?address=$encodedDestination&key=$_apiKey';
+          'https://maps.googleapis.com/maps/api/geocode/json?address=$encodedDestination&key=$_apiKey&language=fr';
 
-      print('ActivityPlacesService: Géocodage de "$destination"');
+      LoggerService.info('ActivityPlacesService: Géocodage de "$destination"');
-      print('ActivityPlacesService: URL = $url');
+      LoggerService.info('ActivityPlacesService: URL = $url');
 
       final response = await http.get(Uri.parse(url));
 
-      print('ActivityPlacesService: Status code = ${response.statusCode}');
+      LoggerService.info(
+        'ActivityPlacesService: Status code = ${response.statusCode}',
+      );
 
       if (response.statusCode == 200) {
         final data = json.decode(response.body);
-        print('ActivityPlacesService: Réponse géocodage = ${data['status']}');
+        LoggerService.info(
+          'ActivityPlacesService: Réponse géocodage = ${data['status']}',
+        );
 
         if (data['status'] == 'OK' && data['results'].isNotEmpty) {
           final location = data['results'][0]['geometry']['location'];
@@ -130,10 +148,12 @@ class ActivityPlacesService {
             'lat': location['lat'].toDouble(),
             'lng': location['lng'].toDouble(),
           };
-          print('ActivityPlacesService: Coordonnées trouvées = $coordinates');
+          LoggerService.info(
+            'ActivityPlacesService: Coordonnées trouvées = $coordinates',
+          );
           return coordinates;
         } else {
-          print(
+          LoggerService.error(
             'ActivityPlacesService: Erreur API = ${data['error_message'] ?? data['status']}',
           );
           if (data['status'] == 'REQUEST_DENIED') {
@@ -154,7 +174,7 @@ class ActivityPlacesService {
         throw Exception('Erreur HTTP ${response.statusCode}');
       }
     } catch (e) {
-      print('ActivityPlacesService: Erreur géocodage: $e');
+      LoggerService.error('ActivityPlacesService: Erreur géocodage: $e');
       rethrow; // Rethrow pour permettre la gestion d'erreur en amont
     }
   }
@@ -167,45 +187,52 @@ class ActivityPlacesService {
     String tripId,
     int radius,
   ) async {
-    try {
+    final url =
-      final url =
+        'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
-          'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
+        '?location=$lat,$lng'
-          '?location=$lat,$lng'
+        '&radius=$radius'
-          '&radius=$radius'
+        '&type=${category.googlePlaceType}'
-          '&type=${category.googlePlaceType}'
+        '&key=$_apiKey'
-          '&key=$_apiKey';
+        '&language=fr';
 
-      final response = await http.get(Uri.parse(url));
+    final response = await http.get(Uri.parse(url));
 
-      if (response.statusCode == 200) {
+    if (response.statusCode == 200) {
-        final data = json.decode(response.body);
+      final data = json.decode(response.body);
 
-        if (data['status'] == 'OK') {
+      if (data['status'] == 'OK') {
-          final List<Activity> activities = [];
+        final List<Activity> activities = [];
 
-          for (final place in data['results']) {
+        for (final place in data['results']) {
-            try {
+          try {
-              final activity = await _convertPlaceToActivity(
+            final activity = await _convertPlaceToActivity(
-                place,
+              place,
-                tripId,
+              tripId,
-                category,
+              category,
-              );
+            );
-              if (activity != null) {
+            if (activity != null) {
-                activities.add(activity);
+              activities.add(activity);
-              }
-            } catch (e) {
-              print('ActivityPlacesService: Erreur conversion place: $e');
             }
+          } catch (e) {
+            LoggerService.error(
+              'ActivityPlacesService: Erreur conversion place: $e',
+            );
           }
-
-          return activities;
         }
-      }
 
-      return [];
+        return activities;
-    } catch (e) {
+      } else if (data['status'] == 'ZERO_RESULTS') {
-      print('ActivityPlacesService: Erreur recherche par catégorie: $e');
+        return [];
-      return [];
+      } else {
+        LoggerService.error(
+          'ActivityPlacesService: Erreur API Places: ${data['status']} - ${data['error_message']}',
+        );
+        throw Exception(
+          'API Places Error: ${data['status']} - ${data['error_message']}',
+        );
+      }
+    } else {
+      throw Exception('Erreur HTTP ${response.statusCode}');
     }
   }
 
@@ -260,7 +287,7 @@ class ActivityPlacesService {
         updatedAt: DateTime.now(),
       );
     } catch (e) {
-      print('ActivityPlacesService: Erreur conversion place: $e');
+      LoggerService.error('ActivityPlacesService: Erreur conversion place: $e');
       return null;
     }
   }
@@ -272,7 +299,8 @@ class ActivityPlacesService {
           'https://maps.googleapis.com/maps/api/place/details/json'
           '?place_id=$placeId'
           '&fields=formatted_address,formatted_phone_number,website,opening_hours,editorial_summary'
-          '&key=$_apiKey';
+          '&key=$_apiKey'
+          '&language=fr';
 
       final response = await http.get(Uri.parse(url));
 
@@ -285,7 +313,9 @@ class ActivityPlacesService {
 
       return null;
     } catch (e) {
-      print('ActivityPlacesService: Erreur récupération détails: $e');
+      LoggerService.error(
+        'ActivityPlacesService: Erreur récupération détails: $e',
+      );
       return null;
     }
   }
@@ -325,57 +355,62 @@ class ActivityPlacesService {
     required String tripId,
     int radius = 5000,
   }) async {
-    try {
+    LoggerService.info(
-      print(
+      'ActivityPlacesService: Recherche textuelle: $query à $destination',
-        'ActivityPlacesService: Recherche textuelle: $query à $destination',
+    );
-      );
 
-      // Géocoder la destination
+    // Géocoder la destination
-      final coordinates = await _geocodeDestination(destination);
+    final coordinates = await _geocodeDestination(destination);
 
-      final encodedQuery = Uri.encodeComponent(query);
+    final encodedQuery = Uri.encodeComponent(query);
-      final url =
+    final url =
-          'https://maps.googleapis.com/maps/api/place/textsearch/json'
+        'https://maps.googleapis.com/maps/api/place/textsearch/json'
-          '?query=$encodedQuery in $destination'
+        '?query=$encodedQuery'
-          '&location=${coordinates['lat']},${coordinates['lng']}'
+        '&location=${coordinates['lat']},${coordinates['lng']}'
-          '&radius=$radius'
+        '&radius=$radius'
-          '&key=$_apiKey';
+        '&key=$_apiKey'
+        '&language=fr';
 
-      final response = await http.get(Uri.parse(url));
+    final response = await http.get(Uri.parse(url));
 
-      if (response.statusCode == 200) {
+    if (response.statusCode == 200) {
-        final data = json.decode(response.body);
+      final data = json.decode(response.body);
 
-        if (data['status'] == 'OK') {
+      if (data['status'] == 'OK') {
-          final List<Activity> activities = [];
+        final List<Activity> activities = [];
 
-          for (final place in data['results']) {
+        for (final place in data['results']) {
-            try {
+          try {
-              // Déterminer la catégorie basée sur les types du lieu
+            // Déterminer la catégorie basée sur les types du lieu
-              final types = List<String>.from(place['types'] ?? []);
+            final types = List<String>.from(place['types'] ?? []);
-              final category = _determineCategoryFromTypes(types);
+            final category = _determineCategoryFromTypes(types);
 
-              final activity = await _convertPlaceToActivity(
+            final activity = await _convertPlaceToActivity(
-                place,
+              place,
-                tripId,
+              tripId,
-                category,
+              category,
-              );
+            );
-              if (activity != null) {
+            if (activity != null) {
-                activities.add(activity);
+              activities.add(activity);
-              }
-            } catch (e) {
-              print('ActivityPlacesService: Erreur conversion place: $e');
             }
+          } catch (e) {
+            LoggerService.error(
+              'ActivityPlacesService: Erreur conversion place: $e',
+            );
           }
-
-          return activities;
         }
-      }
 
-      return [];
+        return activities;
-    } catch (e) {
+      } else if (data['status'] == 'ZERO_RESULTS') {
-      print('ActivityPlacesService: Erreur recherche textuelle: $e');
+        return [];
-      return [];
+      } else {
+        LoggerService.error(
+          'ActivityPlacesService: Erreur API Places Text Search: ${data['status']}',
+        );
+        throw Exception('API Error: ${data['status']}');
+      }
+    } else {
+      throw Exception('Erreur HTTP ${response.statusCode}');
     }
   }
 
@@ -423,11 +458,11 @@ class ActivityPlacesService {
       if (latitude != null && longitude != null) {
         lat = latitude;
         lng = longitude;
-        print(
+        LoggerService.info(
           'ActivityPlacesService: Utilisation des coordonnées pré-géolocalisées: $lat, $lng',
         );
       } else if (destination != null) {
-        print(
+        LoggerService.info(
           'ActivityPlacesService: Géolocalisation de la destination: $destination',
         );
         final coordinates = await _geocodeDestination(destination);
@@ -437,7 +472,7 @@ class ActivityPlacesService {
         throw Exception('Destination ou coordonnées requises');
       }
 
-      print(
+      LoggerService.info(
         'ActivityPlacesService: Recherche paginée aux coordonnées: $lat, $lng (page: ${nextPageToken ?? "première"})',
       );
 
@@ -464,7 +499,9 @@ class ActivityPlacesService {
         );
       }
     } catch (e) {
-      print('ActivityPlacesService: Erreur recherche paginée: $e');
+      LoggerService.error(
+        'ActivityPlacesService: Erreur recherche paginée: $e',
+      );
       _errorService.logError('activity_places_service', e);
       return {
         'activities': <Activity>[],
@@ -484,65 +521,63 @@ class ActivityPlacesService {
     int pageSize,
     String? nextPageToken,
   ) async {
-    try {
+    String url =
-      String url =
+        'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
-          'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
+        '?location=$lat,$lng'
-          '?location=$lat,$lng'
+        '&radius=$radius'
-          '&radius=$radius'
+        '&type=${category.googlePlaceType}'
-          '&type=${category.googlePlaceType}'
+        '&key=$_apiKey'
-          '&key=$_apiKey';
+        '&language=fr';
 
-      if (nextPageToken != null) {
+    if (nextPageToken != null) {
-        url += '&pagetoken=$nextPageToken';
+      url += '&pagetoken=$nextPageToken';
-      }
+    }
 
-      final response = await http.get(Uri.parse(url));
+    final response = await http.get(Uri.parse(url));
 
-      if (response.statusCode == 200) {
+    if (response.statusCode == 200) {
-        final data = json.decode(response.body);
+      final data = json.decode(response.body);
 
-        if (data['status'] == 'OK') {
+      if (data['status'] == 'OK') {
-          final List<Activity> activities = [];
+        final List<Activity> activities = [];
-          final results = data['results'] as List? ?? [];
+        final results = data['results'] as List? ?? [];
 
-          // Limiter à pageSize résultats
+        // Limiter à pageSize résultats
-          final limitedResults = results.take(pageSize).toList();
+        final limitedResults = results.take(pageSize).toList();
 
-          for (final place in limitedResults) {
+        for (final place in limitedResults) {
-            try {
+          try {
-              final activity = await _convertPlaceToActivity(
+            final activity = await _convertPlaceToActivity(
-                place,
+              place,
-                tripId,
+              tripId,
-                category,
+              category,
-              );
+            );
-              if (activity != null) {
+            if (activity != null) {
-                activities.add(activity);
+              activities.add(activity);
-              }
-            } catch (e) {
-              print('ActivityPlacesService: Erreur conversion place: $e');
             }
+          } catch (e) {
+            LoggerService.error(
+              'ActivityPlacesService: Erreur conversion place: $e',
+            );
           }
-
-          return {
-            'activities': activities,
-            'nextPageToken': data['next_page_token'],
-            'hasMoreData': data['next_page_token'] != null,
-          };
         }
-      }
 
-      return {
+        return {
-        'activities': <Activity>[],
+          'activities': activities,
-        'nextPageToken': null,
+          'nextPageToken': data['next_page_token'],
-        'hasMoreData': false,
+          'hasMoreData': data['next_page_token'] != null,
-      };
+        };
-    } catch (e) {
+      } else if (data['status'] == 'ZERO_RESULTS') {
-      print('ActivityPlacesService: Erreur recherche catégorie paginée: $e');
+        return {
-      return {
+          'activities': <Activity>[],
-        'activities': <Activity>[],
+          'nextPageToken': null,
-        'nextPageToken': null,
+          'hasMoreData': false,
-        'hasMoreData': false,
+        };
-      };
+      } else {
+        throw Exception('API Error: ${data['status']}');
+      }
+    } else {
+      throw Exception('Erreur HTTP ${response.statusCode}');
     }
   }
 
@@ -555,72 +590,136 @@ class ActivityPlacesService {
     int pageSize,
     String? nextPageToken,
   ) async {
-    try {
+    // Pour toutes les catégories, on utilise une recherche plus générale
-      // Pour toutes les catégories, on utilise une recherche plus générale
+    String url =
-      String url =
+        'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
-          'https://maps.googleapis.com/maps/api/place/nearbysearch/json'
+        '?location=$lat,$lng'
-          '?location=$lat,$lng'
+        '&radius=$radius'
-          '&radius=$radius'
+        '&type=tourist_attraction'
-          '&type=tourist_attraction'
+        '&key=$_apiKey'
-          '&key=$_apiKey';
+        '&language=fr';
 
-      if (nextPageToken != null) {
+    if (nextPageToken != null) {
-        url += '&pagetoken=$nextPageToken';
+      url += '&pagetoken=$nextPageToken';
+    }
+
+    final response = await http.get(Uri.parse(url));
+
+    if (response.statusCode == 200) {
+      final data = json.decode(response.body);
+
+      if (data['status'] == 'OK') {
+        final List<Activity> activities = [];
+        final results = data['results'] as List? ?? [];
+
+        // Limiter à pageSize résultats
+        final limitedResults = results.take(pageSize).toList();
+
+        for (final place in limitedResults) {
+          try {
+            // Déterminer la catégorie basée sur les types du lieu
+            final types = List<String>.from(place['types'] ?? []);
+            final category = _determineCategoryFromTypes(types);
+
+            final activity = await _convertPlaceToActivity(
+              place,
+              tripId,
+              category,
+            );
+            if (activity != null) {
+              activities.add(activity);
+            }
+          } catch (e) {
+            LoggerService.error(
+              'ActivityPlacesService: Erreur conversion place: $e',
+            );
+          }
+        }
+
+        return {
+          'activities': activities,
+          'nextPageToken': data['next_page_token'],
+          'hasMoreData': data['next_page_token'] != null,
+        };
+      } else if (data['status'] == 'ZERO_RESULTS') {
+        return {
+          'activities': <Activity>[],
+          'nextPageToken': null,
+          'hasMoreData': false,
+        };
+      } else {
+        throw Exception('API Error: ${data['status']}');
+      }
+    } else {
+      throw Exception('Erreur HTTP ${response.statusCode}');
+    }
+  }
+
+  /// Récupère des suggestions d'autocomplétion
+  Future<List<Map<String, String>>> fetchSuggestions({
+    required String query,
+    double? lat,
+    double? lng,
+  }) async {
+    if (query.isEmpty) return [];
+
+    try {
+      String url =
+          'https://maps.googleapis.com/maps/api/place/autocomplete/json'
+          '?input=${Uri.encodeComponent(query)}'
+          '&key=$_apiKey'
+          '&language=fr';
+
+      if (lat != null && lng != null) {
+        url += '&location=$lat,$lng&radius=50000'; // 50km bias
       }
 
       final response = await http.get(Uri.parse(url));
 
       if (response.statusCode == 200) {
         final data = json.decode(response.body);
-
         if (data['status'] == 'OK') {
-          final List<Activity> activities = [];
+          return (data['predictions'] as List).map<Map<String, String>>((p) {
-          final results = data['results'] as List? ?? [];
+            return {
-
+              'description': p['description'] as String,
-          // Limiter à pageSize résultats
+              'placeId': p['place_id'] as String,
-          final limitedResults = results.take(pageSize).toList();
+            };
-
+          }).toList();
-          for (final place in limitedResults) {
-            try {
-              // Déterminer la catégorie basée sur les types du lieu
-              final types = List<String>.from(place['types'] ?? []);
-              final category = _determineCategoryFromTypes(types);
-
-              final activity = await _convertPlaceToActivity(
-                place,
-                tripId,
-                category,
-              );
-              if (activity != null) {
-                activities.add(activity);
-              }
-            } catch (e) {
-              print('ActivityPlacesService: Erreur conversion place: $e');
-            }
-          }
-
-          return {
-            'activities': activities,
-            'nextPageToken': data['next_page_token'],
-            'hasMoreData': data['next_page_token'] != null,
-          };
         }
       }
-
+      return [];
-      return {
-        'activities': <Activity>[],
-        'nextPageToken': null,
-        'hasMoreData': false,
-      };
     } catch (e) {
-      print(
+      LoggerService.error('ActivityPlacesService: Erreur autocomplete: $e');
-        'ActivityPlacesService: Erreur recherche toutes catégories paginée: $e',
+      return [];
+    }
+  }
+
+  /// Récupère une activité via son Place ID
+  Future<Activity?> getActivityByPlaceId({
+    required String placeId,
+    required String tripId,
+  }) async {
+    try {
+      final details = await _getPlaceDetails(placeId);
+      if (details == null) return null;
+
+      // Créer une map simulant la structure "place" attendue par _convertPlaceToActivity
+      // Note: _getPlaceDetails retourne "result", qui est déjà ce qu'on veut,
+      // mais _convertPlaceToActivity attend le format "search result" qui a geometry au premier niveau.
+      // Heureusement _getPlaceDetails retourne une structure compatible pour geometry/photos etc.
+
+      // On doit s'assurer d'avoir les types pour déterminer la catégorie
+      final types = List<String>.from(details['types'] ?? []);
+      final category = _determineCategoryFromTypes(types);
+
+      return await _convertPlaceToActivity(
+        details, // details a la structure nécessaire (geometry, name, etc)
+        tripId,
+        category,
       );
-      return {
+    } catch (e) {
-        'activities': <Activity>[],
+      LoggerService.error('ActivityPlacesService: Erreur get details: $e');
-        'nextPageToken': null,
+      return null;
-        'hasMoreData': false,
-      };
     }
   }
 }

lib/services/analytics_service.dart

@@ -0,0 +1,54 @@
+import 'package:firebase_analytics/firebase_analytics.dart';
+import 'package:flutter/foundation.dart';
+
+/// Service wrapper for Google Analytics
+class AnalyticsService {
+  final FirebaseAnalytics _analytics = FirebaseAnalytics.instance;
+
+  FirebaseAnalyticsObserver getAnalyticsObserver() =>
+      FirebaseAnalyticsObserver(analytics: _analytics);
+
+  Future<void> logEvent({
+    required String name,
+    Map<String, Object>? parameters,
+  }) async {
+    try {
+      await _analytics.logEvent(name: name, parameters: parameters);
+    } catch (e) {
+      debugPrint('Error logging analytics event: $e');
+    }
+  }
+
+  Future<void> setUserProperty({
+    required String name,
+    required String? value,
+  }) async {
+    try {
+      await _analytics.setUserProperty(name: name, value: value);
+    } catch (e) {
+      debugPrint('Error setting user property: $e');
+    }
+  }
+
+  Future<void> setUserId(String? id) async {
+    try {
+      await _analytics.setUserId(id: id);
+    } catch (e) {
+      debugPrint('Error setting user ID: $e');
+    }
+  }
+
+  Future<void> logScreenView({
+    required String screenName,
+    String? screenClass,
+  }) async {
+    try {
+      await _analytics.logScreenView(
+        screenName: screenName,
+        screenClass: screenClass,
+      );
+    } catch (e) {
+      debugPrint('Error logging screen view: $e');
+    }
+  }
+}

lib/services/auth_service.dart

@@ -83,20 +83,30 @@ class AuthService {
   ///
   /// [password] - The user's current password for re-authentication
   /// [email] - The user's email address for re-authentication
-  Future<void> deleteAccount({
+  Future<void> deleteAccount() async {
-    required String password,
+    try {
-    required String email,
+      await currentUser!.delete();
-  }) async {
+      await firebaseAuth.signOut();
-    // Re-authenticate the user for security
+    } on FirebaseAuthException catch (e) {
-    AuthCredential credential = EmailAuthProvider.credential(
+      if (e.code == 'requires-recent-login') {
-      email: email,
+        _errorService.logError(
-      password: password,
+          'Delete account requires recent login',
-    );
+          StackTrace.current,
-    await currentUser!.reauthenticateWithCredential(credential);
+        );
-
+        rethrow;
-    // Delete the user account permanently
+      }
-    await currentUser!.delete();
+      _errorService.logError(
-    await firebaseAuth.signOut();
+        'Error deleting account: ${e.code} - ${e.message}',
+        StackTrace.current,
+      );
+      rethrow;
+    } catch (e) {
+      _errorService.logError(
+        'Unknown error deleting account: $e',
+        StackTrace.current,
+      );
+      rethrow;
+    }
   }
 
   /// Resets the user's password after re-authentication.
@@ -161,18 +171,35 @@ class AuthService {
       }
     } on GoogleSignInException catch (e) {
       _errorService.logError('Google Sign-In error: $e', StackTrace.current);
+      _errorService.showError(
+        message: 'La connexion avec Google a échoué. Veuillez réessayer.',
+      );
       rethrow;
     } on FirebaseAuthException catch (e) {
       _errorService.logError(
         'Firebase error during Google Sign-In initialization: $e',
         StackTrace.current,
       );
+      if (e.code == 'account-exists-with-different-credential') {
+        _errorService.showError(
+          message:
+              'Un compte existe déjà avec cette adresse email. Veuillez vous connecter avec la méthode utilisée précédemment.',
+        );
+      } else {
+        _errorService.showError(
+          message:
+              'Une erreur est survenue lors de la connexion avec Google. Veuillez réessayer plus tard.',
+        );
+      }
       rethrow;
     } catch (e) {
       _errorService.logError(
         'Unknown error during Google Sign-In initialization: $e',
         StackTrace.current,
       );
+      _errorService.showError(
+        message: 'Une erreur inattendue est survenue. Veuillez réessayer.',
+      );
       rethrow;
     }
   }
@@ -198,20 +225,20 @@ class AuthService {
       }
 
       // Request Apple ID credential with platform-specific configuration
-      final AuthorizationCredentialAppleID credential =
+      final AuthorizationCredentialAppleID
-          await SignInWithApple.getAppleIDCredential(
+      credential = await SignInWithApple.getAppleIDCredential(
-            scopes: [
+        scopes: [
-              AppleIDAuthorizationScopes.email,
+          AppleIDAuthorizationScopes.email,
-              AppleIDAuthorizationScopes.fullName,
+          AppleIDAuthorizationScopes.fullName,
-            ],
+        ],
-            // Configuration for Android/Web
+        // Configuration for Android/Web
-            webAuthenticationOptions: WebAuthenticationOptions(
+        webAuthenticationOptions: WebAuthenticationOptions(
-              clientId: 'be.devdayronvl.TravelMate',
+          clientId: 'be.devdayronvl.TravelMate.service',
-              redirectUri: Uri.parse(
+          redirectUri: Uri.parse(
-                'https://your-project-id.firebaseapp.com/__/auth/handler',
+            'https://us-central1-travelmate-a47f5.cloudfunctions.net/callbacks_signInWithApple',
-              ),
+          ),
-            ),
+        ),
-          );
+      );
 
       // Create OAuth credential for Firebase
       final OAuthCredential oauthCredential = OAuthProvider("apple.com")
@@ -237,24 +264,49 @@ class AuthService {
       return userCredential;
     } on SignInWithAppleException catch (e) {
       _errorService.logError('Apple Sign-In error: $e', StackTrace.current);
+      _errorService.showError(
+        message: 'La connexion avec Apple a échoué. Veuillez réessayer.',
+      );
       throw FirebaseAuthException(
         code: 'ERROR_APPLE_SIGNIN_FAILED',
-        message: 'Apple Sign-In failed: ${e.toString()}',
+        message: 'Apple Sign-In failed',
       );
     } on FirebaseAuthException catch (e) {
       _errorService.logError(
         'Firebase error during Apple Sign-In: $e',
         StackTrace.current,
       );
+      if (e.code == 'account-exists-with-different-credential') {
+        _errorService.showError(
+          message:
+              'Un compte existe déjà avec cette adresse email. Veuillez vous connecter avec la méthode utilisée précédemment.',
+        );
+      } else if (e.code == 'invalid-credential') {
+        _errorService.showError(
+          message: 'Les informations de connexion sont invalides.',
+        );
+      } else if (e.code == 'user-disabled') {
+        _errorService.showError(
+          message: 'Ce compte utilisateur a été désactivé.',
+        );
+      } else {
+        _errorService.showError(
+          message:
+              'Une erreur est survenue lors de la connexion avec Apple. Veuillez réessayer plus tard.',
+        );
+      }
       rethrow;
     } catch (e) {
       _errorService.logError(
         'Unknown error during Apple Sign-In: $e',
         StackTrace.current,
       );
+      _errorService.showError(
+        message: 'Une erreur inattendue est survenue. Veuillez réessayer.',
+      );
       throw FirebaseAuthException(
         code: 'ERROR_APPLE_SIGNIN_UNKNOWN',
-        message: 'Unknown error during Apple Sign-In: $e',
+        message: 'Unknown error during Apple Sign-In',
       );
     }
   }

lib/services/balance_service.dart

@@ -32,6 +32,7 @@
 /// - [Settlement] for individual payment recommendations
 /// - [UserBalance] for per-user balance information
 library;
+
 import '../models/group_balance.dart';
 import '../models/expense.dart';
 import '../models/group_statistics.dart';
@@ -59,7 +60,10 @@ class BalanceService {
     try {
       return await _balanceRepository.calculateGroupBalance(groupId);
     } catch (e) {
-      _errorService.logError('BalanceService', 'Erreur calcul balance groupe: $e');
+      _errorService.logError(
+        'BalanceService',
+        'Erreur calcul balance groupe: $e',
+      );
       rethrow;
     }
   }
@@ -80,7 +84,9 @@ class BalanceService {
 
   /// Stream de la balance en temps réel
   Stream<GroupBalance> getGroupBalanceStream(String groupId) {
-    return _expenseRepository.getExpensesStream(groupId).asyncMap((expenses) async {
+    return _expenseRepository.getExpensesStream(groupId).asyncMap((
+      expenses,
+    ) async {
       try {
         final userBalances = calculateUserBalances(expenses);
         final settlements = optimizeSettlements(userBalances);
@@ -164,10 +170,10 @@ class BalanceService {
 
     // Utiliser des copies mutables pour les calculs
     final creditorsRemaining = Map<String, double>.fromEntries(
-      creditors.map((c) => MapEntry(c.userId, c.balance))
+      creditors.map((c) => MapEntry(c.userId, c.balance)),
     );
     final debtorsRemaining = Map<String, double>.fromEntries(
-      debtors.map((d) => MapEntry(d.userId, -d.balance))
+      debtors.map((d) => MapEntry(d.userId, -d.balance)),
     );
 
     // Algorithme glouton optimisé
@@ -185,16 +191,19 @@ class BalanceService {
         );
 
         if (settlementAmount > 0.01) {
-          settlements.add(Settlement(
+          settlements.add(
-            fromUserId: debtor.userId,
+            Settlement(
-            fromUserName: debtor.userName,
+              fromUserId: debtor.userId,
-            toUserId: creditor.userId,
+              fromUserName: debtor.userName,
-            toUserName: creditor.userName,
+              toUserId: creditor.userId,
-            amount: settlementAmount,
+              toUserName: creditor.userName,
-          ));
+              amount: settlementAmount,
+            ),
+          );
 
           // Mettre à jour les montants restants
-          creditorsRemaining[creditor.userId] = creditRemaining - settlementAmount;
+          creditorsRemaining[creditor.userId] =
+              creditRemaining - settlementAmount;
           debtorsRemaining[debtor.userId] = debtRemaining - settlementAmount;
         }
       }
@@ -204,7 +213,10 @@ class BalanceService {
   }
 
   /// Calculer le montant optimal pour un règlement
-  double _calculateOptimalSettlementAmount(double creditAmount, double debtAmount) {
+  double _calculateOptimalSettlementAmount(
+    double creditAmount,
+    double debtAmount,
+  ) {
     final amount = [creditAmount, debtAmount].reduce((a, b) => a < b ? a : b);
     // Arrondir à 2 décimales
     return (amount * 100).round() / 100;
@@ -213,23 +225,36 @@ class BalanceService {
   /// Valider les règlements calculés
   List<Settlement> _validateSettlements(List<Settlement> settlements) {
     // Supprimer les règlements trop petits
-    final validSettlements = settlements
+    final validSettlements = settlements.where((s) => s.amount > 0.01).toList();
-        .where((s) => s.amount > 0.01)
-        .toList();
 
     // Log pour debug en cas de problème
-    final totalSettlements = validSettlements.fold(0.0, (sum, s) => sum + s.amount);
+    final totalSettlements = validSettlements.fold(
-    _errorService.logInfo('BalanceService', 
+      0.0,
-        'Règlements calculés: ${validSettlements.length}, Total: ${totalSettlements.toStringAsFixed(2)}€');
+      (sum, s) => sum + s.amount,
+    );
+    _errorService.logInfo(
+      'BalanceService',
+      'Règlements calculés: ${validSettlements.length}, Total: ${totalSettlements.toStringAsFixed(2)}€',
+    );
 
     return validSettlements;
   }
 
   /// Calculer la dette entre deux utilisateurs spécifiques
-  double calculateDebtBetweenUsers(String groupId, String userId1, String userId2) {
+  double calculateDebtBetweenUsers(
+    String groupId,
+    String userId1,
+    String userId2,
+  ) {
     // Cette méthode pourrait être utile pour des fonctionnalités avancées
     // comme "Combien me doit X ?" ou "Combien je dois à Y ?"
-    return 0.0; // TODO: Implémenter si nécessaire
+
+    // On peut utiliser optimizeSettlements pour avoir la réponse précise
+    // Cependant, cela nécessite d'avoir les dépenses.
+    // Comme cette méthode est synchrone et ne prend pas les dépenses en entrée,
+    // elle est difficile à implémenter correctement sans changer sa signature.
+    // Pour l'instant, on retourne 0.0 car elle n'est pas utilisée.
+    return 0.0;
   }
 
   /// Analyser les tendances de dépenses par catégorie
@@ -240,7 +265,8 @@ class BalanceService {
       if (expense.isArchived) continue;
 
       final categoryName = expense.category.displayName;
-      categoryTotals[categoryName] = (categoryTotals[categoryName] ?? 0) + expense.amountInEur;
+      categoryTotals[categoryName] =
+          (categoryTotals[categoryName] ?? 0) + expense.amountInEur;
     }
 
     return categoryTotals;
@@ -253,7 +279,10 @@ class BalanceService {
     }
 
     final nonArchivedExpenses = expenses.where((e) => !e.isArchived).toList();
-    final totalAmount = nonArchivedExpenses.fold(0.0, (sum, e) => sum + e.amountInEur);
+    final totalAmount = nonArchivedExpenses.fold(
+      0.0,
+      (sum, e) => sum + e.amountInEur,
+    );
     final averageAmount = totalAmount / nonArchivedExpenses.length;
 
     final categorySpending = analyzeCategorySpending(nonArchivedExpenses);
@@ -283,7 +312,10 @@ class BalanceService {
       // Pour l'instant, on pourrait juste recalculer
       await Future.delayed(const Duration(milliseconds: 100));
 
-      _errorService.logSuccess('BalanceService', 'Règlement marqué comme effectué');
+      _errorService.logSuccess(
+        'BalanceService',
+        'Règlement marqué comme effectué',
+      );
     } catch (e) {
       _errorService.logError('BalanceService', 'Erreur mark settlement: $e');
       rethrow;

lib/services/error_service.dart

@@ -1,5 +1,6 @@
 import 'package:flutter/material.dart';
 import '../components/error/error_content.dart';
+import 'logger_service.dart';
 
 /// Service for handling application errors and user notifications.
 ///
@@ -97,13 +98,12 @@ class ErrorService {
   /// [error] - The error object or message
   /// [stackTrace] - Optional stack trace for debugging
   void logError(String source, dynamic error, [StackTrace? stackTrace]) {
-    print('═══════════════════════════════════');
+    LoggerService.error(
-    print('❌ ERROR in $source');
+      '❌ ERROR in $source\nMessage: $error',
-    print('Message: $error');
+      name: source,
-    if (stackTrace != null) {
+      error: error,
-      print('StackTrace: $stackTrace');
+      stackTrace: stackTrace,
-    }
+    );
-    print('═══════════════════════════════════');
   }
 
   /// Logs informational messages to the console during development.
@@ -111,7 +111,7 @@ class ErrorService {
   /// [source] - The source or location of the information
   /// [message] - The informational message
   void logInfo(String source, String message) {
-    print('ℹ️ [$source] $message');
+    LoggerService.info('ℹ️ $message', name: source);
   }
 
   /// Logs success messages to the console during development.
@@ -119,6 +119,6 @@ class ErrorService {
   /// [source] - The source or location of the success
   /// [message] - The success message
   void logSuccess(String source, String message) {
-    print('✅ [$source] $message');
+    LoggerService.info('✅ $message', name: source);
   }
 }

lib/services/logger_service.dart

@@ -0,0 +1,30 @@
+import 'dart:developer' as developer;
+
+class LoggerService {
+  static void log(String message, {String name = 'App'}) {
+    developer.log(message, name: name);
+  }
+
+  static void error(
+    String message, {
+    String name = 'App',
+    Object? error,
+    StackTrace? stackTrace,
+  }) {
+    developer.log(
+      message,
+      name: name,
+      error: error,
+      stackTrace: stackTrace,
+      level: 1000,
+    );
+  }
+
+  static void info(String message, {String name = 'App'}) {
+    developer.log(message, name: name, level: 800);
+  }
+
+  static void warning(String message, {String name = 'App'}) {
+    developer.log(message, name: name, level: 900);
+  }
+}

lib/services/map_navigation_service.dart

@@ -0,0 +1,36 @@
+import 'dart:async';
+
+class MapLocationRequest {
+  final double latitude;
+  final double longitude;
+  final String? name;
+  final DateTime timestamp;
+
+  MapLocationRequest({
+    required this.latitude,
+    required this.longitude,
+    this.name,
+  }) : timestamp = DateTime.now();
+}
+
+class MapNavigationService {
+  final _requestController = StreamController<MapLocationRequest>.broadcast();
+  MapLocationRequest? _lastRequest;
+
+  Stream<MapLocationRequest> get requestStream => _requestController.stream;
+  MapLocationRequest? get lastRequest => _lastRequest;
+
+  void navigateToLocation(double lat, double lng, {String? name}) {
+    final request = MapLocationRequest(
+      latitude: lat,
+      longitude: lng,
+      name: name,
+    );
+    _lastRequest = request;
+    _requestController.add(request);
+  }
+
+  void dispose() {
+    _requestController.close();
+  }
+}

lib/services/message_service.dart

@@ -9,8 +9,8 @@ class MessageService {
   MessageService({
     required MessageRepository messageRepository,
     ErrorService? errorService,
-  })  : _messageRepository = messageRepository,
+  }) : _messageRepository = messageRepository,
-        _errorService = errorService ?? ErrorService();
+       _errorService = errorService ?? ErrorService();
 
   // Envoyer un message
   Future<void> sendMessage({
@@ -30,12 +30,13 @@ class MessageService {
         senderId: senderId,
         senderName: senderName,
       );
-    } catch (e) {
+    } catch (e, stackTrace) {
       _errorService.logError(
         'message_service.dart',
         'Erreur lors de l\'envoi du message: $e',
+        stackTrace,
       );
-      rethrow;
+      throw Exception('Impossible d\'envoyer le message');
     }
   }
 
@@ -43,12 +44,13 @@ class MessageService {
   Stream<List<Message>> getMessagesStream(String groupId) {
     try {
       return _messageRepository.getMessagesStream(groupId);
-    } catch (e) {
+    } catch (e, stackTrace) {
       _errorService.logError(
         'message_service.dart',
         'Erreur lors de la récupération des messages: $e',
+        stackTrace,
       );
-      rethrow;
+      throw Exception('Impossible de récupérer les messages');
     }
   }
 
@@ -62,12 +64,13 @@ class MessageService {
         groupId: groupId,
         messageId: messageId,
       );
-    } catch (e) {
+    } catch (e, stackTrace) {
       _errorService.logError(
         'message_service.dart',
         'Erreur lors de la suppression du message: $e',
+        stackTrace,
       );
-      rethrow;
+      throw Exception('Impossible de supprimer le message');
     }
   }
 
@@ -87,12 +90,13 @@ class MessageService {
         messageId: messageId,
         newText: newText.trim(),
       );
-    } catch (e) {
+    } catch (e, stackTrace) {
       _errorService.logError(
         'message_service.dart',
         'Erreur lors de la modification du message: $e',
+        stackTrace,
       );
-      rethrow;
+      throw Exception('Impossible de modifier le message');
     }
   }
 
@@ -110,12 +114,13 @@ class MessageService {
         userId: userId,
         reaction: reaction,
       );
-    } catch (e) {
+    } catch (e, stackTrace) {
       _errorService.logError(
         'message_service.dart',
         'Erreur lors de l\'ajout de la réaction: $e',
+        stackTrace,
       );
-      rethrow;
+      throw Exception('Impossible d\'ajouter la réaction');
     }
   }
 
@@ -131,12 +136,13 @@ class MessageService {
         messageId: messageId,
         userId: userId,
       );
-    } catch (e) {
+    } catch (e, stackTrace) {
       _errorService.logError(
         'message_service.dart',
         'Erreur lors de la suppression de la réaction: $e',
+        stackTrace,
       );
-      rethrow;
+      throw Exception('Impossible de supprimer la réaction');
     }
   }
 }

lib/services/notification_service.dart

@@ -0,0 +1,256 @@
+import 'dart:convert';
+import 'dart:io';
+import 'package:cloud_firestore/cloud_firestore.dart';
+import 'package:firebase_messaging/firebase_messaging.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';
+import 'package:firebase_core/firebase_core.dart';
+import 'package:travel_mate/services/logger_service.dart';
+import 'package:flutter/material.dart';
+import 'package:travel_mate/services/error_service.dart';
+import 'package:travel_mate/repositories/group_repository.dart';
+import 'package:travel_mate/repositories/account_repository.dart';
+import 'package:travel_mate/components/group/chat_group_content.dart';
+import 'package:travel_mate/components/account/group_expenses_page.dart';
+
+@pragma('vm:entry-point')
+Future<void> firebaseMessagingBackgroundHandler(RemoteMessage message) async {
+  await Firebase.initializeApp();
+  LoggerService.info('Handling a background message: ${message.messageId}');
+}
+
+class NotificationService {
+  static final NotificationService _instance = NotificationService._internal();
+  factory NotificationService() => _instance;
+  NotificationService._internal();
+
+  late final FirebaseMessaging _firebaseMessaging = FirebaseMessaging.instance;
+  late final FlutterLocalNotificationsPlugin _localNotifications =
+      FlutterLocalNotificationsPlugin();
+
+  bool _isInitialized = false;
+
+  Future<void> initialize() async {
+    if (_isInitialized) return;
+
+    // Request permissions
+    await _requestPermissions();
+
+    // Initialize local notifications
+    const androidSettings = AndroidInitializationSettings(
+      '@mipmap/ic_launcher',
+    );
+    const iosSettings = DarwinInitializationSettings();
+    const initSettings = InitializationSettings(
+      android: androidSettings,
+      iOS: iosSettings,
+    );
+
+    await _localNotifications.initialize(
+      initSettings,
+      onDidReceiveNotificationResponse: (details) {
+        // Handle notification tap
+        LoggerService.info('Notification tapped: ${details.payload}');
+        if (details.payload != null) {
+          try {
+            final data = json.decode(details.payload!) as Map<String, dynamic>;
+            _handleNotificationTap(data);
+          } catch (e) {
+            LoggerService.error('Error parsing notification payload', error: e);
+          }
+        }
+      },
+    );
+
+    // Handle foreground messages
+    FirebaseMessaging.onMessage.listen(_handleForegroundMessage);
+
+    // Handle token refresh
+    FirebaseMessaging.instance.onTokenRefresh.listen(_onTokenRefresh);
+
+    // Setup interacted message (Deep Linking)
+    // We don't call this here anymore, it will be called from HomePage
+    // await setupInteractedMessage();
+
+    _isInitialized = true;
+    LoggerService.info('NotificationService initialized');
+
+    // Print current token for debugging
+    final token = await getFCMToken();
+    LoggerService.info('Current FCM Token: $token');
+  }
+
+  /// Sets up the background message listener.
+  /// Should be called when the app is ready to handle navigation.
+  void startListening() {
+    // Handle any interaction when the app is in the background via a
+    // Stream listener
+    FirebaseMessaging.onMessageOpenedApp.listen((RemoteMessage message) {
+      _handleNotificationTap(message.data);
+    });
+  }
+
+  /// Checks for an initial message (app opened from terminated state)
+  /// and handles it if present.
+  Future<void> handleInitialMessage() async {
+    // Get any messages which caused the application to open from
+    // a terminated state.
+    RemoteMessage? initialMessage = await _firebaseMessaging
+        .getInitialMessage();
+
+    if (initialMessage != null) {
+      LoggerService.info('Found initial message: ${initialMessage.data}');
+      _handleNotificationTap(initialMessage.data);
+    }
+  }
+
+  Future<void> _handleNotificationTap(Map<String, dynamic> data) async {
+    LoggerService.info('Handling notification tap with data: $data');
+    // DEBUG: Show snackbar to verify payload
+    // ErrorService().showSnackbar(message: 'Debug: Payload $data', isError: false);
+
+    final type = data['type'];
+
+    try {
+      if (type == 'message') {
+        final groupId = data['groupId'];
+        if (groupId != null) {
+          final groupRepository = GroupRepository();
+          final group = await groupRepository.getGroupById(groupId);
+          if (group != null) {
+            ErrorService.navigatorKey.currentState?.push(
+              MaterialPageRoute(
+                builder: (context) => ChatGroupContent(group: group),
+              ),
+            );
+          } else {
+            LoggerService.error('Group not found: $groupId');
+            // ErrorService().showError(message: 'Groupe introuvable: $groupId');
+          }
+        } else {
+          LoggerService.error('Missing groupId in payload');
+          // ErrorService().showError(message: 'Payload invalide: groupId manquant');
+        }
+      } else if (type == 'expense') {
+        final tripId = data['tripId'];
+        if (tripId != null) {
+          final accountRepository = AccountRepository();
+          final groupRepository = GroupRepository();
+
+          final account = await accountRepository.getAccountByTripId(tripId);
+          final group = await groupRepository.getGroupByTripId(tripId);
+
+          if (account != null && group != null) {
+            ErrorService.navigatorKey.currentState?.push(
+              MaterialPageRoute(
+                builder: (context) =>
+                    GroupExpensesPage(account: account, group: group),
+              ),
+            );
+          } else {
+            LoggerService.error('Account or Group not found for trip: $tripId');
+            // ErrorService().showError(message: 'Compte ou Groupe introuvable');
+          }
+        }
+      } else {
+        LoggerService.info('Unknown notification type: $type');
+      }
+    } catch (e) {
+      LoggerService.error('Error handling notification tap: $e');
+      ErrorService().showError(message: 'Erreur navigation: $e');
+    }
+  }
+
+  Future<void> _onTokenRefresh(String newToken) async {
+    LoggerService.info('FCM Token refreshed: $newToken');
+    // We need the user ID to save the token.
+    // Since this service is a singleton, we might not have direct access to the user ID here
+    // without injecting the repository or bloc.
+    // For now, we rely on the AuthBloc to update the token on login/start.
+    // Ideally, we should save it here if we have the user ID.
+  }
+
+  Future<void> _requestPermissions() async {
+    NotificationSettings settings = await _firebaseMessaging.requestPermission(
+      alert: true,
+      badge: true,
+      sound: true,
+    );
+
+    LoggerService.info(
+      'User granted permission: ${settings.authorizationStatus}',
+    );
+  }
+
+  Future<String?> getFCMToken() async {
+    try {
+      if (Platform.isIOS) {
+        String? apnsToken = await _firebaseMessaging.getAPNSToken();
+        int retries = 0;
+        while (apnsToken == null && retries < 10) {
+          LoggerService.info(
+            'Waiting for APNS token... (Attempt ${retries + 1}/10)',
+          );
+          await Future.delayed(const Duration(seconds: 2));
+          apnsToken = await _firebaseMessaging.getAPNSToken();
+          retries++;
+        }
+        if (apnsToken == null) {
+          LoggerService.error('APNS token not available after retries');
+          return null;
+        }
+      }
+
+      final token = await _firebaseMessaging.getToken();
+      LoggerService.info('NotificationService - FCM Token: $token');
+      return token;
+    } catch (e) {
+      LoggerService.error('Error getting FCM token: $e');
+      return null;
+    }
+  }
+
+  Future<void> saveTokenToFirestore(String userId) async {
+    try {
+      final token = await getFCMToken();
+      if (token != null) {
+        await FirebaseFirestore.instance.collection('users').doc(userId).set({
+          'fcmToken': token,
+        }, SetOptions(merge: true));
+        LoggerService.info('FCM Token saved to Firestore for user: $userId');
+      }
+    } catch (e) {
+      LoggerService.error('Error saving FCM token to Firestore: $e');
+    }
+  }
+
+  Future<void> _handleForegroundMessage(RemoteMessage message) async {
+    LoggerService.info('Got a message whilst in the foreground!');
+    LoggerService.info('Message data: ${message.data}');
+
+    if (message.notification != null) {
+      LoggerService.info(
+        'Message also contained a notification: ${message.notification}',
+      );
+
+      // Show local notification
+      const androidDetails = AndroidNotificationDetails(
+        'high_importance_channel',
+        'High Importance Notifications',
+        importance: Importance.max,
+        priority: Priority.high,
+      );
+      const iosDetails = DarwinNotificationDetails();
+      const details = NotificationDetails(
+        android: androidDetails,
+        iOS: iosDetails,
+      );
+
+      await _localNotifications.show(
+        message.hashCode,
+        message.notification?.title,
+        message.notification?.body,
+        details,
+      );
+    }
+  }
+}